DE69728710T2 - Eine pharmazeutische Tablette charakterisiert durch hohen Volumenzuwachs bei Kontakt mit biologischen Flüssigkeiten - Google Patents
Eine pharmazeutische Tablette charakterisiert durch hohen Volumenzuwachs bei Kontakt mit biologischen Flüssigkeiten Download PDFInfo
- Publication number
- DE69728710T2 DE69728710T2 DE69728710T DE69728710T DE69728710T2 DE 69728710 T2 DE69728710 T2 DE 69728710T2 DE 69728710 T DE69728710 T DE 69728710T DE 69728710 T DE69728710 T DE 69728710T DE 69728710 T2 DE69728710 T2 DE 69728710T2
- Authority
- DE
- Germany
- Prior art keywords
- layer
- pharmaceutical tablet
- tablet according
- layers
- sodium
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000013060 biological fluid Substances 0.000 title description 2
- 239000004480 active ingredient Substances 0.000 claims abstract description 40
- 210000002784 stomach Anatomy 0.000 claims abstract description 15
- 230000008961 swelling Effects 0.000 claims abstract description 14
- 230000002496 gastric effect Effects 0.000 claims abstract 2
- 239000003826 tablet Substances 0.000 claims description 60
- 239000000203 mixture Substances 0.000 claims description 24
- 229940079593 drug Drugs 0.000 claims description 21
- 239000003814 drug Substances 0.000 claims description 21
- 239000000126 substance Substances 0.000 claims description 21
- 210000001035 gastrointestinal tract Anatomy 0.000 claims description 19
- -1 carboxymethylstarch Substances 0.000 claims description 17
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 claims description 16
- 230000004888 barrier function Effects 0.000 claims description 16
- 210000004051 gastric juice Anatomy 0.000 claims description 15
- 239000007788 liquid Substances 0.000 claims description 13
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 claims description 12
- 238000010521 absorption reaction Methods 0.000 claims description 10
- 238000009472 formulation Methods 0.000 claims description 10
- 229920000642 polymer Polymers 0.000 claims description 10
- 239000001267 polyvinylpyrrolidone Substances 0.000 claims description 10
- 229920000036 polyvinylpyrrolidone Polymers 0.000 claims description 10
- 235000013855 polyvinylpyrrolidone Nutrition 0.000 claims description 10
- 238000012360 testing method Methods 0.000 claims description 10
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 claims description 9
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 claims description 9
- 239000008119 colloidal silica Substances 0.000 claims description 9
- 229920001477 hydrophilic polymer Polymers 0.000 claims description 9
- 229920001577 copolymer Polymers 0.000 claims description 8
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 claims description 8
- 239000000546 pharmaceutical excipient Substances 0.000 claims description 8
- 229920000856 Amylose Polymers 0.000 claims description 7
- 229920002472 Starch Polymers 0.000 claims description 7
- 239000004359 castor oil Substances 0.000 claims description 7
- 235000019438 castor oil Nutrition 0.000 claims description 7
- 125000005456 glyceride group Chemical group 0.000 claims description 7
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 claims description 7
- 235000010979 hydroxypropyl methyl cellulose Nutrition 0.000 claims description 7
- 229920003088 hydroxypropyl methyl cellulose Polymers 0.000 claims description 7
- 239000001866 hydroxypropyl methyl cellulose Substances 0.000 claims description 7
- UFVKGYZPFZQRLF-UHFFFAOYSA-N hydroxypropyl methyl cellulose Chemical compound OC1C(O)C(OC)OC(CO)C1OC1C(O)C(O)C(OC2C(C(O)C(OC3C(C(O)C(O)C(CO)O3)O)C(CO)O2)O)C(CO)O1 UFVKGYZPFZQRLF-UHFFFAOYSA-N 0.000 claims description 7
- 239000008107 starch Substances 0.000 claims description 7
- 235000019698 starch Nutrition 0.000 claims description 7
- HBOMLICNUCNMMY-XLPZGREQSA-N zidovudine Chemical compound O=C1NC(=O)C(C)=CN1[C@@H]1O[C@H](CO)[C@@H](N=[N+]=[N-])C1 HBOMLICNUCNMMY-XLPZGREQSA-N 0.000 claims description 7
- 229960002555 zidovudine Drugs 0.000 claims description 7
- OKMWKBLSFKFYGZ-UHFFFAOYSA-N 1-behenoylglycerol Chemical compound CCCCCCCCCCCCCCCCCCCCCC(=O)OCC(O)CO OKMWKBLSFKFYGZ-UHFFFAOYSA-N 0.000 claims description 6
- 239000001856 Ethyl cellulose Substances 0.000 claims description 6
- ZZSNKZQZMQGXPY-UHFFFAOYSA-N Ethyl cellulose Chemical compound CCOCC1OC(OC)C(OCC)C(OCC)C1OC1C(O)C(O)C(OC)C(CO)O1 ZZSNKZQZMQGXPY-UHFFFAOYSA-N 0.000 claims description 6
- 239000001768 carboxy methyl cellulose Substances 0.000 claims description 6
- 235000010418 carrageenan Nutrition 0.000 claims description 6
- 229920001525 carrageenan Polymers 0.000 claims description 6
- 239000003085 diluting agent Substances 0.000 claims description 6
- 210000001198 duodenum Anatomy 0.000 claims description 6
- 235000019325 ethyl cellulose Nutrition 0.000 claims description 6
- 229920001249 ethyl cellulose Polymers 0.000 claims description 6
- 238000000338 in vitro Methods 0.000 claims description 6
- 235000019359 magnesium stearate Nutrition 0.000 claims description 6
- 229920000609 methyl cellulose Polymers 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 6
- 229920002153 Hydroxypropyl cellulose Polymers 0.000 claims description 5
- 229920000168 Microcrystalline cellulose Polymers 0.000 claims description 5
- 229920003171 Poly (ethylene oxide) Polymers 0.000 claims description 5
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 claims description 5
- 150000002334 glycols Chemical class 0.000 claims description 5
- 235000010977 hydroxypropyl cellulose Nutrition 0.000 claims description 5
- 239000001863 hydroxypropyl cellulose Substances 0.000 claims description 5
- 235000010981 methylcellulose Nutrition 0.000 claims description 5
- 239000001923 methylcellulose Substances 0.000 claims description 5
- 235000019813 microcrystalline cellulose Nutrition 0.000 claims description 5
- 239000008108 microcrystalline cellulose Substances 0.000 claims description 5
- 229940016286 microcrystalline cellulose Drugs 0.000 claims description 5
- 229920002451 polyvinyl alcohol Polymers 0.000 claims description 5
- 235000019422 polyvinyl alcohol Nutrition 0.000 claims description 5
- 210000000813 small intestine Anatomy 0.000 claims description 5
- GUBGYTABKSRVRQ-XLOQQCSPSA-N Alpha-Lactose Chemical compound O[C@@H]1[C@@H](O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@H](O)[C@H]1O GUBGYTABKSRVRQ-XLOQQCSPSA-N 0.000 claims description 4
- 229920000858 Cyclodextrin Chemical class 0.000 claims description 4
- FBPFZTCFMRRESA-KVTDHHQDSA-N D-Mannitol Chemical compound OC[C@@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-KVTDHHQDSA-N 0.000 claims description 4
- 108010061435 Enalapril Proteins 0.000 claims description 4
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 claims description 4
- 229930195725 Mannitol Natural products 0.000 claims description 4
- RVGRUAULSDPKGF-UHFFFAOYSA-N Poloxamer Chemical compound C1CO1.CC1CO1 RVGRUAULSDPKGF-UHFFFAOYSA-N 0.000 claims description 4
- 229920002305 Schizophyllan Polymers 0.000 claims description 4
- 239000002671 adjuvant Substances 0.000 claims description 4
- 229960000830 captopril Drugs 0.000 claims description 4
- FAKRSMQSSFJEIM-RQJHMYQMSA-N captopril Chemical compound SC[C@@H](C)C(=O)N1CCC[C@H]1C(O)=O FAKRSMQSSFJEIM-RQJHMYQMSA-N 0.000 claims description 4
- 229960000541 cetyl alcohol Drugs 0.000 claims description 4
- 230000000694 effects Effects 0.000 claims description 4
- 229940075507 glyceryl monostearate Drugs 0.000 claims description 4
- 239000008101 lactose Substances 0.000 claims description 4
- 239000000594 mannitol Substances 0.000 claims description 4
- 235000010355 mannitol Nutrition 0.000 claims description 4
- 230000007721 medicinal effect Effects 0.000 claims description 4
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 claims description 4
- 229960000502 poloxamer Drugs 0.000 claims description 4
- 229920001983 poloxamer Polymers 0.000 claims description 4
- 229920000136 polysorbate Polymers 0.000 claims description 4
- 150000003839 salts Chemical class 0.000 claims description 4
- 235000019333 sodium laurylsulphate Nutrition 0.000 claims description 4
- 150000003626 triacylglycerols Chemical class 0.000 claims description 4
- XZIIFPSPUDAGJM-UHFFFAOYSA-N 6-chloro-2-n,2-n-diethylpyrimidine-2,4-diamine Chemical compound CCN(CC)C1=NC(N)=CC(Cl)=N1 XZIIFPSPUDAGJM-UHFFFAOYSA-N 0.000 claims description 3
- 229920002134 Carboxymethyl cellulose Polymers 0.000 claims description 3
- 229920001661 Chitosan Polymers 0.000 claims description 3
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 claims description 3
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 claims description 3
- 229920000926 Galactomannan Polymers 0.000 claims description 3
- 229920001503 Glucan Polymers 0.000 claims description 3
- 229920000663 Hydroxyethyl cellulose Polymers 0.000 claims description 3
- 239000004354 Hydroxyethyl cellulose Substances 0.000 claims description 3
- 229920000057 Mannan Polymers 0.000 claims description 3
- 229920002732 Polyanhydride Polymers 0.000 claims description 3
- 229920002125 Sokalan® Polymers 0.000 claims description 3
- 235000021355 Stearic acid Nutrition 0.000 claims description 3
- TVXBFESIOXBWNM-UHFFFAOYSA-N Xylitol Natural products OCCC(O)C(O)C(O)CCO TVXBFESIOXBWNM-UHFFFAOYSA-N 0.000 claims description 3
- DPXJVFZANSGRMM-UHFFFAOYSA-N acetic acid;2,3,4,5,6-pentahydroxyhexanal;sodium Chemical compound [Na].CC(O)=O.OCC(O)C(O)C(O)C(O)C=O DPXJVFZANSGRMM-UHFFFAOYSA-N 0.000 claims description 3
- 150000001252 acrylic acid derivatives Chemical class 0.000 claims description 3
- NIXOWILDQLNWCW-UHFFFAOYSA-N acrylic acid group Chemical group C(C=C)(=O)O NIXOWILDQLNWCW-UHFFFAOYSA-N 0.000 claims description 3
- 235000010443 alginic acid Nutrition 0.000 claims description 3
- 239000000783 alginic acid Substances 0.000 claims description 3
- 229920000615 alginic acid Polymers 0.000 claims description 3
- 229960001126 alginic acid Drugs 0.000 claims description 3
- 150000004781 alginic acids Chemical class 0.000 claims description 3
- 125000000129 anionic group Chemical group 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 235000010948 carboxy methyl cellulose Nutrition 0.000 claims description 3
- 239000008112 carboxymethyl-cellulose Substances 0.000 claims description 3
- 125000002091 cationic group Chemical group 0.000 claims description 3
- 235000010980 cellulose Nutrition 0.000 claims description 3
- 229920002678 cellulose Polymers 0.000 claims description 3
- 239000001913 cellulose Substances 0.000 claims description 3
- 239000007891 compressed tablet Substances 0.000 claims description 3
- 229960000878 docusate sodium Drugs 0.000 claims description 3
- 235000011187 glycerol Nutrition 0.000 claims description 3
- 229940049654 glyceryl behenate Drugs 0.000 claims description 3
- 235000019447 hydroxyethyl cellulose Nutrition 0.000 claims description 3
- 229920003063 hydroxymethyl cellulose Polymers 0.000 claims description 3
- 229940031574 hydroxymethyl cellulose Drugs 0.000 claims description 3
- 239000000787 lecithin Substances 0.000 claims description 3
- 235000010445 lecithin Nutrition 0.000 claims description 3
- 239000000314 lubricant Substances 0.000 claims description 3
- LUEWUZLMQUOBSB-GFVSVBBRSA-N mannan Chemical class O[C@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@H](O[C@@H](O[C@H]3[C@H](O[C@@H](O)[C@@H](O)[C@H]3O)CO)[C@@H](O)[C@H]2O)CO)[C@H](O)[C@H]1O LUEWUZLMQUOBSB-GFVSVBBRSA-N 0.000 claims description 3
- 239000000463 material Substances 0.000 claims description 3
- HEBKCHPVOIAQTA-UHFFFAOYSA-N meso ribitol Natural products OCC(O)C(O)C(O)CO HEBKCHPVOIAQTA-UHFFFAOYSA-N 0.000 claims description 3
- 150000002734 metacrylic acid derivatives Chemical class 0.000 claims description 3
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 claims description 3
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 claims description 3
- 229920001308 poly(aminoacid) Polymers 0.000 claims description 3
- 229940068965 polysorbates Drugs 0.000 claims description 3
- 239000011734 sodium Substances 0.000 claims description 3
- 229910052708 sodium Inorganic materials 0.000 claims description 3
- 235000019812 sodium carboxymethyl cellulose Nutrition 0.000 claims description 3
- 229920001027 sodium carboxymethylcellulose Polymers 0.000 claims description 3
- APSBXTVYXVQYAB-UHFFFAOYSA-M sodium docusate Chemical compound [Na+].CCCCC(CC)COC(=O)CC(S([O-])(=O)=O)C(=O)OCC(CC)CCCC APSBXTVYXVQYAB-UHFFFAOYSA-M 0.000 claims description 3
- IJRHDFLHUATAOS-DPMBMXLASA-M sodium ricinoleate Chemical compound [Na+].CCCCCC[C@@H](O)C\C=C/CCCCCCCC([O-])=O IJRHDFLHUATAOS-DPMBMXLASA-M 0.000 claims description 3
- 229960000776 sodium tetradecyl sulfate Drugs 0.000 claims description 3
- UPUIQOIQVMNQAP-UHFFFAOYSA-M sodium;tetradecyl sulfate Chemical compound [Na+].CCCCCCCCCCCCCCOS([O-])(=O)=O UPUIQOIQVMNQAP-UHFFFAOYSA-M 0.000 claims description 3
- 229940035044 sorbitan monolaurate Drugs 0.000 claims description 3
- 239000000600 sorbitol Substances 0.000 claims description 3
- 235000010356 sorbitol Nutrition 0.000 claims description 3
- 239000008117 stearic acid Substances 0.000 claims description 3
- 239000000454 talc Substances 0.000 claims description 3
- 229910052623 talc Inorganic materials 0.000 claims description 3
- 235000012222 talc Nutrition 0.000 claims description 3
- 239000001993 wax Substances 0.000 claims description 3
- 239000000811 xylitol Substances 0.000 claims description 3
- 229960002675 xylitol Drugs 0.000 claims description 3
- HEBKCHPVOIAQTA-SCDXWVJYSA-N xylitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)CO HEBKCHPVOIAQTA-SCDXWVJYSA-N 0.000 claims description 3
- 235000010447 xylitol Nutrition 0.000 claims description 3
- LNAZSHAWQACDHT-XIYTZBAFSA-N (2r,3r,4s,5r,6s)-4,5-dimethoxy-2-(methoxymethyl)-3-[(2s,3r,4s,5r,6r)-3,4,5-trimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-6-[(2r,3r,4s,5r,6r)-4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxyoxane Chemical compound CO[C@@H]1[C@@H](OC)[C@H](OC)[C@@H](COC)O[C@H]1O[C@H]1[C@H](OC)[C@@H](OC)[C@H](O[C@H]2[C@@H]([C@@H](OC)[C@H](OC)O[C@@H]2COC)OC)O[C@@H]1COC LNAZSHAWQACDHT-XIYTZBAFSA-N 0.000 claims description 2
- NLRUDGHSXOEXCE-PPHPATTJSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;hydrochloride Chemical compound Cl.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 NLRUDGHSXOEXCE-PPHPATTJSA-N 0.000 claims description 2
- YKFCISHFRZHKHY-NGQGLHOPSA-N (2s)-2-amino-3-(3,4-dihydroxyphenyl)-2-methylpropanoic acid;trihydrate Chemical compound O.O.O.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1.OC(=O)[C@](N)(C)CC1=CC=C(O)C(O)=C1 YKFCISHFRZHKHY-NGQGLHOPSA-N 0.000 claims description 2
- PVHUJELLJLJGLN-INIZCTEOSA-N (S)-nitrendipine Chemical compound CCOC(=O)C1=C(C)NC(C)=C(C(=O)OC)[C@@H]1C1=CC=CC([N+]([O-])=O)=C1 PVHUJELLJLJGLN-INIZCTEOSA-N 0.000 claims description 2
- SGTNSNPWRIOYBX-UHFFFAOYSA-N 2-(3,4-dimethoxyphenyl)-5-{[2-(3,4-dimethoxyphenyl)ethyl](methyl)amino}-2-(propan-2-yl)pentanenitrile Chemical compound C1=C(OC)C(OC)=CC=C1CCN(C)CCCC(C#N)(C(C)C)C1=CC=C(OC)C(OC)=C1 SGTNSNPWRIOYBX-UHFFFAOYSA-N 0.000 claims description 2
- SUBDBMMJDZJVOS-UHFFFAOYSA-N 5-methoxy-2-{[(4-methoxy-3,5-dimethylpyridin-2-yl)methyl]sulfinyl}-1H-benzimidazole Chemical compound N=1C2=CC(OC)=CC=C2NC=1S(=O)CC1=NC=C(C)C(OC)=C1C SUBDBMMJDZJVOS-UHFFFAOYSA-N 0.000 claims description 2
- 229920001450 Alpha-Cyclodextrin Polymers 0.000 claims description 2
- BQENDLAVTKRQMS-SBBGFIFASA-L Carbenoxolone sodium Chemical compound [Na+].[Na+].C([C@H]1C2=CC(=O)[C@H]34)[C@@](C)(C([O-])=O)CC[C@]1(C)CC[C@@]2(C)[C@]4(C)CC[C@@H]1[C@]3(C)CC[C@H](OC(=O)CCC([O-])=O)C1(C)C BQENDLAVTKRQMS-SBBGFIFASA-L 0.000 claims description 2
- 229920002785 Croscarmellose sodium Polymers 0.000 claims description 2
- 229920001353 Dextrin Chemical class 0.000 claims description 2
- 239000004375 Dextrin Chemical class 0.000 claims description 2
- WDZVGELJXXEGPV-YIXHJXPBSA-N Guanabenz Chemical compound NC(N)=N\N=C\C1=C(Cl)C=CC=C1Cl WDZVGELJXXEGPV-YIXHJXPBSA-N 0.000 claims description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 claims description 2
- 229930010555 Inosine Natural products 0.000 claims description 2
- UGQMRVRMYYASKQ-KQYNXXCUSA-N Inosine Chemical compound O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1C2=NC=NC(O)=C2N=C1 UGQMRVRMYYASKQ-KQYNXXCUSA-N 0.000 claims description 2
- WTDRDQBEARUVNC-LURJTMIESA-N L-DOPA Chemical compound OC(=O)[C@@H](N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-LURJTMIESA-N 0.000 claims description 2
- WTDRDQBEARUVNC-UHFFFAOYSA-N L-Dopa Natural products OC(=O)C(N)CC1=CC=C(O)C(O)=C1 WTDRDQBEARUVNC-UHFFFAOYSA-N 0.000 claims description 2
- 108010007859 Lisinopril Proteins 0.000 claims description 2
- 229920000881 Modified starch Polymers 0.000 claims description 2
- ZBBHBTPTTSWHBA-UHFFFAOYSA-N Nicardipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OCCN(C)CC=2C=CC=CC=2)C1C1=CC=CC([N+]([O-])=O)=C1 ZBBHBTPTTSWHBA-UHFFFAOYSA-N 0.000 claims description 2
- IWUCXVSUMQZMFG-AFCXAGJDSA-N Ribavirin Chemical compound N1=C(C(=O)N)N=CN1[C@H]1[C@H](O)[C@H](O)[C@@H](CO)O1 IWUCXVSUMQZMFG-AFCXAGJDSA-N 0.000 claims description 2
- OIRDTQYFTABQOQ-UHTZMRCNSA-N Vidarabine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O OIRDTQYFTABQOQ-UHTZMRCNSA-N 0.000 claims description 2
- 229960004150 aciclovir Drugs 0.000 claims description 2
- MKUXAQIIEYXACX-UHFFFAOYSA-N aciclovir Chemical compound N1C(N)=NC(=O)C2=C1N(COCCO)C=N2 MKUXAQIIEYXACX-UHFFFAOYSA-N 0.000 claims description 2
- HFHDHCJBZVLPGP-RWMJIURBSA-N alpha-cyclodextrin Chemical class OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO HFHDHCJBZVLPGP-RWMJIURBSA-N 0.000 claims description 2
- 229940043377 alpha-cyclodextrin Drugs 0.000 claims description 2
- WNROFYMDJYEPJX-UHFFFAOYSA-K aluminium hydroxide Chemical compound [OH-].[OH-].[OH-].[Al+3] WNROFYMDJYEPJX-UHFFFAOYSA-K 0.000 claims description 2
- 229960000528 amlodipine Drugs 0.000 claims description 2
- HTIQEAQVCYTUBX-UHFFFAOYSA-N amlodipine Chemical compound CCOC(=O)C1=C(COCCN)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1Cl HTIQEAQVCYTUBX-UHFFFAOYSA-N 0.000 claims description 2
- 239000003945 anionic surfactant Substances 0.000 claims description 2
- BNQDCRGUHNALGH-UHFFFAOYSA-N benserazide Chemical compound OCC(N)C(=O)NNCC1=CC=C(O)C(O)=C1O BNQDCRGUHNALGH-UHFFFAOYSA-N 0.000 claims description 2
- 229960000911 benserazide Drugs 0.000 claims description 2
- WHGYBXFWUBPSRW-FOUAGVGXSA-N beta-cyclodextrin Chemical class OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO WHGYBXFWUBPSRW-FOUAGVGXSA-N 0.000 claims description 2
- 229960004853 betadex Drugs 0.000 claims description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000004327 boric acid Substances 0.000 claims description 2
- 235000010338 boric acid Nutrition 0.000 claims description 2
- 229960004205 carbidopa Drugs 0.000 claims description 2
- TZFNLOMSOLWIDK-JTQLQIEISA-N carbidopa (anhydrous) Chemical compound NN[C@@](C(O)=O)(C)CC1=CC=C(O)C(O)=C1 TZFNLOMSOLWIDK-JTQLQIEISA-N 0.000 claims description 2
- 239000003093 cationic surfactant Substances 0.000 claims description 2
- 229940083181 centrally acting adntiadrenergic agent methyldopa Drugs 0.000 claims description 2
- 229960001380 cimetidine Drugs 0.000 claims description 2
- CCGSUNCLSOWKJO-UHFFFAOYSA-N cimetidine Chemical compound N#CNC(=N/C)\NCCSCC1=NC=N[C]1C CCGSUNCLSOWKJO-UHFFFAOYSA-N 0.000 claims description 2
- 235000010947 crosslinked sodium carboxy methyl cellulose Nutrition 0.000 claims description 2
- 239000001767 crosslinked sodium carboxy methyl cellulose Substances 0.000 claims description 2
- 235000019425 dextrin Nutrition 0.000 claims description 2
- 235000014113 dietary fatty acids Nutrition 0.000 claims description 2
- GBXSMTUPTTWBMN-XIRDDKMYSA-N enalapril Chemical compound C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 GBXSMTUPTTWBMN-XIRDDKMYSA-N 0.000 claims description 2
- 229960000873 enalapril Drugs 0.000 claims description 2
- OYFJQPXVCSSHAI-QFPUQLAESA-N enalapril maleate Chemical compound OC(=O)\C=C/C(O)=O.C([C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@@H](CCC1)C(O)=O)CC1=CC=CC=C1 OYFJQPXVCSSHAI-QFPUQLAESA-N 0.000 claims description 2
- 229960000309 enalapril maleate Drugs 0.000 claims description 2
- XUFQPHANEAPEMJ-UHFFFAOYSA-N famotidine Chemical compound NC(N)=NC1=NC(CSCCC(N)=NS(N)(=O)=O)=CS1 XUFQPHANEAPEMJ-UHFFFAOYSA-N 0.000 claims description 2
- 229960001596 famotidine Drugs 0.000 claims description 2
- 239000000194 fatty acid Substances 0.000 claims description 2
- 229930195729 fatty acid Natural products 0.000 claims description 2
- 150000004665 fatty acids Chemical class 0.000 claims description 2
- GDSRMADSINPKSL-HSEONFRVSA-N gamma-cyclodextrin Chemical class OC[C@H]([C@H]([C@@H]([C@H]1O)O)O[C@H]2O[C@@H]([C@@H](O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O[C@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O3)[C@H](O)[C@H]2O)CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O)[C@@H]3O[C@@H]1CO GDSRMADSINPKSL-HSEONFRVSA-N 0.000 claims description 2
- 229940080345 gamma-cyclodextrin Drugs 0.000 claims description 2
- 229960003050 guanabenz acetate Drugs 0.000 claims description 2
- 230000002209 hydrophobic effect Effects 0.000 claims description 2
- 229960003786 inosine Drugs 0.000 claims description 2
- FPCCSQOGAWCVBH-UHFFFAOYSA-N ketanserin Chemical compound C1=CC(F)=CC=C1C(=O)C1CCN(CCN2C(C3=CC=CC=C3NC2=O)=O)CC1 FPCCSQOGAWCVBH-UHFFFAOYSA-N 0.000 claims description 2
- 229960005417 ketanserin Drugs 0.000 claims description 2
- 229960004502 levodopa Drugs 0.000 claims description 2
- RLAWWYSOJDYHDC-BZSNNMDCSA-N lisinopril Chemical compound C([C@H](N[C@@H](CCCCN)C(=O)N1[C@@H](CCC1)C(O)=O)C(O)=O)CC1=CC=CC=C1 RLAWWYSOJDYHDC-BZSNNMDCSA-N 0.000 claims description 2
- RDOIQAHITMMDAJ-UHFFFAOYSA-N loperamide Chemical compound C=1C=CC=CC=1C(C=1C=CC=CC=1)(C(=O)N(C)C)CCN(CC1)CCC1(O)C1=CC=C(Cl)C=C1 RDOIQAHITMMDAJ-UHFFFAOYSA-N 0.000 claims description 2
- 229960001571 loperamide Drugs 0.000 claims description 2
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 claims description 2
- 239000001095 magnesium carbonate Substances 0.000 claims description 2
- 229910000021 magnesium carbonate Inorganic materials 0.000 claims description 2
- 239000000395 magnesium oxide Substances 0.000 claims description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N magnesium oxide Inorganic materials [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 claims description 2
- AXZKOIWUVFPNLO-UHFFFAOYSA-N magnesium;oxygen(2-) Chemical compound [O-2].[Mg+2] AXZKOIWUVFPNLO-UHFFFAOYSA-N 0.000 claims description 2
- OJLOPKGSLYJEMD-URPKTTJQSA-N methyl 7-[(1r,2r,3r)-3-hydroxy-2-[(1e)-4-hydroxy-4-methyloct-1-en-1-yl]-5-oxocyclopentyl]heptanoate Chemical compound CCCCC(C)(O)C\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1CCCCCCC(=O)OC OJLOPKGSLYJEMD-URPKTTJQSA-N 0.000 claims description 2
- 229960005249 misoprostol Drugs 0.000 claims description 2
- 235000019426 modified starch Nutrition 0.000 claims description 2
- 229960001783 nicardipine Drugs 0.000 claims description 2
- 229960005425 nitrendipine Drugs 0.000 claims description 2
- 239000002736 nonionic surfactant Substances 0.000 claims description 2
- 229960000381 omeprazole Drugs 0.000 claims description 2
- 239000001814 pectin Substances 0.000 claims description 2
- 229920001277 pectin Polymers 0.000 claims description 2
- 235000010987 pectin Nutrition 0.000 claims description 2
- 230000035515 penetration Effects 0.000 claims description 2
- RMHMFHUVIITRHF-UHFFFAOYSA-N pirenzepine Chemical compound C1CN(C)CCN1CC(=O)N1C2=NC=CC=C2NC(=O)C2=CC=CC=C21 RMHMFHUVIITRHF-UHFFFAOYSA-N 0.000 claims description 2
- 229960004633 pirenzepine Drugs 0.000 claims description 2
- 239000004014 plasticizer Substances 0.000 claims description 2
- IENZQIKPVFGBNW-UHFFFAOYSA-N prazosin Chemical compound N=1C(N)=C2C=C(OC)C(OC)=CC2=NC=1N(CC1)CCN1C(=O)C1=CC=CO1 IENZQIKPVFGBNW-UHFFFAOYSA-N 0.000 claims description 2
- 229960001289 prazosin Drugs 0.000 claims description 2
- 229960000329 ribavirin Drugs 0.000 claims description 2
- WXMKPNITSTVMEF-UHFFFAOYSA-M sodium benzoate Chemical compound [Na+].[O-]C(=O)C1=CC=CC=C1 WXMKPNITSTVMEF-UHFFFAOYSA-M 0.000 claims description 2
- 239000004299 sodium benzoate Substances 0.000 claims description 2
- 235000010234 sodium benzoate Nutrition 0.000 claims description 2
- 229960002920 sorbitol Drugs 0.000 claims description 2
- 229960004291 sucralfate Drugs 0.000 claims description 2
- MNQYNQBOVCBZIQ-JQOFMKNESA-A sucralfate Chemical compound O[Al](O)OS(=O)(=O)O[C@@H]1[C@@H](OS(=O)(=O)O[Al](O)O)[C@H](OS(=O)(=O)O[Al](O)O)[C@@H](COS(=O)(=O)O[Al](O)O)O[C@H]1O[C@@]1(COS(=O)(=O)O[Al](O)O)[C@@H](OS(=O)(=O)O[Al](O)O)[C@H](OS(=O)(=O)O[Al](O)O)[C@@H](OS(=O)(=O)O[Al](O)O)O1 MNQYNQBOVCBZIQ-JQOFMKNESA-A 0.000 claims description 2
- OULAJFUGPPVRBK-UHFFFAOYSA-N tetratriacontan-1-ol Chemical compound CCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCCO OULAJFUGPPVRBK-UHFFFAOYSA-N 0.000 claims description 2
- 229960001722 verapamil Drugs 0.000 claims description 2
- 229960003636 vidarabine Drugs 0.000 claims description 2
- 238000007906 compression Methods 0.000 claims 2
- 230000006835 compression Effects 0.000 claims 2
- UHOVQNZJYSORNB-UHFFFAOYSA-N monobenzene Natural products C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 claims 2
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 claims 1
- 230000035587 bioadhesion Effects 0.000 claims 1
- 229960001777 castor oil Drugs 0.000 claims 1
- 239000003086 colorant Substances 0.000 claims 1
- 238000010276 construction Methods 0.000 claims 1
- 210000000981 epithelium Anatomy 0.000 claims 1
- FETSQPAGYOVAQU-UHFFFAOYSA-N glyceryl palmitostearate Chemical compound OCC(O)CO.CCCCCCCCCCCCCCCC(O)=O.CCCCCCCCCCCCCCCCCC(O)=O FETSQPAGYOVAQU-UHFFFAOYSA-N 0.000 claims 1
- 229940046813 glyceryl palmitostearate Drugs 0.000 claims 1
- 229920000591 gum Polymers 0.000 claims 1
- 239000004615 ingredient Substances 0.000 claims 1
- XJRBAMWJDBPFIM-UHFFFAOYSA-N methyl vinyl ether Chemical class COC=C XJRBAMWJDBPFIM-UHFFFAOYSA-N 0.000 claims 1
- 239000011591 potassium Substances 0.000 claims 1
- 229910052700 potassium Inorganic materials 0.000 claims 1
- 230000002035 prolonged effect Effects 0.000 abstract description 4
- 239000012530 fluid Substances 0.000 abstract description 2
- 210000000936 intestine Anatomy 0.000 abstract 1
- 239000013543 active substance Substances 0.000 description 15
- 238000005056 compaction Methods 0.000 description 7
- 238000013270 controlled release Methods 0.000 description 7
- 239000007942 layered tablet Substances 0.000 description 7
- 238000004519 manufacturing process Methods 0.000 description 7
- 238000000034 method Methods 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- 239000008187 granular material Substances 0.000 description 6
- 239000000227 bioadhesive Substances 0.000 description 4
- YQEMORVAKMFKLG-UHFFFAOYSA-N glycerine monostearate Natural products CCCCCCCCCCCCCCCCCC(=O)OC(CO)CO YQEMORVAKMFKLG-UHFFFAOYSA-N 0.000 description 4
- SVUQHVRAGMNPLW-UHFFFAOYSA-N glycerol monostearate Natural products CCCCCCCCCCCCCCCCC(=O)OCC(O)CO SVUQHVRAGMNPLW-UHFFFAOYSA-N 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- 238000007605 air drying Methods 0.000 description 3
- 230000001476 alcoholic effect Effects 0.000 description 3
- TZCXTZWJZNENPQ-UHFFFAOYSA-L barium sulfate Chemical compound [Ba+2].[O-]S([O-])(=O)=O TZCXTZWJZNENPQ-UHFFFAOYSA-L 0.000 description 3
- 239000003795 chemical substances by application Substances 0.000 description 3
- 238000007667 floating Methods 0.000 description 3
- 238000001727 in vivo Methods 0.000 description 3
- 230000003993 interaction Effects 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 230000000877 morphologic effect Effects 0.000 description 3
- 210000004877 mucosa Anatomy 0.000 description 3
- CIWBSHSKHKDKBQ-JLAZNSOCSA-N Ascorbic acid Chemical compound OC[C@H](O)[C@H]1OC(=O)C(O)=C1O CIWBSHSKHKDKBQ-JLAZNSOCSA-N 0.000 description 2
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 229910052784 alkaline earth metal Inorganic materials 0.000 description 2
- 150000001342 alkaline earth metals Chemical class 0.000 description 2
- 239000000679 carrageenan Substances 0.000 description 2
- 229940113118 carrageenan Drugs 0.000 description 2
- 230000003111 delayed effect Effects 0.000 description 2
- 238000000280 densification Methods 0.000 description 2
- 230000000994 depressogenic effect Effects 0.000 description 2
- 238000004090 dissolution Methods 0.000 description 2
- 239000012738 dissolution medium Substances 0.000 description 2
- 238000007922 dissolution test Methods 0.000 description 2
- 238000012377 drug delivery Methods 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 230000003628 erosive effect Effects 0.000 description 2
- 239000012729 immediate-release (IR) formulation Substances 0.000 description 2
- 239000002609 medium Substances 0.000 description 2
- 210000001187 pylorus Anatomy 0.000 description 2
- 230000001225 therapeutic effect Effects 0.000 description 2
- 229920001285 xanthan gum Polymers 0.000 description 2
- 235000010493 xanthan gum Nutrition 0.000 description 2
- 239000000230 xanthan gum Substances 0.000 description 2
- 229940082509 xanthan gum Drugs 0.000 description 2
- UHVMMEOXYDMDKI-JKYCWFKZSA-L zinc;1-(5-cyanopyridin-2-yl)-3-[(1s,2s)-2-(6-fluoro-2-hydroxy-3-propanoylphenyl)cyclopropyl]urea;diacetate Chemical compound [Zn+2].CC([O-])=O.CC([O-])=O.CCC(=O)C1=CC=C(F)C([C@H]2[C@H](C2)NC(=O)NC=2N=CC(=CC=2)C#N)=C1O UHVMMEOXYDMDKI-JKYCWFKZSA-L 0.000 description 2
- CTTJWXVQRJUJQW-UHFFFAOYSA-N 2,2-dioctyl-3-sulfobutanedioic acid Chemical compound CCCCCCCCC(C(O)=O)(C(C(O)=O)S(O)(=O)=O)CCCCCCCC CTTJWXVQRJUJQW-UHFFFAOYSA-N 0.000 description 1
- FEBUJFMRSBAMES-UHFFFAOYSA-N 2-[(2-{[3,5-dihydroxy-2-(hydroxymethyl)-6-phosphanyloxan-4-yl]oxy}-3,5-dihydroxy-6-({[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxan-4-yl)oxy]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl phosphinite Chemical compound OC1C(O)C(O)C(CO)OC1OCC1C(O)C(OC2C(C(OP)C(O)C(CO)O2)O)C(O)C(OC2C(C(CO)OC(P)C2O)O)O1 FEBUJFMRSBAMES-UHFFFAOYSA-N 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-M Bicarbonate Chemical class OC([O-])=O BVKZGUZCCUSVTD-UHFFFAOYSA-M 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 108010010803 Gelatin Proteins 0.000 description 1
- WQZGKKKJIJFFOK-GASJEMHNSA-N Glucose Natural products OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-GASJEMHNSA-N 0.000 description 1
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 229920003091 Methocel™ Polymers 0.000 description 1
- 241000978776 Senegalia senegal Species 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 239000002250 absorbent Substances 0.000 description 1
- 230000002745 absorbent Effects 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 230000009471 action Effects 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 239000003463 adsorbent Substances 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 229940069428 antacid Drugs 0.000 description 1
- 239000003159 antacid agent Substances 0.000 description 1
- 230000000840 anti-viral effect Effects 0.000 description 1
- 229960005070 ascorbic acid Drugs 0.000 description 1
- 235000010323 ascorbic acid Nutrition 0.000 description 1
- 239000011668 ascorbic acid Substances 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- WQZGKKKJIJFFOK-VFUOTHLCSA-N beta-D-glucose Chemical compound OC[C@H]1O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]1O WQZGKKKJIJFFOK-VFUOTHLCSA-N 0.000 description 1
- 230000007227 biological adhesion Effects 0.000 description 1
- 229960000074 biopharmaceutical Drugs 0.000 description 1
- 239000000872 buffer Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- 229910000389 calcium phosphate Inorganic materials 0.000 description 1
- 235000011010 calcium phosphates Nutrition 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 125000002057 carboxymethyl group Chemical group [H]OC(=O)C([H])([H])[*] 0.000 description 1
- 229920003086 cellulose ether Polymers 0.000 description 1
- 239000011248 coating agent Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 230000000295 complement effect Effects 0.000 description 1
- 150000001875 compounds Chemical class 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000011161 development Methods 0.000 description 1
- 239000002662 enteric coated tablet Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 239000001761 ethyl methyl cellulose Chemical class 0.000 description 1
- 235000010944 ethyl methyl cellulose Nutrition 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 239000008273 gelatin Substances 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 235000011852 gelatine desserts Nutrition 0.000 description 1
- 239000008103 glucose Substances 0.000 description 1
- 235000013905 glycine and its sodium salt Nutrition 0.000 description 1
- 239000008202 granule composition Substances 0.000 description 1
- 239000012052 hydrophilic carrier Substances 0.000 description 1
- 238000010191 image analysis Methods 0.000 description 1
- 238000000099 in vitro assay Methods 0.000 description 1
- 210000002429 large intestine Anatomy 0.000 description 1
- 229960002394 lisinopril Drugs 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000002483 medication Methods 0.000 description 1
- 239000003094 microcapsule Substances 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 210000004400 mucous membrane Anatomy 0.000 description 1
- HYIMSNHJOBLJNT-UHFFFAOYSA-N nifedipine Chemical compound COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1C1=CC=CC=C1[N+]([O-])=O HYIMSNHJOBLJNT-UHFFFAOYSA-N 0.000 description 1
- 229960001597 nifedipine Drugs 0.000 description 1
- 230000003204 osmotic effect Effects 0.000 description 1
- 239000003973 paint Substances 0.000 description 1
- 229920006254 polymer film Polymers 0.000 description 1
- 229950008882 polysorbate Drugs 0.000 description 1
- 230000008569 process Effects 0.000 description 1
- VMXUWOKSQNHOCA-LCYFTJDESA-N ranitidine Chemical compound [O-][N+](=O)/C=C(/NC)NCCSCC1=CC=C(CN(C)C)O1 VMXUWOKSQNHOCA-LCYFTJDESA-N 0.000 description 1
- 229960000620 ranitidine Drugs 0.000 description 1
- HZCAHMRRMINHDJ-DBRKOABJSA-N ribavirin Natural products O[C@@H]1[C@H](O)[C@@H](CO)O[C@H]1N1N=CN=C1 HZCAHMRRMINHDJ-DBRKOABJSA-N 0.000 description 1
- 238000005070 sampling Methods 0.000 description 1
- 229910000029 sodium carbonate Inorganic materials 0.000 description 1
- IJRHDFLHUATAOS-MWMYENNMSA-M sodium;(z)-12-hydroxyoctadec-9-enoate Chemical compound [Na+].CCCCCCC(O)C\C=C/CCCCCCCC([O-])=O IJRHDFLHUATAOS-MWMYENNMSA-M 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 239000000758 substrate Substances 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- 230000009747 swallowing Effects 0.000 description 1
- 230000002522 swelling effect Effects 0.000 description 1
- 230000009182 swimming Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- QORWJWZARLRLPR-UHFFFAOYSA-H tricalcium bis(phosphate) Chemical compound [Ca+2].[Ca+2].[Ca+2].[O-]P([O-])([O-])=O.[O-]P([O-])([O-])=O QORWJWZARLRLPR-UHFFFAOYSA-H 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A61—MEDICAL OR VETERINARY SCIENCE; HYGIENE
- A61K—PREPARATIONS FOR MEDICAL, DENTAL OR TOILETRY PURPOSES
- A61K9/00—Medicinal preparations characterised by special physical form
- A61K9/20—Pills, tablets, discs, rods
- A61K9/2072—Pills, tablets, discs, rods characterised by shape, structure or size; Tablets with holes, special break lines or identification marks; Partially coated tablets; Disintegrating flat shaped forms
- A61K9/2086—Layered tablets, e.g. bilayer tablets; Tablets of the type inert core-active coat
Landscapes
- Health & Medical Sciences (AREA)
- Epidemiology (AREA)
- Bioinformatics & Cheminformatics (AREA)
- Chemical & Material Sciences (AREA)
- Medicinal Chemistry (AREA)
- Pharmacology & Pharmacy (AREA)
- Engineering & Computer Science (AREA)
- Life Sciences & Earth Sciences (AREA)
- Animal Behavior & Ethology (AREA)
- General Health & Medical Sciences (AREA)
- Public Health (AREA)
- Veterinary Medicine (AREA)
- Medicinal Preparation (AREA)
- Medical Preparation Storing Or Oral Administration Devices (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| ITMI960311 | 1996-02-19 | ||
| IT96MI000311A IT1282650B1 (it) | 1996-02-19 | 1996-02-19 | Compressa farmaceutica,caratterizzata da elevato aumento di volume a contatto con liquidi biologici |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69728710D1 DE69728710D1 (de) | 2004-05-27 |
| DE69728710T2 true DE69728710T2 (de) | 2005-04-07 |
Family
ID=11373320
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69728710T Expired - Lifetime DE69728710T2 (de) | 1996-02-19 | 1997-02-18 | Eine pharmazeutische Tablette charakterisiert durch hohen Volumenzuwachs bei Kontakt mit biologischen Flüssigkeiten |
Country Status (12)
Families Citing this family (146)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US5534263A (en) | 1995-02-24 | 1996-07-09 | Alza Corporation | Active agent dosage form comprising a matrix and at least two insoluble bands |
| CA2173818A1 (fr) * | 1996-04-10 | 1997-10-11 | Francois Chouinard | Comprime pharmaceutique a liberation controlee contenant un support a base d'amylose reticule et d'hydroxypropylmethylcellulose |
| US5804165A (en) * | 1996-07-24 | 1998-09-08 | Arnold; Michael J. | Antiplaque oral composition |
| DE19640062B4 (de) * | 1996-09-28 | 2006-04-27 | Lts Lohmann Therapie-Systeme Ag | Orale Zubereitung, enthaltend in einer in wässrigem Medium quellbaren Matrix wenigstens einen pharmazeutischen Wirkstoff |
| US6046177A (en) * | 1997-05-05 | 2000-04-04 | Cydex, Inc. | Sulfoalkyl ether cyclodextrin based controlled release solid pharmaceutical formulations |
| IT1294760B1 (it) * | 1997-09-03 | 1999-04-12 | Jagotec Ag | Procedimento per la preparazione di compresse farmaceutiche in grado di cedere,secondo schemi predeterminabili, principi attivi poco |
| IN186245B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1997-09-19 | 2001-07-14 | Ranbaxy Lab Ltd | |
| GB9724186D0 (en) | 1997-11-14 | 1998-01-14 | British Tech Group | Low temperature coatings |
| EP1321147A1 (en) * | 1997-12-22 | 2003-06-25 | Schering Corporation | Orally administrable solid ribavirin dosage forms and process for making them |
| AU755616B2 (en) * | 1998-06-05 | 2002-12-19 | Warner-Lambert Company | Stabilization of compositions containing ace inhibitors using magnesium oxide |
| AU761281B2 (en) * | 1998-09-25 | 2003-05-29 | Delsys Pharmaceutical Corporation | Liquid pharmaceutical for oral delivery |
| US6416786B1 (en) | 1998-12-11 | 2002-07-09 | Nostrum Pharmaceuticals, Inc. | Sustained release tablet containing hydrocolloid and cellulose ether |
| US6635281B2 (en) | 1998-12-23 | 2003-10-21 | Alza Corporation | Gastric retaining oral liquid dosage form |
| US6797283B1 (en) | 1998-12-23 | 2004-09-28 | Alza Corporation | Gastric retention dosage form having multiple layers |
| US6723342B1 (en) | 1999-02-08 | 2004-04-20 | Fmc Corporation | Edible coating composition |
| US6432448B1 (en) | 1999-02-08 | 2002-08-13 | Fmc Corporation | Edible coating composition |
| MY121470A (en) * | 1999-05-03 | 2006-01-28 | Ranbaxy Lab Ltd | Stable solid pharmaceutical compositions containing enalapril maleate |
| US6555139B2 (en) | 1999-06-28 | 2003-04-29 | Wockhardt Europe Limited | Preparation of micron-size pharmaceutical particles by microfluidization |
| FR2797185B1 (fr) * | 1999-08-06 | 2001-10-26 | Galenix Dev | Composition pharmaceutique flottante comprenant une phase active et une phase non active |
| US6500462B1 (en) | 1999-10-29 | 2002-12-31 | Fmc Corporation | Edible MCC/PGA coating composition |
| JP4565456B2 (ja) * | 1999-11-02 | 2010-10-20 | 塩野義製薬株式会社 | 着色顆粒の色素定着法 |
| US6399101B1 (en) | 2000-03-30 | 2002-06-04 | Mova Pharmaceutical Corp. | Stable thyroid hormone preparations and method of making same |
| AR030557A1 (es) | 2000-04-14 | 2003-08-27 | Jagotec Ag | Una tableta en multicapa de liberacion controlada y metodo de tratamiento |
| US6955821B2 (en) * | 2000-04-28 | 2005-10-18 | Adams Laboratories, Inc. | Sustained release formulations of guaifenesin and additional drug ingredients |
| US7985420B2 (en) * | 2000-04-28 | 2011-07-26 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US7838032B2 (en) * | 2000-04-28 | 2010-11-23 | Reckitt Benckiser Inc. | Sustained release of guaifenesin |
| US8012504B2 (en) * | 2000-04-28 | 2011-09-06 | Reckitt Benckiser Inc. | Sustained release of guaifenesin combination drugs |
| US6372252B1 (en) | 2000-04-28 | 2002-04-16 | Adams Laboratories, Inc. | Guaifenesin sustained release formulation and tablets |
| US6881420B2 (en) * | 2000-06-23 | 2005-04-19 | Teva Pharmaceutical Industries Ltd. | Compositions and dosage forms for gastric delivery of irinotecan and methods of treatment that use it to inhibit cancer cell proliferation |
| US6476006B2 (en) | 2000-06-23 | 2002-11-05 | Teva Pharmaceutical Industries, Ltd. | Composition and dosage form for delayed gastric release of alendronate and/or other bis-phosphonates |
| US7674480B2 (en) * | 2000-06-23 | 2010-03-09 | Teva Pharmaceutical Industries Ltd. | Rapidly expanding composition for gastric retention and controlled release of therapeutic agents, and dosage forms including the composition |
| KR20030013460A (ko) * | 2000-06-23 | 2003-02-14 | 테바 파마슈티컬 인더스트리즈 리미티드 | 치료제의 위 체류 및 방출 조절을 위한 급속 팽창성조성물과 이 조성물을 포함하는 제형 |
| DE10031043A1 (de) | 2000-06-26 | 2002-02-14 | Bayer Ag | Retardzubereitungen von Chinolonantibiotika und Verfahren zu ihrer Herstellung |
| US6932861B2 (en) | 2000-11-28 | 2005-08-23 | Fmc Corporation | Edible PGA coating composition |
| BR0115585A (pt) | 2000-11-28 | 2005-12-13 | Fmc Corp | Composições de revestimento de pronta liberação, endurecìvel, comestìvel, seca e, úmida, forma de dosagem sólida, e, método para revestir uma forma de dosagem sólida farmacêutica ou veterinária, confeito, semente, ração animal, fertilizante, comprimido de pesticida ou alimento |
| EP1347748A2 (en) * | 2000-12-05 | 2003-10-01 | MacGregor, Alexander | Hydrostatic delivery system for controlled delivery of agent |
| KR100685945B1 (ko) | 2000-12-29 | 2007-02-23 | 엘지.필립스 엘시디 주식회사 | 액정표시장치 및 그 제조방법 |
| US8268333B2 (en) * | 2001-04-24 | 2012-09-18 | Lintec Corporation | Orally administered agent and an orally administered agent/supporting substrate complex |
| DE10120092B4 (de) * | 2001-04-25 | 2008-03-20 | Lts Lohmann Therapie-Systeme Ag | Magensaftresistente Vorrichtung zur Freisetzung von mukoadhäsiven Wirkstoffträgern und Verfahren zur Herstellung der magensaftresistenten Vorrichtung |
| IL159812A0 (en) * | 2001-07-12 | 2004-06-20 | Teva Pharma | Dual release formulation comprising levodopa ethyl ester and a decarboxylase inhibitor in immediate release layer with levodopa ethyl ester in a controlled release core |
| IL159813A0 (en) * | 2001-07-12 | 2004-06-20 | Teva Pharma | Dual release formulation comprising levodopa ethyl ester and a decarboxylase inhibitor in immediate release layer with levodopa ethyl ester and a decarboxylase inhibitor in a controlled release core |
| US20030091630A1 (en) * | 2001-10-25 | 2003-05-15 | Jenny Louie-Helm | Formulation of an erodible, gastric retentive oral dosage form using in vitro disintegration test data |
| US20030104052A1 (en) * | 2001-10-25 | 2003-06-05 | Bret Berner | Gastric retentive oral dosage form with restricted drug release in the lower gastrointestinal tract |
| CA2409552A1 (en) * | 2001-10-25 | 2003-04-25 | Depomed, Inc. | Gastric retentive oral dosage form with restricted drug release in the lower gastrointestinal tract |
| US20030152622A1 (en) * | 2001-10-25 | 2003-08-14 | Jenny Louie-Helm | Formulation of an erodible, gastric retentive oral diuretic |
| US6645526B2 (en) * | 2001-11-13 | 2003-11-11 | Mylan Pharmaceuticals, Inc. | Storage stable thyroxine active drug formulations and methods for their production |
| AU2002346372A1 (en) * | 2001-11-13 | 2003-05-26 | Teva Pharmaceutical Industries, Ltd. | Process for the production of l-dopa ethyl ester |
| AU2002340470A1 (en) | 2001-11-13 | 2003-05-26 | Teva Pharmaceutical Industries, Ltd. | L-dopa ethyl ester salts and uses thereof |
| US20030099699A1 (en) * | 2001-11-13 | 2003-05-29 | Hanshew Dwight D. | Storage stable thyroxine active drug formulations and methods for their production |
| DE50105577D1 (de) * | 2001-12-21 | 2005-04-14 | Biopartners Gmbh Baar | Ribavirin-granulat zur herstellung von filmtabletten |
| KR20030056474A (ko) * | 2001-12-28 | 2003-07-04 | 한국유나이티드제약 주식회사 | 카르비도파/레보도파 서방정의 조성물과 그의 제조방법 |
| US6682759B2 (en) | 2002-02-01 | 2004-01-27 | Depomed, Inc. | Manufacture of oral dosage forms delivering both immediate-release and sustained-release drugs |
| AU2002302890A1 (en) * | 2002-02-04 | 2003-12-02 | Ranbaxy Laboratories Limited | Hydrodynamically balancing oral drug delivery system with biphasic release |
| US7008979B2 (en) * | 2002-04-30 | 2006-03-07 | Hydromer, Inc. | Coating composition for multiple hydrophilic applications |
| US20060013875A1 (en) * | 2002-05-29 | 2006-01-19 | Impax Laboratories, Inc. | Combination immediate release controlled release levodopa/carbidopa dosage forms |
| US20040005359A1 (en) * | 2002-06-27 | 2004-01-08 | Cheng Xiu Xiu | Controlled release oral dosage form |
| AU2003270778B2 (en) | 2002-09-20 | 2009-10-08 | Alpharma Pharmaceuticals, Llc | Sequestering subunit and related compositions and methods |
| TWI319713B (en) * | 2002-10-25 | 2010-01-21 | Sustained-release tramadol formulations with 24-hour efficacy | |
| US8487002B2 (en) * | 2002-10-25 | 2013-07-16 | Paladin Labs Inc. | Controlled-release compositions |
| US20040091538A1 (en) * | 2002-10-31 | 2004-05-13 | Crystal Pollock-Dove | Dosage form providing ascending release of liquid formulation |
| US8906413B2 (en) | 2003-05-12 | 2014-12-09 | Supernus Pharmaceuticals, Inc. | Drug formulations having reduced abuse potential |
| US20050013863A1 (en) | 2003-07-18 | 2005-01-20 | Depomed, Inc., A Corporation Of The State Of California | Dual drug dosage forms with improved separation of drugs |
| TWI372066B (en) * | 2003-10-01 | 2012-09-11 | Wyeth Corp | Pantoprazole multiparticulate formulations |
| US20060172006A1 (en) * | 2003-10-10 | 2006-08-03 | Vincent Lenaerts | Sustained-release tramadol formulations with 24-hour clinical efficacy |
| JP2005132803A (ja) * | 2003-10-31 | 2005-05-26 | Ono Pharmaceut Co Ltd | 胃内滞留固形剤 |
| EP1701725B1 (en) * | 2003-12-16 | 2013-07-31 | Relevare Aust. Pty Ltd | Compositions comprising flupirtine and an opioid for use in the treatment of neuropathic pain |
| US20070196396A1 (en) * | 2004-02-11 | 2007-08-23 | Rubicon Research Private Limited | Controlled release pharmaceutical compositions with improved bioavailability |
| WO2005084703A1 (ja) * | 2004-03-09 | 2005-09-15 | Nrl Pharma, Inc. | 徐放性の口腔用組成物 |
| FR2874325B1 (fr) * | 2004-08-19 | 2006-10-20 | Sanofi Synthelabo | Composition pharmaceutique sous forme de comprime a residence gastrique contenant de l'alfuzosine |
| CA2581002C (en) * | 2004-10-15 | 2012-01-10 | Supernus Pharmaceuticals, Inc. | Less abusable pharmaceutical preparations |
| MX2007005991A (es) * | 2004-11-19 | 2007-07-20 | Smithkline Beecham Corp | Producto farmaceutico. |
| US20060159753A1 (en) * | 2004-12-27 | 2006-07-20 | Eisai Co. Ltd. | Matrix type sustained-release preparation containing basic drug or salt thereof |
| US8481565B2 (en) * | 2004-12-27 | 2013-07-09 | Eisai R&D Management Co., Ltd. | Method for stabilizing anti-dementia drug |
| US20060246003A1 (en) * | 2004-12-27 | 2006-11-02 | Eisai Co. Ltd. | Composition containing anti-dementia drug |
| US20090208579A1 (en) * | 2004-12-27 | 2009-08-20 | Eisai R & D Management Co., Ltd. | Matrix Type Sustained-Release Preparation Containing Basic Drug or Salt Thereof, and Method for Manufacturing the Same |
| US20060280789A1 (en) * | 2004-12-27 | 2006-12-14 | Eisai Research Institute | Sustained release formulations |
| EP1901720A2 (en) * | 2005-06-23 | 2008-03-26 | Spherics, Inc. | Improved dosage forms for movement disorder treatment |
| WO2007000779A2 (en) * | 2005-06-29 | 2007-01-04 | Panacea Biotec Ltd. | Pharmaceutical sustained release compositions and processes thereof |
| CA2616204C (en) * | 2005-09-09 | 2015-12-01 | Labopharm Inc. | Sustained drug release composition |
| PT1931346E (pt) * | 2005-09-09 | 2012-08-14 | Angelini Labopharm Llc | Composição de trazodona para administração uma vez por dia |
| NL2000281C2 (nl) | 2005-11-02 | 2007-08-07 | Pfizer Prod Inc | Vaste farmaceutische samenstellingen die pregabaline bevatten. |
| WO2007072495A2 (en) * | 2005-11-03 | 2007-06-28 | Sun Pharmaceutical Industries Limited | Coated tablets having prolonged gastric retention |
| WO2007056570A2 (en) * | 2005-11-07 | 2007-05-18 | Teva Pharmaceutical Industries Ltd. | Levodopa compositions |
| US7674396B2 (en) * | 2005-11-08 | 2010-03-09 | Plensat Llc | Method and system for treatment of eating disorders |
| US8691272B2 (en) | 2005-12-30 | 2014-04-08 | Intelgenx Corp. | Multilayer tablet |
| KR100752417B1 (ko) * | 2006-02-14 | 2007-08-28 | 대원제약주식회사 | 안정성이 증진된, 마진돌을 포함하는 약제학적 조성물 |
| US9011930B2 (en) * | 2006-05-01 | 2015-04-21 | Zycal Bioceuticals Healthcare Company, Inc. | Nutritional supplement and use thereof |
| EP2021005A4 (en) * | 2006-05-03 | 2009-11-25 | Cnsbio Pty Ltd | METHOD AND COMPOSITION FOR THE TREATMENT OF INFLAMMATORY PAIN |
| AU2007266574A1 (en) * | 2006-06-01 | 2007-12-06 | Dexcel Pharma Technologies Ltd. | Multiple unit pharmaceutical formulation |
| AU2007261451A1 (en) | 2006-06-19 | 2007-12-27 | Alpharma Pharmaceuticals, Llc | Pharmaceutical compositions |
| US20080131492A1 (en) * | 2006-06-23 | 2008-06-05 | Spherics, Inc. | Dosage forms for movement disorder treatment |
| US20080057123A1 (en) | 2006-08-30 | 2008-03-06 | Jagotec Ag | Controlled Release Formulations |
| EP2067475A4 (en) * | 2006-09-26 | 2010-12-15 | Astellas Pharma Inc | PREPARATION FOR TACROLIMUS MAINTAINED RELEASE |
| BRPI0622039B1 (pt) * | 2006-09-26 | 2020-11-10 | Plensat, Llc | dispositivos gástricos ingeríveis de qualidade alimentícia |
| WO2008039193A2 (en) * | 2006-09-26 | 2008-04-03 | Plensat, Llc | Method and system for treatment of eating disorders |
| EP1935411A1 (en) | 2006-12-15 | 2008-06-25 | Campina Nederland Holding B.V. | Slow release excipient and its use |
| EP2063867A2 (en) * | 2006-12-22 | 2009-06-03 | Combinatorx, Incorporated | Pharmaceutical compositions for treatment of parkinson's disease and related disorders |
| JPWO2008084698A1 (ja) | 2006-12-28 | 2010-04-30 | アステラス製薬株式会社 | タクロリムス徐放性医薬組成物 |
| AT505225A1 (de) | 2007-04-26 | 2008-11-15 | Sanochemia Pharmazeutika Ag | 0erfahren zur herstellung von hoch reinem 2,4'-dimethyl-3-piperidino-propiophenon (tolperison), dieses enthaltende pharmazeutische zusammensetzungen, sowie tolperison enthaltende wirkstoffformulierungen |
| US8623418B2 (en) | 2007-12-17 | 2014-01-07 | Alpharma Pharmaceuticals Llc | Pharmaceutical composition |
| EP2309997A4 (en) * | 2008-06-16 | 2013-01-02 | Appian Labs Llc | COMPOSITION AND METHOD FOR PRODUCING A RELEASE SYSTEM FOR THE CONSTANT (NUMBERED ORDER) RELEASE OF ACTIVE SUBSTANCES |
| WO2010019915A1 (en) | 2008-08-15 | 2010-02-18 | Depomed Inc. | Gastric retentive pharmaceutical compositions for treatment and prevention of cns disorders |
| EA201170529A1 (ru) | 2008-10-08 | 2012-01-30 | Биоплюс Лайф Саенсис Пвт. Лтд. | Система доставки лекарственного препарата с замедленным высвобождением |
| EP2358358A2 (en) * | 2008-10-23 | 2011-08-24 | Appian Labs, Llc | Tablets and discs with compartments with two or more drugs for release at certain intervals and with specific rates |
| US20100233259A1 (en) * | 2008-12-12 | 2010-09-16 | Pascal Grenier | Dosage form of ropinirole |
| EP2210585A1 (en) | 2009-01-16 | 2010-07-28 | Exelgyn | SPRM pharmaceutical compositions methods of treatment using them |
| US20100249423A1 (en) * | 2009-03-09 | 2010-09-30 | Sanochemia Pharmazeutika Ag | Tolperisone controlled release tablet |
| US10610528B2 (en) | 2009-12-08 | 2020-04-07 | Intelgenx Corp. | Solid oral film dosage forms and methods for making same |
| US20110136815A1 (en) | 2009-12-08 | 2011-06-09 | Horst Zerbe | Solid oral film dosage forms and methods for making same |
| WO2011078993A1 (en) | 2009-12-21 | 2011-06-30 | Aptapharma, Inc. | Functionally-coated multilayer tablets |
| EP2554168B1 (en) | 2010-03-29 | 2018-01-24 | Astellas Pharma Inc. | Controlled release pharmaceutical composition |
| JP5459670B2 (ja) * | 2010-05-07 | 2014-04-02 | 塩野義製薬株式会社 | 着色顆粒の色素定着化剤 |
| US20130143867A1 (en) | 2011-12-02 | 2013-06-06 | Sychroneuron Inc. | Acamprosate formulations, methods of using the same, and combinations comprising the same |
| AU2013213317B2 (en) | 2012-01-23 | 2016-06-30 | Sun Pharmaceutical Industries Limited | In-situ multilayered tablet technology |
| EP3878445A3 (en) | 2013-06-05 | 2021-10-27 | Synchroneuron Inc. | Acamprosate formulations, methods of using the same, and combinations comprising the same |
| US10987313B2 (en) | 2013-10-07 | 2021-04-27 | Impax Laboratories, Llc | Muco-adhesive, controlled release formulations of levodopa and/or esters of levodopa and uses thereof |
| EP3782614A1 (en) | 2013-10-07 | 2021-02-24 | Impax Laboratories, LLC | Muco-adhesive, controlled release formulations of levodopa and/or esters of levodopa and uses thereof |
| KR20170015389A (ko) | 2014-06-02 | 2017-02-08 | 테바 파마슈티컬 인더스트리즈 리미티드 | 확장 가능한 위체류 투여 형태 |
| GB201506755D0 (en) | 2015-04-21 | 2015-06-03 | Reckitt Benckiser Llc | Novel pharmaceutical formulation |
| US9617230B2 (en) | 2014-12-22 | 2017-04-11 | Farmington Pharma Development | Creatine prodrugs, compositions and methods of use thereof |
| WO2016115253A1 (en) | 2015-01-14 | 2016-07-21 | The Regents Of The University Ofcolordo, A Body Corporate | Insulin mimotopes and methods of using the same |
| HK1247823A1 (zh) * | 2015-02-09 | 2018-10-05 | Entera Bio Ltd. | 骨质疏松的治疗 |
| US20170042806A1 (en) | 2015-04-29 | 2017-02-16 | Dexcel Pharma Technologies Ltd. | Orally disintegrating compositions |
| CA3001337C (en) | 2015-10-09 | 2023-12-12 | Reckitt Benckiser Llc | Pharmaceutical formulation |
| AU2017236977B2 (en) | 2016-03-24 | 2022-05-26 | Immunomolecular Therapeutics, Inc. | Methods of treating autoimmune disease |
| US9687475B1 (en) | 2016-03-24 | 2017-06-27 | Ezra Pharma Llc | Extended release pharmaceutical formulations with controlled impurity levels |
| US9675585B1 (en) | 2016-03-24 | 2017-06-13 | Ezra Pharma | Extended release pharmaceutical formulations |
| US10076494B2 (en) | 2016-06-16 | 2018-09-18 | Dexcel Pharma Technologies Ltd. | Stable orally disintegrating pharmaceutical compositions |
| AU2017311698B2 (en) | 2016-08-17 | 2024-09-05 | Entera Bio Ltd. | Formulations for oral administration of active agents |
| WO2018102799A1 (en) | 2016-12-02 | 2018-06-07 | Clexio Biosciences Ltd. | Gastric residence system |
| KR102039345B1 (ko) * | 2017-02-01 | 2019-11-01 | 지엘팜텍주식회사 | 프레가발린 함유 고팽윤성 서방성 삼중정제 |
| JP7433226B2 (ja) | 2017-12-01 | 2024-02-19 | ウルトラジェニクス ファーマシューティカル インク. | クレアチンプロドラッグ、組成物及びその使用方法 |
| WO2019111132A1 (en) | 2017-12-04 | 2019-06-13 | Clexio Biosciences Ltd. | Long acting gastric residence system |
| US11337920B2 (en) | 2017-12-18 | 2022-05-24 | Tris Pharma, Inc. | Pharmaceutical composition comprising GHB gastro-retentive raft forming systems having trigger pulse drug release |
| WO2019126218A1 (en) | 2017-12-18 | 2019-06-27 | Tris Pharma, Inc. | Modified release drug powder composition comprising gastro-retentive raft forming systems having trigger pulse drug release |
| US11666546B2 (en) | 2017-12-18 | 2023-06-06 | Tris Pharma, Inc | GHB pharmaceutical compositions comprising a floating interpenetrating polymer network forming system |
| US11052060B2 (en) | 2018-02-12 | 2021-07-06 | The Regents Of The University Of Colorado, A Body Corporate | Compounds and methods for treating autoimmunity |
| US11013707B2 (en) | 2018-03-23 | 2021-05-25 | The Regents Of The University Of Colorado, A Body Corporate | Administration of oral methyldopa |
| JP7550393B2 (ja) * | 2018-05-15 | 2024-09-13 | ジエンス ハンセン ファーマセウティカル グループ カンパニー リミテッド | 低分子egfr阻害剤を含む医薬組成物及びその製造方法 |
| CN110214860A (zh) * | 2019-07-10 | 2019-09-10 | 聂刘明 | 一种宠物饲料及其制备工艺 |
| US11986449B2 (en) | 2020-12-22 | 2024-05-21 | Amneal Pharmaceuticals Llc | Levodopa dosing regimen |
| EP4267113A4 (en) | 2020-12-22 | 2025-02-12 | Amneal Pharmaceuticals LLC | LEVODOPA DOSING SCHEME |
| IL310523A (en) * | 2021-07-30 | 2024-03-01 | Evecxia Therapeutics Inc | 5-hydroxytryptophan gastroretentive dosage forms |
| US12409163B2 (en) | 2021-07-30 | 2025-09-09 | Evecxia Therapeutics, Inc. | Method of enhancing 5-hydroxytryptophan (5-HTP) exposure |
| US11779567B2 (en) | 2021-10-14 | 2023-10-10 | Evecxia Therapeutics, Inc. | Method for optimizing 5-hydroxytryptamine function in the brain for therapeutic purposes |
| WO2023214018A1 (en) | 2022-05-06 | 2023-11-09 | Galenix Innovations | Gastro-retentive swellable sustained release composition |
Family Cites Families (12)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4077407A (en) * | 1975-11-24 | 1978-03-07 | Alza Corporation | Osmotic devices having composite walls |
| US4839171A (en) * | 1984-11-30 | 1989-06-13 | Techmix, Inc. | Composition for treating impaired lactation |
| IT1188212B (it) * | 1985-12-20 | 1988-01-07 | Paolo Colombo | Sistema per il rilascio a velocita' controllata di sostanze attive |
| JPH0747534B2 (ja) * | 1986-06-02 | 1995-05-24 | ロ−ラ−ジヤパン株式会社 | 錠 剤 |
| US4869908A (en) * | 1987-01-09 | 1989-09-26 | K.V. Pharmaceutical Co. | Fibre formulations |
| US4786503A (en) * | 1987-04-06 | 1988-11-22 | Alza Corporation | Dosage form comprising parallel lamine |
| DK469989D0 (da) * | 1989-09-22 | 1989-09-22 | Bukh Meditec | Farmaceutisk praeparat |
| IT1237904B (it) * | 1989-12-14 | 1993-06-18 | Ubaldo Conte | Compresse a rilascio a velocita' controllata delle sostanze attive |
| IT1255522B (it) * | 1992-09-24 | 1995-11-09 | Ubaldo Conte | Compressa per impiego terapeutico atta a cedere una o piu' sostanze attive con differenti velocita' |
| IT1256393B (it) * | 1992-11-17 | 1995-12-04 | Inverni Della Beffa Spa | Forme matriciali multistrato per il rilascio controllato di principi attivi |
| IT1264517B1 (it) * | 1993-05-31 | 1996-09-24 | Ekita Investments Nv | Compressa farmaceutica atta al rilascio in tempi successivi dei principi attivi in essa veicolati |
| US5464633A (en) * | 1994-05-24 | 1995-11-07 | Jagotec Ag | Pharmaceutical tablets releasing the active substance after a definite period of time |
-
1996
- 1996-02-19 IT IT96MI000311A patent/IT1282650B1/it active IP Right Grant
-
1997
- 1997-02-14 US US08/799,313 patent/US5780057A/en not_active Expired - Lifetime
- 1997-02-18 ES ES97102567T patent/ES2219709T3/es not_active Expired - Lifetime
- 1997-02-18 ES ES03078109T patent/ES2376199T3/es not_active Expired - Lifetime
- 1997-02-18 AT AT03078109T patent/ATE530173T1/de not_active IP Right Cessation
- 1997-02-18 DE DE69728710T patent/DE69728710T2/de not_active Expired - Lifetime
- 1997-02-18 AU AU14776/97A patent/AU719170B2/en not_active Expired
- 1997-02-18 AT AT97102567T patent/ATE264670T1/de active
- 1997-02-18 EP EP97102567A patent/EP0795324B1/en not_active Expired - Lifetime
- 1997-02-18 NZ NZ314265A patent/NZ314265A/en not_active IP Right Cessation
- 1997-02-18 DK DK97102567T patent/DK0795324T3/da active
- 1997-02-18 EP EP03078109A patent/EP1382331B1/en not_active Expired - Lifetime
- 1997-02-18 PT PT97102567T patent/PT795324E/pt unknown
- 1997-02-19 JP JP03491897A patent/JP3251190B2/ja not_active Expired - Lifetime
- 1997-02-19 CA CA002197941A patent/CA2197941C/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| CA2197941A1 (en) | 1997-08-20 |
| ATE264670T1 (de) | 2004-05-15 |
| PT795324E (pt) | 2004-09-30 |
| EP0795324A3 (en) | 1998-11-04 |
| ES2376199T8 (es) | 2012-04-04 |
| NZ314265A (en) | 1997-07-27 |
| ITMI960311A1 (it) | 1997-08-19 |
| ATE530173T1 (de) | 2011-11-15 |
| ES2219709T3 (es) | 2004-12-01 |
| JP3251190B2 (ja) | 2002-01-28 |
| JPH09316005A (ja) | 1997-12-09 |
| EP0795324A2 (en) | 1997-09-17 |
| AU719170B2 (en) | 2000-05-04 |
| CA2197941C (en) | 2001-12-04 |
| EP1382331B1 (en) | 2011-10-26 |
| DK0795324T3 (da) | 2004-08-16 |
| ITMI960311A0 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1996-02-19 |
| ES2376199T3 (es) | 2012-03-09 |
| US5780057A (en) | 1998-07-14 |
| EP0795324B1 (en) | 2004-04-21 |
| IT1282650B1 (it) | 1998-03-31 |
| AU1477697A (en) | 1997-08-28 |
| EP1382331A1 (en) | 2004-01-21 |
| DE69728710D1 (de) | 2004-05-27 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69728710T2 (de) | Eine pharmazeutische Tablette charakterisiert durch hohen Volumenzuwachs bei Kontakt mit biologischen Flüssigkeiten | |
| DE69704712T2 (de) | Tablette mit gesteuerter freisetzung von alfuzosinhydrochlorid | |
| DE69521987T2 (de) | Amoxicillin zweischichttabletten | |
| DE69826290T2 (de) | Pharmazeutische zusammensetzungen zur kontrollierten freigabe von wirkstoffen | |
| DE69316715T2 (de) | Mehrschichtige Matrixsysteme mit kontrollierter Wirkstoffabgabe | |
| DE69531216T2 (de) | Verabreichungssystem mit gesteuerter freisetzung einer arzneistoffsuspension | |
| DE69624907T3 (de) | Orale, pharmazeutische darreichungsformen, die einen protonenpumpeninhibitor und ein antacidum oder alginat enthalten | |
| DE69817010T2 (de) | Spheroide, verfahren zu ihrer herstellung und diese enthaltende arzneiformen | |
| DE69628551T2 (de) | Oral anzuwendende pharmazeutische dosierungsformen,enthaltend einem protonenpunpeninibitor und einen nicht-steriodalen antiinflamatorischen wirkstoff | |
| DE69729134T2 (de) | Pharmazeutische Tablette geeignet zur Wirkstofffreisetzung in aufeinanderfolgenden und vorherbestimmbaren Zeiträumen | |
| DE69212710T2 (de) | Pharmazeutische Zusammensetzung mit kontrollierter Freigabe und bioadhäsiven Eigenschaften | |
| DE60038698T2 (de) | Hydrogel-gesteuerte dosierungsform | |
| DE69208299T2 (de) | Feste Arzneizubereitungen zur oralen Verabreichung mit verlängerter Magenverweilzeit | |
| EP1830855B1 (de) | Feste, oral applizierbare pharmazeutische darreichungsformen enthaltend rivaroxaban mit modifizierter freisetzung | |
| EP1138320B1 (de) | Wirkstoffhaltige Schwimmformen enthaltend Polyvinylacetat und Polyvinylpyrrolidon, deren Verwendung und Herstellung | |
| DE69924710T2 (de) | Pharmazeutische zubereitung zur anwendung in der antiasthmatherapie | |
| EP1110544B1 (de) | Verfahren zur Herstellung einer geschmacksmaskierten oralen Darreichungsform& x9; | |
| DE69720055T2 (de) | Verabreichungsform zur abgabe von steigenden wirkstoffdosen | |
| DE69735848T2 (de) | Dosisform mit ansteigender dosisfreisetzung | |
| DE60212475T2 (de) | Pharmazeutische Tablette und ein Verfahren zu ihrer Herstellung | |
| EP1138321A2 (de) | Feste orale Darreichungsformen mit retardierter Wirkstoffreisetzung und hoher mechanischer Stabilität | |
| DE3811114A1 (de) | Zweischichtige dosierungsform zur abgabe eines wirkstoffs | |
| DE3715224A1 (de) | Dosierungsform zur stossweisen freisetzung eines arzneimittels | |
| DE102005016981A1 (de) | Kombination zur Therapie bei benigner Prostatahyperplasie | |
| DE60307819T2 (de) | Venlafaxine Hydrochloridformulierungen mit verzögerter Freisetzung |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8328 | Change in the person/name/address of the agent |
Representative=s name: MEISSNER, BOLTE & PARTNER GBR, 80538 MUENCHEN |