DE3003843A1 - Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidin - Google Patents
Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidinInfo
- Publication number
- DE3003843A1 DE3003843A1 DE19803003843 DE3003843A DE3003843A1 DE 3003843 A1 DE3003843 A1 DE 3003843A1 DE 19803003843 DE19803003843 DE 19803003843 DE 3003843 A DE3003843 A DE 3003843A DE 3003843 A1 DE3003843 A1 DE 3003843A1
- Authority
- DE
- Germany
- Prior art keywords
- taa
- tad
- amino
- ammonia
- reaction
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 238000004519 manufacturing process Methods 0.000 title description 4
- FTVFPPFZRRKJIH-UHFFFAOYSA-N 2,2,6,6-tetramethylpiperidin-4-amine Chemical compound CC1(C)CC(N)CC(C)(C)N1 FTVFPPFZRRKJIH-UHFFFAOYSA-N 0.000 title description 3
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 claims description 23
- 238000000034 method Methods 0.000 claims description 21
- 239000003054 catalyst Substances 0.000 claims description 10
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 9
- 229910021529 ammonia Inorganic materials 0.000 claims description 9
- 229910052739 hydrogen Inorganic materials 0.000 claims description 9
- 239000001257 hydrogen Substances 0.000 claims description 9
- 238000005984 hydrogenation reaction Methods 0.000 claims description 3
- 238000002360 preparation method Methods 0.000 claims description 2
- 238000006243 chemical reaction Methods 0.000 description 8
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 6
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 238000004821 distillation Methods 0.000 description 4
- 229910052751 metal Inorganic materials 0.000 description 4
- 239000002184 metal Substances 0.000 description 4
- -1 aliphatic ethers Chemical class 0.000 description 3
- 239000006227 byproduct Substances 0.000 description 3
- 239000007789 gas Substances 0.000 description 3
- 150000002739 metals Chemical class 0.000 description 3
- MTZWHHIREPJPTG-UHFFFAOYSA-N phorone Chemical compound CC(C)=CC(=O)C=C(C)C MTZWHHIREPJPTG-UHFFFAOYSA-N 0.000 description 3
- BASFCYQUMIYNBI-UHFFFAOYSA-N platinum Chemical compound [Pt] BASFCYQUMIYNBI-UHFFFAOYSA-N 0.000 description 3
- 239000000047 product Substances 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 2
- AVXURJPOCDRRFD-UHFFFAOYSA-N Hydroxylamine Chemical compound ON AVXURJPOCDRRFD-UHFFFAOYSA-N 0.000 description 2
- KDLHZDBZIXYQEI-UHFFFAOYSA-N Palladium Chemical compound [Pd] KDLHZDBZIXYQEI-UHFFFAOYSA-N 0.000 description 2
- NQRYJNQNLNOLGT-UHFFFAOYSA-N Piperidine Chemical compound C1CCNCC1 NQRYJNQNLNOLGT-UHFFFAOYSA-N 0.000 description 2
- 230000015572 biosynthetic process Effects 0.000 description 2
- 239000007795 chemical reaction product Substances 0.000 description 2
- 239000003795 chemical substances by application Substances 0.000 description 2
- 239000003426 co-catalyst Substances 0.000 description 2
- 229910017052 cobalt Inorganic materials 0.000 description 2
- 239000010941 cobalt Substances 0.000 description 2
- GUTLYIVDDKVIGB-UHFFFAOYSA-N cobalt atom Chemical compound [Co] GUTLYIVDDKVIGB-UHFFFAOYSA-N 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 239000013067 intermediate product Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 229910052759 nickel Inorganic materials 0.000 description 2
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 2
- 150000002923 oximes Chemical class 0.000 description 2
- 229910052697 platinum Inorganic materials 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 230000002829 reductive effect Effects 0.000 description 2
- 238000003786 synthesis reaction Methods 0.000 description 2
- 238000010626 work up procedure Methods 0.000 description 2
- 239000011701 zinc Substances 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- ZOKXTWBITQBERF-UHFFFAOYSA-N Molybdenum Chemical compound [Mo] ZOKXTWBITQBERF-UHFFFAOYSA-N 0.000 description 1
- 241001502129 Mullus Species 0.000 description 1
- 239000007868 Raney catalyst Substances 0.000 description 1
- 229910000564 Raney nickel Inorganic materials 0.000 description 1
- KJTLSVCANCCWHF-UHFFFAOYSA-N Ruthenium Chemical compound [Ru] KJTLSVCANCCWHF-UHFFFAOYSA-N 0.000 description 1
- JWUXJYZVKZKLTJ-UHFFFAOYSA-N Triacetonamine Chemical compound CC1(C)CC(=O)CC(C)(C)N1 JWUXJYZVKZKLTJ-UHFFFAOYSA-N 0.000 description 1
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 1
- 239000002253 acid Substances 0.000 description 1
- 125000001931 aliphatic group Chemical group 0.000 description 1
- 150000001414 amino alcohols Chemical class 0.000 description 1
- 239000012295 chemical reaction liquid Substances 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 229910052804 chromium Inorganic materials 0.000 description 1
- 239000011651 chromium Substances 0.000 description 1
- 239000003245 coal Substances 0.000 description 1
- 238000009833 condensation Methods 0.000 description 1
- 230000005494 condensation Effects 0.000 description 1
- 238000010924 continuous production Methods 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- JGDFBJMWFLXCLJ-UHFFFAOYSA-N copper chromite Chemical compound [Cu]=O.[Cu]=O.O=[Cr]O[Cr]=O JGDFBJMWFLXCLJ-UHFFFAOYSA-N 0.000 description 1
- 239000007862 dimeric product Substances 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000004817 gas chromatography Methods 0.000 description 1
- 229930195733 hydrocarbon Natural products 0.000 description 1
- 150000002430 hydrocarbons Chemical class 0.000 description 1
- 239000011261 inert gas Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- 229910052741 iridium Inorganic materials 0.000 description 1
- GKOZUEZYRPOHIO-UHFFFAOYSA-N iridium atom Chemical compound [Ir] GKOZUEZYRPOHIO-UHFFFAOYSA-N 0.000 description 1
- JJWLVOIRVHMVIS-UHFFFAOYSA-N isopropylamine Chemical compound CC(C)N JJWLVOIRVHMVIS-UHFFFAOYSA-N 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 239000000203 mixture Substances 0.000 description 1
- 229910052750 molybdenum Inorganic materials 0.000 description 1
- 239000011733 molybdenum Substances 0.000 description 1
- 229910052762 osmium Inorganic materials 0.000 description 1
- SYQBFIAQOQZEGI-UHFFFAOYSA-N osmium atom Chemical compound [Os] SYQBFIAQOQZEGI-UHFFFAOYSA-N 0.000 description 1
- 229910052763 palladium Inorganic materials 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 238000006722 reduction reaction Methods 0.000 description 1
- 238000006268 reductive amination reaction Methods 0.000 description 1
- 238000010992 reflux Methods 0.000 description 1
- 229910052702 rhenium Inorganic materials 0.000 description 1
- WUAPFZMCVAUBPE-UHFFFAOYSA-N rhenium atom Chemical compound [Re] WUAPFZMCVAUBPE-UHFFFAOYSA-N 0.000 description 1
- 229910052703 rhodium Inorganic materials 0.000 description 1
- 239000010948 rhodium Substances 0.000 description 1
- MHOVAHRLVXNVSD-UHFFFAOYSA-N rhodium atom Chemical compound [Rh] MHOVAHRLVXNVSD-UHFFFAOYSA-N 0.000 description 1
- 229910052707 ruthenium Inorganic materials 0.000 description 1
- 238000007086 side reaction Methods 0.000 description 1
- 150000004760 silicates Chemical class 0.000 description 1
- 239000000126 substance Substances 0.000 description 1
- 230000001629 suppression Effects 0.000 description 1
- 229920001059 synthetic polymer Polymers 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 229910052725 zinc Inorganic materials 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D211/00—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings
- C07D211/04—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D211/06—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members
- C07D211/36—Heterocyclic compounds containing hydrogenated pyridine rings, not condensed with other rings with only hydrogen or carbon atoms directly attached to the ring nitrogen atom having no double bonds between ring members or between ring members and non-ring members with hetero atoms or with carbon atoms having three bonds to hetero atoms with at the most one bond to halogen, e.g. ester or nitrile radicals, directly attached to ring carbon atoms
- C07D211/56—Nitrogen atoms
- C07D211/58—Nitrogen atoms attached in position 4
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Hydrogenated Pyridines (AREA)
- Low-Molecular Organic Synthesis Reactions Using Catalysts (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (4)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803003843 DE3003843A1 (de) | 1980-02-02 | 1980-02-02 | Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidin |
| JP1179381A JPS56122352A (en) | 1980-02-02 | 1981-01-30 | Manufacture of 44aminoo2*2*6*66 tetramethylpiperidine |
| DE8181100698T DE3166231D1 (en) | 1980-02-02 | 1981-01-31 | Process for preparing 4-amino-2,2,6,6-tetramethylpiperidine |
| EP81100698A EP0033529B1 (de) | 1980-02-02 | 1981-01-31 | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19803003843 DE3003843A1 (de) | 1980-02-02 | 1980-02-02 | Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidin |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE3003843A1 true DE3003843A1 (de) | 1981-08-13 |
Family
ID=6093590
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19803003843 Withdrawn DE3003843A1 (de) | 1980-02-02 | 1980-02-02 | Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidin |
| DE8181100698T Expired DE3166231D1 (en) | 1980-02-02 | 1981-01-31 | Process for preparing 4-amino-2,2,6,6-tetramethylpiperidine |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE8181100698T Expired DE3166231D1 (en) | 1980-02-02 | 1981-01-31 | Process for preparing 4-amino-2,2,6,6-tetramethylpiperidine |
Country Status (3)
| Country | Link |
|---|---|
| EP (1) | EP0033529B1 (https=) |
| JP (1) | JPS56122352A (https=) |
| DE (2) | DE3003843A1 (https=) |
Cited By (4)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0103193A1 (de) * | 1982-09-14 | 1984-03-21 | Hüls Aktiengesellschaft | Quadratsäureamidderivate, ihre Verwendung als Stabilisierungsmittel sowie die mit diesen behandelten Kunststoffe |
| DE3525387A1 (de) * | 1985-06-13 | 1987-01-22 | Nii Chimikatov Dlja Polimernyc | Verfahren zur herstellung von 4-amino-2,2,6,6- tetramethylpiperidin |
| EP2085385A1 (de) | 2008-02-01 | 2009-08-05 | Evonik Degussa GmbH | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
| DE102008040045A1 (de) | 2008-02-01 | 2009-08-06 | Evonik Degussa Gmbh | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
Families Citing this family (32)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4605743A (en) * | 1985-04-16 | 1986-08-12 | Uniroyal Chemical Company, Inc. | Process for the production of 2,2,6,6-tetraalkyl-4-piperidylamines |
| US4607104A (en) * | 1985-07-11 | 1986-08-19 | Uniroyal Chemical Company, Inc. | Process for the production of 2,2,6,6-tetraalkyl-4-piperidylamines |
| DE3861897D1 (de) * | 1987-05-05 | 1991-04-11 | Ciba Geigy Ag | Verfahren zur herstellung von 4-hydroxy-2,2,6,6-tetramethyl-piperidin. |
| IT1222394B (it) * | 1987-07-30 | 1990-09-05 | Ciba Geigy Spa | Processo per la preparazione di 2,2,6,6 tetrametil 4 piperidilammine |
| IT1247834B (it) * | 1991-02-05 | 1995-01-02 | Ciba Geigy Spa | Processo per la preparazione di 2,2,6,6-tetrametil-4-piperidilammine |
| CA2115025A1 (en) * | 1993-02-08 | 1994-08-09 | Atsushi Furutani | Process for producing amines |
| DE4442990A1 (de) * | 1994-12-02 | 1996-06-05 | Huels Chemische Werke Ag | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
| DE19544599A1 (de) * | 1995-11-30 | 1997-06-05 | Huels Chemische Werke Ag | Kontinuierliches Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
| DE19622269A1 (de) * | 1996-06-03 | 1997-12-04 | Basf Ag | Verfahren zur Reinigung von sterisch gehinderten 4-Aminopiperidinen |
| DE19622268C1 (de) * | 1996-06-03 | 1997-10-23 | Basf Ag | Sterisch gehindertes 4-Amino-piperidin mit geringem Dimergehalt, seine Herstellung und Verwendung |
| DE19644770A1 (de) * | 1996-10-28 | 1998-04-30 | Basf Ag | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin (TAD) über das Zwischenprodukt 2,2,6,6-Tetramethyl-4-[(2,2,6,6-tetramethyl-4-piperidyliden)-amino]-piperidin |
| DE19704460A1 (de) * | 1997-02-06 | 1998-08-13 | Huels Chemische Werke Ag | Kontinuierliches Verfahren zur Herstellung von 4-Aminopiperidinen |
| DE19709260A1 (de) * | 1997-03-06 | 1998-09-10 | Basf Ag | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethyl-piperidin |
| DE19743433C1 (de) * | 1997-10-01 | 1999-04-22 | Basf Ag | Verfahren zur Reinigung von 4-Amino-piperidinen |
| EP2087930A1 (de) | 2008-02-05 | 2009-08-12 | Evonik Degussa GmbH | Verfahren zur Absorption eines flüchtigen Stoffes in einem flüssigen Absorptionsmittel |
| DE102009000543A1 (de) | 2009-02-02 | 2010-08-12 | Evonik Degussa Gmbh | Verfahren, Absorptionsmedien und Vorrichtung zur Absorption von CO2 aus Gasmischungen |
| DE102009047564A1 (de) | 2009-12-07 | 2011-06-09 | Evonik Degussa Gmbh | Arbeitsmedium für eine Absorptionskältemaschine |
| DE102011077377A1 (de) | 2010-11-12 | 2012-05-16 | Evonik Degussa Gmbh | Verfahren zur Absorption von sauren Gasen aus Gasmischungen |
| AU2012339061B2 (en) | 2011-11-14 | 2016-10-13 | Evonik Degussa Gmbh | Method and device for the separation of acidic gases from a gas mixture |
| DE102012200907A1 (de) | 2012-01-23 | 2013-07-25 | Evonik Industries Ag | Verfahren und Absorptionsmedium zur Absorption von CO2 aus einer Gasmischung |
| DE102012207509A1 (de) | 2012-05-07 | 2013-11-07 | Evonik Degussa Gmbh | Verfahren zur Absorption von CO2 aus einer Gasmischung |
| DE102015212749A1 (de) | 2015-07-08 | 2017-01-12 | Evonik Degussa Gmbh | Verfahren zur Entfeuchtung von feuchten Gasgemischen |
| DE102016204931A1 (de) | 2016-03-24 | 2017-09-28 | Evonik Degussa Gmbh | Verfahren, Absorptionsmedien zur Absorption von CO2 aus Gasmischungen |
| EP3257568B1 (de) | 2016-06-14 | 2019-09-18 | Evonik Degussa GmbH | Verfahren zur entfeuchtung von feuchten gasgemischen mit ionischen flüssigkeiten |
| DE102016210484A1 (de) | 2016-06-14 | 2017-12-14 | Evonik Degussa Gmbh | Verfahren zur Entfeuchtung von feuchten Gasgemischen |
| DE102016210478A1 (de) | 2016-06-14 | 2017-12-14 | Evonik Degussa Gmbh | Verfahren zur Entfeuchtung von feuchten Gasgemischen |
| EP3257843A1 (en) | 2016-06-14 | 2017-12-20 | Evonik Degussa GmbH | Method of preparing a high purity imidazolium salt |
| DE102016210481B3 (de) | 2016-06-14 | 2017-06-08 | Evonik Degussa Gmbh | Verfahren zum Reinigen einer ionischen Flüssigkeit |
| DE102016210483A1 (de) | 2016-06-14 | 2017-12-14 | Evonik Degussa Gmbh | Verfahren und Absorptionsmittel zur Entfeuchtung von feuchten Gasgemischen |
| EP3663284B1 (de) | 2018-12-07 | 2021-02-03 | Evonik Operations GmbH | Verbessertes verfahren zur herstellung von triacetonamin |
| CN109836370A (zh) * | 2019-03-20 | 2019-06-04 | 萧县新秀新材料有限公司 | 特定pH范围的2,2,6,6-四甲基哌啶胺的合成法 |
| US11731940B2 (en) | 2020-05-07 | 2023-08-22 | Evonik Operations Gmbh | Process for preparing triacetonamine |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3684765A (en) * | 1970-01-08 | 1972-08-15 | Sankyo Co | Stabilization of synthetic polymers |
| DE2412750A1 (de) * | 1974-03-16 | 1975-09-18 | Bayer Ag | Verfahren zur herstellung von 4-amino2,2,6,6-tetramethyl-piperidin |
| GB1492494A (en) * | 1975-05-28 | 1977-11-23 | Sankyo Co | Derivatives of 4-aminopiperidine |
| GB1575310A (en) * | 1976-11-16 | 1980-09-17 | Anphar Sa | Piperidine derivatives |
| IT1088576B (it) * | 1977-11-29 | 1985-06-10 | Montedison Spa | Stabilizzanti per polimeri e composizioni polimeriche con essi stabilizzati |
-
1980
- 1980-02-02 DE DE19803003843 patent/DE3003843A1/de not_active Withdrawn
-
1981
- 1981-01-30 JP JP1179381A patent/JPS56122352A/ja active Granted
- 1981-01-31 DE DE8181100698T patent/DE3166231D1/de not_active Expired
- 1981-01-31 EP EP81100698A patent/EP0033529B1/de not_active Expired
Cited By (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0103193A1 (de) * | 1982-09-14 | 1984-03-21 | Hüls Aktiengesellschaft | Quadratsäureamidderivate, ihre Verwendung als Stabilisierungsmittel sowie die mit diesen behandelten Kunststoffe |
| DE3525387A1 (de) * | 1985-06-13 | 1987-01-22 | Nii Chimikatov Dlja Polimernyc | Verfahren zur herstellung von 4-amino-2,2,6,6- tetramethylpiperidin |
| EP2085385A1 (de) | 2008-02-01 | 2009-08-05 | Evonik Degussa GmbH | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
| EP2085384A1 (de) | 2008-02-01 | 2009-08-05 | Evonik Degussa GmbH | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
| DE102008040045A1 (de) | 2008-02-01 | 2009-08-06 | Evonik Degussa Gmbh | Verfahren zur Herstellung von 4-Amino-2,2,6,6-tetramethylpiperidin |
Also Published As
| Publication number | Publication date |
|---|---|
| EP0033529B1 (de) | 1984-09-26 |
| EP0033529A1 (de) | 1981-08-12 |
| JPH031305B2 (https=) | 1991-01-10 |
| JPS56122352A (en) | 1981-09-25 |
| DE3166231D1 (en) | 1984-10-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE3003843A1 (de) | Verfahren zur herstellung von 4-amino-2,2,6,6-tetramethylpiperidin | |
| DE69621491T2 (de) | Verfahren zur Herstellung von Epsilon-Caprolactam | |
| EP0070397B1 (de) | Verfahren und Katalysator zur Herstellung von cyclischen Iminen | |
| DE69909619T2 (de) | Verfahren zur herstellung eines aminonitrils und eines diamins | |
| EP0234295A2 (de) | Verfahren zur Herstellung von Epsilon-Caprolactam | |
| EP1765751B1 (de) | Verfahren zur herstellung von 1,6-hexandiol in einer reinheit von über 99,5% | |
| DE69400158T2 (de) | Verfahren zur Herstellung von Amine ausgehend von cyclischen Ketonen | |
| EP1529027B1 (de) | Verfahren zur herstellung von isophorondiamin (ipda, 3-aminomethyl-3,5,5-trimethylcyclohexylamin) mit einem hohen cis/trans-isomerenverh ltnis | |
| DE69801490T2 (de) | Verfahren zur ununterbrochener herstellung einer wässrigen mischung von (e)-caprolactam und (e)-caprolactamvorläufern | |
| DE69902683T2 (de) | Verfahren zur herstellung von gamma-butyrolacton und tetrahydrofuran | |
| EP0482347B1 (de) | Bis(3-cyano-3,5,5-trimethyl-cyclohexyliden)-azin, Verfahren zu seiner Herstellung und Weiterverarbeitung zu 3-(Aminomethyl)-3,5,5-trimethylcyclohexylamin | |
| EP0584408A2 (en) | Process for the preparation of gamma-butyrolactone | |
| EP0535518B1 (de) | Verfahren zur Herstellung von 2-Aminomethylpiperidin | |
| DE2547654C2 (de) | Herstellung von 2-Amino-1-alkoholen und 3-Oxalin-Derivate | |
| EP0100479B1 (de) | 3-Aminomethyl-1-(3-aminopropyl-1-methyl)-4-methylcyclohexan, Verfahren zu seiner Herstellung und seine Verwendung | |
| EP1036785B1 (de) | Verfahren zur Herstellung von Bistrifluormethylbenzylaminen | |
| EP0435072A2 (de) | Verfahren zur Herstellung von N,N-Dimethylaminen | |
| DE10122758B4 (de) | Verfahren zur Herstellung von gemischten, sekundären Aminen | |
| EP0010179B1 (de) | Verfahren zur Herstellung von 2.2-Dialkyl-pentan-1.5-diaminen und die Verbindungen N-(4-Cyano-2.2-diethyl-butyl)-4-cyano-2.2-diethyl-butyliden-imin und N-(4-Cyano-2-n-butyl-2-ethyl-butyl)-4-cyano-2-n-butyl-2-ethyl-butyliden-imin | |
| DE3508420A1 (de) | Verfahren zur herstellung von 2-alkyl-cyclopentanonen | |
| DE2752307C3 (de) | Verfahren zur Herstellung von Hexamethylenimin | |
| DE2639702A1 (de) | Verfahren zur herstellung von 2,3-cycloalkenopyridinen | |
| DE69929808T2 (de) | Verfahren zur herstellung von 2-piperidinethanol-derivaten | |
| DE3333678A1 (de) | Verfahren zur herstellung von 3-formyl-tetrahydrothiopyranen | |
| DE1903334C (de) | Verfahren zur Herstellung von p-Phenylphenolen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8127 | New person/name/address of the applicant |
Owner name: HUELS AG, 4370 MARL, DE |
|
| 8139 | Disposal/non-payment of the annual fee |