DE69408989T2 - Metallocen-katalysatorsysteme auf einem träger für die olefinpolymerisation, ihre herstellung und verwendung - Google Patents
Metallocen-katalysatorsysteme auf einem träger für die olefinpolymerisation, ihre herstellung und verwendungInfo
- Publication number
- DE69408989T2 DE69408989T2 DE69408989T DE69408989T DE69408989T2 DE 69408989 T2 DE69408989 T2 DE 69408989T2 DE 69408989 T DE69408989 T DE 69408989T DE 69408989 T DE69408989 T DE 69408989T DE 69408989 T2 DE69408989 T2 DE 69408989T2
- Authority
- DE
- Germany
- Prior art keywords
- group
- catalyst system
- same
- different
- metallocene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired - Lifetime
Links
- 239000003054 catalyst Substances 0.000 title claims description 114
- 238000006116 polymerization reaction Methods 0.000 title claims description 30
- 150000001336 alkenes Chemical class 0.000 title claims description 8
- 238000004519 manufacturing process Methods 0.000 title description 3
- JRZJOMJEPLMPRA-UHFFFAOYSA-N olefin Natural products CCCCCCCC=C JRZJOMJEPLMPRA-UHFFFAOYSA-N 0.000 title description 2
- 239000000203 mixture Substances 0.000 claims description 69
- 239000002904 solvent Substances 0.000 claims description 42
- 238000000034 method Methods 0.000 claims description 28
- -1 rac-dimenthylsilandiylbis(2-methylindenyl)zirconium dichloride Chemical compound 0.000 claims description 26
- 239000000178 monomer Substances 0.000 claims description 25
- 238000002844 melting Methods 0.000 claims description 22
- 230000008018 melting Effects 0.000 claims description 22
- QQONPFPTGQHPMA-UHFFFAOYSA-N propylene Natural products CC=C QQONPFPTGQHPMA-UHFFFAOYSA-N 0.000 claims description 22
- 239000002002 slurry Substances 0.000 claims description 22
- 125000004805 propylene group Chemical group [H]C([H])([H])C([H])([*:1])C([H])([H])[*:2] 0.000 claims description 21
- 229920001155 polypropylene Polymers 0.000 claims description 18
- 239000004743 Polypropylene Substances 0.000 claims description 16
- 125000000008 (C1-C10) alkyl group Chemical group 0.000 claims description 12
- 239000007795 chemical reaction product Substances 0.000 claims description 12
- 125000005843 halogen group Chemical group 0.000 claims description 12
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 claims description 10
- 239000005977 Ethylene Substances 0.000 claims description 10
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 10
- 125000003118 aryl group Chemical group 0.000 claims description 9
- 239000007789 gas Substances 0.000 claims description 9
- 125000004122 cyclic group Chemical group 0.000 claims description 8
- 125000004432 carbon atom Chemical group C* 0.000 claims description 7
- 229910052751 metal Inorganic materials 0.000 claims description 7
- 239000002184 metal Substances 0.000 claims description 7
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 6
- 229910052782 aluminium Inorganic materials 0.000 claims description 6
- 125000005018 aryl alkenyl group Chemical group 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 238000002360 preparation method Methods 0.000 claims description 6
- 229910052710 silicon Inorganic materials 0.000 claims description 6
- 239000010703 silicon Substances 0.000 claims description 6
- 125000004429 atom Chemical group 0.000 claims description 5
- 229920001577 copolymer Polymers 0.000 claims description 5
- 230000000737 periodic effect Effects 0.000 claims description 5
- 229910052732 germanium Inorganic materials 0.000 claims description 4
- GNPVGFCGXDBREM-UHFFFAOYSA-N germanium atom Chemical compound [Ge] GNPVGFCGXDBREM-UHFFFAOYSA-N 0.000 claims description 4
- 229920005606 polypropylene copolymer Polymers 0.000 claims description 4
- XUIMIQQOPSSXEZ-UHFFFAOYSA-N Silicon Chemical compound [Si] XUIMIQQOPSSXEZ-UHFFFAOYSA-N 0.000 claims description 3
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 claims description 3
- 125000004104 aryloxy group Chemical group 0.000 claims description 3
- 239000001257 hydrogen Substances 0.000 claims description 3
- 229910052739 hydrogen Inorganic materials 0.000 claims description 3
- 229910052718 tin Inorganic materials 0.000 claims description 3
- VPGLGRNSAYHXPY-UHFFFAOYSA-L zirconium(2+);dichloride Chemical compound Cl[Zr]Cl VPGLGRNSAYHXPY-UHFFFAOYSA-L 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 2
- 125000006374 C2-C10 alkenyl group Chemical group 0.000 claims 4
- 125000000041 C6-C10 aryl group Chemical group 0.000 claims 4
- 125000000027 (C1-C10) alkoxy group Chemical group 0.000 claims 2
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims 2
- 125000003837 (C1-C20) alkyl group Chemical group 0.000 claims 1
- 125000006750 (C7-C60) arylalkyl group Chemical group 0.000 claims 1
- 125000003860 C1-C20 alkoxy group Chemical group 0.000 claims 1
- 125000003358 C2-C20 alkenyl group Chemical group 0.000 claims 1
- 238000007334 copolymerization reaction Methods 0.000 claims 1
- 125000004407 fluoroaryl group Chemical group 0.000 claims 1
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 108
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 81
- 239000000243 solution Substances 0.000 description 58
- YMWUJEATGCHHMB-UHFFFAOYSA-N Dichloromethane Chemical compound ClCCl YMWUJEATGCHHMB-UHFFFAOYSA-N 0.000 description 41
- 229910007928 ZrCl2 Inorganic materials 0.000 description 41
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 38
- 229920000642 polymer Polymers 0.000 description 28
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 27
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 24
- 230000015572 biosynthetic process Effects 0.000 description 24
- 239000007787 solid Substances 0.000 description 22
- 238000003786 synthesis reaction Methods 0.000 description 22
- HEDRZPFGACZZDS-MICDWDOJSA-N Trichloro(2H)methane Chemical compound [2H]C(Cl)(Cl)Cl HEDRZPFGACZZDS-MICDWDOJSA-N 0.000 description 21
- 238000006243 chemical reaction Methods 0.000 description 21
- 150000001875 compounds Chemical class 0.000 description 20
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 18
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 18
- QWTDNUCVQCZILF-UHFFFAOYSA-N isopentane Chemical compound CCC(C)C QWTDNUCVQCZILF-UHFFFAOYSA-N 0.000 description 16
- MZRVEZGGRBJDDB-UHFFFAOYSA-N N-Butyllithium Chemical compound [Li]CCCC MZRVEZGGRBJDDB-UHFFFAOYSA-N 0.000 description 15
- 239000000047 product Substances 0.000 description 15
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 14
- 239000012071 phase Substances 0.000 description 13
- 239000000377 silicon dioxide Substances 0.000 description 13
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 12
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 12
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 12
- YBYIRNPNPLQARY-UHFFFAOYSA-N 1H-indene Natural products C1=CC=C2CC=CC2=C1 YBYIRNPNPLQARY-UHFFFAOYSA-N 0.000 description 11
- 238000006297 dehydration reaction Methods 0.000 description 11
- 230000000694 effects Effects 0.000 description 11
- 239000002245 particle Substances 0.000 description 11
- 239000012190 activator Substances 0.000 description 10
- 239000000463 material Substances 0.000 description 10
- 238000003756 stirring Methods 0.000 description 10
- 238000009826 distribution Methods 0.000 description 9
- 229910052757 nitrogen Inorganic materials 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 235000019198 oils Nutrition 0.000 description 9
- 239000012074 organic phase Substances 0.000 description 9
- 238000010992 reflux Methods 0.000 description 9
- 239000000725 suspension Substances 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 8
- AFABGHUZZDYHJO-UHFFFAOYSA-N dimethyl butane Natural products CCCC(C)C AFABGHUZZDYHJO-UHFFFAOYSA-N 0.000 description 8
- 238000001035 drying Methods 0.000 description 8
- FYSNRJHAOHDILO-UHFFFAOYSA-N thionyl chloride Chemical compound ClS(Cl)=O FYSNRJHAOHDILO-UHFFFAOYSA-N 0.000 description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 7
- 229910052801 chlorine Inorganic materials 0.000 description 7
- 229930195733 hydrocarbon Natural products 0.000 description 7
- 150000002430 hydrocarbons Chemical class 0.000 description 7
- 239000003446 ligand Substances 0.000 description 7
- 239000007788 liquid Substances 0.000 description 7
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 7
- 239000011541 reaction mixture Substances 0.000 description 7
- 239000000126 substance Substances 0.000 description 7
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 7
- 238000005160 1H NMR spectroscopy Methods 0.000 description 6
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 6
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 6
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- PMZURENOXWZQFD-UHFFFAOYSA-L Sodium Sulfate Chemical compound [Na+].[Na+].[O-]S([O-])(=O)=O PMZURENOXWZQFD-UHFFFAOYSA-L 0.000 description 6
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 6
- 239000000460 chlorine Substances 0.000 description 6
- 238000010438 heat treatment Methods 0.000 description 6
- 235000012239 silicon dioxide Nutrition 0.000 description 6
- 229910052938 sodium sulfate Inorganic materials 0.000 description 6
- 235000011152 sodium sulphate Nutrition 0.000 description 6
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 6
- 229910052723 transition metal Inorganic materials 0.000 description 6
- 150000003624 transition metals Chemical class 0.000 description 6
- AQZWEFBJYQSQEH-UHFFFAOYSA-N 2-methyloxaluminane Chemical compound C[Al]1CCCCO1 AQZWEFBJYQSQEH-UHFFFAOYSA-N 0.000 description 5
- 239000004215 Carbon black (E152) Substances 0.000 description 5
- 208000005156 Dehydration Diseases 0.000 description 5
- 230000018044 dehydration Effects 0.000 description 5
- IJKVHSBPTUYDLN-UHFFFAOYSA-N dihydroxy(oxo)silane Chemical compound O[Si](O)=O IJKVHSBPTUYDLN-UHFFFAOYSA-N 0.000 description 5
- LIKFHECYJZWXFJ-UHFFFAOYSA-N dimethyldichlorosilane Chemical compound C[Si](C)(Cl)Cl LIKFHECYJZWXFJ-UHFFFAOYSA-N 0.000 description 5
- 239000011261 inert gas Substances 0.000 description 5
- 239000011148 porous material Substances 0.000 description 5
- 238000000425 proton nuclear magnetic resonance spectrum Methods 0.000 description 5
- 229910052726 zirconium Inorganic materials 0.000 description 5
- DUNKXUFBGCUVQW-UHFFFAOYSA-J zirconium tetrachloride Chemical compound Cl[Zr](Cl)(Cl)Cl DUNKXUFBGCUVQW-UHFFFAOYSA-J 0.000 description 5
- JWVVFPXYZALZDT-UHFFFAOYSA-N 2-methyl-1,3-dihydroinden-2-ol Chemical compound C1=CC=C2CC(C)(O)CC2=C1 JWVVFPXYZALZDT-UHFFFAOYSA-N 0.000 description 4
- FLFNHHSXSLXYQB-UHFFFAOYSA-L CC1=CC(C(=CC=C2)C=3C=CC=CC=3)=C2C1[Zr](Cl)(Cl)(=[Si](C)C)C1C(C)=CC2=C1C=CC=C2C1=CC=CC=C1 Chemical compound CC1=CC(C(=CC=C2)C=3C=CC=CC=3)=C2C1[Zr](Cl)(Cl)(=[Si](C)C)C1C(C)=CC2=C1C=CC=C2C1=CC=CC=C1 FLFNHHSXSLXYQB-UHFFFAOYSA-L 0.000 description 4
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 4
- QCWXUUIWCKQGHC-UHFFFAOYSA-N Zirconium Chemical compound [Zr] QCWXUUIWCKQGHC-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 230000000996 additive effect Effects 0.000 description 4
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 4
- VSCWAEJMTAWNJL-UHFFFAOYSA-K aluminium trichloride Chemical compound Cl[Al](Cl)Cl VSCWAEJMTAWNJL-UHFFFAOYSA-K 0.000 description 4
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 4
- 238000001816 cooling Methods 0.000 description 4
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 4
- 238000001819 mass spectrum Methods 0.000 description 4
- 239000001301 oxygen Substances 0.000 description 4
- 229910052760 oxygen Inorganic materials 0.000 description 4
- 229920000098 polyolefin Polymers 0.000 description 4
- 239000013557 residual solvent Substances 0.000 description 4
- 239000000741 silica gel Substances 0.000 description 4
- 229910002027 silica gel Inorganic materials 0.000 description 4
- GLGNXYJARSMNGJ-VKTIVEEGSA-N (1s,2s,3r,4r)-3-[[5-chloro-2-[(1-ethyl-6-methoxy-2-oxo-4,5-dihydro-3h-1-benzazepin-7-yl)amino]pyrimidin-4-yl]amino]bicyclo[2.2.1]hept-5-ene-2-carboxamide Chemical compound CCN1C(=O)CCCC2=C(OC)C(NC=3N=C(C(=CN=3)Cl)N[C@H]3[C@H]([C@@]4([H])C[C@@]3(C=C4)[H])C(N)=O)=CC=C21 GLGNXYJARSMNGJ-VKTIVEEGSA-N 0.000 description 3
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 3
- CZPSTFVUNSZYCA-UHFFFAOYSA-L CC(C)c1cc2C(C(C)=Cc2c(c1)C(C)C)[Zr](Cl)(Cl)(C1C(C)=Cc2c1cc(cc2C(C)C)C(C)C)=[Si](C)C Chemical compound CC(C)c1cc2C(C(C)=Cc2c(c1)C(C)C)[Zr](Cl)(Cl)(C1C(C)=Cc2c1cc(cc2C(C)C)C(C)C)=[Si](C)C CZPSTFVUNSZYCA-UHFFFAOYSA-L 0.000 description 3
- 229910007932 ZrCl4 Inorganic materials 0.000 description 3
- 239000012298 atmosphere Substances 0.000 description 3
- 238000009835 boiling Methods 0.000 description 3
- 230000003197 catalytic effect Effects 0.000 description 3
- 239000012230 colorless oil Substances 0.000 description 3
- 229940125758 compound 15 Drugs 0.000 description 3
- 229940125810 compound 20 Drugs 0.000 description 3
- 239000010419 fine particle Substances 0.000 description 3
- 229910052731 fluorine Inorganic materials 0.000 description 3
- 239000011737 fluorine Substances 0.000 description 3
- JAXFJECJQZDFJS-XHEPKHHKSA-N gtpl8555 Chemical compound OC(=O)C[C@H](N)C(=O)N[C@@H](CCC(O)=O)C(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C(C)C)C(=O)N1CCC[C@@H]1C(=O)N[C@H](B1O[C@@]2(C)[C@H]3C[C@H](C3(C)C)C[C@H]2O1)CCC1=CC=C(F)C=C1 JAXFJECJQZDFJS-XHEPKHHKSA-N 0.000 description 3
- 229910052735 hafnium Inorganic materials 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- QNXSIUBBGPHDDE-UHFFFAOYSA-N indan-1-one Chemical compound C1=CC=C2C(=O)CCC2=C1 QNXSIUBBGPHDDE-UHFFFAOYSA-N 0.000 description 3
- 239000012442 inert solvent Substances 0.000 description 3
- 229910052809 inorganic oxide Inorganic materials 0.000 description 3
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 3
- 235000019341 magnesium sulphate Nutrition 0.000 description 3
- 239000012968 metallocene catalyst Substances 0.000 description 3
- 238000002156 mixing Methods 0.000 description 3
- 238000000655 nuclear magnetic resonance spectrum Methods 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- XOJVVFBFDXDTEG-UHFFFAOYSA-N pristane Chemical compound CC(C)CCCC(C)CCCC(C)CCCC(C)C XOJVVFBFDXDTEG-UHFFFAOYSA-N 0.000 description 3
- 238000000926 separation method Methods 0.000 description 3
- 235000017557 sodium bicarbonate Nutrition 0.000 description 3
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 3
- 229910000033 sodium borohydride Inorganic materials 0.000 description 3
- 239000012279 sodium borohydride Substances 0.000 description 3
- 229920000576 tactic polymer Polymers 0.000 description 3
- KVNYFPKFSJIPBJ-UHFFFAOYSA-N 1,2-diethylbenzene Chemical compound CCC1=CC=CC=C1CC KVNYFPKFSJIPBJ-UHFFFAOYSA-N 0.000 description 2
- VHIKUGITLWELJA-UHFFFAOYSA-N 2-methyl-3-(2-phenylphenyl)propanoic acid Chemical compound OC(=O)C(C)CC1=CC=CC=C1C1=CC=CC=C1 VHIKUGITLWELJA-UHFFFAOYSA-N 0.000 description 2
- LXZGARSEFLNFFB-UHFFFAOYSA-N 2-methyl-3-naphthalen-1-ylpropanoic acid Chemical compound C1=CC=C2C(CC(C)C(O)=O)=CC=CC2=C1 LXZGARSEFLNFFB-UHFFFAOYSA-N 0.000 description 2
- XFNIQDLAPZZUMH-UHFFFAOYSA-N 2-methyl-4,6-di(propan-2-yl)-1h-indene Chemical compound CC(C)C1=CC(C(C)C)=CC2=C1C=C(C)C2 XFNIQDLAPZZUMH-UHFFFAOYSA-N 0.000 description 2
- ALGLPEWJXUNUOJ-UHFFFAOYSA-N 2-methyl-4,6-di(propan-2-yl)-2,3-dihydroinden-1-one Chemical compound CC(C)C1=CC(C(C)C)=CC2=C1CC(C)C2=O ALGLPEWJXUNUOJ-UHFFFAOYSA-N 0.000 description 2
- IVYCZGYSZDAEPE-UHFFFAOYSA-N 2-methyl-4-phenyl-2,3-dihydroinden-1-one Chemical compound O=C1C(C)CC2=C1C=CC=C2C1=CC=CC=C1 IVYCZGYSZDAEPE-UHFFFAOYSA-N 0.000 description 2
- KSJULJVHQBLVFF-UHFFFAOYSA-N 2-methyl-5,7-di(propan-2-yl)-1h-indene Chemical compound CC(C)C1=CC(C(C)C)=CC2=C1CC(C)=C2 KSJULJVHQBLVFF-UHFFFAOYSA-N 0.000 description 2
- LYGOMMCGNNRRQD-UHFFFAOYSA-N 2-methyl-5,7-di(propan-2-yl)-2,3-dihydroinden-1-one Chemical compound CC(C)C1=CC(C(C)C)=CC2=C1C(=O)C(C)C2 LYGOMMCGNNRRQD-UHFFFAOYSA-N 0.000 description 2
- JQCCMEDYANGBOG-UHFFFAOYSA-N 2-methyl-7-phenyl-1h-indene Chemical compound C=12CC(C)=CC2=CC=CC=1C1=CC=CC=C1 JQCCMEDYANGBOG-UHFFFAOYSA-N 0.000 description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical group [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- RGSFGYAAUTVSQA-UHFFFAOYSA-N Cyclopentane Chemical compound C1CCCC1 RGSFGYAAUTVSQA-UHFFFAOYSA-N 0.000 description 2
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 2
- YNQLUTRBYVCPMQ-UHFFFAOYSA-N Ethylbenzene Chemical compound CCC1=CC=CC=C1 YNQLUTRBYVCPMQ-UHFFFAOYSA-N 0.000 description 2
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- CPLXHLVBOLITMK-UHFFFAOYSA-N Magnesium oxide Chemical compound [Mg]=O CPLXHLVBOLITMK-UHFFFAOYSA-N 0.000 description 2
- 238000005481 NMR spectroscopy Methods 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- RTAQQCXQSZGOHL-UHFFFAOYSA-N Titanium Chemical compound [Ti] RTAQQCXQSZGOHL-UHFFFAOYSA-N 0.000 description 2
- MCMNRKCIXSYSNV-UHFFFAOYSA-N Zirconium dioxide Chemical compound O=[Zr]=O MCMNRKCIXSYSNV-UHFFFAOYSA-N 0.000 description 2
- 125000003342 alkenyl group Chemical group 0.000 description 2
- 125000000217 alkyl group Chemical group 0.000 description 2
- 239000012300 argon atmosphere Substances 0.000 description 2
- 238000010420 art technique Methods 0.000 description 2
- 239000012267 brine Substances 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- 239000000969 carrier Substances 0.000 description 2
- IJOOHPMOJXWVHK-UHFFFAOYSA-N chlorotrimethylsilane Chemical compound C[Si](C)(C)Cl IJOOHPMOJXWVHK-UHFFFAOYSA-N 0.000 description 2
- 238000004587 chromatography analysis Methods 0.000 description 2
- 229910052681 coesite Inorganic materials 0.000 description 2
- 229940125904 compound 1 Drugs 0.000 description 2
- 229940126214 compound 3 Drugs 0.000 description 2
- 229940125898 compound 5 Drugs 0.000 description 2
- 229910052906 cristobalite Inorganic materials 0.000 description 2
- 239000012043 crude product Substances 0.000 description 2
- 125000000058 cyclopentadienyl group Chemical group C1(=CC=CC1)* 0.000 description 2
- 239000012024 dehydrating agents Substances 0.000 description 2
- UPQZOUHVTJNGFK-UHFFFAOYSA-N diethyl 2-methylpropanedioate Chemical compound CCOC(=O)C(C)C(=O)OCC UPQZOUHVTJNGFK-UHFFFAOYSA-N 0.000 description 2
- SMBQBQBNOXIFSF-UHFFFAOYSA-N dilithium Chemical class [Li][Li] SMBQBQBNOXIFSF-UHFFFAOYSA-N 0.000 description 2
- KGDCHNBUAFRQKF-UHFFFAOYSA-N dimethyl-bis[2-methyl-4,6-di(propan-2-yl)-1h-inden-1-yl]silane Chemical compound CC1=CC(C(=CC(=C2)C(C)C)C(C)C)=C2C1[Si](C)(C)C1C(C=C(C=C2C(C)C)C(C)C)=C2C=C1C KGDCHNBUAFRQKF-UHFFFAOYSA-N 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 239000000284 extract Substances 0.000 description 2
- 239000000706 filtrate Substances 0.000 description 2
- VBJZVLUMGGDVMO-UHFFFAOYSA-N hafnium atom Chemical compound [Hf] VBJZVLUMGGDVMO-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 238000007689 inspection Methods 0.000 description 2
- 229920001580 isotactic polymer Polymers 0.000 description 2
- KJIFKLIQANRMOU-UHFFFAOYSA-N oxidanium;4-methylbenzenesulfonate Chemical compound O.CC1=CC=C(S(O)(=O)=O)C=C1 KJIFKLIQANRMOU-UHFFFAOYSA-N 0.000 description 2
- 239000011236 particulate material Substances 0.000 description 2
- 150000003254 radicals Chemical class 0.000 description 2
- 229920006395 saturated elastomer Polymers 0.000 description 2
- 239000011734 sodium Substances 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- HPALAKNZSZLMCH-UHFFFAOYSA-M sodium;chloride;hydrate Chemical compound O.[Na+].[Cl-] HPALAKNZSZLMCH-UHFFFAOYSA-M 0.000 description 2
- 239000012258 stirred mixture Substances 0.000 description 2
- 229910052682 stishovite Inorganic materials 0.000 description 2
- 229910052719 titanium Inorganic materials 0.000 description 2
- 239000010936 titanium Substances 0.000 description 2
- 229910052905 tridymite Inorganic materials 0.000 description 2
- VOITXYVAKOUIBA-UHFFFAOYSA-N triethylaluminium Chemical compound CC[Al](CC)CC VOITXYVAKOUIBA-UHFFFAOYSA-N 0.000 description 2
- 238000005406 washing Methods 0.000 description 2
- 125000004209 (C1-C8) alkyl group Chemical group 0.000 description 1
- UNEATYXSUBPPKP-UHFFFAOYSA-N 1,3-Diisopropylbenzene Chemical compound CC(C)C1=CC=CC(C(C)C)=C1 UNEATYXSUBPPKP-UHFFFAOYSA-N 0.000 description 1
- SEXZHJJUKFXNDY-UHFFFAOYSA-N 1-(bromomethyl)-2-phenylbenzene Chemical compound BrCC1=CC=CC=C1C1=CC=CC=C1 SEXZHJJUKFXNDY-UHFFFAOYSA-N 0.000 description 1
- MEKOFIRRDATTAG-UHFFFAOYSA-N 2,2,5,8-tetramethyl-3,4-dihydrochromen-6-ol Chemical compound C1CC(C)(C)OC2=C1C(C)=C(O)C=C2C MEKOFIRRDATTAG-UHFFFAOYSA-N 0.000 description 1
- RUHJZSZTSCSTCC-UHFFFAOYSA-N 2-(bromomethyl)naphthalene Chemical compound C1=CC=CC2=CC(CBr)=CC=C21 RUHJZSZTSCSTCC-UHFFFAOYSA-N 0.000 description 1
- NGNBDVOYPDDBFK-UHFFFAOYSA-N 2-[2,4-di(pentan-2-yl)phenoxy]acetyl chloride Chemical compound CCCC(C)C1=CC=C(OCC(Cl)=O)C(C(C)CCC)=C1 NGNBDVOYPDDBFK-UHFFFAOYSA-N 0.000 description 1
- YOCIJWAHRAJQFT-UHFFFAOYSA-N 2-bromo-2-methylpropanoyl bromide Chemical compound CC(C)(Br)C(Br)=O YOCIJWAHRAJQFT-UHFFFAOYSA-N 0.000 description 1
- WGAIKEHHOKCOJR-UHFFFAOYSA-N 2-methyl-5-propan-2-yl-2,3-dihydroinden-1-one Chemical compound CC(C)C1=CC=C2C(=O)C(C)CC2=C1 WGAIKEHHOKCOJR-UHFFFAOYSA-N 0.000 description 1
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- KZBUYRJDOAKODT-UHFFFAOYSA-N Chlorine Chemical compound ClCl KZBUYRJDOAKODT-UHFFFAOYSA-N 0.000 description 1
- 239000005046 Chlorosilane Substances 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- XDTMQSROBMDMFD-UHFFFAOYSA-N Cyclohexane Chemical compound C1CCCCC1 XDTMQSROBMDMFD-UHFFFAOYSA-N 0.000 description 1
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 239000007832 Na2SO4 Substances 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 239000004793 Polystyrene Substances 0.000 description 1
- 229910003910 SiCl4 Inorganic materials 0.000 description 1
- BLRPTPMANUNPDV-UHFFFAOYSA-N Silane Chemical compound [SiH4] BLRPTPMANUNPDV-UHFFFAOYSA-N 0.000 description 1
- CGELJBSWQTYCIY-UHFFFAOYSA-L [Cl-].[Cl-].CC1=Cc2ccccc2[C@H]1[Zr++]([C@@H]1C(C)=Cc2ccccc12)=[Si](C)C Chemical compound [Cl-].[Cl-].CC1=Cc2ccccc2[C@H]1[Zr++]([C@@H]1C(C)=Cc2ccccc12)=[Si](C)C CGELJBSWQTYCIY-UHFFFAOYSA-L 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 239000003377 acid catalyst Substances 0.000 description 1
- 238000013019 agitation Methods 0.000 description 1
- 150000001335 aliphatic alkanes Chemical class 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 239000012876 carrier material Substances 0.000 description 1
- 238000012512 characterization method Methods 0.000 description 1
- 239000013043 chemical agent Substances 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 125000001309 chloro group Chemical group Cl* 0.000 description 1
- KOPOQZFJUQMUML-UHFFFAOYSA-N chlorosilane Chemical class Cl[SiH3] KOPOQZFJUQMUML-UHFFFAOYSA-N 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 229940125782 compound 2 Drugs 0.000 description 1
- 239000013078 crystal Substances 0.000 description 1
- 150000001924 cycloalkanes Chemical class 0.000 description 1
- IDASTKMEQGPVRR-UHFFFAOYSA-N cyclopenta-1,3-diene;zirconium(2+) Chemical compound [Zr+2].C=1C=C[CH-]C=1.C=1C=C[CH-]C=1 IDASTKMEQGPVRR-UHFFFAOYSA-N 0.000 description 1
- 238000006114 decarboxylation reaction Methods 0.000 description 1
- 230000008021 deposition Effects 0.000 description 1
- 230000005595 deprotonation Effects 0.000 description 1
- 238000010537 deprotonation reaction Methods 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- DBHDFCXYVXSCAX-UHFFFAOYSA-N dimethyl-bis[2-(2-methylphenyl)-1h-inden-1-yl]silane Chemical compound CC1=CC=CC=C1C1=CC2=CC=CC=C2C1[Si](C)(C)C1C2=CC=CC=C2C=C1C1=CC=CC=C1C DBHDFCXYVXSCAX-UHFFFAOYSA-N 0.000 description 1
- 238000001704 evaporation Methods 0.000 description 1
- 230000008020 evaporation Effects 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- 238000007701 flash-distillation Methods 0.000 description 1
- 238000001640 fractional crystallisation Methods 0.000 description 1
- 230000017525 heat dissipation Effects 0.000 description 1
- DMEGYFMYUHOHGS-UHFFFAOYSA-N heptamethylene Natural products C1CCCCCC1 DMEGYFMYUHOHGS-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- UMJJFEIKYGFCAT-UHFFFAOYSA-N indan-2-one Chemical compound C1=CC=C2CC(=O)CC2=C1 UMJJFEIKYGFCAT-UHFFFAOYSA-N 0.000 description 1
- 239000004615 ingredient Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 1
- DLEDOFVPSDKWEF-UHFFFAOYSA-N lithium butane Chemical compound [Li+].CCC[CH2-] DLEDOFVPSDKWEF-UHFFFAOYSA-N 0.000 description 1
- 229910003002 lithium salt Inorganic materials 0.000 description 1
- 159000000002 lithium salts Chemical class 0.000 description 1
- 239000000395 magnesium oxide Substances 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 239000000155 melt Substances 0.000 description 1
- 238000006263 metalation reaction Methods 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 125000000896 monocarboxylic acid group Chemical group 0.000 description 1
- 239000012452 mother liquor Substances 0.000 description 1
- SYSQUGFVNFXIIT-UHFFFAOYSA-N n-[4-(1,3-benzoxazol-2-yl)phenyl]-4-nitrobenzenesulfonamide Chemical class C1=CC([N+](=O)[O-])=CC=C1S(=O)(=O)NC1=CC=C(C=2OC3=CC=CC=C3N=2)C=C1 SYSQUGFVNFXIIT-UHFFFAOYSA-N 0.000 description 1
- KAHVZNKZQFSBFW-UHFFFAOYSA-N n-methyl-n-trimethylsilylmethanamine Chemical compound CN(C)[Si](C)(C)C KAHVZNKZQFSBFW-UHFFFAOYSA-N 0.000 description 1
- 229910052758 niobium Inorganic materials 0.000 description 1
- 239000010955 niobium Substances 0.000 description 1
- GUCVJGMIXFAOAE-UHFFFAOYSA-N niobium atom Chemical compound [Nb] GUCVJGMIXFAOAE-UHFFFAOYSA-N 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- ZCYXXKJEDCHMGH-UHFFFAOYSA-N nonane Chemical compound CCCC[CH]CCCC ZCYXXKJEDCHMGH-UHFFFAOYSA-N 0.000 description 1
- BKIMMITUMNQMOS-UHFFFAOYSA-N normal nonane Natural products CCCCCCCCC BKIMMITUMNQMOS-UHFFFAOYSA-N 0.000 description 1
- TVMXDCGIABBOFY-UHFFFAOYSA-N octane Chemical compound CCCCCCCC TVMXDCGIABBOFY-UHFFFAOYSA-N 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 239000012044 organic layer Substances 0.000 description 1
- 125000002524 organometallic group Chemical group 0.000 description 1
- 230000000379 polymerizing effect Effects 0.000 description 1
- 229920002223 polystyrene Polymers 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 238000010926 purge Methods 0.000 description 1
- 238000000746 purification Methods 0.000 description 1
- 239000002516 radical scavenger Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000001953 recrystallisation Methods 0.000 description 1
- 239000012266 salt solution Substances 0.000 description 1
- VSZWPYCFIRKVQL-UHFFFAOYSA-N selanylidenegallium;selenium Chemical compound [Se].[Se]=[Ga].[Se]=[Ga] VSZWPYCFIRKVQL-UHFFFAOYSA-N 0.000 description 1
- 229910000077 silane Inorganic materials 0.000 description 1
- FDNAPBUWERUEDA-UHFFFAOYSA-N silicon tetrachloride Chemical compound Cl[Si](Cl)(Cl)Cl FDNAPBUWERUEDA-UHFFFAOYSA-N 0.000 description 1
- URGAHOPLAPQHLN-UHFFFAOYSA-N sodium aluminosilicate Chemical class [Na+].[Al+3].[O-][Si]([O-])=O.[O-][Si]([O-])=O URGAHOPLAPQHLN-UHFFFAOYSA-N 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000011877 solvent mixture Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000012798 spherical particle Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 125000001424 substituent group Chemical group 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229910052715 tantalum Inorganic materials 0.000 description 1
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 description 1
- 239000012485 toluene extract Substances 0.000 description 1
- 239000005051 trimethylchlorosilane Substances 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052720 vanadium Inorganic materials 0.000 description 1
- GPPXJZIENCGNKB-UHFFFAOYSA-N vanadium Chemical compound [V]#[V] GPPXJZIENCGNKB-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/42—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors
- C08F4/44—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides
- C08F4/60—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides together with refractory metals, iron group metals, platinum group metals, manganese, rhenium technetium or compounds thereof
- C08F4/62—Refractory metals or compounds thereof
- C08F4/639—Component covered by group C08F4/62 containing a transition metal-carbon bond
- C08F4/6392—Component covered by group C08F4/62 containing a transition metal-carbon bond containing at least one cyclopentadienyl ring, condensed or not, e.g. an indenyl or a fluorenyl ring
- C08F4/63922—Component covered by group C08F4/62 containing a transition metal-carbon bond containing at least one cyclopentadienyl ring, condensed or not, e.g. an indenyl or a fluorenyl ring containing at least two cyclopentadienyl rings, fused or not
- C08F4/63927—Component covered by group C08F4/62 containing a transition metal-carbon bond containing at least one cyclopentadienyl ring, condensed or not, e.g. an indenyl or a fluorenyl ring containing at least two cyclopentadienyl rings, fused or not two cyclopentadienyl rings being mutually bridged
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F10/00—Homopolymers and copolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F110/00—Homopolymers of unsaturated aliphatic hydrocarbons having only one carbon-to-carbon double bond
- C08F110/04—Monomers containing three or four carbon atoms
- C08F110/06—Propene
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/42—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors
- C08F4/44—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides
- C08F4/60—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides together with refractory metals, iron group metals, platinum group metals, manganese, rhenium technetium or compounds thereof
- C08F4/62—Refractory metals or compounds thereof
- C08F4/639—Component covered by group C08F4/62 containing a transition metal-carbon bond
- C08F4/63912—Component covered by group C08F4/62 containing a transition metal-carbon bond in combination with an organoaluminium compound
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F4/00—Polymerisation catalysts
- C08F4/42—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors
- C08F4/44—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides
- C08F4/60—Metals; Metal hydrides; Metallo-organic compounds; Use thereof as catalyst precursors selected from light metals, zinc, cadmium, mercury, copper, silver, gold, boron, gallium, indium, thallium, rare earths or actinides together with refractory metals, iron group metals, platinum group metals, manganese, rhenium technetium or compounds thereof
- C08F4/62—Refractory metals or compounds thereof
- C08F4/639—Component covered by group C08F4/62 containing a transition metal-carbon bond
- C08F4/63916—Component covered by group C08F4/62 containing a transition metal-carbon bond supported on a carrier, e.g. silica, MgCl2, polymer
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F2500/00—Characteristics or properties of obtained polyolefins; Use thereof
- C08F2500/15—Isotactic
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Crystallography & Structural Chemistry (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Transition And Organic Metals Composition Catalysts For Addition Polymerization (AREA)
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US6674093A | 1993-05-25 | 1993-05-25 | |
| PCT/US1994/005636 WO1994028034A1 (en) | 1993-05-25 | 1994-05-20 | Supported metallocene catalyst systems for the polymerization of olefins, preparation and use thereof |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE69408989D1 DE69408989D1 (de) | 1998-04-16 |
| DE69408989T2 true DE69408989T2 (de) | 1998-11-05 |
Family
ID=22071387
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE69408989T Expired - Lifetime DE69408989T2 (de) | 1993-05-25 | 1994-05-20 | Metallocen-katalysatorsysteme auf einem träger für die olefinpolymerisation, ihre herstellung und verwendung |
Country Status (14)
Families Citing this family (117)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| TW454020B (en) † | 1994-08-09 | 2001-09-11 | Mitsui Chemicals Inc | Olefin polymerization catalyst |
| DE69520370T2 (de) | 1994-12-15 | 2001-10-31 | Exxon Chemical Patents, Inc. | Polymerisationskatalysatorsysteme, ihre herstellung und ihre verwendung |
| PT743324E (pt) * | 1995-05-16 | 2003-01-31 | Univation Tech Llc | Producao de polietileno usando metalocenos estereoisomericos |
| UA47394C2 (uk) * | 1995-05-16 | 2002-07-15 | Юнівейшн Текнолоджіз, Ллс | Етиленовий полімер, який має підвищену придатність до обробки та вирiб, що містить етиленовий полімер |
| DE69620760T2 (de) * | 1995-07-06 | 2002-12-05 | Exxonmobil Chemical Patents Inc., Baytown | Verfahren zur herstellung von polymerisierten geträgerten metallocenkatalysatorsystemen |
| US6156845A (en) * | 1995-10-18 | 2000-12-05 | Chisso Corporation | Polyolefin composition and method of making |
| DE19548288A1 (de) | 1995-12-22 | 1997-06-26 | Hoechst Ag | Geträgertes Katalysatorsystem, Verfahren zu seiner Herstellung und seine Verwendung zur Polymerisation von Olefinen |
| FI104825B (fi) | 1996-01-26 | 2000-04-14 | Borealis As | Olefiinien polymerointikatalysaattorisysteemi, sen valmistus ja käyttö |
| FI104826B (fi) * | 1996-01-30 | 2000-04-14 | Borealis As | Heteroatomilla substituoituja metalloseeniyhdisteitä olefiinipolymerointikatalyytti-systeemejä varten ja menetelmä niiden valmistamiseksi |
| US6225426B1 (en) * | 1996-04-10 | 2001-05-01 | Uniroyal Chemical Company, Inc. | Process for producing polyolefin elastomer employing a metallocene catalyst |
| EP0909279B1 (de) | 1996-07-04 | 2001-04-25 | Basf Aktiengesellschaft | Verfahren zur herstellung von geträgerten übergangsmetallkatalysatoren |
| CN1231678A (zh) * | 1996-09-24 | 1999-10-13 | 埃克森化学专利公司 | 制备载体上的金属茂催化剂体系的改进方法 |
| US6245856B1 (en) | 1996-12-17 | 2001-06-12 | Exxon Chemical Patents, Inc. | Thermoplastic olefin compositions |
| DE19703502A1 (de) | 1997-01-31 | 1998-08-06 | Basf Ag | Nicht selbstentzündlicher Feststoff |
| KR100564500B1 (ko) | 1997-02-07 | 2006-03-29 | 엑손모빌 케미칼 패턴츠 인코포레이티드 | 폴리에틸렌 마크로머를 혼입한 프로필렌 중합체 |
| TW425414B (en) * | 1997-02-18 | 2001-03-11 | Chisso Corp | Preactivated catalyst for olefin (co)polymerization, catalyst for olefin (co)polymerization and olefin (co)polymer composition and their manufacturing method |
| DE19757563A1 (de) * | 1997-03-07 | 1999-07-08 | Targor Gmbh | Geträgertes Katalysatorsystem, Verfahren zur Herstellung und seine Verwendung zur Polymerisation von Olefinen |
| WO1998044042A1 (fr) | 1997-04-02 | 1998-10-08 | Chisso Corporation | Composition (co)polymere d'olefine modifiee, procede pour preparer cette composition et produit moule de cette composition (co)polymere |
| US6143683A (en) * | 1997-04-09 | 2000-11-07 | Fina Technology, Inc. | Metallocene catalyst and catalyst system for polymerizing an olefin having at least 3 carbon atoms |
| US6303696B1 (en) | 1997-04-11 | 2001-10-16 | Chisso Corporation | Propylene (co)polymer composition using metallocene catalyst |
| TW504515B (en) | 1997-08-07 | 2002-10-01 | Chisso Corp | Olefin (co)polymer composition |
| EP1004603B1 (en) | 1997-08-15 | 2003-01-15 | Chisso Corporation | Polydisperse propylene polymer and process for producing the same |
| JP3695331B2 (ja) * | 1997-10-22 | 2005-09-14 | チッソ株式会社 | メタロセン担持型触媒およびその製造方法、ならびにオレフィン重合体の製造方法 |
| US6197910B1 (en) | 1997-12-10 | 2001-03-06 | Exxon Chemical Patents, Inc. | Propylene polymers incorporating macromers |
| US6117962A (en) * | 1997-12-10 | 2000-09-12 | Exxon Chemical Patents Inc. | Vinyl-containing stereospecific polypropylene macromers |
| US6184327B1 (en) | 1997-12-10 | 2001-02-06 | Exxon Chemical Patents, Inc. | Elastomeric propylene polymers |
| EP1042376B1 (en) * | 1997-12-23 | 2003-05-21 | ExxonMobil Chemical Patents Inc. | Ethylene polymerization process in a liquid reaction medium |
| DE19811934A1 (de) | 1998-03-19 | 1999-09-23 | Basf Ag | Ethylencopolymere mit enger Comonomerverteilung |
| US6306960B1 (en) | 1998-05-13 | 2001-10-23 | Exxonmobil Chemical Patents Inc. | Articles formed from foamable polypropylene polymer |
| US6784269B2 (en) | 1998-05-13 | 2004-08-31 | Exxonmobil Chemical Patents Inc. | Polypropylene compositions methods of making the same |
| HK1039495B (zh) | 1998-05-13 | 2004-10-08 | 埃克森美孚化学专利公司 | 丙烯均聚物及其制备方法 |
| DE19821949A1 (de) | 1998-05-15 | 1999-11-18 | Basf Ag | Verfahren zur Herstellung geträgerter Katalysatoren |
| DE19833170A1 (de) | 1998-07-23 | 2000-01-27 | Targor Gmbh | Verfahren zur Herstellung eines metallhaltigen Trägerkatalysators oder einer Trägerkatalysatorkomponente durch Tränkung einer Trägersubstanz |
| MXPA01002023A (es) | 1998-08-26 | 2003-10-14 | Exxonmobil Chem Patents Inc | Composiciones de polipropileno ramificado. |
| DE19949235A1 (de) | 1998-10-16 | 2000-05-11 | Chisso Corp | Propylen/Ethylen/alpha-Olefin-Terpolymere und Verfahren zu ihrer Herstellung |
| GB9826874D0 (en) | 1998-12-07 | 1999-01-27 | Borealis As | Process |
| US6555633B1 (en) * | 1999-01-21 | 2003-04-29 | Idemitsu Petrochemical Co., Ltd. | Catalysts for α-olefin production and processes for producing α-olefin |
| KR100367463B1 (ko) * | 1999-03-03 | 2003-01-14 | 주식회사 엘지화학 | 메탈로센 화합물 및 이를 이용한 올레핀 중합 |
| US6174930B1 (en) | 1999-04-16 | 2001-01-16 | Exxon Chemical Patents, Inc. | Foamable polypropylene polymer |
| DE19927766A1 (de) | 1999-06-17 | 2000-12-21 | Basf Ag | Trägerkatalysator zur Olefinpolymerisation |
| DE60018775T2 (de) * | 1999-10-02 | 2005-08-11 | Borealis Technology Oy | Geträgerter und modifizierter katalysator für die polymerisation von olefine |
| WO2001032758A1 (en) | 1999-11-04 | 2001-05-10 | Exxon Chemical Patents Inc. | Propylene copolymer foams and their use |
| DE19957384A1 (de) | 1999-11-29 | 2001-05-31 | Targor Gmbh | Hochmolekulares Polypropylen mit breiter Molekulargewichtsverteilung und geringer isotaktischer Sequenzlänge |
| AU2001272433A1 (en) | 2000-05-31 | 2001-12-11 | Basell Polyolefine Gmbh | Method for producing transition metal compounds and their use for the polymerization of olefins |
| GB0023662D0 (en) | 2000-09-27 | 2000-11-08 | Borealis Tech Oy | Supported catalyst |
| DE10057009A1 (de) | 2000-11-17 | 2002-05-29 | Celanese Ventures Gmbh | Non-Metallocene, Verfahren zur Herstellung von diesen und deren Verwendung zur Polymerisation von Olefinen |
| US7074863B2 (en) | 2001-06-22 | 2006-07-11 | Borealis Technology Oy | Metallocene catalysts containing an idenyl moiety substituted at the 4,-5,-6- or 7-position by a siloxy or germyloxy group |
| DE10130229A1 (de) | 2001-06-22 | 2003-01-02 | Celanese Ventures Gmbh | Non-Metallocene, Verfahren zur Herstellung von diesen und deren Verwendung zur Polymerisation von Olefinen |
| JP2005522406A (ja) | 2001-06-29 | 2005-07-28 | エクソンモービル・ケミカル・パテンツ・インク | メタロセン及び該メタロセン由来の触媒組成物 |
| DE60137638D1 (de) | 2001-12-19 | 2009-03-26 | Borealis Tech Oy | Herstellung von geträgerten Katalysatoren für die Olefinpolymerisation |
| EP1323747A1 (en) | 2001-12-19 | 2003-07-02 | Borealis Technology Oy | Production of olefin polymerisation catalysts |
| EP1860130A1 (en) * | 2002-01-31 | 2007-11-28 | Mitsubishi Chemical Corporation | Soft propylene-based resin composition |
| DE10208252A1 (de) | 2002-02-26 | 2003-09-04 | Celanese Ventures Gmbh | Konvalent fixierte Non-Metallocene, Verfahren zur Herstellung von diesen und deren Verwendung zur Polymerisation von Olefinen |
| DE10213191A1 (de) | 2002-03-23 | 2003-10-02 | Celanese Ventures Gmbh | Non-Metallocene, Verfahren zur Herstellung von diesen und deren Verwendung zur Polymerisation von Olefinen |
| JP2005525897A (ja) | 2002-05-13 | 2005-09-02 | エス．シー． ジョンソン アンド サン、インコーポレイテッド | 調和した芳香・光・音の発生 |
| US6884749B2 (en) * | 2002-10-17 | 2005-04-26 | Equistar Chemicals L.P. | Supported catalysts which reduce sheeting in olefin polymerization, process for the preparation and the use thereof |
| AU2004212459B2 (en) | 2003-02-07 | 2010-03-11 | S.C. Johnson & Son, Inc. | Diffuser with light emitting diode nightlight |
| US7285608B2 (en) | 2004-04-21 | 2007-10-23 | Novolen Technology Holdings C.V. | Metallocene ligands, metallocene compounds and metallocene catalysts, their synthesis and their use for the polymerization of olefins |
| US7169864B2 (en) | 2004-12-01 | 2007-01-30 | Novolen Technology Holdings, C.V. | Metallocene catalysts, their synthesis and their use for the polymerization of olefins |
| CN100595216C (zh) | 2004-12-31 | 2010-03-24 | 保瑞利斯技术公司 | 制备烯烃聚合催化剂的方法 |
| KR101289946B1 (ko) * | 2005-03-23 | 2013-07-26 | 바젤 폴리올레핀 게엠베하 | 올레핀의 중합 방법 |
| US7281811B2 (en) | 2005-03-31 | 2007-10-16 | S. C. Johnson & Son, Inc. | Multi-clarity lenses |
| USD541922S1 (en) | 2005-03-31 | 2007-05-01 | S.C. Johnson & Son, Inc. | Diffuser |
| US7643734B2 (en) | 2005-03-31 | 2010-01-05 | S.C. Johnson & Son, Inc. | Bottle eject mechanism |
| USD542400S1 (en) | 2005-03-31 | 2007-05-08 | S.C. Johnson & Son, Inc. | Diffuser |
| US7589340B2 (en) | 2005-03-31 | 2009-09-15 | S.C. Johnson & Son, Inc. | System for detecting a container or contents of the container |
| US7232869B2 (en) | 2005-05-17 | 2007-06-19 | Novolen Technology Holdings, C.V. | Catalyst composition for olefin polymerization |
| DE102005052654A1 (de) * | 2005-11-04 | 2007-05-16 | Ticona Gmbh | Verfahren zur Herstellung von ultrahochmolekularen Polymeren unter Verwendung von speziellen verbrückten Metallocen-Katalysatoren |
| US7598329B2 (en) | 2005-11-04 | 2009-10-06 | Ticona Gmbh | Process for manufacturing ultra high molecular weight polymers using novel bridged metallocene catalysts |
| US8034886B2 (en) | 2005-11-04 | 2011-10-11 | Ticona Gmbh | Process for manufacturing high to ultra high molecular weight polymers using novel bridged metallocene catalysts |
| ES2588577T3 (es) | 2005-12-30 | 2016-11-03 | Borealis Technology Oy | Partículas de catalizador |
| KR101364329B1 (ko) * | 2006-02-02 | 2014-02-18 | 바젤 폴리올레핀 게엠베하 | 프로필렌 용융 취입 수지, 이로부터 제조된 프로필렌 용융 취입 수지 섬유 및 부직포, 및 이의 제조 방법 |
| ES2558256T3 (es) | 2006-07-10 | 2016-02-02 | Borealis Technology Oy | Películas de polipropileno orientadas biaxialmente |
| EP1883080B1 (en) | 2006-07-10 | 2009-01-21 | Borealis Technology Oy | Electrical insulation film |
| EP1900764B1 (en) | 2006-08-25 | 2009-04-01 | Borealis Technology Oy | Polypropylene foam |
| EP1967547A1 (en) | 2006-08-25 | 2008-09-10 | Borealis Technology OY | Extrusion coated substrate |
| DE602006008470D1 (de) | 2006-08-25 | 2009-09-24 | Borealis Tech Oy | Geblasene Polypropylenfolie |
| ATE462189T1 (de) | 2006-09-25 | 2010-04-15 | Borealis Tech Oy | Koaxiales kabel |
| ES2322186T3 (es) | 2006-12-28 | 2009-06-17 | Borealis Technology Oy | Proceso para la fabricacion de polipropileno ramificado. |
| EP1990353B1 (en) | 2007-05-08 | 2009-08-05 | Borealis Technology Oy | Electrical insulation film |
| BRPI0703586B1 (pt) | 2007-10-19 | 2018-02-06 | Braskem S.A | Catalisador metaloceno suportado, e, copolímeros de etileno com alfa-olefinas de alto e ultra alto peso molecular |
| WO2009054833A2 (en) | 2007-10-25 | 2009-04-30 | Novolen Technology Holdings, C.V. | Metallocene compounds, catalysts comprising them, process for producing an olefin polymer by use of the catalysts, and olefin homo and copolymers |
| US8168556B2 (en) | 2007-10-25 | 2012-05-01 | Lummus Novolen Technology Gmbh | Racemoselective synthesis of ansa-metallocene compounds, ansa-metallocene compounds, catalysts comprising them, process for producing an olefin polymer by use of the catalysts, and olefin homo- and copolymers |
| KR20100101092A (ko) | 2007-10-25 | 2010-09-16 | 루머스 노보렌 테크놀로지 게엠베하 | 메탈로센 화합물, 이를 포함하는 촉매, 이 촉매를 사용한 올레핀 폴리머생산방법, 및 올레핀 호모- 및 코폴리머 |
| EP2075284B1 (en) | 2007-12-17 | 2013-05-29 | Borealis Technology OY | Heterophasic polypropylene with high flowability and excellent low temperature impact properties |
| ES2337195T5 (es) | 2007-12-18 | 2013-03-01 | Borealis Technology Oy | Polipropileno heterofásico con elevadas propiedades de impacto |
| EP2113541A1 (en) | 2008-04-28 | 2009-11-04 | Borealis AG | Adhesive propylene polymer composition suitable for extrusion coating of paper substrates |
| EP2133389A1 (en) | 2008-06-12 | 2009-12-16 | Borealis AG | Polypropylene composition |
| US7960486B2 (en) | 2008-08-08 | 2011-06-14 | Sumitomo Chemical Company, Limited | Process for producing olefin polymer |
| US20100036068A1 (en) | 2008-08-08 | 2010-02-11 | Sumitomo Chemical Company, Limited | Hydrogenation catalyst and process for producing olefin polymer |
| US7897705B2 (en) | 2008-08-08 | 2011-03-01 | Sumitomo Chemical Company, Limited | Process for producing olefin polymer |
| KR100992715B1 (ko) | 2008-08-21 | 2010-11-05 | 삼성토탈 주식회사 | 폴리올레핀 중합용 촉매의 제조방법 및 그를 이용한 폴리올레핀 중합체 제조방법 |
| JP2010065068A (ja) | 2008-09-08 | 2010-03-25 | Sumitomo Chemical Co Ltd | ポリオレフィンの製造装置および製造方法 |
| EP2355927B1 (en) | 2008-11-07 | 2015-03-04 | Borealis AG | Solid catalyst composition |
| EP2184301A1 (en) | 2008-11-07 | 2010-05-12 | Borealis AG | Process for the preparation of a hafnium catalyst system |
| ATE495204T1 (de) | 2008-11-18 | 2011-01-15 | Borealis Ag | Statistisches propylen/hexen-copolymer, das in gegenwart eines metallocen-katalysators hergestellt wird |
| EP2319885B1 (en) | 2009-10-29 | 2011-12-21 | Borealis AG | Heterophasic polypropylene resin with long chain branching |
| EP2316882A1 (en) | 2009-10-29 | 2011-05-04 | Borealis AG | Heterophasic polypropylene resin |
| EP2325248B1 (en) | 2009-11-16 | 2012-05-16 | Borealis AG | Melt blown fibers of polypropylene compositions |
| EP2330136B1 (en) | 2009-12-07 | 2013-08-28 | Borealis AG | Process for the preparation of an unsupported, solid metallocene catalyst system and its use in polymerization of olefins |
| US8859451B2 (en) | 2009-12-18 | 2014-10-14 | Basell Polyolefine Gmbh | Process for the preparation of supported catalysts |
| EP2338920A1 (en) | 2009-12-22 | 2011-06-29 | Borealis AG | Preparation of single-site catalysts |
| EP2516484A1 (en) | 2009-12-22 | 2012-10-31 | Borealis AG | Preparation of polypropylene in the presence of a single-site catalyst |
| ES2535323T3 (es) | 2009-12-22 | 2015-05-08 | Borealis Ag | Preparación de catalizadores de sitio único |
| EP2341086A1 (en) | 2009-12-30 | 2011-07-06 | Borealis AG | Bopp-film |
| EP2341088B1 (en) | 2009-12-30 | 2012-06-20 | Borealis AG | BOPP with homogeneous film morphology |
| EP2385073A1 (en) | 2010-05-07 | 2011-11-09 | Borealis AG | Process for the preparation of a solid metallocene catalyst system and its use in polymerisation of olefins |
| EP2386584A1 (en) | 2010-05-11 | 2011-11-16 | Borealis AG | Polypropylene composition suitable for extrusion coating |
| EP2418237A1 (en) | 2010-08-12 | 2012-02-15 | Borealis AG | Easy tear polypropylene film without notch |
| EP2743293B1 (en) | 2010-08-12 | 2016-11-30 | Borealis AG | Easy tear polypropylene film without notch |
| EP2426171A1 (en) | 2010-08-30 | 2012-03-07 | Borealis AG | Heterophasic polypropylene with high flowability and enhanced mechanical properties |
| EP2492293B1 (en) | 2011-02-28 | 2017-09-20 | Borealis AG | Polypropylene composition suitable for extrusion coating |
| EP2520425B1 (en) | 2011-05-02 | 2017-11-08 | Borealis AG | Polypropylene for foam and polypropylene foam |
| EP2573091A1 (en) | 2011-09-23 | 2013-03-27 | Lummus Novolen Technology Gmbh | Process for recycling of free ligand from their corresponding metallocene complexes |
| WO2018091653A1 (en) | 2016-11-18 | 2018-05-24 | Borealis Ag | Catalyst |
| KR102225972B1 (ko) * | 2016-12-06 | 2021-03-09 | 주식회사 엘지화학 | 폴리프로필렌의 제조 방법 |
| CN112409515B (zh) * | 2019-08-23 | 2023-10-20 | 中国石油化工股份有限公司 | 茂金属聚丙烯催化剂的制备方法 |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| SU427022A1 (ru) * | 1972-03-16 | 1974-05-05 | Способ получения карбоцепных линейных полимеров | |
| KR920006464B1 (ko) * | 1988-09-14 | 1992-08-07 | 미쓰이 세끼유 가가꾸 고오교오 가부시끼가이샤 | 올레핀중합용 촉매성분, 올레핀중합용 촉매 및 이 올레핀중합용 촉매를 사용한 올레핀의 중합방법 |
| DE3916553A1 (de) * | 1989-05-20 | 1990-11-22 | Hoechst Ag | Syndio- isoblockpolymer und verfahren zu seiner herstellung |
| DE3942364A1 (de) * | 1989-12-21 | 1991-06-27 | Hoechst Ag | Verfahren zur herstellung einer polypropylen-formmasse |
| ES2091273T3 (es) * | 1990-11-12 | 1996-11-01 | Hoechst Ag | Procedimiento para la preparacion de un polimero olefinico de alto peso molecular. |
| DE4119343A1 (de) * | 1991-06-12 | 1992-12-17 | Basf Ag | Isolierbares, getraegertes katalysatorsystem zur polymerisation von c(pfeil abwaerts)2(pfeil abwaerts)- bis c(pfeil abwaerts)1(pfeil abwaerts)(pfeil abwaerts)0(pfeil abwaerts)-alk-1-enen |
| TW300901B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1991-08-26 | 1997-03-21 | Hoechst Ag | |
| FI112233B (fi) * | 1992-04-01 | 2003-11-14 | Basell Polyolefine Gmbh | Katalyytti olefiinipolymerointia varten, menetelmä sen valmistamiseksi ja sen käyttö |
| JP3193110B2 (ja) * | 1992-04-15 | 2001-07-30 | 三菱化学株式会社 | プロピレン重合体の製造法 |
| US5240894A (en) * | 1992-05-18 | 1993-08-31 | Exxon Chemical Patents Inc. | Method for making and using a supported metallocene catalyst system |
| TW294669B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) * | 1992-06-27 | 1997-01-01 | Hoechst Ag |
-
1994
- 1994-05-20 AU AU70413/94A patent/AU683899B2/en not_active Expired
- 1994-05-20 EP EP94919175A patent/EP0705281B1/en not_active Expired - Lifetime
- 1994-05-20 KR KR1019950705272A patent/KR100314971B1/ko not_active Expired - Lifetime
- 1994-05-20 DE DE69408989T patent/DE69408989T2/de not_active Expired - Lifetime
- 1994-05-20 CA CA002163789A patent/CA2163789C/en not_active Expired - Lifetime
- 1994-05-20 CN CN94192752A patent/CN1043474C/zh not_active Expired - Lifetime
- 1994-05-20 JP JP50080295A patent/JP3626186B2/ja not_active Expired - Lifetime
- 1994-05-20 WO PCT/US1994/005636 patent/WO1994028034A1/en active IP Right Grant
- 1994-05-20 RU RU95122079A patent/RU2126017C1/ru active
- 1994-05-20 ES ES94919175T patent/ES2117279T3/es not_active Expired - Lifetime
- 1994-05-24 ZA ZA943595A patent/ZA943595B/xx unknown
- 1994-06-06 TW TW083105189A patent/TW270091B/zh not_active IP Right Cessation
-
1995
- 1995-11-24 NO NO954780A patent/NO308952B1/no not_active IP Right Cessation
- 1995-11-24 FI FI955687A patent/FI114640B/fi not_active IP Right Cessation
Also Published As
| Publication number | Publication date |
|---|---|
| DE69408989D1 (de) | 1998-04-16 |
| FI955687L (fi) | 1996-01-24 |
| CN1043474C (zh) | 1999-05-26 |
| JP3626186B2 (ja) | 2005-03-02 |
| EP0705281B1 (en) | 1998-03-11 |
| FI955687A0 (fi) | 1995-11-24 |
| RU2126017C1 (ru) | 1999-02-10 |
| ES2117279T3 (es) | 1998-08-01 |
| JPH08511044A (ja) | 1996-11-19 |
| WO1994028034A1 (en) | 1994-12-08 |
| TW270091B (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1996-02-11 |
| NO954780L (no) | 1996-01-15 |
| FI114640B (fi) | 2004-11-30 |
| CN1130912A (zh) | 1996-09-11 |
| WO1994028034A9 (en) | 1999-07-29 |
| CA2163789C (en) | 2006-10-24 |
| KR960702484A (ko) | 1996-04-27 |
| NO308952B1 (no) | 2000-11-20 |
| EP0705281A1 (en) | 1996-04-10 |
| KR100314971B1 (ko) | 2002-07-03 |
| CA2163789A1 (en) | 1994-12-08 |
| ZA943595B (en) | 1995-12-14 |
| AU7041394A (en) | 1994-12-20 |
| AU683899B2 (en) | 1997-11-27 |
| NO954780D0 (no) | 1995-11-24 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE69408989T2 (de) | Metallocen-katalysatorsysteme auf einem träger für die olefinpolymerisation, ihre herstellung und verwendung | |
| EP0549900B1 (de) | Metallocene mit benzokondensierten Indenylderivaten als Liganden, Verfahren zu ihrer Herstellung und ihre Verwendung als Katalysatoren | |
| EP0545303B1 (de) | Verfahren zur Herstellung eines hochmolekularen Olefinpolymers | |
| EP1054911B1 (de) | Katalysatorsystem, verfahren zu seiner herstellung und seine verwendung zur polymerisation von olefinen | |
| EP1396495B1 (de) | Metallocenmonohalogenide | |
| DE69315471T2 (de) | Katalysator für die Olefinpolymerisation, Verfahren zu seiner Herstellung und seine Verwendung | |
| EP0659757B1 (de) | Metallocenverbindung | |
| DE69416721T2 (de) | Silylverbrückte Metallocene, und ihre Verwendung | |
| EP0790076A2 (de) | Katalysatoren, die Metallocene mit arylsubstituierten Indenylderivaten als Liganden enthalten, Verfahren und Zwischenprodukte zur Herstllung dieser Metallocene und ihre Verwendung | |
| WO1998040416A1 (de) | Geträgertes katalysatorsystem, verfahren zu seiner herstellung und seine verwendung zur polymerisation von olefinen | |
| EP0485822A2 (de) | Verfahren zur Herstellung eines hochmolekularen Olefinpolymers | |
| EP1133504A1 (de) | Verfahren zur herstellung von monoaryloxy-ansa-metallocenen | |
| EP1082363A1 (de) | Organometallverbindung, katalysatorsystem enthaltend diese organometallverbindung und seine verwendung | |
| US5932669A (en) | Metallocenes having benzo-fused indenyl derivatives as ligands, processes for their preparation and their use as catalysts | |
| EP0839824B1 (de) | Metallocene mit teilhydrierten pi-Liganden | |
| EP0836608B1 (de) | Metallocene mit silylsubstituierten brücken und deren einsatz für die olefinpolymerisation | |
| EP1003757B1 (de) | Verfahren zur herstellung von metallocenen | |
| EP0557718B1 (de) | Katalysator für die Olefinpolymerisation, Verfahren zu seiner Herstellung und seine Verwendung | |
| DE69632128T2 (de) | Verfahren zur herstellung eines vorpolymerisierten katalysators | |
| WO2000031089A1 (de) | Verfahren zur aufreinigung von metallocenen | |
| EP0780402B1 (de) | Geträgertes Katalysatorensystem, Verfahren zu seiner Herstellung und seine Verwendung zur Polymerisation von Olefinen | |
| DE19900585A1 (de) | Verfahren zur Aufreinigung von Metallocenen | |
| DE19912576A1 (de) | Verfahren zur Herstellung von Monoaryloxy-Ansa-Metallocenen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8364 | No opposition during term of opposition |