DE3518770A1 - Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung - Google Patents
Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellungInfo
- Publication number
- DE3518770A1 DE3518770A1 DE19853518770 DE3518770A DE3518770A1 DE 3518770 A1 DE3518770 A1 DE 3518770A1 DE 19853518770 DE19853518770 DE 19853518770 DE 3518770 A DE3518770 A DE 3518770A DE 3518770 A1 DE3518770 A1 DE 3518770A1
- Authority
- DE
- Germany
- Prior art keywords
- acid
- component
- mixture
- compounds
- alkylene
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 239000011230 binding agent Substances 0.000 title claims description 34
- 238000000034 method Methods 0.000 title claims description 17
- 238000004519 manufacturing process Methods 0.000 title claims description 13
- 239000002253 acid Substances 0.000 claims description 70
- 150000001875 compounds Chemical class 0.000 claims description 62
- 238000006243 chemical reaction Methods 0.000 claims description 51
- 239000000203 mixture Substances 0.000 claims description 49
- -1 preferably η-butyl Chemical group 0.000 claims description 34
- XYFCBTPGUUZFHI-UHFFFAOYSA-N Phosphine Chemical compound P XYFCBTPGUUZFHI-UHFFFAOYSA-N 0.000 claims description 30
- 239000004593 Epoxy Substances 0.000 claims description 26
- 150000003839 salts Chemical class 0.000 claims description 22
- 235000013824 polyphenols Nutrition 0.000 claims description 19
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 claims description 18
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 claims description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 claims description 17
- 125000002091 cationic group Chemical group 0.000 claims description 15
- 125000003700 epoxy group Chemical group 0.000 claims description 15
- LNEPOXFFQSENCJ-UHFFFAOYSA-N haloperidol Chemical class C1CC(O)(C=2C=CC(Cl)=CC=2)CCN1CCCC(=O)C1=CC=C(F)C=C1 LNEPOXFFQSENCJ-UHFFFAOYSA-N 0.000 claims description 15
- 229910000073 phosphorus hydride Inorganic materials 0.000 claims description 15
- 150000008442 polyphenolic compounds Chemical class 0.000 claims description 15
- 125000000217 alkyl group Chemical group 0.000 claims description 14
- 125000004432 carbon atom Chemical group C* 0.000 claims description 14
- 125000002887 hydroxy group Chemical group [H]O* 0.000 claims description 12
- 239000003431 cross linking reagent Substances 0.000 claims description 11
- 150000003512 tertiary amines Chemical class 0.000 claims description 11
- 238000004070 electrodeposition Methods 0.000 claims description 10
- 239000003973 paint Substances 0.000 claims description 10
- 229920000768 polyamine Polymers 0.000 claims description 10
- 239000003054 catalyst Substances 0.000 claims description 9
- 229920000728 polyester Polymers 0.000 claims description 9
- 150000003335 secondary amines Chemical class 0.000 claims description 9
- 239000007795 chemical reaction product Substances 0.000 claims description 8
- 150000002118 epoxides Chemical group 0.000 claims description 8
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 8
- 125000003118 aryl group Chemical group 0.000 claims description 7
- 229920001021 polysulfide Polymers 0.000 claims description 7
- 150000003141 primary amines Chemical class 0.000 claims description 7
- RWSOTUBLDIXVET-UHFFFAOYSA-O sulfonium Chemical compound [SH3+] RWSOTUBLDIXVET-UHFFFAOYSA-O 0.000 claims description 7
- 125000003396 thiol group Chemical group [H]S* 0.000 claims description 7
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 6
- 238000000576 coating method Methods 0.000 claims description 6
- 229920000570 polyether Polymers 0.000 claims description 6
- 239000005077 polysulfide Substances 0.000 claims description 6
- 150000008117 polysulfides Polymers 0.000 claims description 6
- SNRUBQQJIBEYMU-UHFFFAOYSA-N Dodecane Natural products CCCCCCCCCCCC SNRUBQQJIBEYMU-UHFFFAOYSA-N 0.000 claims description 5
- 239000011248 coating agent Substances 0.000 claims description 5
- 125000003438 dodecyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 claims description 5
- 239000000654 additive Substances 0.000 claims description 4
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims description 4
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 4
- 125000005496 phosphonium group Chemical group 0.000 claims description 4
- 239000004814 polyurethane Substances 0.000 claims description 4
- 229920002635 polyurethane Polymers 0.000 claims description 4
- 230000005588 protonation Effects 0.000 claims description 4
- 239000000758 substrate Substances 0.000 claims description 4
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 claims description 3
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 3
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 claims description 3
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 claims description 3
- GYZLOYUZLJXAJU-UHFFFAOYSA-N diglycidyl ether Chemical compound C1OC1COCC1CO1 GYZLOYUZLJXAJU-UHFFFAOYSA-N 0.000 claims description 3
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 3
- 229920000515 polycarbonate Polymers 0.000 claims description 3
- 239000004417 polycarbonate Substances 0.000 claims description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 claims description 3
- 229910052717 sulfur Inorganic materials 0.000 claims description 2
- 125000002947 alkylene group Chemical group 0.000 claims 4
- 239000004952 Polyamide Substances 0.000 claims 2
- 125000000732 arylene group Chemical group 0.000 claims 2
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 2
- 229920002647 polyamide Polymers 0.000 claims 2
- LCFVJGUPQDGYKZ-UHFFFAOYSA-N Bisphenol A diglycidyl ether Chemical compound C=1C=C(OCC2OC2)C=CC=1C(C)(C)C(C=C1)=CC=C1OCC1CO1 LCFVJGUPQDGYKZ-UHFFFAOYSA-N 0.000 claims 1
- 150000002170 ethers Chemical class 0.000 claims 1
- 239000000843 powder Substances 0.000 claims 1
- 150000001412 amines Chemical class 0.000 description 23
- 229920005989 resin Polymers 0.000 description 22
- 239000011347 resin Substances 0.000 description 22
- 239000000049 pigment Substances 0.000 description 19
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 16
- 239000005056 polyisocyanate Substances 0.000 description 14
- 229920001228 polyisocyanate Polymers 0.000 description 14
- 229920005862 polyol Polymers 0.000 description 12
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 11
- 150000007513 acids Chemical class 0.000 description 11
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 10
- 229920000647 polyepoxide Polymers 0.000 description 10
- 150000003077 polyols Chemical class 0.000 description 10
- 150000002009 diols Chemical class 0.000 description 8
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 8
- 239000003822 epoxy resin Substances 0.000 description 7
- 239000002904 solvent Substances 0.000 description 7
- FERIUCNNQQJTOY-UHFFFAOYSA-N Butyric acid Chemical compound CCCC(O)=O FERIUCNNQQJTOY-UHFFFAOYSA-N 0.000 description 6
- 239000004971 Cross linker Substances 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 6
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 6
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 6
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 6
- XBDQKXXYIPTUBI-UHFFFAOYSA-N dimethylselenoniopropionate Natural products CCC(O)=O XBDQKXXYIPTUBI-UHFFFAOYSA-N 0.000 description 6
- 238000000227 grinding Methods 0.000 description 6
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 description 6
- IISBACLAFKSPIT-UHFFFAOYSA-N bisphenol A Chemical compound C=1C=C(O)C=CC=1C(C)(C)C1=CC=C(O)C=C1 IISBACLAFKSPIT-UHFFFAOYSA-N 0.000 description 5
- 238000004132 cross linking Methods 0.000 description 5
- 238000000151 deposition Methods 0.000 description 5
- 230000008021 deposition Effects 0.000 description 5
- 239000006185 dispersion Substances 0.000 description 5
- IQPQWNKOIGAROB-UHFFFAOYSA-N isocyanate group Chemical group [N-]=C=O IQPQWNKOIGAROB-UHFFFAOYSA-N 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N nitrogen Substances N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 5
- 229920005906 polyester polyol Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- 239000007858 starting material Substances 0.000 description 5
- 239000004721 Polyphenylene oxide Substances 0.000 description 4
- KKEYFWRCBNTPAC-UHFFFAOYSA-N Terephthalic acid Chemical compound OC(=O)C1=CC=C(C(O)=O)C=C1 KKEYFWRCBNTPAC-UHFFFAOYSA-N 0.000 description 4
- YGCOKJWKWLYHTG-UHFFFAOYSA-N [[4,6-bis[bis(hydroxymethyl)amino]-1,3,5-triazin-2-yl]-(hydroxymethyl)amino]methanol Chemical compound OCN(CO)C1=NC(N(CO)CO)=NC(N(CO)CO)=N1 YGCOKJWKWLYHTG-UHFFFAOYSA-N 0.000 description 4
- 229960000583 acetic acid Drugs 0.000 description 4
- 125000001931 aliphatic group Chemical group 0.000 description 4
- 150000008064 anhydrides Chemical class 0.000 description 4
- 230000015572 biosynthetic process Effects 0.000 description 4
- 150000004985 diamines Chemical class 0.000 description 4
- 150000002334 glycols Chemical class 0.000 description 4
- 239000012948 isocyanate Substances 0.000 description 4
- 239000004310 lactic acid Substances 0.000 description 4
- 235000014655 lactic acid Nutrition 0.000 description 4
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 4
- 229910052757 nitrogen Inorganic materials 0.000 description 4
- XNGIFLGASWRNHJ-UHFFFAOYSA-N phthalic acid Chemical compound OC(=O)C1=CC=CC=C1C(O)=O XNGIFLGASWRNHJ-UHFFFAOYSA-N 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- MTZUIIAIAKMWLI-UHFFFAOYSA-N 1,2-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC=C1N=C=O MTZUIIAIAKMWLI-UHFFFAOYSA-N 0.000 description 3
- HZAXFHJVJLSVMW-UHFFFAOYSA-N 2-Aminoethan-1-ol Chemical compound NCCO HZAXFHJVJLSVMW-UHFFFAOYSA-N 0.000 description 3
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- IMNFDUFMRHMDMM-UHFFFAOYSA-N N-Heptane Chemical compound CCCCCCC IMNFDUFMRHMDMM-UHFFFAOYSA-N 0.000 description 3
- MUBZPKHOEPUJKR-UHFFFAOYSA-N Oxalic acid Chemical compound OC(=O)C(O)=O MUBZPKHOEPUJKR-UHFFFAOYSA-N 0.000 description 3
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 3
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 3
- 235000011054 acetic acid Nutrition 0.000 description 3
- 150000001346 alkyl aryl ethers Chemical class 0.000 description 3
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 3
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 3
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 3
- 239000004327 boric acid Substances 0.000 description 3
- 235000010338 boric acid Nutrition 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 239000008367 deionised water Substances 0.000 description 3
- 229910021641 deionized water Inorganic materials 0.000 description 3
- ZBCBWPMODOFKDW-UHFFFAOYSA-N diethanolamine Chemical compound OCCNCCO ZBCBWPMODOFKDW-UHFFFAOYSA-N 0.000 description 3
- MTHSVFCYNBDYFN-UHFFFAOYSA-N diethylene glycol Chemical compound OCCOCCO MTHSVFCYNBDYFN-UHFFFAOYSA-N 0.000 description 3
- JXCHMDATRWUOAP-UHFFFAOYSA-N diisocyanatomethylbenzene Chemical compound O=C=NC(N=C=O)C1=CC=CC=C1 JXCHMDATRWUOAP-UHFFFAOYSA-N 0.000 description 3
- 235000019253 formic acid Nutrition 0.000 description 3
- 239000000499 gel Substances 0.000 description 3
- 150000004658 ketimines Chemical class 0.000 description 3
- 230000004048 modification Effects 0.000 description 3
- 238000012986 modification Methods 0.000 description 3
- 125000000466 oxiranyl group Chemical group 0.000 description 3
- 235000019260 propionic acid Nutrition 0.000 description 3
- IUVKMZGDUIUOCP-BTNSXGMBSA-N quinbolone Chemical compound O([C@H]1CC[C@H]2[C@H]3[C@@H]([C@]4(C=CC(=O)C=C4CC3)C)CC[C@@]21C)C1=CCCC1 IUVKMZGDUIUOCP-BTNSXGMBSA-N 0.000 description 3
- 239000011541 reaction mixture Substances 0.000 description 3
- 239000000243 solution Substances 0.000 description 3
- 125000001424 substituent group Chemical group 0.000 description 3
- 150000003568 thioethers Chemical class 0.000 description 3
- RTBFRGCFXZNCOE-UHFFFAOYSA-N 1-methylsulfonylpiperidin-4-one Chemical compound CS(=O)(=O)N1CCC(=O)CC1 RTBFRGCFXZNCOE-UHFFFAOYSA-N 0.000 description 2
- POAOYUHQDCAZBD-UHFFFAOYSA-N 2-butoxyethanol Chemical compound CCCCOCCO POAOYUHQDCAZBD-UHFFFAOYSA-N 0.000 description 2
- YIWUKEYIRIRTPP-UHFFFAOYSA-N 2-ethylhexan-1-ol Chemical compound CCCCC(CC)CO YIWUKEYIRIRTPP-UHFFFAOYSA-N 0.000 description 2
- PMNLUUOXGOOLSP-UHFFFAOYSA-N 2-mercaptopropanoic acid Chemical compound CC(S)C(O)=O PMNLUUOXGOOLSP-UHFFFAOYSA-N 0.000 description 2
- FJKROLUGYXJWQN-UHFFFAOYSA-N 4-hydroxybenzoic acid Chemical compound OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- QUSNBJAOOMFDIB-UHFFFAOYSA-N Ethylamine Chemical compound CCN QUSNBJAOOMFDIB-UHFFFAOYSA-N 0.000 description 2
- 239000004606 Fillers/Extenders Substances 0.000 description 2
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- 239000005057 Hexamethylene diisocyanate Substances 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 description 2
- BAVYZALUXZFZLV-UHFFFAOYSA-N Methylamine Chemical compound NC BAVYZALUXZFZLV-UHFFFAOYSA-N 0.000 description 2
- QCOGKXLOEWLIDC-UHFFFAOYSA-N N-methylbutylamine Chemical compound CCCCNC QCOGKXLOEWLIDC-UHFFFAOYSA-N 0.000 description 2
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 description 2
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 description 2
- YKTSYUJCYHOUJP-UHFFFAOYSA-N [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] Chemical compound [O--].[Al+3].[Al+3].[O-][Si]([O-])([O-])[O-] YKTSYUJCYHOUJP-UHFFFAOYSA-N 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- WNLRTRBMVRJNCN-UHFFFAOYSA-N adipic acid Chemical compound OC(=O)CCCCC(O)=O WNLRTRBMVRJNCN-UHFFFAOYSA-N 0.000 description 2
- 230000001476 alcoholic effect Effects 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 2
- JFCQEDHGNNZCLN-UHFFFAOYSA-N anhydrous glutaric acid Natural products OC(=O)CCCC(O)=O JFCQEDHGNNZCLN-UHFFFAOYSA-N 0.000 description 2
- 239000002981 blocking agent Substances 0.000 description 2
- HQABUPZFAYXKJW-UHFFFAOYSA-N butan-1-amine Chemical compound CCCCN HQABUPZFAYXKJW-UHFFFAOYSA-N 0.000 description 2
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- VEZUQRBDRNJBJY-UHFFFAOYSA-N cyclohexanone oxime Chemical compound ON=C1CCCCC1 VEZUQRBDRNJBJY-UHFFFAOYSA-N 0.000 description 2
- JQVDAXLFBXTEQA-UHFFFAOYSA-N dibutylamine Chemical compound CCCCNCCCC JQVDAXLFBXTEQA-UHFFFAOYSA-N 0.000 description 2
- LJSQFQKUNVCTIA-UHFFFAOYSA-N diethyl sulfide Chemical compound CCSCC LJSQFQKUNVCTIA-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- 239000000539 dimer Substances 0.000 description 2
- 238000006735 epoxidation reaction Methods 0.000 description 2
- 150000002148 esters Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000001257 hydrogen Substances 0.000 description 2
- 229910052739 hydrogen Inorganic materials 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 150000002513 isocyanates Chemical class 0.000 description 2
- QQVIHTHCMHWDBS-UHFFFAOYSA-N isophthalic acid Chemical compound OC(=O)C1=CC=CC(C(O)=O)=C1 QQVIHTHCMHWDBS-UHFFFAOYSA-N 0.000 description 2
- 150000002596 lactones Chemical class 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 238000002156 mixing Methods 0.000 description 2
- BDJRBEYXGGNYIS-UHFFFAOYSA-N nonanedioic acid Chemical compound OC(=O)CCCCCCCC(O)=O BDJRBEYXGGNYIS-UHFFFAOYSA-N 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- NMHMNPHRMNGLLB-UHFFFAOYSA-N phloretic acid Chemical compound OC(=O)CCC1=CC=C(O)C=C1 NMHMNPHRMNGLLB-UHFFFAOYSA-N 0.000 description 2
- 150000003003 phosphines Chemical class 0.000 description 2
- 229920001281 polyalkylene Polymers 0.000 description 2
- 238000002360 preparation method Methods 0.000 description 2
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- WGYKZJWCGVVSQN-UHFFFAOYSA-N propylamine Chemical compound CCCN WGYKZJWCGVVSQN-UHFFFAOYSA-N 0.000 description 2
- 230000004044 response Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- CXMXRPHRNRROMY-UHFFFAOYSA-N sebacic acid Chemical compound OC(=O)CCCCCCCCC(O)=O CXMXRPHRNRROMY-UHFFFAOYSA-N 0.000 description 2
- 150000005846 sugar alcohols Polymers 0.000 description 2
- 239000004094 surface-active agent Substances 0.000 description 2
- CWERGRDVMFNCDR-UHFFFAOYSA-N thioglycolic acid Chemical compound OC(=O)CS CWERGRDVMFNCDR-UHFFFAOYSA-N 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 238000005809 transesterification reaction Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- YWWDBCBWQNCYNR-UHFFFAOYSA-N trimethylphosphine Chemical compound CP(C)C YWWDBCBWQNCYNR-UHFFFAOYSA-N 0.000 description 2
- RIOQSEWOXXDEQQ-UHFFFAOYSA-N triphenylphosphine Chemical compound C1=CC=CC=C1P(C=1C=CC=CC=1)C1=CC=CC=C1 RIOQSEWOXXDEQQ-UHFFFAOYSA-N 0.000 description 2
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 1
- DEQUKPCANKRTPZ-UHFFFAOYSA-N (2,3-dihydroxyphenyl)-phenylmethanone Chemical compound OC1=CC=CC(C(=O)C=2C=CC=CC=2)=C1O DEQUKPCANKRTPZ-UHFFFAOYSA-N 0.000 description 1
- HIEYJGCOXHYDTC-UHFFFAOYSA-N 1,2-diisocyanatobenzene;1,3-diisocyanatobenzene Chemical compound O=C=NC1=CC=CC(N=C=O)=C1.O=C=NC1=CC=CC=C1N=C=O HIEYJGCOXHYDTC-UHFFFAOYSA-N 0.000 description 1
- WVWYODXLKONLEM-UHFFFAOYSA-N 1,2-diisocyanatobutane Chemical compound O=C=NC(CC)CN=C=O WVWYODXLKONLEM-UHFFFAOYSA-N 0.000 description 1
- ZGDSDWSIFQBAJS-UHFFFAOYSA-N 1,2-diisocyanatopropane Chemical compound O=C=NC(C)CN=C=O ZGDSDWSIFQBAJS-UHFFFAOYSA-N 0.000 description 1
- PQDIQKXGPYOGDI-UHFFFAOYSA-N 1,3,5-triisocyanatobenzene Chemical compound O=C=NC1=CC(N=C=O)=CC(N=C=O)=C1 PQDIQKXGPYOGDI-UHFFFAOYSA-N 0.000 description 1
- UFXYYTWJETZVHG-UHFFFAOYSA-N 1,3-diisocyanatobutane Chemical compound O=C=NC(C)CCN=C=O UFXYYTWJETZVHG-UHFFFAOYSA-N 0.000 description 1
- GNQKHBSIBXSFFD-UHFFFAOYSA-N 1,3-diisocyanatocyclohexane Chemical compound O=C=NC1CCCC(N=C=O)C1 GNQKHBSIBXSFFD-UHFFFAOYSA-N 0.000 description 1
- IKYNWXNXXHWHLL-UHFFFAOYSA-N 1,3-diisocyanatopropane Chemical compound O=C=NCCCN=C=O IKYNWXNXXHWHLL-UHFFFAOYSA-N 0.000 description 1
- OVBFMUAFNIIQAL-UHFFFAOYSA-N 1,4-diisocyanatobutane Chemical compound O=C=NCCCCN=C=O OVBFMUAFNIIQAL-UHFFFAOYSA-N 0.000 description 1
- SBJCUZQNHOLYMD-UHFFFAOYSA-N 1,5-Naphthalene diisocyanate Chemical compound C1=CC=C2C(N=C=O)=CC=CC2=C1N=C=O SBJCUZQNHOLYMD-UHFFFAOYSA-N 0.000 description 1
- DFPJRUKWEPYFJT-UHFFFAOYSA-N 1,5-diisocyanatopentane Chemical compound O=C=NCCCCCN=C=O DFPJRUKWEPYFJT-UHFFFAOYSA-N 0.000 description 1
- LTIKIBFTASQKMM-UHFFFAOYSA-N 1-[bis(4-isocyanatophenyl)methyl]-4-isocyanatobenzene Chemical compound C1=CC(N=C=O)=CC=C1C(C=1C=CC(=CC=1)N=C=O)C1=CC=C(N=C=O)C=C1 LTIKIBFTASQKMM-UHFFFAOYSA-N 0.000 description 1
- OLNJLYIFHMFWIN-UHFFFAOYSA-N 1-carbamoyl-3-(6-isocyanatohexyl)urea Chemical compound NC(=O)NC(=O)NCCCCCCN=C=O OLNJLYIFHMFWIN-UHFFFAOYSA-N 0.000 description 1
- LHNRHYOMDUJLLM-UHFFFAOYSA-N 1-hexylsulfanylhexane Chemical compound CCCCCCSCCCCCC LHNRHYOMDUJLLM-UHFFFAOYSA-N 0.000 description 1
- WAPNOHKVXSQRPX-UHFFFAOYSA-N 1-phenylethanol Chemical compound CC(O)C1=CC=CC=C1 WAPNOHKVXSQRPX-UHFFFAOYSA-N 0.000 description 1
- YJJKYKYXZZCJEE-UHFFFAOYSA-N 2,2-diphenylethylphosphane Chemical compound C=1C=CC=CC=1C(CP)C1=CC=CC=C1 YJJKYKYXZZCJEE-UHFFFAOYSA-N 0.000 description 1
- FALRKNHUBBKYCC-UHFFFAOYSA-N 2-(chloromethyl)pyridine-3-carbonitrile Chemical compound ClCC1=NC=CC=C1C#N FALRKNHUBBKYCC-UHFFFAOYSA-N 0.000 description 1
- MXZROAOUCUVNHX-UHFFFAOYSA-N 2-Aminopropanol Chemical compound CCC(N)O MXZROAOUCUVNHX-UHFFFAOYSA-N 0.000 description 1
- ZNQVEEAIQZEUHB-UHFFFAOYSA-N 2-ethoxyethanol Chemical compound CCOCCO ZNQVEEAIQZEUHB-UHFFFAOYSA-N 0.000 description 1
- CFPHMAVQAJGVPV-UHFFFAOYSA-N 2-sulfanylbutanoic acid Chemical compound CCC(S)C(O)=O CFPHMAVQAJGVPV-UHFFFAOYSA-N 0.000 description 1
- DKIDEFUBRARXTE-UHFFFAOYSA-N 3-mercaptopropanoic acid Chemical compound OC(=O)CCS DKIDEFUBRARXTE-UHFFFAOYSA-N 0.000 description 1
- PLIKAWJENQZMHA-UHFFFAOYSA-N 4-aminophenol Chemical compound NC1=CC=C(O)C=C1 PLIKAWJENQZMHA-UHFFFAOYSA-N 0.000 description 1
- 229940090248 4-hydroxybenzoic acid Drugs 0.000 description 1
- ACVCIJWFRHNPBF-UHFFFAOYSA-N 6-(oxiran-2-ylmethoxy)-6-oxohexanoic acid Chemical compound OC(=O)CCCCC(=O)OCC1CO1 ACVCIJWFRHNPBF-UHFFFAOYSA-N 0.000 description 1
- RREANTFLPGEWEN-MBLPBCRHSA-N 7-[4-[[(3z)-3-[4-amino-5-[(3,4,5-trimethoxyphenyl)methyl]pyrimidin-2-yl]imino-5-fluoro-2-oxoindol-1-yl]methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid Chemical compound COC1=C(OC)C(OC)=CC(CC=2C(=NC(\N=C/3C4=CC(F)=CC=C4N(CN4CCN(CC4)C=4C(=CC=5C(=O)C(C(O)=O)=CN(C=5C=4)C4CC4)F)C\3=O)=NC=2)N)=C1 RREANTFLPGEWEN-MBLPBCRHSA-N 0.000 description 1
- WVDDGKGOMKODPV-UHFFFAOYSA-N Benzyl alcohol Chemical compound OCC1=CC=CC=C1 WVDDGKGOMKODPV-UHFFFAOYSA-N 0.000 description 1
- 229930185605 Bisphenol Natural products 0.000 description 1
- 229910001369 Brass Inorganic materials 0.000 description 1
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- HTIRHQRTDBPHNZ-UHFFFAOYSA-N Dibutyl sulfide Chemical compound CCCCSCCCC HTIRHQRTDBPHNZ-UHFFFAOYSA-N 0.000 description 1
- RPNUMPOLZDHAAY-UHFFFAOYSA-N Diethylenetriamine Chemical compound NCCNCCN RPNUMPOLZDHAAY-UHFFFAOYSA-N 0.000 description 1
- ZERULLAPCVRMCO-UHFFFAOYSA-N Dipropyl sulfide Chemical compound CCCSCCC ZERULLAPCVRMCO-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- QIGBRXMKCJKVMJ-UHFFFAOYSA-N Hydroquinone Chemical compound OC1=CC=C(O)C=C1 QIGBRXMKCJKVMJ-UHFFFAOYSA-N 0.000 description 1
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 1
- OYHQOLUKZRVURQ-HZJYTTRNSA-N Linoleic acid Chemical compound CCCCC\C=C/C\C=C/CCCCCCCC(O)=O OYHQOLUKZRVURQ-HZJYTTRNSA-N 0.000 description 1
- FYYHWMGAXLPEAU-UHFFFAOYSA-N Magnesium Chemical compound [Mg] FYYHWMGAXLPEAU-UHFFFAOYSA-N 0.000 description 1
- 229920000877 Melamine resin Polymers 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- UEEJHVSXFDXPFK-UHFFFAOYSA-N N-dimethylaminoethanol Chemical compound CN(C)CCO UEEJHVSXFDXPFK-UHFFFAOYSA-N 0.000 description 1
- OPKOKAMJFNKNAS-UHFFFAOYSA-N N-methylethanolamine Chemical compound CNCCO OPKOKAMJFNKNAS-UHFFFAOYSA-N 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 1
- 239000005062 Polybutadiene Substances 0.000 description 1
- OFOBLEOULBTSOW-UHFFFAOYSA-N Propanedioic acid Natural products OC(=O)CC(O)=O OFOBLEOULBTSOW-UHFFFAOYSA-N 0.000 description 1
- 229910000831 Steel Inorganic materials 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- YPWFISCTZQNZAU-UHFFFAOYSA-N Thiane Chemical compound C1CCSCC1 YPWFISCTZQNZAU-UHFFFAOYSA-N 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- ZJCCRDAZUWHFQH-UHFFFAOYSA-N Trimethylolpropane Chemical compound CCC(CO)(CO)CO ZJCCRDAZUWHFQH-UHFFFAOYSA-N 0.000 description 1
- 239000007983 Tris buffer Substances 0.000 description 1
- 229920001807 Urea-formaldehyde Polymers 0.000 description 1
- 229910000004 White lead Inorganic materials 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- UKLDJPRMSDWDSL-UHFFFAOYSA-L [dibutyl(dodecanoyloxy)stannyl] dodecanoate Chemical compound CCCCCCCCCCCC(=O)O[Sn](CCCC)(CCCC)OC(=O)CCCCCCCCCCC UKLDJPRMSDWDSL-UHFFFAOYSA-L 0.000 description 1
- 239000001361 adipic acid Substances 0.000 description 1
- 235000011037 adipic acid Nutrition 0.000 description 1
- 150000001334 alicyclic compounds Chemical class 0.000 description 1
- 239000003513 alkali Substances 0.000 description 1
- 125000003545 alkoxy group Chemical group 0.000 description 1
- DTOSIQBPPRVQHS-PDBXOOCHSA-N alpha-linolenic acid Chemical compound CC\C=C/C\C=C/C\C=C/CCCCCCCC(O)=O DTOSIQBPPRVQHS-PDBXOOCHSA-N 0.000 description 1
- 235000020661 alpha-linolenic acid Nutrition 0.000 description 1
- XPNGNIFUDRPBFJ-UHFFFAOYSA-N alpha-methylbenzylalcohol Natural products CC1=CC=CC=C1CO XPNGNIFUDRPBFJ-UHFFFAOYSA-N 0.000 description 1
- 229910052782 aluminium Inorganic materials 0.000 description 1
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229920003180 amino resin Polymers 0.000 description 1
- 239000002518 antifoaming agent Substances 0.000 description 1
- 229910000410 antimony oxide Inorganic materials 0.000 description 1
- 239000003963 antioxidant agent Substances 0.000 description 1
- 239000008346 aqueous phase Substances 0.000 description 1
- AYJRCSIUFZENHW-DEQYMQKBSA-L barium(2+);oxomethanediolate Chemical compound [Ba+2].[O-][14C]([O-])=O AYJRCSIUFZENHW-DEQYMQKBSA-L 0.000 description 1
- 229960004217 benzyl alcohol Drugs 0.000 description 1
- 235000019445 benzyl alcohol Nutrition 0.000 description 1
- 230000001588 bifunctional effect Effects 0.000 description 1
- 239000004841 bisphenol A epoxy resin Substances 0.000 description 1
- 230000000903 blocking effect Effects 0.000 description 1
- 239000010951 brass Substances 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 229910052793 cadmium Inorganic materials 0.000 description 1
- BDOSMKKIYDKNTQ-UHFFFAOYSA-N cadmium atom Chemical compound [Cd] BDOSMKKIYDKNTQ-UHFFFAOYSA-N 0.000 description 1
- CJOBVZJTOIVNNF-UHFFFAOYSA-N cadmium sulfide Chemical compound [Cd]=S CJOBVZJTOIVNNF-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 239000006229 carbon black Substances 0.000 description 1
- BVKZGUZCCUSVTD-UHFFFAOYSA-N carbonic acid Chemical compound OC(O)=O BVKZGUZCCUSVTD-UHFFFAOYSA-N 0.000 description 1
- HDFRDWFLWVCOGP-UHFFFAOYSA-N carbonothioic O,S-acid Chemical class OC(S)=O HDFRDWFLWVCOGP-UHFFFAOYSA-N 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- ZLFVRXUOSPRRKQ-UHFFFAOYSA-N chembl2138372 Chemical compound [O-][N+](=O)C1=CC(C)=CC=C1N=NC1=C(O)C=CC2=CC=CC=C12 ZLFVRXUOSPRRKQ-UHFFFAOYSA-N 0.000 description 1
- 238000007385 chemical modification Methods 0.000 description 1
- 125000002603 chloroethyl group Chemical group [H]C([*])([H])C([H])([H])Cl 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000004927 clay Substances 0.000 description 1
- 229910052570 clay Inorganic materials 0.000 description 1
- 239000008199 coating composition Substances 0.000 description 1
- 239000003086 colorant Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- XCJYREBRNVKWGJ-UHFFFAOYSA-N copper(II) phthalocyanine Chemical compound [Cu+2].C12=CC=CC=C2C(N=C2[N-]C(C3=CC=CC=C32)=N2)=NC1=NC([C]1C=CC=CC1=1)=NC=1N=C1[C]3C=CC=CC3=C2[N-]1 XCJYREBRNVKWGJ-UHFFFAOYSA-N 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- IFDVQVHZEKPUSC-UHFFFAOYSA-N cyclohex-3-ene-1,2-dicarboxylic acid Chemical compound OC(=O)C1CCC=CC1C(O)=O IFDVQVHZEKPUSC-UHFFFAOYSA-N 0.000 description 1
- VEIOBOXBGYWJIT-UHFFFAOYSA-N cyclohexane;methanol Chemical compound OC.OC.C1CCCCC1 VEIOBOXBGYWJIT-UHFFFAOYSA-N 0.000 description 1
- HPXRVTGHNJAIIH-UHFFFAOYSA-N cyclohexanol Chemical compound OC1CCCCC1 HPXRVTGHNJAIIH-UHFFFAOYSA-N 0.000 description 1
- XCIXKGXIYUWCLL-UHFFFAOYSA-N cyclopentanol Chemical compound OC1CCCC1 XCIXKGXIYUWCLL-UHFFFAOYSA-N 0.000 description 1
- 229960002887 deanol Drugs 0.000 description 1
- 125000005265 dialkylamine group Chemical group 0.000 description 1
- 239000012975 dibutyltin dilaurate Substances 0.000 description 1
- 150000001991 dicarboxylic acids Chemical class 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- LVTCZSBUROAWTE-UHFFFAOYSA-N diethyl(phenyl)phosphane Chemical compound CCP(CC)C1=CC=CC=C1 LVTCZSBUROAWTE-UHFFFAOYSA-N 0.000 description 1
- HPNMFZURTQLUMO-UHFFFAOYSA-N diethylamine Chemical compound CCNCC HPNMFZURTQLUMO-UHFFFAOYSA-N 0.000 description 1
- 125000005442 diisocyanate group Chemical group 0.000 description 1
- HASCQPSFPAKVEK-UHFFFAOYSA-N dimethyl(phenyl)phosphine Chemical compound CP(C)C1=CC=CC=C1 HASCQPSFPAKVEK-UHFFFAOYSA-N 0.000 description 1
- IUNMPGNGSSIWFP-UHFFFAOYSA-N dimethylaminopropylamine Chemical compound CN(C)CCCN IUNMPGNGSSIWFP-UHFFFAOYSA-N 0.000 description 1
- XXBDWLFCJWSEKW-UHFFFAOYSA-N dimethylbenzylamine Chemical compound CN(C)CC1=CC=CC=C1 XXBDWLFCJWSEKW-UHFFFAOYSA-N 0.000 description 1
- 239000012972 dimethylethanolamine Substances 0.000 description 1
- LTYMSROWYAPPGB-UHFFFAOYSA-N diphenyl sulfide Chemical compound C=1C=CC=CC=1SC1=CC=CC=C1 LTYMSROWYAPPGB-UHFFFAOYSA-N 0.000 description 1
- AAXGWYDSLJUQLN-UHFFFAOYSA-N diphenyl(propyl)phosphane Chemical compound C=1C=CC=CC=1P(CCC)C1=CC=CC=C1 AAXGWYDSLJUQLN-UHFFFAOYSA-N 0.000 description 1
- WEHWNAOGRSTTBQ-UHFFFAOYSA-N dipropylamine Chemical compound CCCNCCC WEHWNAOGRSTTBQ-UHFFFAOYSA-N 0.000 description 1
- 238000010494 dissociation reaction Methods 0.000 description 1
- 230000005593 dissociations Effects 0.000 description 1
- LQZZUXJYWNFBMV-UHFFFAOYSA-N dodecan-1-ol Chemical compound CCCCCCCCCCCCO LQZZUXJYWNFBMV-UHFFFAOYSA-N 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 125000004185 ester group Chemical group 0.000 description 1
- 230000032050 esterification Effects 0.000 description 1
- 238000005886 esterification reaction Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- AEHWKBXBXYNPCX-UHFFFAOYSA-N ethylsulfanylbenzene Chemical compound CCSC1=CC=CC=C1 AEHWKBXBXYNPCX-UHFFFAOYSA-N 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 239000000945 filler Substances 0.000 description 1
- IVJISJACKSSFGE-UHFFFAOYSA-N formaldehyde;1,3,5-triazine-2,4,6-triamine Chemical class O=C.NC1=NC(N)=NC(N)=N1 IVJISJACKSSFGE-UHFFFAOYSA-N 0.000 description 1
- 238000009472 formulation Methods 0.000 description 1
- 238000001879 gelation Methods 0.000 description 1
- 239000012362 glacial acetic acid Substances 0.000 description 1
- 235000011187 glycerol Nutrition 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- RRAMGCGOFNQTLD-UHFFFAOYSA-N hexamethylene diisocyanate Chemical compound O=C=NCCCCCCN=C=O RRAMGCGOFNQTLD-UHFFFAOYSA-N 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- 150000002443 hydroxylamines Chemical class 0.000 description 1
- 125000004464 hydroxyphenyl group Chemical group 0.000 description 1
- 238000009776 industrial production Methods 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000002329 infrared spectrum Methods 0.000 description 1
- 239000013067 intermediate product Substances 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000001282 iso-butane Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- MOUPNEIJQCETIW-UHFFFAOYSA-N lead chromate Chemical compound [Pb+2].[O-][Cr]([O-])(=O)=O MOUPNEIJQCETIW-UHFFFAOYSA-N 0.000 description 1
- PIJPYDMVFNTHIP-UHFFFAOYSA-L lead sulfate Chemical compound [PbH4+2].[O-]S([O-])(=O)=O PIJPYDMVFNTHIP-UHFFFAOYSA-L 0.000 description 1
- RYZCLUQMCYZBJQ-UHFFFAOYSA-H lead(2+);dicarbonate;dihydroxide Chemical compound [OH-].[OH-].[Pb+2].[Pb+2].[Pb+2].[O-]C([O-])=O.[O-]C([O-])=O RYZCLUQMCYZBJQ-UHFFFAOYSA-H 0.000 description 1
- 235000020778 linoleic acid Nutrition 0.000 description 1
- OYHQOLUKZRVURQ-IXWMQOLASA-N linoleic acid Natural products CCCCC\C=C/C\C=C\CCCCCCCC(O)=O OYHQOLUKZRVURQ-IXWMQOLASA-N 0.000 description 1
- 229960004488 linolenic acid Drugs 0.000 description 1
- KQQKGWQCNNTQJW-UHFFFAOYSA-N linolenic acid Natural products CC=CCCC=CCC=CCCCCCCCC(O)=O KQQKGWQCNNTQJW-UHFFFAOYSA-N 0.000 description 1
- 239000004850 liquid epoxy resins (LERs) Substances 0.000 description 1
- 229910052749 magnesium Inorganic materials 0.000 description 1
- 239000011777 magnesium Substances 0.000 description 1
- ZLNQQNXFFQJAID-UHFFFAOYSA-L magnesium carbonate Chemical compound [Mg+2].[O-]C([O-])=O ZLNQQNXFFQJAID-UHFFFAOYSA-L 0.000 description 1
- 239000001095 magnesium carbonate Substances 0.000 description 1
- 229910000021 magnesium carbonate Inorganic materials 0.000 description 1
- HCWCAKKEBCNQJP-UHFFFAOYSA-N magnesium orthosilicate Chemical compound [Mg+2].[Mg+2].[O-][Si]([O-])([O-])[O-] HCWCAKKEBCNQJP-UHFFFAOYSA-N 0.000 description 1
- 239000000391 magnesium silicate Substances 0.000 description 1
- 229910052919 magnesium silicate Inorganic materials 0.000 description 1
- 235000019792 magnesium silicate Nutrition 0.000 description 1
- VZCYOOQTPOCHFL-UPHRSURJSA-N maleic acid Chemical compound OC(=O)\C=C/C(O)=O VZCYOOQTPOCHFL-UPHRSURJSA-N 0.000 description 1
- 239000011976 maleic acid Substances 0.000 description 1
- 150000002739 metals Chemical class 0.000 description 1
- UJNZOIKQAUQOCN-UHFFFAOYSA-N methyl(diphenyl)phosphane Chemical compound C=1C=CC=CC=1P(C)C1=CC=CC=C1 UJNZOIKQAUQOCN-UHFFFAOYSA-N 0.000 description 1
- 238000003801 milling Methods 0.000 description 1
- 238000006011 modification reaction Methods 0.000 description 1
- QOHMWDJIBGVPIF-UHFFFAOYSA-N n',n'-diethylpropane-1,3-diamine Chemical compound CCN(CC)CCCN QOHMWDJIBGVPIF-UHFFFAOYSA-N 0.000 description 1
- DILRJUIACXKSQE-UHFFFAOYSA-N n',n'-dimethylethane-1,2-diamine Chemical compound CN(C)CCN DILRJUIACXKSQE-UHFFFAOYSA-N 0.000 description 1
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- NXPPAOGUKPJVDI-UHFFFAOYSA-N naphthalene-1,2-diol Chemical compound C1=CC=CC2=C(O)C(O)=CC=C21 NXPPAOGUKPJVDI-UHFFFAOYSA-N 0.000 description 1
- RXOHFPCZGPKIRD-UHFFFAOYSA-N naphthalene-2,6-dicarboxylic acid Chemical compound C1=C(C(O)=O)C=CC2=CC(C(=O)O)=CC=C21 RXOHFPCZGPKIRD-UHFFFAOYSA-N 0.000 description 1
- SLCVBVWXLSEKPL-UHFFFAOYSA-N neopentyl glycol Chemical compound OCC(C)(C)CO SLCVBVWXLSEKPL-UHFFFAOYSA-N 0.000 description 1
- 229910052759 nickel Inorganic materials 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- QJGQUHMNIGDVPM-UHFFFAOYSA-N nitrogen group Chemical group [N] QJGQUHMNIGDVPM-UHFFFAOYSA-N 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 239000011368 organic material Substances 0.000 description 1
- 235000006408 oxalic acid Nutrition 0.000 description 1
- VTRUBDSFZJNXHI-UHFFFAOYSA-N oxoantimony Chemical compound [Sb]=O VTRUBDSFZJNXHI-UHFFFAOYSA-N 0.000 description 1
- 125000006353 oxyethylene group Chemical group 0.000 description 1
- 238000007591 painting process Methods 0.000 description 1
- 150000004707 phenolate Chemical class 0.000 description 1
- 229920001568 phenolic resin Polymers 0.000 description 1
- 150000002989 phenols Chemical class 0.000 description 1
- OSRKWUXYLYWDOH-UHFFFAOYSA-N phenyl(dipropyl)phosphane Chemical compound CCCP(CCC)C1=CC=CC=C1 OSRKWUXYLYWDOH-UHFFFAOYSA-N 0.000 description 1
- XYFCBTPGUUZFHI-UHFFFAOYSA-O phosphonium Chemical compound [PH4+] XYFCBTPGUUZFHI-UHFFFAOYSA-O 0.000 description 1
- 150000004714 phosphonium salts Chemical group 0.000 description 1
- XNGIFLGASWRNHJ-UHFFFAOYSA-L phthalate(2-) Chemical compound [O-]C(=O)C1=CC=CC=C1C([O-])=O XNGIFLGASWRNHJ-UHFFFAOYSA-L 0.000 description 1
- 239000004014 plasticizer Substances 0.000 description 1
- 238000007747 plating Methods 0.000 description 1
- 229920002857 polybutadiene Polymers 0.000 description 1
- 229920001610 polycaprolactone Polymers 0.000 description 1
- 239000004632 polycaprolactone Substances 0.000 description 1
- ODGAOXROABLFNM-UHFFFAOYSA-N polynoxylin Chemical class O=C.NC(N)=O ODGAOXROABLFNM-UHFFFAOYSA-N 0.000 description 1
- 229910052573 porcelain Inorganic materials 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 230000037452 priming Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 239000011833 salt mixture Substances 0.000 description 1
- 239000004576 sand Substances 0.000 description 1
- 125000000467 secondary amino group Chemical group [H]N([*:1])[*:2] 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 239000000377 silicon dioxide Substances 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- HYHCSLBZRBJJCH-UHFFFAOYSA-N sodium polysulfide Chemical compound [Na+].S HYHCSLBZRBJJCH-UHFFFAOYSA-N 0.000 description 1
- 239000004071 soot Substances 0.000 description 1
- 239000010959 steel Substances 0.000 description 1
- 238000003860 storage Methods 0.000 description 1
- 229940014800 succinic anhydride Drugs 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- UFDHBDMSHIXOKF-UHFFFAOYSA-N tetrahydrophthalic acid Natural products OC(=O)C1=C(C(O)=O)CCCC1 UFDHBDMSHIXOKF-UHFFFAOYSA-N 0.000 description 1
- RAOIDOHSFRTOEL-UHFFFAOYSA-N tetrahydrothiophene Chemical compound C1CCSC1 RAOIDOHSFRTOEL-UHFFFAOYSA-N 0.000 description 1
- 150000003573 thiols Chemical class 0.000 description 1
- 229910052718 tin Inorganic materials 0.000 description 1
- 239000011135 tin Substances 0.000 description 1
- 239000004408 titanium dioxide Substances 0.000 description 1
- VZCYOOQTPOCHFL-UHFFFAOYSA-N trans-butenedioic acid Natural products OC(=O)C=CC(O)=O VZCYOOQTPOCHFL-UHFFFAOYSA-N 0.000 description 1
- DKZBBWMURDFHNE-UHFFFAOYSA-N trans-coniferylaldehyde Natural products COC1=CC(C=CC=O)=CC=C1O DKZBBWMURDFHNE-UHFFFAOYSA-N 0.000 description 1
- TUQOTMZNTHZOKS-UHFFFAOYSA-N tributylphosphine Chemical compound CCCCP(CCCC)CCCC TUQOTMZNTHZOKS-UHFFFAOYSA-N 0.000 description 1
- ZIBGPFATKBEMQZ-UHFFFAOYSA-N triethylene glycol Chemical compound OCCOCCOCCO ZIBGPFATKBEMQZ-UHFFFAOYSA-N 0.000 description 1
- RXJKFRMDXUJTEX-UHFFFAOYSA-N triethylphosphine Chemical compound CCP(CC)CC RXJKFRMDXUJTEX-UHFFFAOYSA-N 0.000 description 1
- RKBCYCFRFCNLTO-UHFFFAOYSA-N triisopropylamine Chemical compound CC(C)N(C(C)C)C(C)C RKBCYCFRFCNLTO-UHFFFAOYSA-N 0.000 description 1
- SRPWOOOHEPICQU-UHFFFAOYSA-N trimellitic anhydride Chemical compound OC(=O)C1=CC=C2C(=O)OC(=O)C2=C1 SRPWOOOHEPICQU-UHFFFAOYSA-N 0.000 description 1
- 239000013638 trimer Substances 0.000 description 1
- MEBONNVPKOBPEA-UHFFFAOYSA-N trimethyl cyclohexane Natural products CC1CCCCC1(C)C MEBONNVPKOBPEA-UHFFFAOYSA-N 0.000 description 1
- 150000005219 trimethyl ethers Chemical class 0.000 description 1
- 150000004072 triols Chemical class 0.000 description 1
- KCTAHLRCZMOTKM-UHFFFAOYSA-N tripropylphosphane Chemical compound CCCP(CCC)CCC KCTAHLRCZMOTKM-UHFFFAOYSA-N 0.000 description 1
- MWOOGOJBHIARFG-UHFFFAOYSA-N vanillin Chemical compound COC1=CC(C=O)=CC=C1O MWOOGOJBHIARFG-UHFFFAOYSA-N 0.000 description 1
- 210000003462 vein Anatomy 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 239000012463 white pigment Substances 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
- 239000011701 zinc Substances 0.000 description 1
- 239000011787 zinc oxide Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C09—DYES; PAINTS; POLISHES; NATURAL RESINS; ADHESIVES; COMPOSITIONS NOT OTHERWISE PROVIDED FOR; APPLICATIONS OF MATERIALS NOT OTHERWISE PROVIDED FOR
- C09D—COATING COMPOSITIONS, e.g. PAINTS, VARNISHES OR LACQUERS; FILLING PASTES; CHEMICAL PAINT OR INK REMOVERS; INKS; CORRECTING FLUIDS; WOODSTAINS; PASTES OR SOLIDS FOR COLOURING OR PRINTING; USE OF MATERIALS THEREFOR
- C09D5/00—Coating compositions, e.g. paints, varnishes or lacquers, characterised by their physical nature or the effects produced; Filling pastes
- C09D5/44—Coating compositions, e.g. paints, varnishes or lacquers, characterised by their physical nature or the effects produced; Filling pastes for electrophoretic applications
- C09D5/4419—Coating compositions, e.g. paints, varnishes or lacquers, characterised by their physical nature or the effects produced; Filling pastes for electrophoretic applications with polymers obtained otherwise than by polymerisation reactions only involving carbon-to-carbon unsaturated bonds
- C09D5/443—Polyepoxides
- C09D5/4434—Polyepoxides characterised by the nature of the epoxy binder
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/02—Polycondensates containing more than one epoxy group per molecule
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G59/00—Polycondensates containing more than one epoxy group per molecule; Macromolecules obtained by polymerising compounds containing more than one epoxy group per molecule using curing agents or catalysts which react with the epoxy groups
- C08G59/14—Polycondensates modified by chemical after-treatment
- C08G59/1433—Polycondensates modified by chemical after-treatment with organic low-molecular-weight compounds
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10S—TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10S524/00—Synthetic resins or natural rubbers -- part of the class 520 series
- Y10S524/901—Electrodepositable compositions
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Life Sciences & Earth Sciences (AREA)
- General Chemical & Material Sciences (AREA)
- Molecular Biology (AREA)
- Engineering & Computer Science (AREA)
- Materials Engineering (AREA)
- Wood Science & Technology (AREA)
- Epoxy Resins (AREA)
- Paints Or Removers (AREA)
Priority Applications (11)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853518770 DE3518770A1 (de) | 1985-05-24 | 1985-05-24 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| DE8686903341T DE3673640D1 (de) | 1985-05-24 | 1986-05-17 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung. |
| BR8607119A BR8607119A (pt) | 1985-05-24 | 1986-05-17 | Aglutinantes diluiveis em agua para lacas de eletro-imersao cationicas e processo para a sua obtencao |
| JP61503035A JPS62502899A (ja) | 1985-05-24 | 1986-05-17 | カチオン性電着塗料用水希釈性結合剤及びその製法 |
| AT86903341T ATE55773T1 (de) | 1985-05-24 | 1986-05-17 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung. |
| EP86903341A EP0241476B1 (de) | 1985-05-24 | 1986-05-17 | Wasserverdünnbare bindemittel für kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| US07/009,956 US4780524A (en) | 1985-05-24 | 1986-05-17 | Water-dilutable binders for cationic electrocoating finishes and a process for the preparation thereof |
| PCT/EP1986/000303 WO1986007083A1 (fr) | 1985-05-24 | 1986-05-17 | Liants diluables a l'eau pour laques electrophoretiques et cationiques et leur procede de fabrication |
| ES555300A ES8704191A1 (es) | 1985-05-24 | 1986-05-23 | Procedimiento para la fabricacion de ligantes solubles en agua para lacas de electroinmersion cationicas |
| CA000509886A CA1258740A (en) | 1985-05-24 | 1986-05-23 | Water-dilutable binders for cationic electrocoating finishes and a process for the preparation thereof |
| US07/202,144 US4830722A (en) | 1985-05-24 | 1988-07-14 | Water-dilutable binders for cationic electrocoating finishes and a process for the preparation thereof |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19853518770 DE3518770A1 (de) | 1985-05-24 | 1985-05-24 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3518770A1 true DE3518770A1 (de) | 1986-11-27 |
Family
ID=6271594
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19853518770 Withdrawn DE3518770A1 (de) | 1985-05-24 | 1985-05-24 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| DE8686903341T Expired - Lifetime DE3673640D1 (de) | 1985-05-24 | 1986-05-17 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung. |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8686903341T Expired - Lifetime DE3673640D1 (de) | 1985-05-24 | 1986-05-17 | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung. |
Country Status (8)
| Country | Link |
|---|---|
| US (2) | US4780524A (https=) |
| EP (1) | EP0241476B1 (https=) |
| JP (1) | JPS62502899A (https=) |
| BR (1) | BR8607119A (https=) |
| CA (1) | CA1258740A (https=) |
| DE (2) | DE3518770A1 (https=) |
| ES (1) | ES8704191A1 (https=) |
| WO (1) | WO1986007083A1 (https=) |
Cited By (34)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0301293A1 (de) | 1987-07-29 | 1989-02-01 | BASF Lacke + Farben AG | Kathodisch abscheidbare Kunstharze enthaltende wässrige Elektrotauchlackbäder und Verfahren zur Beschichtung elektrisch leitfähiger Substrate |
| EP0324950A1 (de) * | 1988-01-22 | 1989-07-26 | BASF Lacke + Farben AG | Verfahren zur Beschichtung elektrisch leitfähiger Substrate, nach diesem Verfahren beschichtete Substrate und wässrige Elektrotauchlackbäder |
| EP0324951A1 (de) * | 1988-01-22 | 1989-07-26 | BASF Lacke + Farben AG | Verfahren zur Beschichtung elektrisch leitfähiger Substrate, nach diesem Verfahren beschichtete Substrate und wässrige Elektrotauchlackbäder |
| US5039721A (en) * | 1988-07-28 | 1991-08-13 | Basf Lacke & Farben Aktiengesellschaft | Based on monofunctionally initiated, polyaminoamide modified epoxy resins |
| EP0546269A1 (de) * | 1991-10-12 | 1993-06-16 | BASF Lacke + Farben AG | Pigmentzubereitungen |
| EP0784065A2 (de) | 1995-12-20 | 1997-07-16 | BASF Lacke + Farben AG | Aufbau von modifizierten Epoxidharzen für die kathodische Elektrotauchlackierung mit Katalysator-Desaktivierung und Diolmodifizierung |
| DE19804291A1 (de) * | 1998-02-04 | 1999-10-28 | Basf Coatings Ag | Kathodisch abscheidbare, Schwefel enthaltende Elektrotauchlacke |
| US6200447B1 (en) | 1995-11-06 | 2001-03-13 | Basf Coatings Ag | Electrically deposited coating agent |
| US6235812B1 (en) | 1996-05-08 | 2001-05-22 | Basf Coatings Ag | Water-dispersible epoxy resins modified with vinyl acetate copolymers |
| US6288176B1 (en) | 1998-04-15 | 2001-09-11 | Basf Coatings Ag | Agent for blocking polyisocyanates, polyisocyanates blocked therewith, and coating compositions comprising these blocked polyisocyanates |
| DE102007012406A1 (de) | 2007-03-15 | 2008-09-18 | Basf Coatings Ag | Verfahren zur Korrosionsschutzausrüstung metallischer Substrate |
| WO2011113929A1 (de) | 2010-03-19 | 2011-09-22 | Basf Coatings Gmbh | Verfahren zur beschichtung eines metall- oder kunststoffsubstrats, daraus erhältliche beschichtung und beschichtetes substrat |
| US8399061B2 (en) | 2006-11-13 | 2013-03-19 | Basf Coatings Gmbh | Anti-corrosion agent forming a coating film with good adhesion and method for nongalvanic application thereof |
| US8475883B2 (en) | 2005-05-23 | 2013-07-02 | Basf Coatings Gmbh | Corrosion-protection agent forming a layer of paint and method for current-free application thereof |
| WO2014191481A1 (de) | 2013-05-28 | 2014-12-04 | Basf Coatings Gmbh | Verfahren zur tauchlack-beschichtung elektrisch leitfähiger substrate unter nachbehandlung der tauchlack-beschichtung mit einer wässrigen sol-gel- zusammensetzung vor deren aushärtung |
| WO2015022007A1 (de) | 2013-08-12 | 2015-02-19 | Basf Coatings Gmbh | Beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend eine sol-gel-zusammensetzung |
| WO2015070931A1 (de) | 2013-11-18 | 2015-05-21 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut in gelöst vorliegender form |
| WO2015070930A1 (de) | 2013-11-18 | 2015-05-21 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut sowohl in gelöst als auch ungelöst vorliegender form |
| WO2015074679A1 (de) | 2013-11-19 | 2015-05-28 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend aluminiumoxid |
| WO2015074680A1 (de) | 2013-11-19 | 2015-05-28 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend magnesiumoxid |
| US9982147B2 (en) | 2013-12-10 | 2018-05-29 | Basf Coatings Gmbh | Aqueous dip-coating composition for electroconductive substrates, comprising bismuth and a phosphorus-containing, amine-blocked compound |
| US10137476B2 (en) | 2009-02-05 | 2018-11-27 | Basf Coatings Gmbh | Coating agent for corrosion-resistant coatings |
| WO2019072774A1 (de) | 2017-10-09 | 2019-04-18 | Basf Coatings Gmbh | Elektrotauchlacke enthaltend wenigstens eine triazin-verbindung |
| US10435805B2 (en) | 2013-11-18 | 2019-10-08 | Basf Coatings Gmbh | Two-stage method for dip-coating electrically conductive substrates using a Bi (III)-containing composition |
| WO2020212074A1 (de) | 2019-04-15 | 2020-10-22 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut sowie lithium |
| WO2021123106A1 (en) | 2019-12-19 | 2021-06-24 | Basf Coatings Gmbh | Lamp black pigment containing electrodeposition coating material compositions |
| WO2021148261A1 (en) | 2020-01-24 | 2021-07-29 | Basf Coatings Gmbh | Aqueous electrocoating materials comprising a silane-containing crosslinker |
| WO2022128359A1 (en) | 2020-12-15 | 2022-06-23 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising alkoxylated polyethyleneimines |
| WO2023237284A1 (en) | 2022-06-09 | 2023-12-14 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising alkoxylated polyethyleneimines |
| WO2024056308A1 (en) | 2022-09-15 | 2024-03-21 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising pigment slurry and composite particles containing metal-containing catalyst |
| WO2024056309A1 (en) | 2022-09-15 | 2024-03-21 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising composite particles containing metal-containing catalyst |
| WO2026052295A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Electrodeposition coating material having good uv stability |
| WO2026052294A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Electrodeposition coating material with improved uv-stability |
| WO2026052296A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Serial cathodic electrodeposition coating process |
Families Citing this family (28)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| DE3518732A1 (de) * | 1985-05-24 | 1986-11-27 | BASF Lacke + Farben AG, 4400 Münster | Wasserverduennbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| US4715898A (en) * | 1986-06-30 | 1987-12-29 | Ppg Industries, Inc. | Sulfonium resins useful as pigment grinding vehicles in cationic electrodeposition |
| US5171765A (en) * | 1987-03-27 | 1992-12-15 | North Dakota State University | Water dispersible polymers for coatings based on polymers containing mesogenic groups |
| US5235006A (en) * | 1987-03-27 | 1993-08-10 | North Dakota State University | Mesogens and polymers with mesogens |
| JP2686283B2 (ja) * | 1988-06-13 | 1997-12-08 | 関西ペイント株式会社 | 光重合性組成物 |
| CA1336523C (en) * | 1988-04-04 | 1995-08-01 | Hideo Nakamura | Polyol resin and process for preparing the same |
| ZA891937B (en) * | 1988-04-04 | 1990-11-28 | Ppg Industries Inc | Pigment grinding vehicles containing quaternary ammonium and ternary sulfonium groups |
| US5268435A (en) * | 1988-04-04 | 1993-12-07 | Mitsui Petrochemical Industries, Ltd. | Epoxy resin reacted with primary amine active hydrogen compound and esterifying agent to yield polyol resin |
| DE3825464A1 (de) * | 1988-07-27 | 1990-02-01 | Basf Lacke & Farben | Wasserdispergierbare bindemittel fuer kationische elektrotauchlacke, verfahren zu ihrer herstellung sowie verfahren zur beschichtung elektrisch leitfaehiger substrate |
| US4920162A (en) * | 1988-12-22 | 1990-04-24 | Clark Peter D | Electrocoating composition of a polyamine self-condensed epoxy adduct and coatings produced thereby |
| DE3902441A1 (de) * | 1989-01-27 | 1990-08-16 | Basf Lacke & Farben | Hitzehaertbares ueberzugsmittel fuer die kathodische elektrotauchlackierung |
| US5108575A (en) * | 1990-02-23 | 1992-04-28 | E. I. Du Pont De Nemours And Company | Polyamine enamine containing cationic resin |
| US5464913A (en) * | 1990-03-15 | 1995-11-07 | Kansai Paint Co., Ltd. | Cycloaliphatic epoxy and primary hydroxyl groups-containing cationic resin |
| US5095051A (en) * | 1990-08-06 | 1992-03-10 | E. I. Du Pont De Nemours And Company | Amide diol extended cathodic electrodeposition resins |
| US5089100A (en) * | 1990-08-06 | 1992-02-18 | E. I. Du Pont De Nemours And Company | Method of incorporating polyamine into a cationic resin |
| JPH0759617B2 (ja) * | 1990-09-10 | 1995-06-28 | 日立化成工業株式会社 | 高分子量エポキシ樹脂の製造方法 |
| JPH0759620B2 (ja) * | 1990-09-12 | 1995-06-28 | 日立化成工業株式会社 | 高分子量エポキシ樹脂の製造方法 |
| US5464924A (en) * | 1994-01-07 | 1995-11-07 | The Dow Chemical Company | Flexible poly(amino ethers) for barrier packaging |
| US6037405A (en) * | 1995-12-25 | 2000-03-14 | Sakata Inx Corp. | Pigment dispersion and offset printing ink composition using the same |
| JP3396585B2 (ja) * | 1995-12-25 | 2003-04-14 | サカタインクス株式会社 | 顔料分散物及びそれを用いたオフセット印刷用インキ組成物 |
| DE19650157A1 (de) * | 1996-12-04 | 1998-06-10 | Basf Coatings Ag | Verfahren zur Beschichtung von Substraten, vorzugsweise aus Metall |
| JP4663870B2 (ja) * | 1999-11-30 | 2011-04-06 | 日本ペイント株式会社 | カチオン電着塗料用顔料分散樹脂の製造方法 |
| US6423774B1 (en) * | 2000-03-21 | 2002-07-23 | Ppg Industries Ohio, Inc. | Cationic aliphatic polyester resins and their electrodeposition |
| US6902766B1 (en) * | 2000-07-27 | 2005-06-07 | Lord Corporation | Two-part aqueous metal protection treatment |
| DE102005012056A1 (de) | 2005-03-16 | 2006-09-28 | Basf Coatings Ag | Mehrschichtlackierungen, Verfahren zu ihrer Herstellung und deren Verwendung im Automobilbau |
| DE102008061329A1 (de) | 2008-12-11 | 2010-06-17 | Basf Coatings Ag | Verwendung von 1,3-substituierten Imidazoliumsalzen zur katalytischen Deblockierung blockierter Isocyanate |
| MX374622B (es) | 2012-12-03 | 2025-03-06 | Basf Coatings Gmbh | Pintura de varias capas que induce efecto y/o color y método para su producción, y su uso. |
| WO2023117962A1 (en) | 2021-12-21 | 2023-06-29 | Basf Se | Chemical product passport |
Family Cites Families (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4246089A (en) * | 1979-11-30 | 1981-01-20 | E. I. Du Pont De Nemours And Company | Graft copolymer useful in electrodeposition |
| DE3108073C2 (de) * | 1981-03-04 | 1983-10-06 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke |
| DE3300583A1 (de) * | 1983-01-10 | 1984-07-12 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserdispergierbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| GB8315230D0 (en) * | 1983-06-03 | 1983-07-06 | Shell Int Research | Polyglycidyl ethers |
| DE3475524D1 (en) * | 1983-06-03 | 1989-01-12 | Shell Int Research | Novel polyglycidyl ethers, their preparation and their use as thermosetting coating compositions |
| DE3331903A1 (de) * | 1983-09-03 | 1985-03-21 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserdispergierbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| DE3331904A1 (de) * | 1983-09-03 | 1985-03-21 | Basf Farben + Fasern Ag, 2000 Hamburg | Wasserdispergierbare bindemittel fuer kationische elektrotauchlacke und verfahren zu ihrer herstellung |
| US4686248A (en) * | 1984-02-28 | 1987-08-11 | Shell Oil Company | Preparation of binders for coatings, thermosetting coating compositions and their use |
-
1985
- 1985-05-24 DE DE19853518770 patent/DE3518770A1/de not_active Withdrawn
-
1986
- 1986-05-17 WO PCT/EP1986/000303 patent/WO1986007083A1/de not_active Ceased
- 1986-05-17 JP JP61503035A patent/JPS62502899A/ja active Granted
- 1986-05-17 DE DE8686903341T patent/DE3673640D1/de not_active Expired - Lifetime
- 1986-05-17 BR BR8607119A patent/BR8607119A/pt not_active IP Right Cessation
- 1986-05-17 EP EP86903341A patent/EP0241476B1/de not_active Expired - Lifetime
- 1986-05-17 US US07/009,956 patent/US4780524A/en not_active Expired - Lifetime
- 1986-05-23 ES ES555300A patent/ES8704191A1/es not_active Expired
- 1986-05-23 CA CA000509886A patent/CA1258740A/en not_active Expired
-
1988
- 1988-07-14 US US07/202,144 patent/US4830722A/en not_active Expired - Lifetime
Cited By (42)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0301293A1 (de) | 1987-07-29 | 1989-02-01 | BASF Lacke + Farben AG | Kathodisch abscheidbare Kunstharze enthaltende wässrige Elektrotauchlackbäder und Verfahren zur Beschichtung elektrisch leitfähiger Substrate |
| EP0324950A1 (de) * | 1988-01-22 | 1989-07-26 | BASF Lacke + Farben AG | Verfahren zur Beschichtung elektrisch leitfähiger Substrate, nach diesem Verfahren beschichtete Substrate und wässrige Elektrotauchlackbäder |
| EP0324951A1 (de) * | 1988-01-22 | 1989-07-26 | BASF Lacke + Farben AG | Verfahren zur Beschichtung elektrisch leitfähiger Substrate, nach diesem Verfahren beschichtete Substrate und wässrige Elektrotauchlackbäder |
| WO1989006672A1 (fr) * | 1988-01-22 | 1989-07-27 | Basf Lacke + Farben Aktiengesellschaft | Procede de revetement de substrats electroconducteurs, substrats revetus selon ce procede et bains aqueux de trempage electrophoretique |
| WO1989006673A1 (fr) * | 1988-01-22 | 1989-07-27 | Basf Lacke + Farben Aktiengesellschaft | Procede de revetement de substrats electroconducteurs, substrats revetus selon ce procede et bains aqueux de trempage electrophoretique |
| US5039721A (en) * | 1988-07-28 | 1991-08-13 | Basf Lacke & Farben Aktiengesellschaft | Based on monofunctionally initiated, polyaminoamide modified epoxy resins |
| EP0546269A1 (de) * | 1991-10-12 | 1993-06-16 | BASF Lacke + Farben AG | Pigmentzubereitungen |
| US6200447B1 (en) | 1995-11-06 | 2001-03-13 | Basf Coatings Ag | Electrically deposited coating agent |
| EP0784065A2 (de) | 1995-12-20 | 1997-07-16 | BASF Lacke + Farben AG | Aufbau von modifizierten Epoxidharzen für die kathodische Elektrotauchlackierung mit Katalysator-Desaktivierung und Diolmodifizierung |
| US6235812B1 (en) | 1996-05-08 | 2001-05-22 | Basf Coatings Ag | Water-dispersible epoxy resins modified with vinyl acetate copolymers |
| DE19804291A1 (de) * | 1998-02-04 | 1999-10-28 | Basf Coatings Ag | Kathodisch abscheidbare, Schwefel enthaltende Elektrotauchlacke |
| US6288176B1 (en) | 1998-04-15 | 2001-09-11 | Basf Coatings Ag | Agent for blocking polyisocyanates, polyisocyanates blocked therewith, and coating compositions comprising these blocked polyisocyanates |
| US8475883B2 (en) | 2005-05-23 | 2013-07-02 | Basf Coatings Gmbh | Corrosion-protection agent forming a layer of paint and method for current-free application thereof |
| US8399061B2 (en) | 2006-11-13 | 2013-03-19 | Basf Coatings Gmbh | Anti-corrosion agent forming a coating film with good adhesion and method for nongalvanic application thereof |
| DE102007012406A1 (de) | 2007-03-15 | 2008-09-18 | Basf Coatings Ag | Verfahren zur Korrosionsschutzausrüstung metallischer Substrate |
| US10137476B2 (en) | 2009-02-05 | 2018-11-27 | Basf Coatings Gmbh | Coating agent for corrosion-resistant coatings |
| US9889466B2 (en) | 2010-03-19 | 2018-02-13 | Basf Coatings Gmbh | Method for coating a metal or plastic substrate, coating that can be obtained therefrom, and coated substrate |
| WO2011113929A1 (de) | 2010-03-19 | 2011-09-22 | Basf Coatings Gmbh | Verfahren zur beschichtung eines metall- oder kunststoffsubstrats, daraus erhältliche beschichtung und beschichtetes substrat |
| DE102010012047A1 (de) | 2010-03-19 | 2011-09-22 | Basf Coatings Gmbh | Verfahren zur Beschichtung eines Metall- oder Kunststoffsubstrats, daraus erhältliche Beschichtung und beschichtetes Substrat |
| WO2014191481A1 (de) | 2013-05-28 | 2014-12-04 | Basf Coatings Gmbh | Verfahren zur tauchlack-beschichtung elektrisch leitfähiger substrate unter nachbehandlung der tauchlack-beschichtung mit einer wässrigen sol-gel- zusammensetzung vor deren aushärtung |
| WO2015022007A1 (de) | 2013-08-12 | 2015-02-19 | Basf Coatings Gmbh | Beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend eine sol-gel-zusammensetzung |
| US10208213B2 (en) | 2013-08-12 | 2019-02-19 | Basf Coatings Gmbh | Dip-coating composition for electroconductive substrates, comprising a sol-gel composition |
| WO2015070930A1 (de) | 2013-11-18 | 2015-05-21 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut sowohl in gelöst als auch ungelöst vorliegender form |
| US9920205B2 (en) | 2013-11-18 | 2018-03-20 | Basf Coatings Gmbh | Aqueous dip-coating composition for electroconductive substrates, comprising dissolved bismuth |
| WO2015070931A1 (de) | 2013-11-18 | 2015-05-21 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut in gelöst vorliegender form |
| US10407578B2 (en) | 2013-11-18 | 2019-09-10 | Basf Coatings Gmbh | Aqueous dip-coating composition for electroconductive substrates, comprising both dissolved and undissolved bismuth |
| US10435805B2 (en) | 2013-11-18 | 2019-10-08 | Basf Coatings Gmbh | Two-stage method for dip-coating electrically conductive substrates using a Bi (III)-containing composition |
| WO2015074680A1 (de) | 2013-11-19 | 2015-05-28 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend magnesiumoxid |
| WO2015074679A1 (de) | 2013-11-19 | 2015-05-28 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend aluminiumoxid |
| US9982147B2 (en) | 2013-12-10 | 2018-05-29 | Basf Coatings Gmbh | Aqueous dip-coating composition for electroconductive substrates, comprising bismuth and a phosphorus-containing, amine-blocked compound |
| WO2019072774A1 (de) | 2017-10-09 | 2019-04-18 | Basf Coatings Gmbh | Elektrotauchlacke enthaltend wenigstens eine triazin-verbindung |
| WO2020212074A1 (de) | 2019-04-15 | 2020-10-22 | Basf Coatings Gmbh | Wässrige beschichtungszusammensetzung zur tauchlack-beschichtung elektrisch leitfähiger substrate enthaltend bismut sowie lithium |
| WO2021123106A1 (en) | 2019-12-19 | 2021-06-24 | Basf Coatings Gmbh | Lamp black pigment containing electrodeposition coating material compositions |
| WO2021148261A1 (en) | 2020-01-24 | 2021-07-29 | Basf Coatings Gmbh | Aqueous electrocoating materials comprising a silane-containing crosslinker |
| US12460093B2 (en) | 2020-01-24 | 2025-11-04 | Basf Coatings Gmbh | Aqueous electrocoating materials comprising a silane-containing crosslinker |
| WO2022128359A1 (en) | 2020-12-15 | 2022-06-23 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising alkoxylated polyethyleneimines |
| WO2023237284A1 (en) | 2022-06-09 | 2023-12-14 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising alkoxylated polyethyleneimines |
| WO2024056308A1 (en) | 2022-09-15 | 2024-03-21 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising pigment slurry and composite particles containing metal-containing catalyst |
| WO2024056309A1 (en) | 2022-09-15 | 2024-03-21 | Basf Coatings Gmbh | Electrodeposition coating material compositions comprising composite particles containing metal-containing catalyst |
| WO2026052295A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Electrodeposition coating material having good uv stability |
| WO2026052294A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Electrodeposition coating material with improved uv-stability |
| WO2026052296A1 (en) | 2024-09-05 | 2026-03-12 | Basf Coatings Gmbh | Serial cathodic electrodeposition coating process |
Also Published As
| Publication number | Publication date |
|---|---|
| DE3673640D1 (de) | 1990-09-27 |
| JPS62502899A (ja) | 1987-11-19 |
| CA1258740A (en) | 1989-08-22 |
| US4830722A (en) | 1989-05-16 |
| EP0241476B1 (de) | 1990-08-22 |
| US4780524A (en) | 1988-10-25 |
| ES555300A0 (es) | 1987-03-16 |
| BR8607119A (pt) | 1988-02-09 |
| EP0241476A1 (de) | 1987-10-21 |
| WO1986007083A1 (fr) | 1986-12-04 |
| ES8704191A1 (es) | 1987-03-16 |
| JPH0137432B2 (https=) | 1989-08-07 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0241476B1 (de) | Wasserverdünnbare bindemittel für kationische elektrotauchlacke und verfahren zu ihrer herstellung | |
| EP0256020B1 (de) | Wasserverdünnbare bindemittel für kationische elektrotauchlacke und verfahren zu ihrer herstellung | |
| EP0961797B1 (de) | Wässrige bindemitteldispersion für kationische elektrotauchlacke | |
| EP0135811B1 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlace und Verfahren zu ihrer Herstellung | |
| DE2701002C2 (de) | Verfahren zur Herstellung einer wässrigen Dispersion eines kationischen Kunstharzes | |
| EP0089488B1 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke und Verfahren zu ihrer Herstellung | |
| DE3108073C2 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke | |
| EP0154724B1 (de) | In Wasser dispergierbare Kunstharze, Verfahren zur Herstellung der Kunstharze und Verwendung der Kunstharze als Bindemittel für Electrotauchlackbäder | |
| EP0154775B1 (de) | Wasserdispergierbare Bindemittel auf der Basis von modifizierten Epoxid-Amin-Addukten, deren Herstellung und Verwendung | |
| WO1986007372A1 (fr) | Liants diluables a l'eau contenant des amino groupes primaires latents pour emaillage electrophoretique cationique et un procede pour leur fabrication | |
| EP0135810B1 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke und Verfahren zu ihrer Herstellung | |
| WO1992000358A1 (de) | Verfahren zum beschichten elektrisch leitfähiger substrate, wässriger lacke und blockierte nco-gruppen enthaltendes vernetzungsmittel | |
| EP0352457B1 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke, Verfahren zu ihrer Herstellung sowie Verfahren zur Beschichtung elektrisch leitfähiger Substrate | |
| DE3152220C2 (de) | Verfahren zum elektrophoretischen Beschichten eines elektrisch leitenden als Kathode geschalteten Substrates | |
| EP0644245B1 (de) | Wässrige Dispersionen, deren Herstellung und Verwendung in Überzugsmitteln zur kathodischen Tauchlackierung | |
| EP0089489A2 (de) | Wasserdispergierbare Bindemittel für kationische Elektrotauchlacke und Verfahren zu ihrer Herstellung | |
| DE4224882A1 (de) | Epoxidharze |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8141 | Disposal/no request for examination |