DE69707951T2 - Diazoverbindungen für Laser-induzierte massenübertragende Bildaufzeichnungsmaterialien - Google Patents
Diazoverbindungen für Laser-induzierte massenübertragende BildaufzeichnungsmaterialienInfo
- Publication number
- DE69707951T2 DE69707951T2 DE69707951T DE69707951T DE69707951T2 DE 69707951 T2 DE69707951 T2 DE 69707951T2 DE 69707951 T DE69707951 T DE 69707951T DE 69707951 T DE69707951 T DE 69707951T DE 69707951 T2 DE69707951 T2 DE 69707951T2
- Authority
- DE
- Germany
- Prior art keywords
- diazo
- compound
- layer
- donor
- mass transfer
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Fee Related
Links
- 238000012546 transfer Methods 0.000 title claims description 130
- 239000000463 material Substances 0.000 title claims description 117
- 150000008049 diazo compounds Chemical class 0.000 title claims description 47
- 238000003384 imaging method Methods 0.000 title description 23
- 150000001875 compounds Chemical class 0.000 claims description 72
- 238000000354 decomposition reaction Methods 0.000 claims description 36
- 239000000758 substrate Substances 0.000 claims description 31
- 238000000034 method Methods 0.000 claims description 25
- 239000006100 radiation absorber Substances 0.000 claims description 21
- 125000000664 diazo group Chemical group [N-]=[N+]=[*] 0.000 claims description 20
- 125000000524 functional group Chemical group 0.000 claims description 9
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 6
- 125000001931 aliphatic group Chemical group 0.000 claims description 5
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 5
- 125000003118 aryl group Chemical group 0.000 claims description 5
- 125000000623 heterocyclic group Chemical group 0.000 claims description 4
- 125000006732 (C1-C15) alkyl group Chemical group 0.000 claims description 3
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 3
- 125000006527 (C1-C5) alkyl group Chemical group 0.000 claims 1
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 126
- 239000010410 layer Substances 0.000 description 90
- 239000000975 dye Substances 0.000 description 66
- -1 azidomethyl Chemical group 0.000 description 53
- 239000000243 solution Substances 0.000 description 48
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 30
- 239000000203 mixture Substances 0.000 description 26
- 229920005989 resin Polymers 0.000 description 25
- 239000011347 resin Substances 0.000 description 25
- 239000000049 pigment Substances 0.000 description 23
- 230000035945 sensitivity Effects 0.000 description 22
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 21
- 229910052782 aluminium Inorganic materials 0.000 description 20
- 229920000728 polyester Polymers 0.000 description 20
- 229920000642 polymer Polymers 0.000 description 20
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 238000000576 coating method Methods 0.000 description 18
- 239000010408 film Substances 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical class [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 17
- 239000011248 coating agent Substances 0.000 description 17
- 239000007787 solid Substances 0.000 description 17
- 229920003986 novolac Polymers 0.000 description 15
- 238000007639 printing Methods 0.000 description 15
- PXIPVTKHYLBLMZ-UHFFFAOYSA-N Sodium azide Chemical compound [Na+].[N-]=[N+]=[N-] PXIPVTKHYLBLMZ-UHFFFAOYSA-N 0.000 description 14
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 14
- 150000003254 radicals Chemical class 0.000 description 14
- YYROPELSRYBVMQ-UHFFFAOYSA-N 4-toluenesulfonyl chloride Chemical compound CC1=CC=C(S(Cl)(=O)=O)C=C1 YYROPELSRYBVMQ-UHFFFAOYSA-N 0.000 description 13
- 239000011521 glass Substances 0.000 description 13
- GQHTUMJGOHRCHB-UHFFFAOYSA-N 2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine Chemical compound C1CCCCN2CCCN=C21 GQHTUMJGOHRCHB-UHFFFAOYSA-N 0.000 description 12
- 238000001704 evaporation Methods 0.000 description 12
- 230000008020 evaporation Effects 0.000 description 12
- 238000004519 manufacturing process Methods 0.000 description 12
- 239000011230 binding agent Substances 0.000 description 11
- 239000006185 dispersion Substances 0.000 description 11
- 238000010438 heat treatment Methods 0.000 description 11
- 229910052751 metal Inorganic materials 0.000 description 11
- 239000002184 metal Substances 0.000 description 11
- 229920006395 saturated elastomer Polymers 0.000 description 11
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 10
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 10
- 239000008367 deionised water Substances 0.000 description 10
- 229910021641 deionized water Inorganic materials 0.000 description 10
- 238000000113 differential scanning calorimetry Methods 0.000 description 10
- 239000007789 gas Substances 0.000 description 10
- 239000003208 petroleum Substances 0.000 description 10
- 239000011541 reaction mixture Substances 0.000 description 10
- 239000000126 substance Substances 0.000 description 10
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 9
- 238000002679 ablation Methods 0.000 description 9
- 239000000123 paper Substances 0.000 description 9
- 239000004215 Carbon black (E152) Substances 0.000 description 8
- FKLJPTJMIBLJAV-UHFFFAOYSA-N Compound IV Chemical compound O1N=C(C)C=C1CCCCCCCOC1=CC=C(C=2OCCN=2)C=C1 FKLJPTJMIBLJAV-UHFFFAOYSA-N 0.000 description 8
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 8
- 239000006096 absorbing agent Substances 0.000 description 8
- 230000000052 comparative effect Effects 0.000 description 8
- 229910052802 copper Inorganic materials 0.000 description 8
- 239000010949 copper Substances 0.000 description 8
- 229930195733 hydrocarbon Natural products 0.000 description 8
- MNUOSEFUAPTYSE-UHFFFAOYSA-N 3-diazonio-4-[2-(2-methylprop-2-enoyloxy)ethoxy]-4-oxobut-2-en-2-olate Chemical compound C\C([O-])=C(/[N+]#N)C(=O)OCCOC(=O)C(C)=C MNUOSEFUAPTYSE-UHFFFAOYSA-N 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 7
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 7
- 229920001577 copolymer Polymers 0.000 description 7
- 239000000284 extract Substances 0.000 description 7
- 239000003921 oil Substances 0.000 description 7
- 239000002245 particle Substances 0.000 description 7
- 229920006267 polyester film Polymers 0.000 description 7
- 230000005855 radiation Effects 0.000 description 7
- 239000004065 semiconductor Substances 0.000 description 7
- 239000011780 sodium chloride Substances 0.000 description 7
- HTSGKJQDMSTCGS-UHFFFAOYSA-N 1,4-bis(4-chlorophenyl)-2-(4-methylphenyl)sulfonylbutane-1,4-dione Chemical compound C1=CC(C)=CC=C1S(=O)(=O)C(C(=O)C=1C=CC(Cl)=CC=1)CC(=O)C1=CC=C(Cl)C=C1 HTSGKJQDMSTCGS-UHFFFAOYSA-N 0.000 description 6
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 6
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 6
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 6
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 6
- 239000012954 diazonium Substances 0.000 description 6
- 239000004094 surface-active agent Substances 0.000 description 6
- 241000356539 Aquis Species 0.000 description 5
- 239000000020 Nitrocellulose Substances 0.000 description 5
- 238000006243 chemical reaction Methods 0.000 description 5
- 239000003086 colorant Substances 0.000 description 5
- 150000001989 diazonium salts Chemical class 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 150000002739 metals Chemical class 0.000 description 5
- 238000005065 mining Methods 0.000 description 5
- 229920001220 nitrocellulos Polymers 0.000 description 5
- 239000012044 organic layer Substances 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 238000001228 spectrum Methods 0.000 description 5
- 238000003860 storage Methods 0.000 description 5
- 238000006467 substitution reaction Methods 0.000 description 5
- 238000001931 thermography Methods 0.000 description 5
- 238000005160 1H NMR spectroscopy Methods 0.000 description 4
- WROAPMIYFGUNPW-UHFFFAOYSA-N 3-diazonio-5,8,8-trimethyl-2-oxobicyclo[3.2.1]oct-3-en-4-olate Chemical compound O=C1C(=[N+]=[N-])C(=O)C2(C)CCC1C2(C)C WROAPMIYFGUNPW-UHFFFAOYSA-N 0.000 description 4
- KUXKACNMIDMZAB-UHFFFAOYSA-N 5-diazonio-2-methyl-6-oxo-2-(2-phenylethyl)-1,3-dioxin-4-olate Chemical compound C=1C=CC=CC=1CCC1(C)OC(=O)C(=[N+]=[N-])C(=O)O1 KUXKACNMIDMZAB-UHFFFAOYSA-N 0.000 description 4
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 4
- 239000004593 Epoxy Substances 0.000 description 4
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 4
- 229920000877 Melamine resin Polymers 0.000 description 4
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 4
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 4
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 4
- 239000002253 acid Substances 0.000 description 4
- 239000000853 adhesive Substances 0.000 description 4
- 230000001070 adhesive effect Effects 0.000 description 4
- 239000000835 fiber Substances 0.000 description 4
- 229910052738 indium Inorganic materials 0.000 description 4
- APFVFJFRJDLVQX-UHFFFAOYSA-N indium atom Chemical compound [In] APFVFJFRJDLVQX-UHFFFAOYSA-N 0.000 description 4
- RKJUIXBNRJVNHR-UHFFFAOYSA-N indolenine group Chemical group N1=CCC2=CC=CC=C12 RKJUIXBNRJVNHR-UHFFFAOYSA-N 0.000 description 4
- 239000000178 monomer Substances 0.000 description 4
- 229910052759 nickel Inorganic materials 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 4
- 229910052718 tin Inorganic materials 0.000 description 4
- 238000013519 translation Methods 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- DSSYKIVIOFKYAU-XCBNKYQSSA-N (R)-camphor Chemical compound C1C[C@@]2(C)C(=O)C[C@@H]1C2(C)C DSSYKIVIOFKYAU-XCBNKYQSSA-N 0.000 description 3
- PSINDLUNOGABJV-UHFFFAOYSA-N (z)-2-diazonio-1,3-diethoxy-3-oxoprop-1-en-1-olate Chemical compound CCO\C([O-])=C(/[N+]#N)C(=O)OCC PSINDLUNOGABJV-UHFFFAOYSA-N 0.000 description 3
- RXYMTVAHQNMICF-UHFFFAOYSA-N 2-diazonio-1,3-bis[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-en-1-olate Chemical compound CC(C)(C)OC([O-])=C([N+]#N)C(=O)OC(C)(C)C RXYMTVAHQNMICF-UHFFFAOYSA-N 0.000 description 3
- CYYVRGUWUAFEDN-UHFFFAOYSA-N 2-diazonio-3-oxo-1-phenylbut-1-en-1-olate Chemical compound CC(=O)C([N+]#N)=C([O-])C1=CC=CC=C1 CYYVRGUWUAFEDN-UHFFFAOYSA-N 0.000 description 3
- YRCVEMYVKSXPLM-UHFFFAOYSA-N 5-diazonio-2,2-dimethyl-6-oxo-1,3-dioxin-4-olate Chemical compound CC1(C)OC([O-])=C([N+]#N)C(=O)O1 YRCVEMYVKSXPLM-UHFFFAOYSA-N 0.000 description 3
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 description 3
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 3
- 241000723346 Cinnamomum camphora Species 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- 239000005062 Polybutadiene Substances 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 description 3
- 125000000217 alkyl group Chemical group 0.000 description 3
- 238000004458 analytical method Methods 0.000 description 3
- 229910052787 antimony Inorganic materials 0.000 description 3
- WATWJIUSRGPENY-UHFFFAOYSA-N antimony atom Chemical compound [Sb] WATWJIUSRGPENY-UHFFFAOYSA-N 0.000 description 3
- 125000000751 azo group Chemical group [*]N=N[*] 0.000 description 3
- 229930008380 camphor Natural products 0.000 description 3
- 229960000846 camphor Drugs 0.000 description 3
- 229910052804 chromium Inorganic materials 0.000 description 3
- 239000011651 chromium Substances 0.000 description 3
- 229910017052 cobalt Inorganic materials 0.000 description 3
- 239000010941 cobalt Substances 0.000 description 3
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 3
- 238000010276 construction Methods 0.000 description 3
- 239000003431 cross linking reagent Substances 0.000 description 3
- 229920001971 elastomer Polymers 0.000 description 3
- 125000006575 electron-withdrawing group Chemical group 0.000 description 3
- 229910052742 iron Inorganic materials 0.000 description 3
- 239000011159 matrix material Substances 0.000 description 3
- 229910044991 metal oxide Inorganic materials 0.000 description 3
- 150000004706 metal oxides Chemical class 0.000 description 3
- 239000002923 metal particle Substances 0.000 description 3
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 3
- 230000003287 optical effect Effects 0.000 description 3
- VLTRZXGMWDSKGL-UHFFFAOYSA-N perchloric acid Chemical compound OCl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-N 0.000 description 3
- 229920001568 phenolic resin Polymers 0.000 description 3
- 239000005011 phenolic resin Substances 0.000 description 3
- 229920003023 plastic Polymers 0.000 description 3
- 229920003223 poly(pyromellitimide-1,4-diphenyl ether) Polymers 0.000 description 3
- 229920002857 polybutadiene Polymers 0.000 description 3
- 229920000570 polyether Polymers 0.000 description 3
- 238000012545 processing Methods 0.000 description 3
- 239000005060 rubber Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 3
- 238000005979 thermal decomposition reaction Methods 0.000 description 3
- UORPZKSQFCKMOW-UHFFFAOYSA-N (e)-2-diazonio-3-ethoxy-3-oxo-1-phenylprop-1-en-1-olate Chemical compound CCO\C([O-])=C(/[N+]#N)C(=O)C1=CC=CC=C1 UORPZKSQFCKMOW-UHFFFAOYSA-N 0.000 description 2
- PMBXCGGQNSVESQ-UHFFFAOYSA-N 1-Hexanethiol Chemical compound CCCCCCS PMBXCGGQNSVESQ-UHFFFAOYSA-N 0.000 description 2
- NNHHHXHIPDZKFU-UHFFFAOYSA-N 2-methyl-2-(2-phenylethyl)-1,3-dioxane-4,6-dione Chemical compound C=1C=CC=CC=1CCC1(C)OC(=O)CC(=O)O1 NNHHHXHIPDZKFU-UHFFFAOYSA-N 0.000 description 2
- FCSKOFQQCWLGMV-UHFFFAOYSA-N 5-{5-[2-chloro-4-(4,5-dihydro-1,3-oxazol-2-yl)phenoxy]pentyl}-3-methylisoxazole Chemical compound O1N=C(C)C=C1CCCCCOC1=CC=C(C=2OCCN=2)C=C1Cl FCSKOFQQCWLGMV-UHFFFAOYSA-N 0.000 description 2
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- 229920000178 Acrylic resin Polymers 0.000 description 2
- 239000004925 Acrylic resin Substances 0.000 description 2
- 229910000906 Bronze Inorganic materials 0.000 description 2
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 2
- OFOBLEOULBTSOW-UHFFFAOYSA-N Malonic acid Chemical compound OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 2
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 2
- 239000004721 Polyphenylene oxide Substances 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 2
- 238000010521 absorption reaction Methods 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000002671 adjuvant Substances 0.000 description 2
- 125000003545 alkoxy group Chemical group 0.000 description 2
- 125000004390 alkyl sulfonyl group Chemical group 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 235000010233 benzoic acid Nutrition 0.000 description 2
- AKGGYBADQZYZPD-UHFFFAOYSA-N benzylacetone Chemical compound CC(=O)CCC1=CC=CC=C1 AKGGYBADQZYZPD-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 229910052797 bismuth Inorganic materials 0.000 description 2
- JCXGWMGPZLAOME-UHFFFAOYSA-N bismuth atom Chemical compound [Bi] JCXGWMGPZLAOME-UHFFFAOYSA-N 0.000 description 2
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 2
- 239000010974 bronze Substances 0.000 description 2
- 229910052799 carbon Inorganic materials 0.000 description 2
- 239000006229 carbon black Substances 0.000 description 2
- 125000002915 carbonyl group Chemical group [*:2]C([*:1])=O 0.000 description 2
- 239000003054 catalyst Substances 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- KUNSUQLRTQLHQQ-UHFFFAOYSA-N copper tin Chemical compound [Cu].[Sn] KUNSUQLRTQLHQQ-UHFFFAOYSA-N 0.000 description 2
- 238000004132 cross linking Methods 0.000 description 2
- VFLDPWHFBUODDF-FCXRPNKRSA-N curcumin Chemical compound C1=C(O)C(OC)=CC(\C=C\C(=O)CC(=O)\C=C\C=2C=C(OC)C(O)=CC=2)=C1 VFLDPWHFBUODDF-FCXRPNKRSA-N 0.000 description 2
- 125000004093 cyano group Chemical group *C#N 0.000 description 2
- 230000032798 delamination Effects 0.000 description 2
- DMBHHRLKUKUOEG-UHFFFAOYSA-N diphenylamine Chemical compound C=1C=CC=CC=1NC1=CC=CC=C1 DMBHHRLKUKUOEG-UHFFFAOYSA-N 0.000 description 2
- 238000010494 dissociation reaction Methods 0.000 description 2
- 230000005593 dissociations Effects 0.000 description 2
- 230000005670 electromagnetic radiation Effects 0.000 description 2
- 238000005516 engineering process Methods 0.000 description 2
- 238000005530 etching Methods 0.000 description 2
- NLFBCYMMUAKCPC-KQQUZDAGSA-N ethyl (e)-3-[3-amino-2-cyano-1-[(e)-3-ethoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-enyl]sulfanylprop-2-enoate Chemical compound CCOC(=O)\C=C\SC(=C(C#N)C(N)=O)S\C=C\C(=O)OCC NLFBCYMMUAKCPC-KQQUZDAGSA-N 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000005227 gel permeation chromatography Methods 0.000 description 2
- 229910052732 germanium Inorganic materials 0.000 description 2
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 description 2
- PCHJSUWPFVWCPO-UHFFFAOYSA-N gold Chemical compound [Au] PCHJSUWPFVWCPO-UHFFFAOYSA-N 0.000 description 2
- 229910052737 gold Inorganic materials 0.000 description 2
- 239000010931 gold Substances 0.000 description 2
- 229910002804 graphite Inorganic materials 0.000 description 2
- 239000010439 graphite Substances 0.000 description 2
- 238000007756 gravure coating Methods 0.000 description 2
- 238000002329 infrared spectrum Methods 0.000 description 2
- 229910052741 iridium Inorganic materials 0.000 description 2
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 239000004973 liquid crystal related substance Substances 0.000 description 2
- 239000000314 lubricant Substances 0.000 description 2
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 2
- 238000005259 measurement Methods 0.000 description 2
- 238000005649 metathesis reaction Methods 0.000 description 2
- 229910052750 molybdenum Inorganic materials 0.000 description 2
- 239000011733 molybdenum Substances 0.000 description 2
- 239000003960 organic solvent Substances 0.000 description 2
- 229910052760 oxygen Inorganic materials 0.000 description 2
- 229910052763 palladium Inorganic materials 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 229920000058 polyacrylate Polymers 0.000 description 2
- 229920000647 polyepoxide Polymers 0.000 description 2
- 229920000139 polyethylene terephthalate Polymers 0.000 description 2
- 239000005020 polyethylene terephthalate Substances 0.000 description 2
- 229920001296 polysiloxane Polymers 0.000 description 2
- 229920002635 polyurethane Polymers 0.000 description 2
- 239000004814 polyurethane Substances 0.000 description 2
- 239000002243 precursor Substances 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 230000001681 protective effect Effects 0.000 description 2
- 229920003987 resole Polymers 0.000 description 2
- 229910052710 silicon Inorganic materials 0.000 description 2
- 239000010703 silicon Substances 0.000 description 2
- 229910052709 silver Inorganic materials 0.000 description 2
- 239000004332 silver Substances 0.000 description 2
- 239000002356 single layer Substances 0.000 description 2
- 238000007767 slide coating Methods 0.000 description 2
- 238000004544 sputter deposition Methods 0.000 description 2
- 230000000087 stabilizing effect Effects 0.000 description 2
- 229910052714 tellurium Inorganic materials 0.000 description 2
- PORWMNRCUJJQNO-UHFFFAOYSA-N tellurium atom Chemical compound [Te] PORWMNRCUJJQNO-UHFFFAOYSA-N 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- 238000002411 thermogravimetry Methods 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- NDLIRBZKZSDGSO-UHFFFAOYSA-N tosyl azide Chemical compound CC1=CC=C(S(=O)(=O)[N-][N+]#N)C=C1 NDLIRBZKZSDGSO-UHFFFAOYSA-N 0.000 description 2
- 238000010023 transfer printing Methods 0.000 description 2
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 2
- 229910052721 tungsten Inorganic materials 0.000 description 2
- 239000010937 tungsten Substances 0.000 description 2
- 230000008016 vaporization Effects 0.000 description 2
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 239000001993 wax Substances 0.000 description 2
- 230000004580 weight loss Effects 0.000 description 2
- JIAARYAFYJHUJI-UHFFFAOYSA-L zinc dichloride Chemical compound [Cl-].[Cl-].[Zn+2] JIAARYAFYJHUJI-UHFFFAOYSA-L 0.000 description 2
- 229910052726 zirconium Inorganic materials 0.000 description 2
- RLJALOQFYHCJKG-FVRNMFRHSA-N (1e,3e,6e,8e)-1,9-diphenylnona-1,3,6,8-tetraen-5-one Chemical class C=1C=CC=CC=1\C=C\C=C\C(=O)\C=C\C=C\C1=CC=CC=C1 RLJALOQFYHCJKG-FVRNMFRHSA-N 0.000 description 1
- QGZQYGDAZLYBIG-UHFFFAOYSA-N (e)-2-diazonio-2-diphenylphosphoryl-1-methoxyethenolate Chemical compound C=1C=CC=CC=1P(=O)(C(=[N+]=[N-])C(=O)OC)C1=CC=CC=C1 QGZQYGDAZLYBIG-UHFFFAOYSA-N 0.000 description 1
- GXYCJBWPRTZHBY-UHFFFAOYSA-N (z)-2-diazonio-2-diphenylphosphoryl-1-phenylethenolate Chemical compound C=1C=CC=CC=1P(=O)(C=1C=CC=CC=1)C(=[N+]=[N-])C(=O)C1=CC=CC=C1 GXYCJBWPRTZHBY-UHFFFAOYSA-N 0.000 description 1
- ICKAEAFPESRWOT-UHFFFAOYSA-N 1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonic acid Chemical class OS(=O)(=O)C1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C1(F)F ICKAEAFPESRWOT-UHFFFAOYSA-N 0.000 description 1
- CVBUKMMMRLOKQR-UHFFFAOYSA-N 1-phenylbutane-1,3-dione Chemical compound CC(=O)CC(=O)C1=CC=CC=C1 CVBUKMMMRLOKQR-UHFFFAOYSA-N 0.000 description 1
- 238000001644 13C nuclear magnetic resonance spectroscopy Methods 0.000 description 1
- LTMRRSWNXVJMBA-UHFFFAOYSA-L 2,2-diethylpropanedioate Chemical compound CCC(CC)(C([O-])=O)C([O-])=O LTMRRSWNXVJMBA-UHFFFAOYSA-L 0.000 description 1
- JLZIIHMTTRXXIN-UHFFFAOYSA-N 2-(2-hydroxy-4-methoxybenzoyl)benzoic acid Chemical compound OC1=CC(OC)=CC=C1C(=O)C1=CC=CC=C1C(O)=O JLZIIHMTTRXXIN-UHFFFAOYSA-N 0.000 description 1
- IBDVWXAVKPRHCU-UHFFFAOYSA-N 2-(2-methylprop-2-enoyloxy)ethyl 3-oxobutanoate Chemical compound CC(=O)CC(=O)OCCOC(=O)C(C)=C IBDVWXAVKPRHCU-UHFFFAOYSA-N 0.000 description 1
- JSOGDEOQBIUNTR-UHFFFAOYSA-N 2-(azidomethyl)oxirane Chemical compound [N-]=[N+]=NCC1CO1 JSOGDEOQBIUNTR-UHFFFAOYSA-N 0.000 description 1
- WYGWHHGCAGTUCH-UHFFFAOYSA-N 2-[(2-cyano-4-methylpentan-2-yl)diazenyl]-2,4-dimethylpentanenitrile Chemical compound CC(C)CC(C)(C#N)N=NC(C)(C#N)CC(C)C WYGWHHGCAGTUCH-UHFFFAOYSA-N 0.000 description 1
- LVLXAIROXMLXJY-UHFFFAOYSA-N 2-diazonio-1,2-diphenylethenolate Chemical compound C=1C=CC=CC=1C([O-])=C([N+]#N)C1=CC=CC=C1 LVLXAIROXMLXJY-UHFFFAOYSA-N 0.000 description 1
- DYCIOVIEGYZBJP-UHFFFAOYSA-N 2-diazonio-1-ethoxy-2-phenylethenolate Chemical compound CCOC(=O)C(=[N+]=[N-])C1=CC=CC=C1 DYCIOVIEGYZBJP-UHFFFAOYSA-N 0.000 description 1
- UNSBFCQQGGWONQ-UHFFFAOYSA-N 2-diazonio-2-diethoxyphosphoryl-1-ethoxyethenolate Chemical compound CCOC(=O)C(=[N+]=[N-])P(=O)(OCC)OCC UNSBFCQQGGWONQ-UHFFFAOYSA-N 0.000 description 1
- OOHAJTLMZFITEZ-UHFFFAOYSA-N 2-diazonio-3-oxo-1,3-diphenylprop-1-en-1-olate Chemical compound C=1C=CC=CC=1C(/[O-])=C(\[N+]#N)C(=O)C1=CC=CC=C1 OOHAJTLMZFITEZ-UHFFFAOYSA-N 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- JRBJSXQPQWSCCF-UHFFFAOYSA-N 3,3'-Dimethoxybenzidine Chemical compound C1=C(N)C(OC)=CC(C=2C=C(OC)C(N)=CC=2)=C1 JRBJSXQPQWSCCF-UHFFFAOYSA-N 0.000 description 1
- MJFITTKTVWJPNO-UHFFFAOYSA-N 3h-dithiole;nickel Chemical class [Ni].C1SSC=C1 MJFITTKTVWJPNO-UHFFFAOYSA-N 0.000 description 1
- ZTIUZVPQAUZNLG-UHFFFAOYSA-N 5,8,8-trimethylbicyclo[3.2.1]octane-2,4-dione Chemical compound O=C1CC(=O)C2(C)CCC1C2(C)C ZTIUZVPQAUZNLG-UHFFFAOYSA-N 0.000 description 1
- YWFPGFJLYRKYJZ-UHFFFAOYSA-N 9,9-bis(4-hydroxyphenyl)fluorene Chemical compound C1=CC(O)=CC=C1C1(C=2C=CC(O)=CC=2)C2=CC=CC=C2C2=CC=CC=C21 YWFPGFJLYRKYJZ-UHFFFAOYSA-N 0.000 description 1
- RSWGJHLUYNHPMX-UHFFFAOYSA-N Abietic-Saeure Natural products C12CCC(C(C)C)=CC2=CCC2C1(C)CCCC2(C)C(O)=O RSWGJHLUYNHPMX-UHFFFAOYSA-N 0.000 description 1
- NIXOWILDQLNWCW-UHFFFAOYSA-M Acrylate Chemical compound [O-]C(=O)C=C NIXOWILDQLNWCW-UHFFFAOYSA-M 0.000 description 1
- NLHHRLWOUZZQLW-UHFFFAOYSA-N Acrylonitrile Chemical compound C=CC#N NLHHRLWOUZZQLW-UHFFFAOYSA-N 0.000 description 1
- JBRZTFJDHDCESZ-UHFFFAOYSA-N AsGa Chemical compound [As]#[Ga] JBRZTFJDHDCESZ-UHFFFAOYSA-N 0.000 description 1
- WPYMKLBDIGXBTP-UHFFFAOYSA-N Benzoic acid Natural products OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- XZMCDFZZKTWFGF-UHFFFAOYSA-N Cyanamide Chemical compound NC#N XZMCDFZZKTWFGF-UHFFFAOYSA-N 0.000 description 1
- 229920003270 Cymel® Polymers 0.000 description 1
- GKKZMYDNDDMXSE-UHFFFAOYSA-N Ethyl 3-oxo-3-phenylpropanoate Chemical compound CCOC(=O)CC(=O)C1=CC=CC=C1 GKKZMYDNDDMXSE-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 229910005540 GaP Inorganic materials 0.000 description 1
- 229910052688 Gadolinium Inorganic materials 0.000 description 1
- GYHNNYVSQQEPJS-UHFFFAOYSA-N Gallium Chemical compound [Ga] GYHNNYVSQQEPJS-UHFFFAOYSA-N 0.000 description 1
- 229910001218 Gallium arsenide Inorganic materials 0.000 description 1
- 229920005692 JONCRYL® Polymers 0.000 description 1
- 238000005684 Liebig rearrangement reaction Methods 0.000 description 1
- 241001465754 Metazoa Species 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 229920001890 Novodur Polymers 0.000 description 1
- 229930182556 Polyacetal Natural products 0.000 description 1
- 239000004698 Polyethylene Substances 0.000 description 1
- 239000004734 Polyphenylene sulfide Substances 0.000 description 1
- 239000004743 Polypropylene Substances 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 239000004820 Pressure-sensitive adhesive Substances 0.000 description 1
- 229920003265 Resimene® Polymers 0.000 description 1
- KHPCPRHQVVSZAH-HUOMCSJISA-N Rosin Natural products O(C/C=C/c1ccccc1)[C@H]1[C@H](O)[C@@H](O)[C@@H](O)[C@@H](CO)O1 KHPCPRHQVVSZAH-HUOMCSJISA-N 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000004809 Teflon Substances 0.000 description 1
- 229920006362 Teflon® Polymers 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 229920006311 Urethane elastomer Polymers 0.000 description 1
- XTXRWKRVRITETP-UHFFFAOYSA-N Vinyl acetate Chemical compound CC(=O)OC=C XTXRWKRVRITETP-UHFFFAOYSA-N 0.000 description 1
- BZHJMEDXRYGGRV-UHFFFAOYSA-N Vinyl chloride Chemical compound ClC=C BZHJMEDXRYGGRV-UHFFFAOYSA-N 0.000 description 1
- LWVVNNZRDBXOQL-AATRIKPKSA-O [(e)-3-(dimethylamino)prop-2-enyl]-dimethylazanium Chemical compound CN(C)\C=C\C[NH+](C)C LWVVNNZRDBXOQL-AATRIKPKSA-O 0.000 description 1
- WBAXTYHOYZJLAV-UHFFFAOYSA-N [(e)-diazo(diethoxyphosphoryl)methyl]benzene Chemical compound CCOP(=O)(OCC)C(=[N+]=[N-])C1=CC=CC=C1 WBAXTYHOYZJLAV-UHFFFAOYSA-N 0.000 description 1
- BFNZXDWMJHFDHY-UHFFFAOYSA-N [(e)-diazo(diphenylphosphoryl)methyl]benzene Chemical compound C=1C=CC=CC=1P(=O)(C=1C=CC=CC=1)C(=[N+]=[N-])C1=CC=CC=C1 BFNZXDWMJHFDHY-UHFFFAOYSA-N 0.000 description 1
- OMPDKLBVTGFBFW-UHFFFAOYSA-N [N+](=[N-])=C1C(=CC=CC1=O)C(C(=O)O)C Chemical compound [N+](=[N-])=C1C(=CC=CC1=O)C(C(=O)O)C OMPDKLBVTGFBFW-UHFFFAOYSA-N 0.000 description 1
- 239000011358 absorbing material Substances 0.000 description 1
- 238000000862 absorption spectrum Methods 0.000 description 1
- LZBCVRCTAYKYHR-UHFFFAOYSA-N acetic acid;chloroethene Chemical compound ClC=C.CC(O)=O LZBCVRCTAYKYHR-UHFFFAOYSA-N 0.000 description 1
- 125000002777 acetyl group Chemical class [H]C([H])([H])C(*)=O 0.000 description 1
- 150000001252 acrylic acid derivatives Chemical class 0.000 description 1
- 229920000800 acrylic rubber Polymers 0.000 description 1
- 239000002318 adhesion promoter Substances 0.000 description 1
- 238000011256 aggressive treatment Methods 0.000 description 1
- 125000003342 alkenyl group Chemical group 0.000 description 1
- LVQULNGDVIKLPK-UHFFFAOYSA-N aluminium antimonide Chemical compound [Sb]#[Al] LVQULNGDVIKLPK-UHFFFAOYSA-N 0.000 description 1
- 239000001000 anthraquinone dye Substances 0.000 description 1
- CZJCMXPZSYNVLP-UHFFFAOYSA-N antimony zinc Chemical compound [Zn].[Sb] CZJCMXPZSYNVLP-UHFFFAOYSA-N 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000002216 antistatic agent Substances 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000003125 aqueous solvent Substances 0.000 description 1
- 238000003491 array Methods 0.000 description 1
- 229910052785 arsenic Inorganic materials 0.000 description 1
- RQNWIZPPADIBDY-UHFFFAOYSA-N arsenic atom Chemical compound [As] RQNWIZPPADIBDY-UHFFFAOYSA-N 0.000 description 1
- 150000005840 aryl radicals Chemical class 0.000 description 1
- 230000000712 assembly Effects 0.000 description 1
- 238000000429 assembly Methods 0.000 description 1
- 239000012298 atmosphere Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- 150000001540 azides Chemical class 0.000 description 1
- 125000000852 azido group Chemical group *N=[N+]=[N-] 0.000 description 1
- 150000001558 benzoic acid derivatives Chemical class 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 150000008366 benzophenones Chemical class 0.000 description 1
- 230000005540 biological transmission Effects 0.000 description 1
- MTAZNLWOLGHBHU-UHFFFAOYSA-N butadiene-styrene rubber Chemical compound C=CC=C.C=CC1=CC=CC=C1 MTAZNLWOLGHBHU-UHFFFAOYSA-N 0.000 description 1
- QHIWVLPBUQWDMQ-UHFFFAOYSA-N butyl prop-2-enoate;methyl 2-methylprop-2-enoate;prop-2-enoic acid Chemical compound OC(=O)C=C.COC(=O)C(C)=C.CCCCOC(=O)C=C QHIWVLPBUQWDMQ-UHFFFAOYSA-N 0.000 description 1
- 229920005549 butyl rubber Polymers 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- 238000003490 calendering Methods 0.000 description 1
- 239000000298 carbocyanine Substances 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 125000003262 carboxylic acid ester group Chemical group [H]C([H])([*:2])OC(=O)C([H])([H])[*:1] 0.000 description 1
- 125000002843 carboxylic acid group Chemical group 0.000 description 1
- 229920002301 cellulose acetate Polymers 0.000 description 1
- 239000013626 chemical specie Substances 0.000 description 1
- 150000001844 chromium Chemical class 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 239000007859 condensation product Substances 0.000 description 1
- 229920001940 conductive polymer Polymers 0.000 description 1
- 150000001879 copper Chemical class 0.000 description 1
- 239000004148 curcumin Substances 0.000 description 1
- 229940109262 curcumin Drugs 0.000 description 1
- 235000012754 curcumin Nutrition 0.000 description 1
- 238000007766 curtain coating Methods 0.000 description 1
- 125000000392 cycloalkenyl group Chemical group 0.000 description 1
- 125000000753 cycloalkyl group Chemical group 0.000 description 1
- 238000000151 deposition Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 238000013461 design Methods 0.000 description 1
- 238000002059 diagnostic imaging Methods 0.000 description 1
- 229910003460 diamond Inorganic materials 0.000 description 1
- 239000010432 diamond Substances 0.000 description 1
- 238000007607 die coating method Methods 0.000 description 1
- VFLDPWHFBUODDF-UHFFFAOYSA-N diferuloylmethane Natural products C1=C(O)C(OC)=CC(C=CC(=O)CC(=O)C=CC=2C=C(OC)C(O)=CC=2)=C1 VFLDPWHFBUODDF-UHFFFAOYSA-N 0.000 description 1
- 238000009792 diffusion process Methods 0.000 description 1
- BADXJIPKFRBFOT-UHFFFAOYSA-N dimedone Chemical compound CC1(C)CC(=O)CC(=O)C1 BADXJIPKFRBFOT-UHFFFAOYSA-N 0.000 description 1
- KREDQIDLGFBDMQ-UHFFFAOYSA-N ditert-butyl 3-oxopentanedioate Chemical compound CC(C)(C)OC(=O)CC(=O)CC(=O)OC(C)(C)C KREDQIDLGFBDMQ-UHFFFAOYSA-N 0.000 description 1
- CLPHAYNBNTVRDI-UHFFFAOYSA-N ditert-butyl propanedioate Chemical compound CC(C)(C)OC(=O)CC(=O)OC(C)(C)C CLPHAYNBNTVRDI-UHFFFAOYSA-N 0.000 description 1
- 238000007606 doctor blade method Methods 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000007772 electroless plating Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005538 encapsulation Methods 0.000 description 1
- 125000003700 epoxy group Chemical group 0.000 description 1
- 239000003822 epoxy resin Substances 0.000 description 1
- IDGUHHHQCWSQLU-UHFFFAOYSA-N ethanol;hydrate Chemical compound O.CCO IDGUHHHQCWSQLU-UHFFFAOYSA-N 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000002657 fibrous material Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 239000007850 fluorescent dye Substances 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 229920002313 fluoropolymer Polymers 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 125000002485 formyl group Chemical group [H]C(*)=O 0.000 description 1
- UIWYJDYFSGRHKR-UHFFFAOYSA-N gadolinium atom Chemical compound [Gd] UIWYJDYFSGRHKR-UHFFFAOYSA-N 0.000 description 1
- 229910052733 gallium Inorganic materials 0.000 description 1
- VTGARNNDLOTBET-UHFFFAOYSA-N gallium antimonide Chemical compound [Sb]#[Ga] VTGARNNDLOTBET-UHFFFAOYSA-N 0.000 description 1
- HZXMRANICFIONG-UHFFFAOYSA-N gallium phosphide Chemical compound [Ga]#P HZXMRANICFIONG-UHFFFAOYSA-N 0.000 description 1
- 239000001056 green pigment Substances 0.000 description 1
- 229910052735 hafnium Inorganic materials 0.000 description 1
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 1
- 125000001188 haloalkyl group Chemical group 0.000 description 1
- 125000005843 halogen group Chemical group 0.000 description 1
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical compound C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 description 1
- 239000012456 homogeneous solution Substances 0.000 description 1
- 229920001519 homopolymer Polymers 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 125000004356 hydroxy functional group Chemical group O* 0.000 description 1
- 125000002768 hydroxyalkyl group Chemical group 0.000 description 1
- 229920002681 hypalon Polymers 0.000 description 1
- 238000010348 incorporation Methods 0.000 description 1
- AMGQUBHHOARCQH-UHFFFAOYSA-N indium;oxotin Chemical compound [In].[Sn]=O AMGQUBHHOARCQH-UHFFFAOYSA-N 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 239000001023 inorganic pigment Substances 0.000 description 1
- 239000012948 isocyanate Substances 0.000 description 1
- 150000002513 isocyanates Chemical class 0.000 description 1
- 229920003049 isoprene rubber Polymers 0.000 description 1
- 125000000468 ketone group Chemical group 0.000 description 1
- 239000003041 laboratory chemical Substances 0.000 description 1
- 229910052746 lanthanum Inorganic materials 0.000 description 1
- FZLIPJUXYLNCLC-UHFFFAOYSA-N lanthanum atom Chemical compound [La] FZLIPJUXYLNCLC-UHFFFAOYSA-N 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 230000031700 light absorption Effects 0.000 description 1
- 239000004611 light stabiliser Substances 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- 230000000873 masking effect Effects 0.000 description 1
- JDSHMPZPIAZGSV-UHFFFAOYSA-N melamine Chemical compound NC1=NC(N)=NC(N)=N1 JDSHMPZPIAZGSV-UHFFFAOYSA-N 0.000 description 1
- DZVCFNFOPIZQKX-LTHRDKTGSA-M merocyanine Chemical compound [Na+].O=C1N(CCCC)C(=O)N(CCCC)C(=O)C1=C\C=C\C=C/1N(CCCS([O-])(=O)=O)C2=CC=CC=C2O\1 DZVCFNFOPIZQKX-LTHRDKTGSA-M 0.000 description 1
- 150000001247 metal acetylides Chemical class 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229920003052 natural elastomer Polymers 0.000 description 1
- 229920001194 natural rubber Polymers 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 150000004767 nitrides Chemical class 0.000 description 1
- 125000002560 nitrile group Chemical group 0.000 description 1
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 description 1
- 125000004971 nitroalkyl group Chemical group 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 1
- 239000013307 optical fiber Substances 0.000 description 1
- 238000012634 optical imaging Methods 0.000 description 1
- 239000012860 organic pigment Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 238000013021 overheating Methods 0.000 description 1
- 150000004866 oxadiazoles Chemical class 0.000 description 1
- AHHWIHXENZJRFG-UHFFFAOYSA-N oxetane Chemical compound C1COC1 AHHWIHXENZJRFG-UHFFFAOYSA-N 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- MPQXHAGKBWFSNV-UHFFFAOYSA-N oxidophosphanium Chemical group [PH3]=O MPQXHAGKBWFSNV-UHFFFAOYSA-N 0.000 description 1
- TWNQGVIAIRXVLR-UHFFFAOYSA-N oxo(oxoalumanyloxy)alumane Chemical compound O=[Al]O[Al]=O TWNQGVIAIRXVLR-UHFFFAOYSA-N 0.000 description 1
- 125000005740 oxycarbonyl group Chemical group [*:1]OC([*:2])=O 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 238000004806 packaging method and process Methods 0.000 description 1
- 239000011087 paperboard Substances 0.000 description 1
- VLTRZXGMWDSKGL-UHFFFAOYSA-M perchlorate Inorganic materials [O-]Cl(=O)(=O)=O VLTRZXGMWDSKGL-UHFFFAOYSA-M 0.000 description 1
- 125000005010 perfluoroalkyl group Chemical group 0.000 description 1
- JGTNAGYHADQMCM-UHFFFAOYSA-N perfluorobutanesulfonic acid Chemical compound OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F JGTNAGYHADQMCM-UHFFFAOYSA-N 0.000 description 1
- 125000005007 perfluorooctyl group Chemical group FC(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)* 0.000 description 1
- 239000000546 pharmaceutical excipient Substances 0.000 description 1
- ACVYVLVWPXVTIT-UHFFFAOYSA-M phosphinate Chemical group [O-][PH2]=O ACVYVLVWPXVTIT-UHFFFAOYSA-M 0.000 description 1
- UEZVMMHDMIWARA-UHFFFAOYSA-M phosphonate Chemical group [O-]P(=O)=O UEZVMMHDMIWARA-UHFFFAOYSA-M 0.000 description 1
- 239000011941 photocatalyst Substances 0.000 description 1
- 239000002985 plastic film Substances 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 229920001084 poly(chloroprene) Polymers 0.000 description 1
- 229920002285 poly(styrene-co-acrylonitrile) Polymers 0.000 description 1
- 229920002492 poly(sulfone) Polymers 0.000 description 1
- 229920006122 polyamide resin Polymers 0.000 description 1
- 229920005668 polycarbonate resin Polymers 0.000 description 1
- 239000004431 polycarbonate resin Substances 0.000 description 1
- 229920005547 polycyclic aromatic hydrocarbon Polymers 0.000 description 1
- 125000005575 polycyclic aromatic hydrocarbon group Chemical group 0.000 description 1
- 229920001225 polyester resin Polymers 0.000 description 1
- 239000004645 polyester resin Substances 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 229920001721 polyimide Polymers 0.000 description 1
- 239000009719 polyimide resin Substances 0.000 description 1
- 229920001855 polyketal Polymers 0.000 description 1
- 239000002685 polymerization catalyst Substances 0.000 description 1
- 229920000098 polyolefin Polymers 0.000 description 1
- 229920005672 polyolefin resin Polymers 0.000 description 1
- 229920006324 polyoxymethylene Polymers 0.000 description 1
- 229920006380 polyphenylene oxide Polymers 0.000 description 1
- 229920000069 polyphenylene sulfide Polymers 0.000 description 1
- 229920001155 polypropylene Polymers 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 229920005749 polyurethane resin Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 229920001004 polyvinyl nitrate Chemical group 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- XAEFZNCEHLXOMS-UHFFFAOYSA-M potassium benzoate Chemical compound [K+].[O-]C(=O)C1=CC=CC=C1 XAEFZNCEHLXOMS-UHFFFAOYSA-M 0.000 description 1
- LRIBRUAEJSZTFO-UHFFFAOYSA-M potassium;1,2,2,3,3,4,5,5,6,6-decafluoro-4-(1,1,2,2,2-pentafluoroethyl)cyclohexane-1-sulfonate Chemical compound [K+].[O-]S(=O)(=O)C1(F)C(F)(F)C(F)(F)C(F)(C(F)(F)C(F)(F)F)C(F)(F)C1(F)F LRIBRUAEJSZTFO-UHFFFAOYSA-M 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 239000003755 preservative agent Substances 0.000 description 1
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 1
- JEXVQSWXXUJEMA-UHFFFAOYSA-N pyrazol-3-one Chemical compound O=C1C=CN=N1 JEXVQSWXXUJEMA-UHFFFAOYSA-N 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 238000002390 rotary evaporation Methods 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 229910052706 scandium Inorganic materials 0.000 description 1
- SIXSYDAISGFNSX-UHFFFAOYSA-N scandium atom Chemical compound [Sc] SIXSYDAISGFNSX-UHFFFAOYSA-N 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 230000035939 shock Effects 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- 229920005573 silicon-containing polymer Polymers 0.000 description 1
- 229920002050 silicone resin Polymers 0.000 description 1
- 238000004528 spin coating Methods 0.000 description 1
- 229910001220 stainless steel Inorganic materials 0.000 description 1
- 239000010935 stainless steel Substances 0.000 description 1
- 229920003048 styrene butadiene rubber Polymers 0.000 description 1
- 238000000859 sublimation Methods 0.000 description 1
- 230000008022 sublimation Effects 0.000 description 1
- 125000004964 sulfoalkyl group Chemical group 0.000 description 1
- 125000000472 sulfonyl group Chemical group *S(*)(=O)=O 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 125000004434 sulfur atom Chemical group 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 238000003786 synthesis reaction Methods 0.000 description 1
- 239000000979 synthetic dye Substances 0.000 description 1
- 229920003051 synthetic elastomer Polymers 0.000 description 1
- 239000005061 synthetic rubber Substances 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 238000010345 tape casting Methods 0.000 description 1
- 238000012360 testing method Methods 0.000 description 1
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical compound FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 description 1
- 229910052716 thallium Inorganic materials 0.000 description 1
- BKVIYDNLLOSFOA-UHFFFAOYSA-N thallium Chemical compound [Tl] BKVIYDNLLOSFOA-UHFFFAOYSA-N 0.000 description 1
- 229920005992 thermoplastic resin Polymers 0.000 description 1
- 229920001187 thermosetting polymer Polymers 0.000 description 1
- 150000003568 thioethers Chemical class 0.000 description 1
- ANRHNWWPFJCPAZ-UHFFFAOYSA-M thionine Chemical compound [Cl-].C1=CC(N)=CC2=[S+]C3=CC(N)=CC=C3N=C21 ANRHNWWPFJCPAZ-UHFFFAOYSA-M 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- KHPCPRHQVVSZAH-UHFFFAOYSA-N trans-cinnamyl beta-D-glucopyranoside Natural products OC1C(O)C(O)C(CO)OC1OCC=CC1=CC=CC=C1 KHPCPRHQVVSZAH-UHFFFAOYSA-N 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
- 238000007740 vapor deposition Methods 0.000 description 1
- 238000009834 vaporization Methods 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000004034 viscosity adjusting agent Substances 0.000 description 1
- 239000002699 waste material Substances 0.000 description 1
- 238000004804 winding Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
- 229910052727 yttrium Inorganic materials 0.000 description 1
- VWQVUPCCIRVNHF-UHFFFAOYSA-N yttrium atom Chemical compound [Y] VWQVUPCCIRVNHF-UHFFFAOYSA-N 0.000 description 1
- 239000011592 zinc chloride Substances 0.000 description 1
- 235000005074 zinc chloride Nutrition 0.000 description 1
Classifications
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41M—PRINTING, DUPLICATING, MARKING, OR COPYING PROCESSES; COLOUR PRINTING
- B41M5/00—Duplicating or marking methods; Sheet materials for use therein
- B41M5/26—Thermography ; Marking by high energetic means, e.g. laser otherwise than by burning, and characterised by the material used
- B41M5/382—Contact thermal transfer or sublimation processes
- B41M5/392—Additives, other than colour forming substances, dyes or pigments, e.g. sensitisers, transfer promoting agents
-
- B—PERFORMING OPERATIONS; TRANSPORTING
- B41—PRINTING; LINING MACHINES; TYPEWRITERS; STAMPS
- B41C—PROCESSES FOR THE MANUFACTURE OR REPRODUCTION OF PRINTING SURFACES
- B41C1/00—Forme preparation
- B41C1/10—Forme preparation for lithographic printing; Master sheets for transferring a lithographic image to the forme
- B41C1/1091—Forme preparation for lithographic printing; Master sheets for transferring a lithographic image to the forme by physical transfer from a donor sheet having an uniform coating of lithographic material using thermal means as provided by a thermal head or a laser; by mechanical pressure, e.g. from a typewriter by electrical recording ribbon therefor
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C245/00—Compounds containing chains of at least two nitrogen atoms with at least one nitrogen-to-nitrogen multiple bond
- C07C245/12—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom
- C07C245/14—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom having diazo groups bound to acyclic carbon atoms of a carbon skeleton
- C07C245/18—Diazo compounds, i.e. compounds having the free valencies of >N2 groups attached to the same carbon atom having diazo groups bound to acyclic carbon atoms of a carbon skeleton the carbon skeleton being further substituted by carboxyl groups
-
- G—PHYSICS
- G03—PHOTOGRAPHY; CINEMATOGRAPHY; ANALOGOUS TECHNIQUES USING WAVES OTHER THAN OPTICAL WAVES; ELECTROGRAPHY; HOLOGRAPHY
- G03F—PHOTOMECHANICAL PRODUCTION OF TEXTURED OR PATTERNED SURFACES, e.g. FOR PRINTING, FOR PROCESSING OF SEMICONDUCTOR DEVICES; MATERIALS THEREFOR; ORIGINALS THEREFOR; APPARATUS SPECIALLY ADAPTED THEREFOR
- G03F3/00—Colour separation; Correction of tonal value
- G03F3/10—Checking the colour or tonal value of separation negatives or positives
- G03F3/108—Checking the colour or tonal value of separation negatives or positives using a non-impact printing method, e.g. ink jet, using duplicating or marking methods covered by B41M5/00, e.g. by ablation or by thermographic means
Landscapes
- Physics & Mathematics (AREA)
- Organic Chemistry (AREA)
- Chemical & Material Sciences (AREA)
- Optics & Photonics (AREA)
- Engineering & Computer Science (AREA)
- Manufacturing & Machinery (AREA)
- Mechanical Engineering (AREA)
- General Physics & Mathematics (AREA)
- Thermal Transfer Or Thermal Recording In General (AREA)
- Photosensitive Polymer And Photoresist Processing (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
- Optical Record Carriers And Manufacture Thereof (AREA)
- Non-Silver Salt Photosensitive Materials And Non-Silver Salt Photography (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US08/627,160 US5691098A (en) | 1996-04-03 | 1996-04-03 | Laser-Induced mass transfer imaging materials utilizing diazo compounds |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69707951D1 DE69707951D1 (de) | 2001-12-13 |
| DE69707951T2 true DE69707951T2 (de) | 2002-07-25 |
Family
ID=24513455
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69707951T Expired - Fee Related DE69707951T2 (de) | 1996-04-03 | 1997-03-26 | Diazoverbindungen für Laser-induzierte massenübertragende Bildaufzeichnungsmaterialien |
Country Status (4)
| Country | Link |
|---|---|
| US (2) | US5691098A (https=) |
| EP (1) | EP0799716B1 (https=) |
| JP (1) | JPH1036331A (https=) |
| DE (1) | DE69707951T2 (https=) |
Families Citing this family (66)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US7109968B2 (en) | 1995-07-20 | 2006-09-19 | E Ink Corporation | Non-spherical cavity electrophoretic displays and methods and materials for making the same |
| US6515649B1 (en) | 1995-07-20 | 2003-02-04 | E Ink Corporation | Suspended particle displays and materials for making the same |
| US7071913B2 (en) | 1995-07-20 | 2006-07-04 | E Ink Corporation | Retroreflective electrophoretic displays and materials for making the same |
| US7106296B1 (en) | 1995-07-20 | 2006-09-12 | E Ink Corporation | Electronic book with multiple page displays |
| US6262706B1 (en) | 1995-07-20 | 2001-07-17 | E Ink Corporation | Retroreflective electrophoretic displays and materials for making the same |
| US6727881B1 (en) | 1995-07-20 | 2004-04-27 | E Ink Corporation | Encapsulated electrophoretic displays and methods and materials for making the same |
| US6120839A (en) | 1995-07-20 | 2000-09-19 | E Ink Corporation | Electro-osmotic displays and materials for making the same |
| US5747217A (en) * | 1996-04-03 | 1998-05-05 | Minnesota Mining And Manufacturing Company | Laser-induced mass transfer imaging materials and methods utilizing colorless sublimable compounds |
| US6037085A (en) * | 1996-06-19 | 2000-03-14 | Printing Development Inc. | Photoresists and method for making printing plates |
| US5908731A (en) * | 1996-07-04 | 1999-06-01 | Agfa-Gevaert, N.V. | Heat sensitive imaging element and a method for producing lithographic plates therewith |
| US5945517A (en) * | 1996-07-24 | 1999-08-31 | Tokyo Ohka Kogyo Co., Ltd. | Chemical-sensitization photoresist composition |
| US6067185A (en) | 1997-08-28 | 2000-05-23 | E Ink Corporation | Process for creating an encapsulated electrophoretic display |
| US7242513B2 (en) | 1997-08-28 | 2007-07-10 | E Ink Corporation | Encapsulated electrophoretic displays having a monolayer of capsules and materials and methods for making the same |
| US6300932B1 (en) | 1997-08-28 | 2001-10-09 | E Ink Corporation | Electrophoretic displays with luminescent particles and materials for making the same |
| US7247379B2 (en) | 1997-08-28 | 2007-07-24 | E Ink Corporation | Electrophoretic particles, and processes for the production thereof |
| US7002728B2 (en) | 1997-08-28 | 2006-02-21 | E Ink Corporation | Electrophoretic particles, and processes for the production thereof |
| US6839158B2 (en) | 1997-08-28 | 2005-01-04 | E Ink Corporation | Encapsulated electrophoretic displays having a monolayer of capsules and materials and methods for making the same |
| CA2320788A1 (en) | 1998-03-18 | 1999-09-23 | Joseph M. Jacobson | Electrophoretic displays and systems for addressing such displays |
| AU3552699A (en) | 1998-04-10 | 1999-11-01 | E-Ink Corporation | Electronic displays using organic-based field effect transistors |
| AU3987299A (en) | 1998-05-12 | 1999-11-29 | E-Ink Corporation | Microencapsulated electrophoretic electrostatically-addressed media for drawing device applications |
| USD485294S1 (en) | 1998-07-22 | 2004-01-13 | E Ink Corporation | Electrode structure for an electronic display |
| WO2000020923A1 (en) | 1998-10-07 | 2000-04-13 | E Ink Corporation | Illumination system for nonemissive electronic displays |
| AU6293499A (en) | 1998-10-07 | 2000-04-26 | E-Ink Corporation | Capsules for electrophoretic displays and methods for making the same |
| DE60003281T2 (de) | 1999-01-15 | 2004-05-06 | 3M Innovative Properties Co., Saint Paul | Thermisches Übertragungsverfahren. |
| US6168903B1 (en) * | 1999-01-21 | 2001-01-02 | Presstek, Inc. | Lithographic imaging with reduced power requirements |
| GB9904326D0 (en) * | 1999-02-26 | 1999-04-21 | Ici Plc | Improvements in or relating to mass transfer printing |
| WO2000059625A1 (en) | 1999-04-06 | 2000-10-12 | E Ink Corporation | Methods for producing droplets for use in capsule-based electrophoretic displays |
| US6498114B1 (en) | 1999-04-09 | 2002-12-24 | E Ink Corporation | Method for forming a patterned semiconductor film |
| US6842657B1 (en) | 1999-04-09 | 2005-01-11 | E Ink Corporation | Reactive formation of dielectric layers and protection of organic layers in organic semiconductor device fabrication |
| US6693620B1 (en) | 1999-05-03 | 2004-02-17 | E Ink Corporation | Threshold addressing of electrophoretic displays |
| US8115729B2 (en) | 1999-05-03 | 2012-02-14 | E Ink Corporation | Electrophoretic display element with filler particles |
| US7038655B2 (en) | 1999-05-03 | 2006-05-02 | E Ink Corporation | Electrophoretic ink composed of particles with field dependent mobilities |
| GB9917676D0 (en) * | 1999-07-09 | 1999-09-29 | Ici Plc | Improvements in or relating to mass transfer printing |
| DE19937478B4 (de) * | 1999-08-07 | 2004-08-19 | Man Roland Druckmaschinen Ag | Thermotransferfolie zur laserinduzierten Beschichtung einer Metalloberfläche |
| JP4590663B2 (ja) * | 1999-10-29 | 2010-12-01 | セイコーエプソン株式会社 | カラーフィルタの製造方法 |
| US6228555B1 (en) | 1999-12-28 | 2001-05-08 | 3M Innovative Properties Company | Thermal mass transfer donor element |
| US6284425B1 (en) | 1999-12-28 | 2001-09-04 | 3M Innovative Properties | Thermal transfer donor element having a heat management underlayer |
| AU6147201A (en) | 2000-05-16 | 2001-11-26 | Du Pont | Aqueous dispersions for color imaging |
| US6855384B1 (en) | 2000-09-15 | 2005-02-15 | 3M Innovative Properties Company | Selective thermal transfer of light emitting polymer blends |
| US6358664B1 (en) | 2000-09-15 | 2002-03-19 | 3M Innovative Properties Company | Electronically active primer layers for thermal patterning of materials for electronic devices |
| US20100261159A1 (en) | 2000-10-10 | 2010-10-14 | Robert Hess | Apparatus for assay, synthesis and storage, and methods of manufacture, use, and manipulation thereof |
| US6716629B2 (en) * | 2000-10-10 | 2004-04-06 | Biotrove, Inc. | Apparatus for assay, synthesis and storage, and methods of manufacture, use, and manipulation thereof |
| DE10063819B4 (de) * | 2000-12-21 | 2006-02-02 | Man Roland Druckmaschinen Ag | Maskenerstellung zur Herstellung einer Druckform |
| JP2002248874A (ja) * | 2001-02-27 | 2002-09-03 | Konica Corp | レーザー熱転写用インクシート及びその製造方法並びに画像記録方法 |
| US7230750B2 (en) | 2001-05-15 | 2007-06-12 | E Ink Corporation | Electrophoretic media and processes for the production thereof |
| US20050156340A1 (en) | 2004-01-20 | 2005-07-21 | E Ink Corporation | Preparation of capsules |
| US20030124265A1 (en) | 2001-12-04 | 2003-07-03 | 3M Innovative Properties Company | Method and materials for transferring a material onto a plasma treated surface according to a pattern |
| AU2002357842A1 (en) | 2001-12-13 | 2003-06-23 | E Ink Corporation | Electrophoretic electronic displays with films having a low index of refraction |
| US6913794B2 (en) * | 2002-01-14 | 2005-07-05 | Coherent, Inc. | Diode-laser curing of liquid epoxide encapsulants |
| US20040004433A1 (en) * | 2002-06-26 | 2004-01-08 | 3M Innovative Properties Company | Buffer layers for organic electroluminescent devices and methods of manufacture and use |
| US7312916B2 (en) | 2002-08-07 | 2007-12-25 | E Ink Corporation | Electrophoretic media containing specularly reflective particles |
| JP4426526B2 (ja) | 2003-07-17 | 2010-03-03 | ハネウエル・インターナシヨナル・インコーポレーテツド | 最新式のマイクロエレクトロニクス用途およびデバイス用の平坦化膜およびそれらの製造方法 |
| JP2005064143A (ja) * | 2003-08-08 | 2005-03-10 | Seiko Epson Corp | レジストパターンの形成方法、配線パターンの形成方法、半導体装置の製造方法、電気光学装置及び電子機器 |
| US7275972B2 (en) * | 2003-08-22 | 2007-10-02 | 3M Innovative Properties Company | Method of making an electroluminescent device having a patterned emitter layer and non-patterned emitter layer |
| US7354965B2 (en) * | 2003-09-18 | 2008-04-08 | Fujifilm Corporation | Azo compound, colorant-containing curable composition, and color filter and method of producing the same |
| US7648741B2 (en) * | 2005-05-17 | 2010-01-19 | Eastman Kodak Company | Forming a patterned metal layer using laser induced thermal transfer method |
| US7670450B2 (en) * | 2006-07-31 | 2010-03-02 | 3M Innovative Properties Company | Patterning and treatment methods for organic light emitting diode devices |
| US8273426B1 (en) * | 2007-01-10 | 2012-09-25 | Fritz Industries, Inc | Encapsulated compositions |
| US7927454B2 (en) * | 2007-07-17 | 2011-04-19 | Samsung Mobile Display Co., Ltd. | Method of patterning a substrate |
| JP5387141B2 (ja) * | 2009-05-28 | 2014-01-15 | Ｊｓｒ株式会社 | 感放射線性樹脂組成物およびそれに用いる重合体 |
| KR20110059471A (ko) * | 2009-11-27 | 2011-06-02 | 삼성전자주식회사 | 포토레지스트 조성물, 이를 이용한 패턴의 형성방법 및 반도체 장치의 제조방법 |
| KR102307014B1 (ko) * | 2013-10-30 | 2021-10-01 | 네덜란제 오르가니자티에 포오르 토에게파스트-나투우르베텐샤펠리즈크 온데르조에크 테엔오 | 전기 회로 패턴을 포함하는 기판, 그를 제공하기 위한 방법 및 시스템 |
| US11300773B2 (en) * | 2014-09-29 | 2022-04-12 | Agilent Technologies, Inc. | Mid-infrared scanning system |
| CN106565535B (zh) * | 2016-11-15 | 2018-07-17 | 山西师范大学 | 2-重氮-1-芳基酮类化合物的制备方法 |
| CN109865485B (zh) * | 2019-03-06 | 2021-05-11 | 广东工业大学 | 一种微小物体的定向移动方法 |
| TWI731774B (zh) * | 2020-08-18 | 2021-06-21 | 國立清華大學 | 聚醯亞胺高分子、聚醯亞胺混合物及其製備之聚醯亞胺薄膜 |
Family Cites Families (57)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| BE540601A (https=) * | 1950-12-06 | |||
| GB842655A (en) * | 1957-05-16 | 1960-07-27 | Caribonum Ltd | Improvements in or relating to colouring materials |
| US3751257A (en) * | 1971-04-16 | 1973-08-07 | Minnesota Mining & Mfg | Polyamide-diazo resin composition |
| US3790556A (en) * | 1971-04-28 | 1974-02-05 | Scott Paper Co | Organic solvent soluble diazonium compound formed from anionic sulfate or sulfonate surfactants |
| US4039521A (en) * | 1973-04-23 | 1977-08-02 | Minnesota Mining And Manufacturing Company | Aromatic diazonium bis(fluorinated alkylsulfonyl) methides |
| US4038253A (en) * | 1973-11-02 | 1977-07-26 | Hercules Incorporated | Photocross-linkable polymers containing pendant diazoester groups |
| CA1063415A (en) * | 1974-01-17 | 1979-10-02 | Scott Paper Company | Planographic printing plate with layer of diazo compound, carbon and nitrocellulose |
| US3964389A (en) * | 1974-01-17 | 1976-06-22 | Scott Paper Company | Printing plate by laser transfer |
| US4339522A (en) * | 1979-06-18 | 1982-07-13 | International Business Machines Corporation | Ultra-violet lithographic resist composition and process |
| US4315983A (en) * | 1979-07-13 | 1982-02-16 | Fuji Photo Film Co., Ltd. | 2,6-Di-tert-butyl-4-substituted thiopyrylium salt, process for production of same, and a photoconductive composition containing same |
| US4245003A (en) * | 1979-08-17 | 1981-01-13 | James River Graphics, Inc. | Coated transparent film for laser imaging |
| US4252671A (en) * | 1979-12-04 | 1981-02-24 | Xerox Corporation | Preparation of colloidal iron dispersions by the polymer-catalyzed decomposition of iron carbonyl and iron organocarbonyl compounds |
| US4415621A (en) * | 1980-02-25 | 1983-11-15 | Eastman Kodak Company | Use of α,α-bis(dialkylaminobenzylidene) ketone dyes in optical recording elements |
| US4401743A (en) * | 1980-04-30 | 1983-08-30 | Minnesota Mining And Manufacturing Company | Aqueous developable photosensitive composition and printing plate |
| US4307182A (en) * | 1980-05-23 | 1981-12-22 | Minnesota Mining And Manufacturing Company | Imaging systems with tetra(aliphatic) borate salts |
| US4582776A (en) * | 1981-10-09 | 1986-04-15 | Pioneer Electronic Corporation | Information recording disc having light absorbing cellulose nitrate coating |
| EP0113167A3 (en) * | 1982-10-14 | 1986-06-18 | Autotype International Limited | Laser imaging materials |
| US4491432A (en) * | 1982-12-30 | 1985-01-01 | International Business Machines Corporation | Chemical heat amplification in thermal transfer printing |
| NL8300155A (nl) * | 1983-01-17 | 1984-08-16 | Philips Nv | Registratie-element met een pyrylium- of thiopyrylium-squarylium kleurstoflaag en nieuwe pyrylium- of thiopyrylium-squarylium verbindingen. |
| JPS60350A (ja) * | 1983-06-17 | 1985-01-05 | Ngk Insulators Ltd | セラミツクスの試験方法 |
| US4549824A (en) * | 1983-12-30 | 1985-10-29 | International Business Machines Corporation | Ink additives for efficient thermal ink transfer printing processes |
| DE3503995A1 (de) * | 1984-02-06 | 1985-08-08 | Ricoh Co., Ltd., Tokio/Tokyo | Optischer informationsaufzeichnungstraeger |
| GB8410515D0 (en) * | 1984-04-25 | 1984-05-31 | Ici Plc | Laser-imageable assembly |
| JPS60255491A (ja) * | 1984-06-01 | 1985-12-17 | Daicel Chem Ind Ltd | レ−ザ−記録用フイルム |
| JPS60262687A (ja) * | 1984-06-11 | 1985-12-26 | Daicel Chem Ind Ltd | レ−ザ−記録用フイルム |
| DE3781067T2 (de) * | 1986-09-01 | 1993-01-21 | Matsushita Electric Ind Co Ltd | Uebertragungsaufzeichnungsmittel und ihre verwendung fuer uebertragungsaufzeichnungsverfahren. |
| JPH089272B2 (ja) * | 1986-12-25 | 1996-01-31 | 株式会社巴川製紙所 | 転写記録媒体および転写記録方法 |
| US4833124A (en) * | 1987-12-04 | 1989-05-23 | Eastman Kodak Company | Process for increasing the density of images obtained by thermal dye transfer |
| DE3900735A1 (de) * | 1989-01-12 | 1990-07-26 | Hoechst Ag | Neue mehrfunktionelle (alpha)-diazo-(beta)-ketoester, verfahren zu ihrer herstellung und deren verwendung |
| US5256506A (en) * | 1990-10-04 | 1993-10-26 | Graphics Technology International Inc. | Ablation-transfer imaging/recording |
| US5171650A (en) * | 1990-10-04 | 1992-12-15 | Graphics Technology International, Inc. | Ablation-transfer imaging/recording |
| US5156938A (en) * | 1989-03-30 | 1992-10-20 | Graphics Technology International, Inc. | Ablation-transfer imaging/recording |
| US4948777A (en) * | 1989-06-16 | 1990-08-14 | Eastman Kodak Company | Infrared absorbing bis(chalcogenopyrylo)polymethine dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4950639A (en) * | 1989-06-16 | 1990-08-21 | Eastman Kodak Company | Infrared absorbing bis(aminoaryl)polymethine dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4948776A (en) * | 1989-06-16 | 1990-08-14 | Eastman Kodak Company | Infrared absorbing chalcogenopyrylo-arylidene dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4942141A (en) * | 1989-06-16 | 1990-07-17 | Eastman Kodak Company | Infrared absorbing squarylium dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4948778A (en) * | 1989-06-20 | 1990-08-14 | Eastman Kodak Company | Infrared absorbing oxyindolizine dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4952552A (en) * | 1989-06-20 | 1990-08-28 | Eastman Kodak Company | Infrared absorbing quinoid dyes for dye-donor element used in laser-induced thermal dye transfer |
| US4912083A (en) * | 1989-06-20 | 1990-03-27 | Eastman Kodak Company | Infrared absorbing ferrous complexes for dye-donor element used in laser-induced thermal dye transfer |
| DE4014648A1 (de) * | 1990-05-08 | 1991-11-14 | Hoechst Ag | Positiv arbeitendes strahlungsempfindiches gemisch und strahlungsempfindliches aufzeichnungsmaterial fuer die belichtung mit duv-strahlung |
| CA2039668A1 (en) * | 1990-06-20 | 1991-12-21 | Steven T. Hedrick | Photosensitive composition and printing plate |
| US5024990A (en) * | 1990-10-31 | 1991-06-18 | Eastman Kodak Company | Mixture of dyes for cyan dye donor for thermal color proofing |
| US5023229A (en) * | 1990-10-31 | 1991-06-11 | Eastman Kodak Company | Mixture of dyes for magenta dye donor for thermal color proofing |
| US5166024A (en) * | 1990-12-21 | 1992-11-24 | Eastman Kodak Company | Photoelectrographic imaging with near-infrared sensitizing pigments |
| DE4106357A1 (de) * | 1991-02-28 | 1992-09-03 | Hoechst Ag | Strahlungsempfindliche polymere mit 2-diazo-1,3-dicarbonyl-gruppen, verfahren zu deren herstellung und verwendung in einem positiv arbeitenden aufzeichnungsmaterial |
| US5401607A (en) * | 1991-04-17 | 1995-03-28 | Polaroid Corporation | Processes and compositions for photogeneration of acid |
| IT1247978B (it) * | 1991-06-04 | 1995-01-05 | Ciba Geigy Spa | Composti piperidinici contenenti l'anello tetraidrofuranico atti all'impiego come stabilizzanti per materiali organici |
| EP0568993B1 (en) * | 1992-05-06 | 1998-08-12 | Kyowa Hakko Kogyo Co., Ltd. | Chemical amplification resist composition |
| US5351617A (en) * | 1992-07-20 | 1994-10-04 | Presstek, Inc. | Method for laser-discharge imaging a printing plate |
| EP0582001B1 (en) * | 1992-08-03 | 1996-12-11 | Agfa-Gevaert N.V. | Heat mode recording material and method for obtaining color images |
| US5278023A (en) * | 1992-11-16 | 1994-01-11 | Minnesota Mining And Manufacturing Company | Propellant-containing thermal transfer donor elements |
| US5286604A (en) * | 1992-11-25 | 1994-02-15 | E. I. Du Pont De Nemours And Company | Single layer dry processible photothermal-sensitive element |
| GB9225724D0 (en) * | 1992-12-09 | 1993-02-03 | Minnesota Mining & Mfg | Transfer imaging elements |
| US5308737A (en) * | 1993-03-18 | 1994-05-03 | Minnesota Mining And Manufacturing Company | Laser propulsion transfer using black metal coated substrates |
| US5340699A (en) * | 1993-05-19 | 1994-08-23 | Eastman Kodak Company | Radiation-sensitive composition containing a resole resin and a novolac resin and use thereof in lithographic printing plates |
| US5360694A (en) * | 1993-10-18 | 1994-11-01 | Minnesota Mining And Manufacturing Company | Thermal dye transfer |
| ZA966322B (en) * | 1995-08-07 | 1997-02-10 | Lederle Japan Ltd | 1,9-diazabicyclo 4.3.0 nona-3, 8-diene derivatives. |
-
1996
- 1996-04-03 US US08/627,160 patent/US5691098A/en not_active Expired - Lifetime
-
1997
- 1997-03-26 DE DE69707951T patent/DE69707951T2/de not_active Expired - Fee Related
- 1997-03-26 EP EP97105097A patent/EP0799716B1/en not_active Expired - Lifetime
- 1997-04-03 JP JP9084776A patent/JPH1036331A/ja active Pending
- 1997-05-19 US US08/858,307 patent/US5756689A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| EP0799716A3 (en) | 1998-02-04 |
| EP0799716A2 (en) | 1997-10-08 |
| JPH1036331A (ja) | 1998-02-10 |
| US5756689A (en) | 1998-05-26 |
| DE69707951D1 (de) | 2001-12-13 |
| EP0799716B1 (en) | 2001-11-07 |
| US5691098A (en) | 1997-11-25 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69707951T2 (de) | Diazoverbindungen für Laser-induzierte massenübertragende Bildaufzeichnungsmaterialien | |
| DE69702559T2 (de) | Thermotransfer-Donorelement, das eine farblose sublimierbare Verbindung enthält, und Bildaufzeichnungsverfahren | |
| DE69412313T2 (de) | Laser-induzierte thermische Farbstoffübertragung unter Verwendung mit schwarzem Metall beschichteter Substrate | |
| DE69708120T2 (de) | Laser-absorbierende, lichtbleichbare zusammensetzungen | |
| DE69713646T2 (de) | Laseradressierbares thermisches Übertragungsbilderzeugungselement und Bilderzeugungsverfahren | |
| DE69410212T2 (de) | Lithographische Druckplatten | |
| DE69405521T2 (de) | Thermisches Übertragungsfarbstoffgebendes Element, das ein Substrat mit einer mikrostrukturierten Oberfläche verwendet | |
| DE69908269T2 (de) | Direktbeschreibbare entwicklungsfreie Flachdruckplatte, sowie Aufzeichnungs und Druckverfahren | |
| DE69818098T2 (de) | Wärmeempfindliches farbbildendes Polymer | |
| DE60216663T2 (de) | Negativ arbeitendes thermisches Bebilderungselement sowie Verfahren für Bebilderung und Druck | |
| DE69722396T2 (de) | Mit einem laser ansprechbares thermisches übertragungselement zur bildaufzeichnung mit einer zwischenschicht | |
| DE60011146T2 (de) | Thermische übertragung von vernetzten materialien | |
| EP0993966B1 (de) | Negativ arbeitendes, strahlungsempfindliches Gemisch zur Herstellung eines mit Wärme oder Infrarotlaser bebilderbaren Aufzeichnungsmaterials | |
| DE69400754T2 (de) | Thermisches übertragungsverfahren durch laser | |
| DE69907840T2 (de) | Direkt beschreibbare ein wärmeempfindliches Polymer enthaltende verarbeitungsfreie Druckplatte | |
| DE69418826T2 (de) | Zusammensetzungen zur Herstellung strukturierter Farbbilder und deren Anwendung | |
| DE69030083T2 (de) | Im nahen uv-bereich arbeitenden laser absorbierende beschichtung sowie gebrauch derselben in der herstellung von farbbildern und prüffolien | |
| DE69132508T2 (de) | Bilderzeugung/aufzeichnung durch verbesserte abtragungs-übertragung | |
| DE69628737T2 (de) | Verfahren zur herstellung eines z-achse-klebestoffs und einer elektrischen verbindung damit | |
| DE69516521T2 (de) | Verfahren zur herstellung einer integrierten schwarzmatrix mit farbfilterelementen | |
| DE112007001312T5 (de) | Laserablationslack | |
| DE10297059B4 (de) | Verfahren für die Bebilderung direkt auf der Druckmaschine | |
| DE60212748T2 (de) | Thermisch umschaltbare Zusammensetzung und Bebilderungselement mit Polymethin-IR-Farbstoff sowie Verfahren für Bebilderung und Druck | |
| DE69500682T2 (de) | Donorelement für thermische Übertragung durch Laser | |
| DE69500683T2 (de) | Donor-element für thermische Übertragung durch Laser |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition | ||
| 8339 | Ceased/non-payment of the annual fee |