DE2801509A1 - 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel - Google Patents
1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittelInfo
- Publication number
- DE2801509A1 DE2801509A1 DE19782801509 DE2801509A DE2801509A1 DE 2801509 A1 DE2801509 A1 DE 2801509A1 DE 19782801509 DE19782801509 DE 19782801509 DE 2801509 A DE2801509 A DE 2801509A DE 2801509 A1 DE2801509 A1 DE 2801509A1
- Authority
- DE
- Germany
- Prior art keywords
- deep
- oxadiazole
- phenyl
- dimethylureido
- general formula
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Withdrawn
Links
- 150000001875 compounds Chemical class 0.000 title claims description 23
- 150000005071 1,2,4-oxadiazoles Chemical class 0.000 title claims description 6
- 239000004009 herbicide Substances 0.000 title claims description 6
- 238000004519 manufacturing process Methods 0.000 title 1
- -1 carboxylic acid halide Chemical class 0.000 claims description 60
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 45
- 239000000203 mixture Substances 0.000 claims description 15
- 239000003795 chemical substances by application Substances 0.000 claims description 14
- 239000003960 organic solvent Substances 0.000 claims description 12
- 230000002363 herbicidal effect Effects 0.000 claims description 9
- 239000012948 isocyanate Substances 0.000 claims description 8
- 150000002513 isocyanates Chemical class 0.000 claims description 8
- 238000002360 preparation method Methods 0.000 claims description 8
- 239000007795 chemical reaction product Substances 0.000 claims description 7
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 claims description 6
- BBVIDBNAYOIXOE-UHFFFAOYSA-N 1,2,4-oxadiazole Chemical compound C=1N=CON=1 BBVIDBNAYOIXOE-UHFFFAOYSA-N 0.000 claims description 5
- WTDHULULXKLSOZ-UHFFFAOYSA-N Hydroxylamine hydrochloride Chemical compound Cl.ON WTDHULULXKLSOZ-UHFFFAOYSA-N 0.000 claims description 5
- 239000000969 carrier Substances 0.000 claims description 5
- 238000000034 method Methods 0.000 claims description 5
- NCEFFLIJHUKDFT-UHFFFAOYSA-N 1,1-dimethyl-3-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 NCEFFLIJHUKDFT-UHFFFAOYSA-N 0.000 claims description 4
- YGYAWVDWMABLBF-UHFFFAOYSA-N Phosgene Chemical compound ClC(Cl)=O YGYAWVDWMABLBF-UHFFFAOYSA-N 0.000 claims description 4
- 239000002253 acid Substances 0.000 claims description 4
- 150000001244 carboxylic acid anhydrides Chemical class 0.000 claims description 4
- GARQCOHTWRJTDA-UHFFFAOYSA-N 1-methyl-3-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CNC(=O)NC1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 GARQCOHTWRJTDA-UHFFFAOYSA-N 0.000 claims description 3
- DYPMQVKYPRWLSW-UHFFFAOYSA-N 3-[3-(3-butyl-1,2,4-oxadiazol-5-yl)phenyl]-1,1-dimethylurea Chemical compound CCCCC1=NOC(C=2C=C(NC(=O)N(C)C)C=CC=2)=N1 DYPMQVKYPRWLSW-UHFFFAOYSA-N 0.000 claims description 3
- NXTNASSYJUXJDV-UHFFFAOYSA-N 3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1 NXTNASSYJUXJDV-UHFFFAOYSA-N 0.000 claims description 3
- SFZULDYEOVSIKM-UHFFFAOYSA-N chembl321317 Chemical compound C1=CC(C(=N)NO)=CC=C1C1=CC=C(C=2C=CC(=CC=2)C(=N)NO)O1 SFZULDYEOVSIKM-UHFFFAOYSA-N 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 claims description 3
- 125000000217 alkyl group Chemical group 0.000 claims description 2
- 150000008359 benzonitriles Chemical class 0.000 claims description 2
- 125000004093 cyano group Chemical group *C#N 0.000 claims description 2
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 2
- YRDOADGOKNMBBB-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea Chemical compound CN(C(NC=1C=C(C=CC1)C1=NOC(=N1)C)=O)C YRDOADGOKNMBBB-UHFFFAOYSA-N 0.000 claims 1
- ZRQLYWULDLBPBC-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(5-phenyl-1,2,4-oxadiazol-3-yl)phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C=2C=CC=CC=2)=C1 ZRQLYWULDLBPBC-UHFFFAOYSA-N 0.000 claims 1
- UDPAYSUIKZDPHY-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(5-propan-2-yl-1,2,4-oxadiazol-3-yl)phenyl]urea Chemical compound O1C(C(C)C)=NC(C=2C=C(NC(=O)N(C)C)C=CC=2)=N1 UDPAYSUIKZDPHY-UHFFFAOYSA-N 0.000 claims 1
- MHZDUPDYRUEKSV-UHFFFAOYSA-N 1,1-dimethyl-3-[3-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]urea Chemical compound O1C(CCC)=NC(C=2C=C(NC(=O)N(C)C)C=CC=2)=N1 MHZDUPDYRUEKSV-UHFFFAOYSA-N 0.000 claims 1
- BRRIVBVOVAEGCW-UHFFFAOYSA-N 1,1-dimethyl-3-[3-[5-(2-methylpropyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound O1C(CC(C)C)=NC(C=2C=C(NC(=O)N(C)C)C=CC=2)=N1 BRRIVBVOVAEGCW-UHFFFAOYSA-N 0.000 claims 1
- LXYVGPFLHHGKPW-UHFFFAOYSA-N 1,1-dimethyl-3-[3-[5-(3-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C=2C=C(C)C=CC=2)=C1 LXYVGPFLHHGKPW-UHFFFAOYSA-N 0.000 claims 1
- RMDYPVKOSDSONC-UHFFFAOYSA-N 1,1-dimethyl-3-[3-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C=2C=CC(C)=CC=2)=C1 RMDYPVKOSDSONC-UHFFFAOYSA-N 0.000 claims 1
- TVMUODVRGSJGGN-UHFFFAOYSA-N 1,1-dimethyl-3-[3-[5-(trichloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C(Cl)(Cl)Cl)=C1 TVMUODVRGSJGGN-UHFFFAOYSA-N 0.000 claims 1
- KIOKPFFDHFCODX-UHFFFAOYSA-N 1-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-3-propan-2-ylurea Chemical compound C(C)(C)NC(NC=1C=C(C=CC1)C1=NOC(=N1)C)=O KIOKPFFDHFCODX-UHFFFAOYSA-N 0.000 claims 1
- UZPDLWSMSUWBJS-UHFFFAOYSA-N 1-ethyl-3-[3-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]urea Chemical compound CCNC(=O)NC1=CC=CC(C=2N=C(C)ON=2)=C1 UZPDLWSMSUWBJS-UHFFFAOYSA-N 0.000 claims 1
- XHWXUNPRBMEBKC-UHFFFAOYSA-N 1-propan-2-yl-3-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]urea Chemical compound CC(C)NC(=O)NC1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 XHWXUNPRBMEBKC-UHFFFAOYSA-N 0.000 claims 1
- SVKBNGOOZLQYHO-UHFFFAOYSA-N 3-[3-(5-benzyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(CC=3C=CC=CC=3)ON=2)=C1 SVKBNGOOZLQYHO-UHFFFAOYSA-N 0.000 claims 1
- KFBZOAJRECIBCH-UHFFFAOYSA-N 3-[3-(5-cyclohexyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C2CCCCC2)=C1 KFBZOAJRECIBCH-UHFFFAOYSA-N 0.000 claims 1
- HWPFVJBKSVYSQJ-UHFFFAOYSA-N 3-[3-(5-cyclopropyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C2CC2)=C1 HWPFVJBKSVYSQJ-UHFFFAOYSA-N 0.000 claims 1
- BRKXRTGDJUZGMS-UHFFFAOYSA-N 3-[3-(5-ethyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-dimethylurea Chemical compound O1C(CC)=NC(C=2C=C(NC(=O)N(C)C)C=CC=2)=N1 BRKXRTGDJUZGMS-UHFFFAOYSA-N 0.000 claims 1
- OTNFDPLFYIPDOI-UHFFFAOYSA-N 3-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-diethylurea Chemical compound CCN(CC)C(=O)NC1=CC=CC(C=2N=C(ON=2)C(C)(C)C)=C1 OTNFDPLFYIPDOI-UHFFFAOYSA-N 0.000 claims 1
- AYKYJACOLNROEP-UHFFFAOYSA-N 3-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C(C)(C)C)=C1 AYKYJACOLNROEP-UHFFFAOYSA-N 0.000 claims 1
- SPBAMJCIVLUHCQ-UHFFFAOYSA-N 3-[3-[5-(4-chlorophenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C=2C=CC(Cl)=CC=2)=C1 SPBAMJCIVLUHCQ-UHFFFAOYSA-N 0.000 claims 1
- JVLFWHIFACANJA-UHFFFAOYSA-N 3-[3-[5-(4-tert-butylphenyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C=2C=CC(=CC=2)C(C)(C)C)=C1 JVLFWHIFACANJA-UHFFFAOYSA-N 0.000 claims 1
- RYAPHUFCLFLKEL-UHFFFAOYSA-N 3-[3-[5-(dichloromethyl)-1,2,4-oxadiazol-3-yl]phenyl]-1,1-dimethylurea Chemical compound CN(C)C(=O)NC1=CC=CC(C=2N=C(ON=2)C(Cl)Cl)=C1 RYAPHUFCLFLKEL-UHFFFAOYSA-N 0.000 claims 1
- GOWOXXPNBVQWMG-UHFFFAOYSA-N N-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]butanamide Chemical compound CCCC(=O)NC1=CC=CC(C=2N=C(ON=2)C(C)(C)C)=C1 GOWOXXPNBVQWMG-UHFFFAOYSA-N 0.000 claims 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 claims 1
- QCOFSSVHNAELMA-UHFFFAOYSA-N methyl n-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]carbamate Chemical compound COC(=O)NC1=CC=CC(C=2N=C(ON=2)C(C)(C)C)=C1 QCOFSSVHNAELMA-UHFFFAOYSA-N 0.000 claims 1
- DBRNMSGZYOWAGB-UHFFFAOYSA-N n-[3-(5-tert-butyl-1,2,4-oxadiazol-3-yl)phenyl]cyclopropanecarboxamide Chemical compound O1C(C(C)(C)C)=NC(C=2C=C(NC(=O)C3CC3)C=CC=2)=N1 DBRNMSGZYOWAGB-UHFFFAOYSA-N 0.000 claims 1
- QRTJFQOTUPDEPF-UHFFFAOYSA-N propyl n-[3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]phenyl]carbamate Chemical compound CCCOC(=O)NC1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 QRTJFQOTUPDEPF-UHFFFAOYSA-N 0.000 claims 1
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 24
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 19
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 18
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 18
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 17
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 241000196324 Embryophyta Species 0.000 description 13
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000004480 active ingredient Substances 0.000 description 11
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 10
- 238000006243 chemical reaction Methods 0.000 description 10
- 235000019441 ethanol Nutrition 0.000 description 10
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 9
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 9
- CSNNHWWHGAXBCP-UHFFFAOYSA-L Magnesium sulfate Chemical compound [Mg+2].[O-][S+2]([O-])([O-])[O-] CSNNHWWHGAXBCP-UHFFFAOYSA-L 0.000 description 8
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 239000002585 base Substances 0.000 description 7
- HEMHJVSKTPXQMS-UHFFFAOYSA-M sodium hydroxide Inorganic materials [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 7
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 6
- HCHKCACWOHOZIP-UHFFFAOYSA-N Zinc Chemical compound [Zn] HCHKCACWOHOZIP-UHFFFAOYSA-N 0.000 description 6
- 125000001951 carbamoylamino group Chemical group C(N)(=O)N* 0.000 description 6
- 239000000706 filtrate Substances 0.000 description 6
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 6
- 244000056139 Brassica cretica Species 0.000 description 5
- 235000003351 Brassica cretica Nutrition 0.000 description 5
- 235000003343 Brassica rupestris Nutrition 0.000 description 5
- 235000007688 Lycopersicon esculentum Nutrition 0.000 description 5
- 240000003768 Solanum lycopersicum Species 0.000 description 5
- QKSKPIVNLNLAAV-UHFFFAOYSA-N bis(2-chloroethyl) sulfide Chemical compound ClCCSCCCl QKSKPIVNLNLAAV-UHFFFAOYSA-N 0.000 description 5
- 235000010460 mustard Nutrition 0.000 description 5
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 5
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 4
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 4
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- MVPPADPHJFYWMZ-UHFFFAOYSA-N chlorobenzene Chemical compound ClC1=CC=CC=C1 MVPPADPHJFYWMZ-UHFFFAOYSA-N 0.000 description 4
- 125000004772 dichloromethyl group Chemical group [H]C(Cl)(Cl)* 0.000 description 4
- 239000007788 liquid Substances 0.000 description 4
- 229910052943 magnesium sulfate Inorganic materials 0.000 description 4
- 235000019341 magnesium sulphate Nutrition 0.000 description 4
- 239000007787 solid Substances 0.000 description 4
- 239000000243 solution Substances 0.000 description 4
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 4
- QAEDZJGFFMLHHQ-UHFFFAOYSA-N trifluoroacetic anhydride Chemical compound FC(F)(F)C(=O)OC(=O)C(F)(F)F QAEDZJGFFMLHHQ-UHFFFAOYSA-N 0.000 description 4
- 229910052725 zinc Inorganic materials 0.000 description 4
- 239000011701 zinc Substances 0.000 description 4
- DZQVRXWFPZNPPQ-UHFFFAOYSA-N 3-(trifluoromethyl)-1,2,4-oxadiazole Chemical compound FC(F)(F)C=1N=CON=1 DZQVRXWFPZNPPQ-UHFFFAOYSA-N 0.000 description 3
- FEPMSRYYFXNOOH-UHFFFAOYSA-N 3-[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aniline Chemical compound NC1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 FEPMSRYYFXNOOH-UHFFFAOYSA-N 0.000 description 3
- ZAFNJMIOTHYJRJ-UHFFFAOYSA-N Diisopropyl ether Chemical compound CC(C)OC(C)C ZAFNJMIOTHYJRJ-UHFFFAOYSA-N 0.000 description 3
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- JFDZBHWFFUWGJE-UHFFFAOYSA-N benzonitrile Chemical compound N#CC1=CC=CC=C1 JFDZBHWFFUWGJE-UHFFFAOYSA-N 0.000 description 3
- 238000001816 cooling Methods 0.000 description 3
- 125000004108 n-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 3
- 125000003854 p-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C([H])=C1Cl 0.000 description 3
- 150000003254 radicals Chemical class 0.000 description 3
- 150000003839 salts Chemical class 0.000 description 3
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 3
- 125000001478 1-chloroethyl group Chemical group [H]C([H])([H])C([H])(Cl)* 0.000 description 2
- 125000001340 2-chloroethyl group Chemical group [H]C([H])(Cl)C([H])([H])* 0.000 description 2
- QQBMDAGYVKZSOS-UHFFFAOYSA-N 3-(2-methylpropyl)-1,2,4-oxadiazole Chemical compound CC(C)CC=1N=CON=1 QQBMDAGYVKZSOS-UHFFFAOYSA-N 0.000 description 2
- RWMPKFYAPUVIDL-UHFFFAOYSA-N 3-(3-butyl-1,2,4-oxadiazol-5-yl)aniline Chemical compound CCCCC1=NOC(C=2C=C(N)C=CC=2)=N1 RWMPKFYAPUVIDL-UHFFFAOYSA-N 0.000 description 2
- VDZKUINGZNXBDH-UHFFFAOYSA-N 3-(3-methylphenyl)-1,2,4-oxadiazole Chemical compound CC1=CC=CC(C2=NOC=N2)=C1 VDZKUINGZNXBDH-UHFFFAOYSA-N 0.000 description 2
- SFWRWZSCYBJCMH-UHFFFAOYSA-N 3-(3-nitrophenyl)-5-(trifluoromethyl)-1,2,4-oxadiazole Chemical compound [O-][N+](=O)C1=CC=CC(C=2N=C(ON=2)C(F)(F)F)=C1 SFWRWZSCYBJCMH-UHFFFAOYSA-N 0.000 description 2
- FLWXYSUNYCKFIJ-UHFFFAOYSA-N 3-butyl-1,2,4-oxadiazole Chemical compound CCCCC=1N=CON=1 FLWXYSUNYCKFIJ-UHFFFAOYSA-N 0.000 description 2
- DADSVCRVXWGVDN-UHFFFAOYSA-N 3-butyl-5-(3-nitrophenyl)-1,2,4-oxadiazole Chemical compound CCCCC1=NOC(C=2C=C(C=CC=2)[N+]([O-])=O)=N1 DADSVCRVXWGVDN-UHFFFAOYSA-N 0.000 description 2
- FZAXBPZVVJOFKX-UHFFFAOYSA-N 3-methyl-1,2,4-oxadiazole Chemical compound CC=1N=CON=1 FZAXBPZVVJOFKX-UHFFFAOYSA-N 0.000 description 2
- JTSXJHQYAMOGSA-UHFFFAOYSA-N 3-propan-2-yl-1,2,4-oxadiazole Chemical compound CC(C)C=1N=CON=1 JTSXJHQYAMOGSA-UHFFFAOYSA-N 0.000 description 2
- VFPPJWXHNMALKG-UHFFFAOYSA-N 3-propyl-1,2,4-oxadiazole Chemical compound CCCC=1N=CON=1 VFPPJWXHNMALKG-UHFFFAOYSA-N 0.000 description 2
- VPQUXMJGCDXDFA-UHFFFAOYSA-N 3-tert-butyl-1,2,4-oxadiazole Chemical compound CC(C)(C)C=1N=CON=1 VPQUXMJGCDXDFA-UHFFFAOYSA-N 0.000 description 2
- XDOXQQBUPUADQB-UHFFFAOYSA-N 5-(trifluoromethyl)-1,2,4-oxadiazole Chemical compound FC(F)(F)C1=NC=NO1 XDOXQQBUPUADQB-UHFFFAOYSA-N 0.000 description 2
- YIIMEMSDCNDGTB-UHFFFAOYSA-N Dimethylcarbamoyl chloride Chemical compound CN(C)C(Cl)=O YIIMEMSDCNDGTB-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 150000007513 acids Chemical class 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 235000019270 ammonium chloride Nutrition 0.000 description 2
- 239000003638 chemical reducing agent Substances 0.000 description 2
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 2
- 125000000640 cyclooctyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C([H])([H])C1([H])[H] 0.000 description 2
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 2
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 2
- 230000006378 damage Effects 0.000 description 2
- 238000000354 decomposition reaction Methods 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003995 emulsifying agent Substances 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 239000005457 ice water Substances 0.000 description 2
- 239000012442 inert solvent Substances 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- HJOVHMDZYOCNQW-UHFFFAOYSA-N isophorone Chemical compound CC1=CC(=O)CC(C)(C)C1 HJOVHMDZYOCNQW-UHFFFAOYSA-N 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 2
- 125000003136 n-heptyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000740 n-pentyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000004123 n-propyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 230000007935 neutral effect Effects 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000012071 phase Substances 0.000 description 2
- 239000000047 product Substances 0.000 description 2
- 239000011541 reaction mixture Substances 0.000 description 2
- 125000002914 sec-butyl group Chemical group [H]C([H])([H])C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- 239000002689 soil Substances 0.000 description 2
- JOXIMZWYDAKGHI-UHFFFAOYSA-N toluene-4-sulfonic acid Chemical compound CC1=CC=C(S(O)(=O)=O)C=C1 JOXIMZWYDAKGHI-UHFFFAOYSA-N 0.000 description 2
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 2
- 244000045561 useful plants Species 0.000 description 2
- NQPDZGIKBAWPEJ-UHFFFAOYSA-N valeric acid Chemical compound CCCCC(O)=O NQPDZGIKBAWPEJ-UHFFFAOYSA-N 0.000 description 2
- 239000000080 wetting agent Substances 0.000 description 2
- NJYFRQQXXXRJHK-UHFFFAOYSA-N (4-aminophenyl) thiocyanate Chemical compound NC1=CC=C(SC#N)C=C1 NJYFRQQXXXRJHK-UHFFFAOYSA-N 0.000 description 1
- VEUMBMHMMCOFAG-UHFFFAOYSA-N 2,3-dihydrooxadiazole Chemical compound N1NC=CO1 VEUMBMHMMCOFAG-UHFFFAOYSA-N 0.000 description 1
- JSIAIROWMJGMQZ-UHFFFAOYSA-N 2h-triazol-4-amine Chemical class NC1=CNN=N1 JSIAIROWMJGMQZ-UHFFFAOYSA-N 0.000 description 1
- WKZZREFREGLEGB-UHFFFAOYSA-N 3-(4-methylphenyl)-1,2,4-oxadiazole Chemical compound C1=CC(C)=CC=C1C1=NOC=N1 WKZZREFREGLEGB-UHFFFAOYSA-N 0.000 description 1
- CREJDZKNFJVWFY-UHFFFAOYSA-N 3-(fluoromethyl)-1,2,4-oxadiazole Chemical compound FCC=1N=CON=1 CREJDZKNFJVWFY-UHFFFAOYSA-N 0.000 description 1
- OKNMGYIKMVZDRB-UHFFFAOYSA-N 3-(trichloromethyl)-1,2,4-oxadiazole Chemical compound ClC(Cl)(Cl)C=1N=CON=1 OKNMGYIKMVZDRB-UHFFFAOYSA-N 0.000 description 1
- 125000004179 3-chlorophenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(Cl)=C1[H] 0.000 description 1
- 125000004207 3-methoxyphenyl group Chemical group [H]C1=C([H])C(*)=C([H])C(OC([H])([H])[H])=C1[H] 0.000 description 1
- JJBDWBUEPCGFMN-UHFFFAOYSA-N 3-phenyl-1,2,4-oxadiazole Chemical compound O1C=NC(C=2C=CC=CC=2)=N1 JJBDWBUEPCGFMN-UHFFFAOYSA-N 0.000 description 1
- SNFAEUZNFIYGNA-UHFFFAOYSA-N 5-phenyl-1,2,4-oxadiazole Chemical compound C1=NOC(C=2C=CC=CC=2)=N1 SNFAEUZNFIYGNA-UHFFFAOYSA-N 0.000 description 1
- YCFXZBJJCFOWPH-UHFFFAOYSA-N 5-tert-butyl-1,2,4-oxadiazole Chemical compound CC(C)(C)C1=NC=NO1 YCFXZBJJCFOWPH-UHFFFAOYSA-N 0.000 description 1
- 241000743985 Alopecurus Species 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 241000219318 Amaranthus Species 0.000 description 1
- 235000017060 Arachis glabrata Nutrition 0.000 description 1
- 244000105624 Arachis hypogaea Species 0.000 description 1
- 235000010777 Arachis hypogaea Nutrition 0.000 description 1
- 235000018262 Arachis monticola Nutrition 0.000 description 1
- OYPRJOBELJOOCE-UHFFFAOYSA-N Calcium Chemical compound [Ca] OYPRJOBELJOOCE-UHFFFAOYSA-N 0.000 description 1
- 241000132570 Centaurea Species 0.000 description 1
- 235000007516 Chrysanthemum Nutrition 0.000 description 1
- 240000005250 Chrysanthemum indicum Species 0.000 description 1
- 244000192528 Chrysanthemum parthenium Species 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- 241000208296 Datura Species 0.000 description 1
- 235000010469 Glycine max Nutrition 0.000 description 1
- 241000219146 Gossypium Species 0.000 description 1
- 244000020551 Helianthus annuus Species 0.000 description 1
- 235000003222 Helianthus annuus Nutrition 0.000 description 1
- 235000021506 Ipomoea Nutrition 0.000 description 1
- 241000207783 Ipomoea Species 0.000 description 1
- 241000110847 Kochia Species 0.000 description 1
- 241000520028 Lamium Species 0.000 description 1
- 241000209510 Liliopsida Species 0.000 description 1
- 235000019738 Limestone Nutrition 0.000 description 1
- 241000209082 Lolium Species 0.000 description 1
- 235000017945 Matricaria Nutrition 0.000 description 1
- 235000007232 Matricaria chamomilla Nutrition 0.000 description 1
- 240000004658 Medicago sativa Species 0.000 description 1
- 235000017587 Medicago sativa ssp. sativa Nutrition 0.000 description 1
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 1
- 240000007594 Oryza sativa Species 0.000 description 1
- 235000007164 Oryza sativa Nutrition 0.000 description 1
- 235000011096 Papaver Nutrition 0.000 description 1
- 240000001090 Papaver somniferum Species 0.000 description 1
- 240000004713 Pisum sativum Species 0.000 description 1
- 235000010582 Pisum sativum Nutrition 0.000 description 1
- 229920003171 Poly (ethylene oxide) Polymers 0.000 description 1
- 241000780602 Senecio Species 0.000 description 1
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 1
- 241000220261 Sinapis Species 0.000 description 1
- 241000207763 Solanum Species 0.000 description 1
- 235000002634 Solanum Nutrition 0.000 description 1
- 240000006694 Stellaria media Species 0.000 description 1
- 241000219793 Trifolium Species 0.000 description 1
- 241000607479 Yersinia pestis Species 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000016383 Zea mays subsp huehuetenangensis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 150000007933 aliphatic carboxylic acids Chemical class 0.000 description 1
- 150000001338 aliphatic hydrocarbons Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 150000001408 amides Chemical class 0.000 description 1
- 229940051881 anilide analgesics and antipyretics Drugs 0.000 description 1
- 150000003931 anilides Chemical class 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- 150000008107 benzenesulfonic acids Chemical class 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- 150000001559 benzoic acids Chemical class 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 239000011575 calcium Substances 0.000 description 1
- 229910052791 calcium Inorganic materials 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 230000003197 catalytic effect Effects 0.000 description 1
- 229940112021 centrally acting muscle relaxants carbamic acid ester Drugs 0.000 description 1
- 235000013339 cereals Nutrition 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 125000004802 cyanophenyl group Chemical group 0.000 description 1
- 239000002837 defoliant Substances 0.000 description 1
- 150000004891 diazines Chemical class 0.000 description 1
- 125000001664 diethylamino group Chemical group [H]C([H])([H])C([H])([H])N(*)C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003085 diluting agent Substances 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 150000002148 esters Chemical class 0.000 description 1
- 150000002170 ethers Chemical class 0.000 description 1
- 241001233957 eudicotyledons Species 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 235000013312 flour Nutrition 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 150000003977 halocarboxylic acids Chemical class 0.000 description 1
- 229940042795 hydrazides for tuberculosis treatment Drugs 0.000 description 1
- WCYJQVALWQMJGE-UHFFFAOYSA-M hydroxylammonium chloride Chemical compound [Cl-].O[NH3+] WCYJQVALWQMJGE-UHFFFAOYSA-M 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 235000021374 legumes Nutrition 0.000 description 1
- 239000006028 limestone Substances 0.000 description 1
- 125000000040 m-tolyl group Chemical group [H]C1=C([H])C(*)=C([H])C(=C1[H])C([H])([H])[H] 0.000 description 1
- 235000009973 maize Nutrition 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- HAMGRBXTJNITHG-UHFFFAOYSA-N methyl isocyanate Chemical compound CN=C=O HAMGRBXTJNITHG-UHFFFAOYSA-N 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- ZAIHFKLUPWFUGH-UHFFFAOYSA-N n'-hydroxy-3-nitrobenzenecarboximidamide Chemical compound ON=C(N)C1=CC=CC([N+]([O-])=O)=C1 ZAIHFKLUPWFUGH-UHFFFAOYSA-N 0.000 description 1
- 125000001280 n-hexyl group Chemical group C(CCCCC)* 0.000 description 1
- PSZYNBSKGUBXEH-UHFFFAOYSA-N naphthalene-1-sulfonic acid Chemical class C1=CC=C2C(S(=O)(=O)O)=CC=CC2=C1 PSZYNBSKGUBXEH-UHFFFAOYSA-N 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 231100001184 nonphytotoxic Toxicity 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 125000001037 p-tolyl group Chemical group [H]C1=C([H])C(=C([H])C([H])=C1*)C([H])([H])[H] 0.000 description 1
- 210000002741 palatine tonsil Anatomy 0.000 description 1
- 235000020232 peanut Nutrition 0.000 description 1
- 125000000286 phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000000843 powder Substances 0.000 description 1
- 230000001376 precipitating effect Effects 0.000 description 1
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 description 1
- 235000009566 rice Nutrition 0.000 description 1
- 229930195734 saturated hydrocarbon Natural products 0.000 description 1
- 239000000741 silica gel Substances 0.000 description 1
- 229910002027 silica gel Inorganic materials 0.000 description 1
- RMAQACBXLXPBSY-UHFFFAOYSA-N silicic acid Chemical compound O[Si](O)(O)O RMAQACBXLXPBSY-UHFFFAOYSA-N 0.000 description 1
- 235000012239 silicon dioxide Nutrition 0.000 description 1
- QDRKDTQENPPHOJ-UHFFFAOYSA-N sodium ethoxide Chemical compound [Na+].CC[O-] QDRKDTQENPPHOJ-UHFFFAOYSA-N 0.000 description 1
- 239000002904 solvent Substances 0.000 description 1
- 241000894007 species Species 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000000725 suspension Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 150000003560 thiocarbamic acids Chemical class 0.000 description 1
- 150000003918 triazines Chemical class 0.000 description 1
- ILWRPSCZWQJDMK-UHFFFAOYSA-N triethylazanium;chloride Chemical compound Cl.CCN(CC)CC ILWRPSCZWQJDMK-UHFFFAOYSA-N 0.000 description 1
- JOYRKODLDBILNP-UHFFFAOYSA-N urethane group Chemical group NC(=O)OCC JOYRKODLDBILNP-UHFFFAOYSA-N 0.000 description 1
- 229940005605 valeric acid Drugs 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 239000008096 xylene Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D271/00—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms
- C07D271/02—Heterocyclic compounds containing five-membered rings having two nitrogen atoms and one oxygen atom as the only ring hetero atoms not condensed with other rings
- C07D271/06—1,2,4-Oxadiazoles; Hydrogenated 1,2,4-oxadiazoles
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N43/00—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds
- A01N43/72—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms
- A01N43/82—Biocides, pest repellants or attractants, or plant growth regulators containing heterocyclic compounds having rings with nitrogen atoms and oxygen or sulfur atoms as ring hetero atoms five-membered rings with three ring hetero atoms
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/10—Carbamic acid derivatives, i.e. containing the group —O—CO—N<; Thio analogues thereof
- A01N47/20—N-Aryl derivatives thereof
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N47/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid
- A01N47/08—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom not being member of a ring and having no bond to a carbon or hydrogen atom, e.g. derivatives of carbonic acid the carbon atom having one or more single bonds to nitrogen atoms
- A01N47/28—Ureas or thioureas containing the groups >N—CO—N< or >N—CS—N<
- A01N47/30—Derivatives containing the group >N—CO—N aryl or >N—CS—N—aryl
Landscapes
- Life Sciences & Earth Sciences (AREA)
- Wood Science & Technology (AREA)
- Chemical & Material Sciences (AREA)
- Plant Pathology (AREA)
- Health & Medical Sciences (AREA)
- Engineering & Computer Science (AREA)
- Dentistry (AREA)
- Pest Control & Pesticides (AREA)
- Zoology (AREA)
- General Health & Medical Sciences (AREA)
- Environmental Sciences (AREA)
- Agronomy & Crop Science (AREA)
- Organic Chemistry (AREA)
- Heterocyclic Carbon Compounds Containing A Hetero Ring Having Nitrogen And Oxygen As The Only Ring Hetero Atoms (AREA)
- Agricultural Chemicals And Associated Chemicals (AREA)
- Plural Heterocyclic Compounds (AREA)
Priority Applications (27)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782801509 DE2801509A1 (de) | 1978-01-12 | 1978-01-12 | 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| DK542178A DK542178A (da) | 1978-01-12 | 1978-11-30 | 1,2,4-oxadiazolderivater fremgangsmaade til fremstilling af disse forbindelser samt selektive herbicide midler indeholdende disse forbindelser |
| NL7811925A NL7811925A (nl) | 1978-01-12 | 1978-12-06 | 1,2,4-oxadiazool-derivaten, werkwijze voor het bereiden daarvan en op deze verbindingen, gebaseerde, selectieve herbiciden. |
| YU03017/78A YU301778A (en) | 1978-01-12 | 1978-12-21 | Process for obtaining 1,2,4-oxadiazole derivatives |
| ES476468A ES476468A1 (es) | 1978-01-12 | 1978-12-29 | Procedimiento para la preparacion de derivados de 1,2,4-oxa-diazol. |
| IL56339A IL56339A (en) | 1978-01-12 | 1978-12-29 | Herbicidally active(3-amidophenyl)-1,2,4-oxadiazole derivatives,process for their manufacture and their use |
| US06/001,157 US4243409A (en) | 1978-01-12 | 1979-01-04 | 1,2,4-Oxadiazole derivatives and herbicide composition containing same |
| JP33279A JPS54100376A (en) | 1978-01-12 | 1979-01-08 | 1*2*44oxadiazole derivative*its manufacture and selective herbicide containing it |
| GB79587A GB2012764B (en) | 1978-01-12 | 1979-01-08 | Herbicidally active 1,2,4-oxadiazole derivatives a process for their manufacture and their use |
| BG042001A BG30169A3 (en) | 1978-01-12 | 1979-01-09 | Selective herbicide means |
| CS79208A CS204045B2 (en) | 1978-01-12 | 1979-01-09 | Selective herbicide means and method of making the active elements thereof |
| PT69058A PT69058A (de) | 1978-01-12 | 1979-01-10 | 1,2,4-oxadiazolderivate verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| DD79210409A DD141405A5 (de) | 1978-01-12 | 1979-01-10 | Selektive herbizide mittel |
| RO7996238A RO76592A (ro) | 1978-01-12 | 1979-01-10 | Procedeu pentru prepararea unor derivati de 1,2,4-oxadiazol |
| IT19176/79A IT1110393B (it) | 1978-01-12 | 1979-01-10 | Derivati dell 1,2,4-ossadiazolo, procedimento per preparare tali composti e mezzi erbicidi selettiviche li contengono |
| PL1979212703A PL113006B1 (en) | 1978-01-12 | 1979-01-10 | Selective herbicide |
| AU43263/79A AU527548B2 (en) | 1978-01-12 | 1979-01-10 | Herbicidally active 1,2,4-oxadiazole derivatives |
| GR58063A GR73141B (https=) | 1978-01-12 | 1979-01-10 | |
| LU80775A LU80775A1 (de) | 1978-01-12 | 1979-01-10 | 1,2,4-oxadiazolderivate,verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
| CA000319464A CA1118426A (en) | 1978-01-12 | 1979-01-11 | Herbicidally active 1,2,4-oxadiazole derivatives, a process for their manufacture and their use |
| HU79SCHE668A HU180987B (en) | 1978-01-12 | 1979-01-11 | Selective herbicide compositions containing 1,2,4-oxadiazole derivatives |
| FR7900595A FR2414504A1 (fr) | 1978-01-12 | 1979-01-11 | Oxadiazoles-1,2,4 et produits herbicides qui en contiennent |
| SU792707604A SU969162A3 (ru) | 1978-01-12 | 1979-01-11 | Способ получени производных 1,2,4-оксадиазола (его вариант) |
| AT21379A AT362614B (de) | 1978-01-12 | 1979-01-11 | Selektive herbizide mittel |
| BE0/192873A BE873447A (fr) | 1978-01-12 | 1979-01-12 | Derives de 1,2,4-oxadiazole, leur procede de preparation et leur utilisation |
| IE50/79A IE47724B1 (en) | 1978-01-12 | 1979-01-12 | Herbicidally active 1,2,4-oxadiazole derivatives,a process for their manufacture and their use |
| CH31579A CH637647A5 (de) | 1978-01-12 | 1979-01-12 | 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19782801509 DE2801509A1 (de) | 1978-01-12 | 1978-01-12 | 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2801509A1 true DE2801509A1 (de) | 1979-07-19 |
Family
ID=6029492
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19782801509 Withdrawn DE2801509A1 (de) | 1978-01-12 | 1978-01-12 | 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel |
Country Status (27)
| Country | Link |
|---|---|
| US (1) | US4243409A (https=) |
| JP (1) | JPS54100376A (https=) |
| AT (1) | AT362614B (https=) |
| AU (1) | AU527548B2 (https=) |
| BE (1) | BE873447A (https=) |
| BG (1) | BG30169A3 (https=) |
| CA (1) | CA1118426A (https=) |
| CH (1) | CH637647A5 (https=) |
| CS (1) | CS204045B2 (https=) |
| DD (1) | DD141405A5 (https=) |
| DE (1) | DE2801509A1 (https=) |
| DK (1) | DK542178A (https=) |
| ES (1) | ES476468A1 (https=) |
| FR (1) | FR2414504A1 (https=) |
| GB (1) | GB2012764B (https=) |
| GR (1) | GR73141B (https=) |
| HU (1) | HU180987B (https=) |
| IE (1) | IE47724B1 (https=) |
| IL (1) | IL56339A (https=) |
| IT (1) | IT1110393B (https=) |
| LU (1) | LU80775A1 (https=) |
| NL (1) | NL7811925A (https=) |
| PL (1) | PL113006B1 (https=) |
| PT (1) | PT69058A (https=) |
| RO (1) | RO76592A (https=) |
| SU (1) | SU969162A3 (https=) |
| YU (1) | YU301778A (https=) |
Cited By (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0081141A1 (de) * | 1981-12-05 | 1983-06-15 | BASF Aktiengesellschaft | Harnstoffderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| EP0185983A1 (de) * | 1984-12-12 | 1986-07-02 | Bayer Ag | N-(3-Chlor-1,2,4-oxadiazol-5-yl)-harnstoffe |
| US4618617A (en) * | 1982-03-03 | 1986-10-21 | Sumitomo Chemical Company, Limited | Novel 5-substituted 1,2,4,-oxadiazole derivatives and preparation thereof |
| US4871753A (en) * | 1986-12-12 | 1989-10-03 | Ciba-Geigy Corporation | 3-Phenyl-5-trifluoromethyl-1,2,4-oxadiazole compounds which are useful pesticides |
| WO2017076757A1 (en) | 2015-11-02 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10492494B2 (en) | 2015-11-13 | 2019-12-03 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10674727B2 (en) | 2015-11-19 | 2020-06-09 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10687532B2 (en) | 2015-11-13 | 2020-06-23 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10986839B2 (en) | 2016-04-11 | 2021-04-27 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
Families Citing this family (13)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4857099A (en) * | 1982-02-12 | 1989-08-15 | American Cyanamid Company | Terrestrial and aquatic herbicidal methods |
| US4426527A (en) | 1982-02-12 | 1984-01-17 | Ppg Industries, Inc. | 3-[5- Or 3-substituted-1,2,4-oxadiazol-3- or -5-yl]-1-substituted-4-substituted-5-substituted or unsubstituted-2-imidazolidinones |
| IT1163183B (it) * | 1983-03-29 | 1987-04-08 | Anic Spa | Composti eterociclici ad attivita' erbicida |
| US4488897A (en) * | 1983-09-06 | 1984-12-18 | Stauffer Chemical Company | Dichloromethyl oxadiazole herbicide antidotes |
| DE19643037A1 (de) * | 1996-10-18 | 1998-04-23 | Boehringer Ingelheim Kg | Neue Oxadiazole, Verfahren zu ihrer Herstellung sowie deren Verwendung als Arzneimittel |
| WO2001051456A2 (en) * | 2000-01-13 | 2001-07-19 | Tularik Inc. | Antibacterial agents |
| DE102005061427A1 (de) * | 2005-12-22 | 2007-06-28 | Grünenthal GmbH | Substituierte Oxadiazol-Derivate |
| UA99265C2 (ru) * | 2006-09-08 | 2012-08-10 | ПиТиСи ТЕРАПЬЮТИКС, ИНК. | Способ получения 1,2,4-оксадиазолбензойной кислоты и ее производных (варианты) |
| RU2607084C2 (ru) * | 2010-11-12 | 2017-01-10 | Сионоги Энд Ко., Лтд. | Кристаллы производных 6,7-ненасыщенного-7-карбамоилморфинана и способ их получения |
| RU2512293C1 (ru) * | 2012-12-13 | 2014-04-10 | Федеральное государственное бюджетное образовательное учреждение высшего профессионального образования "Ярославский государственный технический университет" | Способ получения этил 1,2,4-оксадиазол-5-карбоксилатов |
| US20180352814A1 (en) * | 2015-12-25 | 2018-12-13 | Sumitomo Chemical Company, Limited | Oxadiazole compounds and use for same |
| RU2674448C1 (ru) * | 2017-07-12 | 2018-12-10 | Марина Владимировна Тарасенко | 3-(3-аминофенил)-5-(проп-1-ен-2-ил)-1,2,4-оксадиазол |
| RU2754735C1 (ru) * | 2020-12-14 | 2021-09-06 | Федеральное государственное бюджетное образовательное учреждение высшего образования "Ярославский государственный технический университет" ФГБОУВО "ЯГТУ" | Способ получения 3,5-дизамещенных 1,2,4-оксадиазолов, содержащих алкенильный фрагмент |
Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB913383A (en) | 1959-08-05 | 1962-12-19 | Ciba Ltd | New carbamic acid derivatives and process for their manufacture |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3218331A (en) * | 1962-04-17 | 1965-11-16 | Union Carbide Corp | Preparation of substituted oxadiazoles |
| NL302339A (https=) * | 1963-03-22 | |||
| FR1395890A (fr) * | 1963-03-22 | 1965-04-16 | Chinoin Gyogyszer Es Vegyeszet | Procédé de préparation de dérivés de l'oxadiazole |
| US3632599A (en) * | 1967-04-28 | 1972-01-04 | Basf Ag | Substituted 1 2 4-oxadiazolidine-3 5-diones |
| GB1051322A (https=) * | 1967-08-09 | |||
| US3575997A (en) * | 1968-07-24 | 1971-04-20 | Squibb & Sons Inc | Novel nematocides and herbicides |
| FR2076487A5 (https=) * | 1970-01-16 | 1971-10-15 | Rhone Poulenc Sa | |
| JPS5012088A (https=) * | 1973-05-31 | 1975-02-07 | ||
| US4003909A (en) * | 1974-07-22 | 1977-01-18 | E. R. Squibb & Sons, Inc. | [(1,2,4-Oxadiazol-3-yl)phenyl]carbamic or thiocarbamic acid esters |
| GB1490406A (en) * | 1974-07-22 | 1977-11-02 | Squibb & Sons Inc | Oxadiazoles |
| JPS51128434A (en) * | 1975-01-10 | 1976-11-09 | Commw Scient Ind Res Org | Method of controlling plant growth and killing it |
-
1978
- 1978-01-12 DE DE19782801509 patent/DE2801509A1/de not_active Withdrawn
- 1978-11-30 DK DK542178A patent/DK542178A/da not_active Application Discontinuation
- 1978-12-06 NL NL7811925A patent/NL7811925A/xx not_active Application Discontinuation
- 1978-12-21 YU YU03017/78A patent/YU301778A/xx unknown
- 1978-12-29 ES ES476468A patent/ES476468A1/es not_active Expired
- 1978-12-29 IL IL56339A patent/IL56339A/xx unknown
-
1979
- 1979-01-04 US US06/001,157 patent/US4243409A/en not_active Expired - Lifetime
- 1979-01-08 GB GB79587A patent/GB2012764B/en not_active Expired
- 1979-01-08 JP JP33279A patent/JPS54100376A/ja active Pending
- 1979-01-09 CS CS79208A patent/CS204045B2/cs unknown
- 1979-01-09 BG BG042001A patent/BG30169A3/xx unknown
- 1979-01-10 GR GR58063A patent/GR73141B/el unknown
- 1979-01-10 RO RO7996238A patent/RO76592A/ro unknown
- 1979-01-10 PT PT69058A patent/PT69058A/pt unknown
- 1979-01-10 PL PL1979212703A patent/PL113006B1/pl unknown
- 1979-01-10 DD DD79210409A patent/DD141405A5/de unknown
- 1979-01-10 LU LU80775A patent/LU80775A1/de unknown
- 1979-01-10 IT IT19176/79A patent/IT1110393B/it active
- 1979-01-10 AU AU43263/79A patent/AU527548B2/en not_active Ceased
- 1979-01-11 AT AT21379A patent/AT362614B/de not_active IP Right Cessation
- 1979-01-11 CA CA000319464A patent/CA1118426A/en not_active Expired
- 1979-01-11 FR FR7900595A patent/FR2414504A1/fr active Granted
- 1979-01-11 HU HU79SCHE668A patent/HU180987B/hu unknown
- 1979-01-11 SU SU792707604A patent/SU969162A3/ru active
- 1979-01-12 BE BE0/192873A patent/BE873447A/xx not_active IP Right Cessation
- 1979-01-12 IE IE50/79A patent/IE47724B1/en unknown
- 1979-01-12 CH CH31579A patent/CH637647A5/de not_active IP Right Cessation
Patent Citations (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB913383A (en) | 1959-08-05 | 1962-12-19 | Ciba Ltd | New carbamic acid derivatives and process for their manufacture |
Cited By (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0081141A1 (de) * | 1981-12-05 | 1983-06-15 | BASF Aktiengesellschaft | Harnstoffderivate, Verfahren zu ihrer Herstellung und ihre Verwendung zur Bekämpfung unerwünschten Pflanzenwuchses |
| US4618617A (en) * | 1982-03-03 | 1986-10-21 | Sumitomo Chemical Company, Limited | Novel 5-substituted 1,2,4,-oxadiazole derivatives and preparation thereof |
| EP0185983A1 (de) * | 1984-12-12 | 1986-07-02 | Bayer Ag | N-(3-Chlor-1,2,4-oxadiazol-5-yl)-harnstoffe |
| US4642312A (en) * | 1984-12-12 | 1987-02-10 | Bayer Aktiengesellschaft | N-(3-chloro-1,2,4-oxadiazol-5-yl)-ureas |
| US4871753A (en) * | 1986-12-12 | 1989-10-03 | Ciba-Geigy Corporation | 3-Phenyl-5-trifluoromethyl-1,2,4-oxadiazole compounds which are useful pesticides |
| WO2017076757A1 (en) | 2015-11-02 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10492494B2 (en) | 2015-11-13 | 2019-12-03 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10687532B2 (en) | 2015-11-13 | 2020-06-23 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10674727B2 (en) | 2015-11-19 | 2020-06-09 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
| US10986839B2 (en) | 2016-04-11 | 2021-04-27 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
Also Published As
| Publication number | Publication date |
|---|---|
| PL113006B1 (en) | 1980-11-29 |
| DK542178A (da) | 1979-07-13 |
| LU80775A1 (de) | 1979-05-16 |
| IT7919176A0 (it) | 1979-01-10 |
| IE47724B1 (en) | 1984-05-30 |
| PL212703A1 (pl) | 1979-09-10 |
| GB2012764B (en) | 1982-06-23 |
| RO76592A (ro) | 1981-04-30 |
| DD141405A5 (de) | 1980-04-30 |
| US4243409A (en) | 1981-01-06 |
| ATA21379A (de) | 1980-10-15 |
| FR2414504A1 (fr) | 1979-08-10 |
| BG30169A3 (en) | 1981-04-15 |
| AU527548B2 (en) | 1983-03-10 |
| AT362614B (de) | 1981-06-10 |
| CH637647A5 (de) | 1983-08-15 |
| SU969162A3 (ru) | 1982-10-23 |
| CS204045B2 (en) | 1981-03-31 |
| GR73141B (https=) | 1984-02-08 |
| FR2414504B1 (https=) | 1983-10-21 |
| IE790050L (en) | 1979-07-12 |
| JPS54100376A (en) | 1979-08-08 |
| PT69058A (de) | 1979-02-01 |
| GB2012764A (en) | 1979-08-01 |
| ES476468A1 (es) | 1979-04-16 |
| HU180987B (en) | 1983-05-30 |
| AU4326379A (en) | 1979-07-19 |
| IL56339A0 (en) | 1979-03-12 |
| CA1118426A (en) | 1982-02-16 |
| BE873447A (fr) | 1979-07-12 |
| IT1110393B (it) | 1985-12-23 |
| YU301778A (en) | 1983-01-21 |
| NL7811925A (nl) | 1979-07-16 |
| IL56339A (en) | 1982-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2801509A1 (de) | 1,2,4-oxadiazolderivate, verfahren zur herstellung dieser verbindungen sowie diese enthaltende selektive herbizide mittel | |
| EP0005501B1 (de) | Heteroaryl-oxyessigsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0029171B1 (de) | Azolyloxy-carbonsäure-N-oxy-amide, Verfahren und Zwischenprodukte zu ihrer Herstellung, ihre Verwendung, sie enthaltende herbizide Mittel und deren Herstellung | |
| EP0148501B1 (de) | 5-Halogenalkyl-1,3,4-thiadiazol-2-yloxyacetamide | |
| EP0300344B1 (de) | Halogenierte Thiadiazolyl-oxyessig-säureamide, Verfahren und Zwischenprodukte zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0100045B1 (de) | Substituierte 3-Trichlormethyl-1,2,4-thiadiazol-5-yl-oxyessigsäureamide, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0348734B1 (de) | Neue Difluormethyl-thiadiazolyl-oxyessigsäureamiden | |
| EP0348736B1 (de) | Substituierte Thiadiazolyloxyessigsäureamide | |
| EP0010163B1 (de) | N-Diazolylalkyl-chloracetanilide, Verfahren zu ihrer Herstellung sowie ihre Verwendung als Herbizide | |
| EP0173312A1 (de) | 1-(2-Trifluormethoxy-phenylsulfonyl)-3-heteroaryl-(thio)-harnstoffe | |
| EP0510479A1 (de) | 7-Chlor-Benzthiazolyloxyacetamide | |
| DE3738963A1 (de) | 3-aminopyrazolin-5-one | |
| DE4230903A1 (de) | Fluorbenzthiazolyloxyacetamide | |
| DE4018352A1 (de) | Cycloalkyl-substituierte thiadiazolyloxyessigsaeureamide | |
| DE3821598A1 (de) | 5-chlor-4-cyano-thiazol-2-yl-oxyessigsaeureamide | |
| EP0410238A2 (de) | 2H-Pyridazinon-Derivate | |
| EP0192117A2 (de) | 5-Chlor-1,3,4-thiadiazol-2-yloxy-acetamide | |
| DE3421351A1 (de) | Substituierte tetrahydrothiopyran-2,4-dione | |
| DE3541260A1 (de) | N-(4-tert.-butoxy-phenyl)-harnstoffe | |
| DE3238007A1 (de) | Herbizide mittel auf basis von triazinon- und triazindion-derivaten | |
| DE3431933A1 (de) | Heteroarylthioharnstoffe | |
| EP0117477A1 (de) | Alkoximinoalkylamino-1,3,5-triazine, Verfahren zu ihrer Herstellung und ihre Verwendung als Herbizide | |
| EP0443164A1 (de) | Chlorfluormethyl-thiadiazolyloxyessigsäureamide | |
| DE3819477A1 (de) | Halogenierte thiadiazolyl-oxyessigsaeureamide, verfahren und neue zwischenprodukte zu ihrer herstellung und ihre verwendung als herbizide | |
| EP0049760A2 (de) | Heterocyclisch substituierte Amide, Verfahren zu deren Herstellung und deren Verwendung als Gegenmittel zum Schutz von Kulturpflanzen vor Schädigungen durch Herbizide |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| 8139 | Disposal/non-payment of the annual fee |