DE2460756A1 - Arzneimittel zur verbesserung der endogenen prostaglandinbildung sowie neue n-(pyridylalkyl)-benzamide, die als wirkstoffe fuer die arzneimittel geeignet sind, und verfahren zu deren herstellung - Google Patents
Arzneimittel zur verbesserung der endogenen prostaglandinbildung sowie neue n-(pyridylalkyl)-benzamide, die als wirkstoffe fuer die arzneimittel geeignet sind, und verfahren zu deren herstellungInfo
- Publication number
- DE2460756A1 DE2460756A1 DE19742460756 DE2460756A DE2460756A1 DE 2460756 A1 DE2460756 A1 DE 2460756A1 DE 19742460756 DE19742460756 DE 19742460756 DE 2460756 A DE2460756 A DE 2460756A DE 2460756 A1 DE2460756 A1 DE 2460756A1
- Authority
- DE
- Germany
- Prior art keywords
- benzamide
- pyridylmethyl
- group
- formula
- chloro
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000004480 active ingredient Substances 0.000 title claims description 30
- 230000015572 biosynthetic process Effects 0.000 title claims description 25
- 229940054066 benzamide antipsychotics Drugs 0.000 title claims description 11
- 238000004519 manufacturing process Methods 0.000 title description 9
- 229940126601 medicinal product Drugs 0.000 title 2
- -1 nitro, amino Chemical group 0.000 claims description 97
- 150000003180 prostaglandins Chemical class 0.000 claims description 55
- 238000000034 method Methods 0.000 claims description 40
- KXDAEFPNCMNJSK-UHFFFAOYSA-N Benzamide Chemical compound NC(=O)C1=CC=CC=C1 KXDAEFPNCMNJSK-UHFFFAOYSA-N 0.000 claims description 36
- 150000001875 compounds Chemical class 0.000 claims description 35
- 239000002253 acid Substances 0.000 claims description 31
- 239000000203 mixture Substances 0.000 claims description 29
- 125000005843 halogen group Chemical group 0.000 claims description 26
- 125000000217 alkyl group Chemical group 0.000 claims description 22
- 150000003839 salts Chemical class 0.000 claims description 22
- 125000004435 hydrogen atom Chemical group [H]* 0.000 claims description 20
- 125000003545 alkoxy group Chemical group 0.000 claims description 18
- 238000002360 preparation method Methods 0.000 claims description 18
- 229930195733 hydrocarbon Natural products 0.000 claims description 17
- 239000004215 Carbon black (E152) Substances 0.000 claims description 16
- 125000004442 acylamino group Chemical group 0.000 claims description 14
- 125000003282 alkyl amino group Chemical group 0.000 claims description 14
- 125000004414 alkyl thio group Chemical group 0.000 claims description 13
- 125000004432 carbon atom Chemical group C* 0.000 claims description 13
- 125000004663 dialkyl amino group Chemical group 0.000 claims description 13
- 229910052739 hydrogen Inorganic materials 0.000 claims description 11
- 239000001257 hydrogen Substances 0.000 claims description 11
- 230000008569 process Effects 0.000 claims description 11
- 125000003118 aryl group Chemical group 0.000 claims description 10
- 239000003795 chemical substances by application Substances 0.000 claims description 10
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 claims description 9
- 238000006243 chemical reaction Methods 0.000 claims description 8
- 125000000753 cycloalkyl group Chemical group 0.000 claims description 7
- 150000002430 hydrocarbons Chemical class 0.000 claims description 7
- 125000000449 nitro group Chemical group [O-][N+](*)=O 0.000 claims description 7
- UFHFLCQGNIYNRP-UHFFFAOYSA-N Hydrogen Chemical compound [H][H] UFHFLCQGNIYNRP-UHFFFAOYSA-N 0.000 claims description 6
- 125000003710 aryl alkyl group Chemical group 0.000 claims description 6
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 claims description 6
- 125000005110 aryl thio group Chemical group 0.000 claims description 5
- 125000004104 aryloxy group Chemical group 0.000 claims description 5
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Chemical compound BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 claims description 5
- 125000002924 primary amino group Chemical group [H]N([H])* 0.000 claims description 5
- 125000004953 trihalomethyl group Chemical group 0.000 claims description 5
- 229910052801 chlorine Inorganic materials 0.000 claims description 4
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical group [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 claims description 3
- 229910052794 bromium Inorganic materials 0.000 claims description 3
- 239000000460 chlorine Substances 0.000 claims description 3
- 229910052731 fluorine Inorganic materials 0.000 claims description 3
- 239000011737 fluorine Substances 0.000 claims description 3
- 229910052736 halogen Inorganic materials 0.000 claims description 3
- 150000002367 halogens Chemical class 0.000 claims description 3
- 229910052740 iodine Inorganic materials 0.000 claims description 3
- 230000003647 oxidation Effects 0.000 claims description 3
- 238000007254 oxidation reaction Methods 0.000 claims description 3
- XKXMLNIPBUIQLH-UHFFFAOYSA-N 2-chloro-n-(pyridin-2-ylmethyl)benzamide Chemical compound ClC1=CC=CC=C1C(=O)NCC1=CC=CC=N1 XKXMLNIPBUIQLH-UHFFFAOYSA-N 0.000 claims description 2
- XNULAMMBNYUVDU-UHFFFAOYSA-N 3-(pyridin-2-ylmethylcarbamoyl)benzenesulfonyl fluoride Chemical compound FS(=O)(=O)C1=CC=CC(C(=O)NCC=2N=CC=CC=2)=C1 XNULAMMBNYUVDU-UHFFFAOYSA-N 0.000 claims description 2
- PXGOKWXKJXAPGV-UHFFFAOYSA-N Fluorine Chemical compound FF PXGOKWXKJXAPGV-UHFFFAOYSA-N 0.000 claims description 2
- 125000003342 alkenyl group Chemical group 0.000 claims description 2
- 125000001309 chloro group Chemical group Cl* 0.000 claims description 2
- 125000004093 cyano group Chemical class *C#N 0.000 claims description 2
- 150000002431 hydrogen Chemical class 0.000 claims description 2
- XDBJKCZHMYOLMS-UHFFFAOYSA-N n-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)benzamide Chemical compound C1=CC(C(F)(F)F)=CC=C1C(=O)NCCC1=CC=CC=N1 XDBJKCZHMYOLMS-UHFFFAOYSA-N 0.000 claims description 2
- JYSGFMAMKCAGON-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)-3-(trifluoromethyl)benzamide Chemical compound FC(F)(F)C1=CC=CC(C(=O)NCC=2C=NC=CC=2)=C1 JYSGFMAMKCAGON-UHFFFAOYSA-N 0.000 claims description 2
- 125000001183 hydrocarbyl group Chemical class 0.000 claims 2
- DERJYEZSLHIUKF-UHFFFAOYSA-N procarbazine hydrochloride Chemical compound Cl.CNNCC1=CC=C(C(=O)NC(C)C)C=C1 DERJYEZSLHIUKF-UHFFFAOYSA-N 0.000 claims 2
- 241000605281 Anaplasma phagocytophilum Species 0.000 claims 1
- 229940094443 oxytocics prostaglandins Drugs 0.000 description 33
- 241000124008 Mammalia Species 0.000 description 23
- 239000003814 drug Substances 0.000 description 23
- 238000002844 melting Methods 0.000 description 22
- 230000008018 melting Effects 0.000 description 22
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 19
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 19
- 239000013078 crystal Substances 0.000 description 17
- DNIAPMSPPWPWGF-UHFFFAOYSA-N Propylene glycol Chemical compound CC(O)CO DNIAPMSPPWPWGF-UHFFFAOYSA-N 0.000 description 16
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 15
- WHIHIKVIWVIIER-UHFFFAOYSA-N 3-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(Cl)=C1 WHIHIKVIWVIIER-UHFFFAOYSA-N 0.000 description 14
- QTBSBXVTEAMEQO-UHFFFAOYSA-N Acetic acid Chemical compound CC(O)=O QTBSBXVTEAMEQO-UHFFFAOYSA-N 0.000 description 12
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 12
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 12
- WOXFMYVTSLAQMO-UHFFFAOYSA-N 2-Pyridinemethanamine Chemical compound NCC1=CC=CC=N1 WOXFMYVTSLAQMO-UHFFFAOYSA-N 0.000 description 11
- 150000003254 radicals Chemical class 0.000 description 11
- 239000007787 solid Substances 0.000 description 11
- 239000000243 solution Substances 0.000 description 11
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 9
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 9
- 239000007788 liquid Substances 0.000 description 9
- 210000001519 tissue Anatomy 0.000 description 9
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 8
- 238000003756 stirring Methods 0.000 description 8
- 208000028990 Skin injury Diseases 0.000 description 7
- 208000027418 Wounds and injury Diseases 0.000 description 7
- 239000000969 carrier Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- VLKZOEOYAKHREP-UHFFFAOYSA-N n-Hexane Chemical compound CCCCCC VLKZOEOYAKHREP-UHFFFAOYSA-N 0.000 description 7
- HDOUGSFASVGDCS-UHFFFAOYSA-N pyridin-3-ylmethanamine Chemical compound NCC1=CC=CN=C1 HDOUGSFASVGDCS-UHFFFAOYSA-N 0.000 description 7
- OXZYBOLWRXENKT-UHFFFAOYSA-N 4-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=C(C(Cl)=O)C=C1 OXZYBOLWRXENKT-UHFFFAOYSA-N 0.000 description 6
- PEDCQBHIVMGVHV-UHFFFAOYSA-N Glycerine Chemical compound OCC(O)CO PEDCQBHIVMGVHV-UHFFFAOYSA-N 0.000 description 6
- 210000001772 blood platelet Anatomy 0.000 description 6
- KRKNYBCHXYNGOX-UHFFFAOYSA-N citric acid Chemical compound OC(=O)CC(O)(C(O)=O)CC(O)=O KRKNYBCHXYNGOX-UHFFFAOYSA-N 0.000 description 6
- 238000002425 crystallisation Methods 0.000 description 6
- 230000008025 crystallization Effects 0.000 description 6
- 230000006378 damage Effects 0.000 description 6
- 230000035876 healing Effects 0.000 description 6
- 239000003921 oil Substances 0.000 description 6
- 235000019198 oils Nutrition 0.000 description 6
- 235000013772 propylene glycol Nutrition 0.000 description 6
- 239000002904 solvent Substances 0.000 description 6
- 239000000829 suppository Substances 0.000 description 6
- YLQBMQCUIZJEEH-UHFFFAOYSA-N tetrahydrofuran Natural products C=1C=COC=1 YLQBMQCUIZJEEH-UHFFFAOYSA-N 0.000 description 6
- 208000032843 Hemorrhage Diseases 0.000 description 5
- 241000282412 Homo Species 0.000 description 5
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 5
- 241000700159 Rattus Species 0.000 description 5
- 210000004369 blood Anatomy 0.000 description 5
- 239000008280 blood Substances 0.000 description 5
- 239000002775 capsule Substances 0.000 description 5
- 239000003085 diluting agent Substances 0.000 description 5
- 208000014674 injury Diseases 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- 230000001225 therapeutic effect Effects 0.000 description 5
- ONIKNECPXCLUHT-UHFFFAOYSA-N 2-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1Cl ONIKNECPXCLUHT-UHFFFAOYSA-N 0.000 description 4
- HEDRZPFGACZZDS-UHFFFAOYSA-N Chloroform Chemical compound ClC(Cl)Cl HEDRZPFGACZZDS-UHFFFAOYSA-N 0.000 description 4
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 4
- MHAJPDPJQMAIIY-UHFFFAOYSA-N Hydrogen peroxide Chemical compound OO MHAJPDPJQMAIIY-UHFFFAOYSA-N 0.000 description 4
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 4
- 150000005840 aryl radicals Chemical group 0.000 description 4
- 230000000740 bleeding effect Effects 0.000 description 4
- BXWNKGSJHAJOGX-UHFFFAOYSA-N hexadecan-1-ol Chemical compound CCCCCCCCCCCCCCCCO BXWNKGSJHAJOGX-UHFFFAOYSA-N 0.000 description 4
- HQKMJHAJHXVSDF-UHFFFAOYSA-L magnesium stearate Chemical compound [Mg+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O HQKMJHAJHXVSDF-UHFFFAOYSA-L 0.000 description 4
- QELSKZZBTMNZEB-UHFFFAOYSA-N propylparaben Chemical compound CCCOC(=O)C1=CC=C(O)C=C1 QELSKZZBTMNZEB-UHFFFAOYSA-N 0.000 description 4
- TXQWFIVRZNOPCK-UHFFFAOYSA-N pyridin-4-ylmethanamine Chemical compound NCC1=CC=NC=C1 TXQWFIVRZNOPCK-UHFFFAOYSA-N 0.000 description 4
- 239000011541 reaction mixture Substances 0.000 description 4
- 230000004044 response Effects 0.000 description 4
- 210000000582 semen Anatomy 0.000 description 4
- 210000003491 skin Anatomy 0.000 description 4
- 238000003786 synthesis reaction Methods 0.000 description 4
- 238000007910 systemic administration Methods 0.000 description 4
- 239000000454 talc Substances 0.000 description 4
- 229910052623 talc Inorganic materials 0.000 description 4
- 235000012222 talc Nutrition 0.000 description 4
- LTHOSILCKUBBIS-UHFFFAOYSA-N 3-(trifluoromethyl)benzoyl fluoride Chemical compound FC(=O)C1=CC=CC(C(F)(F)F)=C1 LTHOSILCKUBBIS-UHFFFAOYSA-N 0.000 description 3
- RKIDDEGICSMIJA-UHFFFAOYSA-N 4-chlorobenzoyl chloride Chemical compound ClC(=O)C1=CC=C(Cl)C=C1 RKIDDEGICSMIJA-UHFFFAOYSA-N 0.000 description 3
- WEVYAHXRMPXWCK-UHFFFAOYSA-N Acetonitrile Chemical compound CC#N WEVYAHXRMPXWCK-UHFFFAOYSA-N 0.000 description 3
- GUBGYTABKSRVRQ-QKKXKWKRSA-N Lactose Natural products OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@H]1O GUBGYTABKSRVRQ-QKKXKWKRSA-N 0.000 description 3
- 241001465754 Metazoa Species 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 150000001204 N-oxides Chemical class 0.000 description 3
- 229920002472 Starch Polymers 0.000 description 3
- 239000000443 aerosol Substances 0.000 description 3
- 125000003277 amino group Chemical group 0.000 description 3
- 239000007864 aqueous solution Substances 0.000 description 3
- 230000037396 body weight Effects 0.000 description 3
- 239000006071 cream Substances 0.000 description 3
- 238000001914 filtration Methods 0.000 description 3
- 235000011187 glycerol Nutrition 0.000 description 3
- 239000005457 ice water Substances 0.000 description 3
- 239000008101 lactose Substances 0.000 description 3
- 239000006210 lotion Substances 0.000 description 3
- 230000007246 mechanism Effects 0.000 description 3
- 150000002825 nitriles Chemical class 0.000 description 3
- 239000000546 pharmaceutical excipient Substances 0.000 description 3
- 239000000843 powder Substances 0.000 description 3
- 239000002244 precipitate Substances 0.000 description 3
- 239000003755 preservative agent Substances 0.000 description 3
- 229920006395 saturated elastomer Polymers 0.000 description 3
- 239000008107 starch Substances 0.000 description 3
- 235000019698 starch Nutrition 0.000 description 3
- 230000000638 stimulation Effects 0.000 description 3
- 239000000725 suspension Substances 0.000 description 3
- PUPZLCDOIYMWBV-UHFFFAOYSA-N (+/-)-1,3-Butanediol Chemical compound CC(O)CCO PUPZLCDOIYMWBV-UHFFFAOYSA-N 0.000 description 2
- VBICKXHEKHSIBG-UHFFFAOYSA-N 1-monostearoylglycerol Chemical compound CCCCCCCCCCCCCCCCCC(=O)OCC(O)CO VBICKXHEKHSIBG-UHFFFAOYSA-N 0.000 description 2
- XPQIPUZPSLAZDV-UHFFFAOYSA-N 2-pyridylethylamine Chemical compound NCCC1=CC=CC=N1 XPQIPUZPSLAZDV-UHFFFAOYSA-N 0.000 description 2
- CFKMVGJGLGKFKI-UHFFFAOYSA-N 4-chloro-m-cresol Chemical compound CC1=CC(O)=CC=C1Cl CFKMVGJGLGKFKI-UHFFFAOYSA-N 0.000 description 2
- NWPBFGWVZQGAHM-UHFFFAOYSA-N 4-methylbenzenecarbothioyl chloride Chemical compound CC1=CC=C(C(Cl)=S)C=C1 NWPBFGWVZQGAHM-UHFFFAOYSA-N 0.000 description 2
- JPVUWCPKMYXOKW-UHFFFAOYSA-N 4-phenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1=CC=CC=C1 JPVUWCPKMYXOKW-UHFFFAOYSA-N 0.000 description 2
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 2
- ROSDSFDQCJNGOL-UHFFFAOYSA-N Dimethylamine Chemical compound CNC ROSDSFDQCJNGOL-UHFFFAOYSA-N 0.000 description 2
- IAZDPXIOMUYVGZ-UHFFFAOYSA-N Dimethylsulphoxide Chemical compound CS(C)=O IAZDPXIOMUYVGZ-UHFFFAOYSA-N 0.000 description 2
- 206010021929 Infertility male Diseases 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 208000007466 Male Infertility Diseases 0.000 description 2
- 230000006181 N-acylation Effects 0.000 description 2
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 2
- NBIIXXVUZAFLBC-UHFFFAOYSA-N Phosphoric acid Chemical compound OP(O)(O)=O NBIIXXVUZAFLBC-UHFFFAOYSA-N 0.000 description 2
- 206010072170 Skin wound Diseases 0.000 description 2
- UIIMBOGNXHQVGW-UHFFFAOYSA-M Sodium bicarbonate Chemical compound [Na+].OC([O-])=O UIIMBOGNXHQVGW-UHFFFAOYSA-M 0.000 description 2
- FAPWRFPIFSIZLT-UHFFFAOYSA-M Sodium chloride Chemical compound [Na+].[Cl-] FAPWRFPIFSIZLT-UHFFFAOYSA-M 0.000 description 2
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 2
- 229930006000 Sucrose Natural products 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 2
- 208000007536 Thrombosis Diseases 0.000 description 2
- 208000036029 Uterine contractions during pregnancy Diseases 0.000 description 2
- 206010046788 Uterine haemorrhage Diseases 0.000 description 2
- 206010052428 Wound Diseases 0.000 description 2
- 241000607479 Yersinia pestis Species 0.000 description 2
- 239000000370 acceptor Substances 0.000 description 2
- 150000001298 alcohols Chemical class 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 125000004202 aminomethyl group Chemical group [H]N([H])C([H])([H])* 0.000 description 2
- 239000002585 base Substances 0.000 description 2
- WPYMKLBDIGXBTP-UHFFFAOYSA-N benzoic acid Chemical compound OC(=O)C1=CC=CC=C1 WPYMKLBDIGXBTP-UHFFFAOYSA-N 0.000 description 2
- SESFRYSPDFLNCH-UHFFFAOYSA-N benzyl benzoate Chemical compound C=1C=CC=CC=1C(=O)OCC1=CC=CC=C1 SESFRYSPDFLNCH-UHFFFAOYSA-N 0.000 description 2
- UUQMNUMQCIQDMZ-UHFFFAOYSA-N betahistine Chemical compound CNCCC1=CC=CC=N1 UUQMNUMQCIQDMZ-UHFFFAOYSA-N 0.000 description 2
- 229960000541 cetyl alcohol Drugs 0.000 description 2
- OSASVXMJTNOKOY-UHFFFAOYSA-N chlorobutanol Chemical compound CC(C)(O)C(Cl)(Cl)Cl OSASVXMJTNOKOY-UHFFFAOYSA-N 0.000 description 2
- 235000014113 dietary fatty acids Nutrition 0.000 description 2
- 239000002552 dosage form Substances 0.000 description 2
- 229940079593 drug Drugs 0.000 description 2
- 239000003937 drug carrier Substances 0.000 description 2
- 238000000605 extraction Methods 0.000 description 2
- 239000000194 fatty acid Substances 0.000 description 2
- 229930195729 fatty acid Natural products 0.000 description 2
- 150000004665 fatty acids Chemical class 0.000 description 2
- 239000012458 free base Substances 0.000 description 2
- 239000007903 gelatin capsule Substances 0.000 description 2
- 238000011065 in-situ storage Methods 0.000 description 2
- 230000004054 inflammatory process Effects 0.000 description 2
- 239000004615 ingredient Substances 0.000 description 2
- 238000002347 injection Methods 0.000 description 2
- 239000007924 injection Substances 0.000 description 2
- 239000007951 isotonicity adjuster Substances 0.000 description 2
- 235000015110 jellies Nutrition 0.000 description 2
- JVTAAEKCZFNVCJ-UHFFFAOYSA-N lactic acid Chemical compound CC(O)C(O)=O JVTAAEKCZFNVCJ-UHFFFAOYSA-N 0.000 description 2
- 235000019359 magnesium stearate Nutrition 0.000 description 2
- LXCFILQKKLGQFO-UHFFFAOYSA-N methylparaben Chemical compound COC(=O)C1=CC=C(O)C=C1 LXCFILQKKLGQFO-UHFFFAOYSA-N 0.000 description 2
- 239000002674 ointment Substances 0.000 description 2
- 239000006072 paste Substances 0.000 description 2
- 239000000575 pesticide Substances 0.000 description 2
- 210000002381 plasma Anatomy 0.000 description 2
- 229920001223 polyethylene glycol Polymers 0.000 description 2
- 229940057838 polyethylene glycol 4000 Drugs 0.000 description 2
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Chemical compound [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 2
- 239000004405 propyl p-hydroxybenzoate Substances 0.000 description 2
- 235000010232 propyl p-hydroxybenzoate Nutrition 0.000 description 2
- 229960003415 propylparaben Drugs 0.000 description 2
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 2
- 230000009467 reduction Effects 0.000 description 2
- YGSDEFSMJLZEOE-UHFFFAOYSA-N salicylic acid Chemical compound OC(=O)C1=CC=CC=C1O YGSDEFSMJLZEOE-UHFFFAOYSA-N 0.000 description 2
- 210000003752 saphenous vein Anatomy 0.000 description 2
- PUZPDOWCWNUUKD-UHFFFAOYSA-M sodium fluoride Chemical compound [F-].[Na+] PUZPDOWCWNUUKD-UHFFFAOYSA-M 0.000 description 2
- 208000010110 spontaneous platelet aggregation Diseases 0.000 description 2
- 230000004936 stimulating effect Effects 0.000 description 2
- 238000003860 storage Methods 0.000 description 2
- 239000005720 sucrose Substances 0.000 description 2
- 230000009885 systemic effect Effects 0.000 description 2
- 238000011200 topical administration Methods 0.000 description 2
- 230000000699 topical effect Effects 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- 235000015112 vegetable and seed oil Nutrition 0.000 description 2
- 239000008158 vegetable oil Substances 0.000 description 2
- 229920002554 vinyl polymer Polymers 0.000 description 2
- 238000005303 weighing Methods 0.000 description 2
- BNJMRELGMDUDDB-UHFFFAOYSA-N $l^{1}-sulfanylbenzene Chemical compound [S]C1=CC=CC=C1 BNJMRELGMDUDDB-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-VKHMYHEASA-N (+)-propylene glycol Chemical compound C[C@H](O)CO DNIAPMSPPWPWGF-VKHMYHEASA-N 0.000 description 1
- GGHCWJWUOSNCSK-UHFFFAOYSA-N (2-chloropyridin-4-yl)methanamine Chemical compound NCC1=CC=NC(Cl)=C1 GGHCWJWUOSNCSK-UHFFFAOYSA-N 0.000 description 1
- QPRZPKGMUJBNPY-UHFFFAOYSA-N (3-chloropyridin-2-yl)methanamine Chemical compound NCC1=NC=CC=C1Cl QPRZPKGMUJBNPY-UHFFFAOYSA-N 0.000 description 1
- CCSXJBGBEXZUAD-UHFFFAOYSA-N (3-nitropyridin-2-yl)methanamine Chemical compound NCC1=NC=CC=C1[N+]([O-])=O CCSXJBGBEXZUAD-UHFFFAOYSA-N 0.000 description 1
- PEEZBLLORUWHPZ-UHFFFAOYSA-N (4-benzylpyridin-2-yl)methanamine Chemical compound C1=NC(CN)=CC(CC=2C=CC=CC=2)=C1 PEEZBLLORUWHPZ-UHFFFAOYSA-N 0.000 description 1
- KUGZSPNESAJGED-UHFFFAOYSA-N (4-phenylpyridin-2-yl)methanamine Chemical compound C1=NC(CN)=CC(C=2C=CC=CC=2)=C1 KUGZSPNESAJGED-UHFFFAOYSA-N 0.000 description 1
- HXFYXLLVIVSPLT-UHFFFAOYSA-N (6-methylpyridin-2-yl)methanamine Chemical compound CC1=CC=CC(CN)=N1 HXFYXLLVIVSPLT-UHFFFAOYSA-N 0.000 description 1
- DNIAPMSPPWPWGF-GSVOUGTGSA-N (R)-(-)-Propylene glycol Chemical compound C[C@@H](O)CO DNIAPMSPPWPWGF-GSVOUGTGSA-N 0.000 description 1
- YPFDHNVEDLHUCE-UHFFFAOYSA-N 1,3-propanediol Substances OCCCO YPFDHNVEDLHUCE-UHFFFAOYSA-N 0.000 description 1
- RYHBNJHYFVUHQT-UHFFFAOYSA-N 1,4-Dioxane Chemical compound C1COCCO1 RYHBNJHYFVUHQT-UHFFFAOYSA-N 0.000 description 1
- RRLRWANEZGPBAD-UHFFFAOYSA-N 1-phenyl-n-(pyridin-2-ylmethyl)methanamine Chemical compound C=1C=CC=CC=1CNCC1=CC=CC=N1 RRLRWANEZGPBAD-UHFFFAOYSA-N 0.000 description 1
- RSINFFVFOTUDEC-UHFFFAOYSA-N 2,5-dichlorobenzoyl chloride Chemical compound ClC(=O)C1=CC(Cl)=CC=C1Cl RSINFFVFOTUDEC-UHFFFAOYSA-N 0.000 description 1
- PEVJTUUIXUSOHW-UHFFFAOYSA-N 2,5-diethylbenzoyl chloride Chemical compound CCC1=CC=C(CC)C(C(Cl)=O)=C1 PEVJTUUIXUSOHW-UHFFFAOYSA-N 0.000 description 1
- YARKPRSRXZGKNI-UHFFFAOYSA-N 2,5-dimethoxybenzoyl chloride Chemical compound COC1=CC=C(OC)C(C(Cl)=O)=C1 YARKPRSRXZGKNI-UHFFFAOYSA-N 0.000 description 1
- SZADDZMVFPDSLB-UHFFFAOYSA-N 2-(aminomethyl)-n,n-diethylpyridin-3-amine Chemical compound CCN(CC)C1=CC=CN=C1CN SZADDZMVFPDSLB-UHFFFAOYSA-N 0.000 description 1
- JXKWRWSEFDSNTQ-UHFFFAOYSA-N 2-(aminomethyl)-n-ethylpyridin-3-amine Chemical compound CCNC1=CC=CN=C1CN JXKWRWSEFDSNTQ-UHFFFAOYSA-N 0.000 description 1
- AIZIIROOYVPSIM-UHFFFAOYSA-N 2-(pyridin-2-ylmethyl)benzamide Chemical compound NC(=O)C1=CC=CC=C1CC1=CC=CC=N1 AIZIIROOYVPSIM-UHFFFAOYSA-N 0.000 description 1
- MXIUWSYTQJLIKE-UHFFFAOYSA-N 2-(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC=CC=C1C(Cl)=O MXIUWSYTQJLIKE-UHFFFAOYSA-N 0.000 description 1
- VQCAHUSKECKWPX-UHFFFAOYSA-N 2-amino-n-(pyridin-3-ylmethyl)benzamide Chemical compound NC1=CC=CC=C1C(=O)NCC1=CC=CN=C1 VQCAHUSKECKWPX-UHFFFAOYSA-N 0.000 description 1
- RLCMQWBYWOIEGD-UHFFFAOYSA-N 2-aminobenzoyl chloride Chemical compound NC1=CC=CC=C1C(Cl)=O RLCMQWBYWOIEGD-UHFFFAOYSA-N 0.000 description 1
- 125000000022 2-aminoethyl group Chemical group [H]C([*])([H])C([H])([H])N([H])[H] 0.000 description 1
- QQKFAVVRKQUZBJ-UHFFFAOYSA-N 2-chloro-6-ethylpyridine-4-carbothioamide Chemical compound CCC1=CC(C(N)=S)=CC(Cl)=N1 QQKFAVVRKQUZBJ-UHFFFAOYSA-N 0.000 description 1
- 125000004182 2-chlorophenyl group Chemical group [H]C1=C([H])C(Cl)=C(*)C([H])=C1[H] 0.000 description 1
- FFNVQNRYTPFDDP-UHFFFAOYSA-N 2-cyanopyridine Chemical compound N#CC1=CC=CC=N1 FFNVQNRYTPFDDP-UHFFFAOYSA-N 0.000 description 1
- NRGGMCIBEHEAIL-UHFFFAOYSA-N 2-ethylpyridine Chemical compound CCC1=CC=CC=N1 NRGGMCIBEHEAIL-UHFFFAOYSA-N 0.000 description 1
- GPZXFICWCMCQPF-UHFFFAOYSA-N 2-methylbenzoyl chloride Chemical compound CC1=CC=CC=C1C(Cl)=O GPZXFICWCMCQPF-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- 125000003903 2-propenyl group Chemical group [H]C([*])([H])C([H])=C([H])[H] 0.000 description 1
- UXVCEKRAZBZVSL-UHFFFAOYSA-N 2-pyridin-2-ylacetamide Chemical compound NC(=O)CC1=CC=CC=N1 UXVCEKRAZBZVSL-UHFFFAOYSA-N 0.000 description 1
- OIPHWUPMXHQWLR-UHFFFAOYSA-N 2-pyridin-3-ylacetonitrile Chemical compound N#CCC1=CC=CN=C1 OIPHWUPMXHQWLR-UHFFFAOYSA-N 0.000 description 1
- OPDAKWVUGWSQRB-UHFFFAOYSA-N 3,5-bis(diethylamino)benzoyl chloride Chemical compound CCN(CC)C1=CC(N(CC)CC)=CC(C(Cl)=O)=C1 OPDAKWVUGWSQRB-UHFFFAOYSA-N 0.000 description 1
- WAKMMQSMEDJRRI-UHFFFAOYSA-N 3,5-bis(trifluoromethyl)benzoyl chloride Chemical compound FC(F)(F)C1=CC(C(Cl)=O)=CC(C(F)(F)F)=C1 WAKMMQSMEDJRRI-UHFFFAOYSA-N 0.000 description 1
- YUJIMZVDTNCSEI-UHFFFAOYSA-N 3,5-diaminopyridine-2-carbonitrile Chemical compound NC1=CN=C(C#N)C(N)=C1 YUJIMZVDTNCSEI-UHFFFAOYSA-N 0.000 description 1
- VPQYELFUUKKTLX-UHFFFAOYSA-N 3-(ethylamino)pyridine-2-carbonitrile Chemical compound CCNC1=CC=CN=C1C#N VPQYELFUUKKTLX-UHFFFAOYSA-N 0.000 description 1
- XFJPRHCNBRLWAF-UHFFFAOYSA-N 3-(methylamino)benzoyl chloride Chemical compound CNC1=CC=CC(C(Cl)=O)=C1 XFJPRHCNBRLWAF-UHFFFAOYSA-N 0.000 description 1
- IJDQYWTWEUAXTL-UHFFFAOYSA-N 3-(pyridin-2-ylmethylcarbamoyl)benzenesulfonyl fluoride;hydrochloride Chemical compound Cl.FS(=O)(=O)C1=CC=CC(C(=O)NCC=2N=CC=CC=2)=C1 IJDQYWTWEUAXTL-UHFFFAOYSA-N 0.000 description 1
- CKDOJCKBQWSURG-UHFFFAOYSA-N 3-amino-n-(pyridin-3-ylmethyl)benzamide Chemical compound NC1=CC=CC(C(=O)NCC=2C=NC=CC=2)=C1 CKDOJCKBQWSURG-UHFFFAOYSA-N 0.000 description 1
- BMYNFMYTOJXKLE-UHFFFAOYSA-N 3-azaniumyl-2-hydroxypropanoate Chemical compound NCC(O)C(O)=O BMYNFMYTOJXKLE-UHFFFAOYSA-N 0.000 description 1
- YDPLFBIGFQFIDB-UHFFFAOYSA-N 3-chloropyridine-2-carbonitrile Chemical compound ClC1=CC=CN=C1C#N YDPLFBIGFQFIDB-UHFFFAOYSA-N 0.000 description 1
- CYAKEVDKUSKXRV-UHFFFAOYSA-N 3-cyano-n-(pyridin-3-ylmethyl)benzamide Chemical compound C=1C=CC(C#N)=CC=1C(=O)NCC1=CC=CN=C1 CYAKEVDKUSKXRV-UHFFFAOYSA-N 0.000 description 1
- RPESZQVUWMFBEO-UHFFFAOYSA-N 3-cyanobenzoyl chloride Chemical compound ClC(=O)C1=CC=CC(C#N)=C1 RPESZQVUWMFBEO-UHFFFAOYSA-N 0.000 description 1
- SYVNVEGIRVXRQH-UHFFFAOYSA-N 3-fluorobenzoyl chloride Chemical compound FC1=CC=CC(C(Cl)=O)=C1 SYVNVEGIRVXRQH-UHFFFAOYSA-N 0.000 description 1
- YFXIDEGFJPCTGO-UHFFFAOYSA-N 3-nitro-n-(pyridin-2-ylmethyl)benzamide Chemical compound [O-][N+](=O)C1=CC=CC(C(=O)NCC=2N=CC=CC=2)=C1 YFXIDEGFJPCTGO-UHFFFAOYSA-N 0.000 description 1
- NXTNASSYJUXJDV-UHFFFAOYSA-N 3-nitrobenzoyl chloride Chemical compound [O-][N+](=O)C1=CC=CC(C(Cl)=O)=C1 NXTNASSYJUXJDV-UHFFFAOYSA-N 0.000 description 1
- OLXPGXMJZQJQHT-UHFFFAOYSA-N 3-nitropyridine-2-carbonitrile Chemical compound [O-][N+](=O)C1=CC=CN=C1C#N OLXPGXMJZQJQHT-UHFFFAOYSA-N 0.000 description 1
- AQFRWFUYNPZERK-UHFFFAOYSA-N 4,6-dimethylpyridine-2-carbonitrile Chemical compound CC1=CC(C)=NC(C#N)=C1 AQFRWFUYNPZERK-UHFFFAOYSA-N 0.000 description 1
- LVYNUANHGDRHJV-UHFFFAOYSA-N 4-(diethylamino)-n-(pyridin-3-ylmethyl)benzamide Chemical compound C1=CC(N(CC)CC)=CC=C1C(=O)NCC1=CC=CN=C1 LVYNUANHGDRHJV-UHFFFAOYSA-N 0.000 description 1
- SKASDNMOTIBYSI-UHFFFAOYSA-N 4-(methylamino)-n-(pyridin-3-ylmethyl)benzamide Chemical compound C1=CC(NC)=CC=C1C(=O)NCC1=CC=CN=C1 SKASDNMOTIBYSI-UHFFFAOYSA-N 0.000 description 1
- CNUSUSDRUJDLFU-UHFFFAOYSA-N 4-(trifluoromethyl)pyridine-2-carbonitrile Chemical compound FC(F)(F)C1=CC=NC(C#N)=C1 CNUSUSDRUJDLFU-UHFFFAOYSA-N 0.000 description 1
- QAGZEYSYZCLCSG-UHFFFAOYSA-N 4-amino-n-(pyridin-4-ylmethyl)benzamide Chemical compound C1=CC(N)=CC=C1C(=O)NCC1=CC=NC=C1 QAGZEYSYZCLCSG-UHFFFAOYSA-N 0.000 description 1
- WBTYJEKADPHWEW-UHFFFAOYSA-N 4-benzylpyridine-2-carbonitrile Chemical compound C1=NC(C#N)=CC(CC=2C=CC=CC=2)=C1 WBTYJEKADPHWEW-UHFFFAOYSA-N 0.000 description 1
- WRFYIYOXJWKONR-UHFFFAOYSA-N 4-bromo-2-methoxyaniline Chemical compound COC1=CC(Br)=CC=C1N WRFYIYOXJWKONR-UHFFFAOYSA-N 0.000 description 1
- BIXFYDAUXVQCJX-UHFFFAOYSA-N 4-cyclohexyl-n-(pyridin-3-ylmethyl)benzamide Chemical compound C=1C=C(C2CCCCC2)C=CC=1C(=O)NCC1=CC=CN=C1 BIXFYDAUXVQCJX-UHFFFAOYSA-N 0.000 description 1
- MWLQEWDQXQHQED-UHFFFAOYSA-N 4-cyclohexylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1C1CCCCC1 MWLQEWDQXQHQED-UHFFFAOYSA-N 0.000 description 1
- RGSJKAOAQWCUME-UHFFFAOYSA-N 4-ethoxypyridine-2-carboxamide Chemical compound CCOC1=CC=NC(C(N)=O)=C1 RGSJKAOAQWCUME-UHFFFAOYSA-N 0.000 description 1
- HIQIXEFWDLTDED-UHFFFAOYSA-N 4-hydroxy-1-piperidin-4-ylpyrrolidin-2-one Chemical compound O=C1CC(O)CN1C1CCNCC1 HIQIXEFWDLTDED-UHFFFAOYSA-N 0.000 description 1
- LQAWSWUFSHYCHP-UHFFFAOYSA-N 4-methylpyridine-2-carbonitrile Chemical compound CC1=CC=NC(C#N)=C1 LQAWSWUFSHYCHP-UHFFFAOYSA-N 0.000 description 1
- VUARMFARHOEACL-UHFFFAOYSA-N 4-methylsulfanyl-n-(pyridin-3-ylmethyl)benzamide Chemical compound C1=CC(SC)=CC=C1C(=O)NCC1=CC=CN=C1 VUARMFARHOEACL-UHFFFAOYSA-N 0.000 description 1
- OHBQLVNPKQOPQO-UHFFFAOYSA-N 4-methylsulfanylpyridine-2-carbonitrile Chemical compound CSC1=CC=NC(C#N)=C1 OHBQLVNPKQOPQO-UHFFFAOYSA-N 0.000 description 1
- DWCCZVGNMVCAKX-UHFFFAOYSA-N 4-nitro-n-(pyridin-2-ylmethyl)benzamide Chemical compound C1=CC([N+](=O)[O-])=CC=C1C(=O)NCC1=CC=CC=N1 DWCCZVGNMVCAKX-UHFFFAOYSA-N 0.000 description 1
- PCWRYVVSPBQDBX-UHFFFAOYSA-N 4-phenoxy-n-(pyridin-3-ylmethyl)benzamide Chemical compound C=1C=C(OC=2C=CC=CC=2)C=CC=1C(=O)NCC1=CC=CN=C1 PCWRYVVSPBQDBX-UHFFFAOYSA-N 0.000 description 1
- VATJSEUMTGEIQS-UHFFFAOYSA-N 4-phenyldiazenyl-n-(pyridin-3-ylmethyl)benzamide Chemical compound C=1C=C(N=NC=2C=CC=CC=2)C=CC=1C(=O)NCC1=CC=CN=C1 VATJSEUMTGEIQS-UHFFFAOYSA-N 0.000 description 1
- RYMHZBAYPLCCAC-UHFFFAOYSA-N 4-phenyldiazenylbenzoyl chloride Chemical compound C1=CC(C(=O)Cl)=CC=C1N=NC1=CC=CC=C1 RYMHZBAYPLCCAC-UHFFFAOYSA-N 0.000 description 1
- SRJOCJAOPUBFSW-UHFFFAOYSA-N 5-(aminomethyl)-2-methylpyridin-3-amine Chemical compound CC1=NC=C(CN)C=C1N SRJOCJAOPUBFSW-UHFFFAOYSA-N 0.000 description 1
- OTXCDWIUODLZFJ-UHFFFAOYSA-N 5-ethylsulfanyl-N-phenylpyridine-2-carboxamide Chemical compound N1=CC(SCC)=CC=C1C(=O)NC1=CC=CC=C1 OTXCDWIUODLZFJ-UHFFFAOYSA-N 0.000 description 1
- 239000005995 Aluminium silicate Substances 0.000 description 1
- 240000002470 Amphicarpaea bracteata Species 0.000 description 1
- 206010003210 Arteriosclerosis Diseases 0.000 description 1
- 241000416162 Astragalus gummifer Species 0.000 description 1
- 201000001320 Atherosclerosis Diseases 0.000 description 1
- 239000005711 Benzoic acid Substances 0.000 description 1
- 241000283690 Bos taurus Species 0.000 description 1
- 101000692466 Bos taurus Prostaglandin F synthase 2 Proteins 0.000 description 1
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 1
- HAXZWXZGOAGAIY-UHFFFAOYSA-N CC([O])Cl Chemical compound CC([O])Cl HAXZWXZGOAGAIY-UHFFFAOYSA-N 0.000 description 1
- 244000278792 Calathea allouia Species 0.000 description 1
- 235000007487 Calathea allouia Nutrition 0.000 description 1
- 241000282472 Canis lupus familiaris Species 0.000 description 1
- 229920002134 Carboxymethyl cellulose Polymers 0.000 description 1
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 1
- 229920002261 Corn starch Polymers 0.000 description 1
- FBPFZTCFMRRESA-FSIIMWSLSA-N D-Glucitol Natural products OC[C@H](O)[C@H](O)[C@@H](O)[C@H](O)CO FBPFZTCFMRRESA-FSIIMWSLSA-N 0.000 description 1
- FBPFZTCFMRRESA-JGWLITMVSA-N D-glucitol Chemical compound OC[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO FBPFZTCFMRRESA-JGWLITMVSA-N 0.000 description 1
- 235000019739 Dicalciumphosphate Nutrition 0.000 description 1
- 241000283086 Equidae Species 0.000 description 1
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 239000001828 Gelatine Substances 0.000 description 1
- PVNIQBQSYATKKL-UHFFFAOYSA-N Glycerol trihexadecanoate Natural products CCCCCCCCCCCCCCCC(=O)OCC(OC(=O)CCCCCCCCCCCCCCC)COC(=O)CCCCCCCCCCCCCCC PVNIQBQSYATKKL-UHFFFAOYSA-N 0.000 description 1
- 229920000084 Gum arabic Polymers 0.000 description 1
- 108010076876 Keratins Proteins 0.000 description 1
- 102000011782 Keratins Human genes 0.000 description 1
- 239000004166 Lanolin Substances 0.000 description 1
- 235000010643 Leucaena leucocephala Nutrition 0.000 description 1
- 240000007472 Leucaena leucocephala Species 0.000 description 1
- 229920000168 Microcrystalline cellulose Polymers 0.000 description 1
- KBIVBZOXQXLKOP-UHFFFAOYSA-N ON(CCC1=CC=CC=N1)C(C1=CC=C(C(F)(F)F)C=C1)=O Chemical compound ON(CCC1=CC=CC=N1)C(C1=CC=C(C(F)(F)F)C=C1)=O KBIVBZOXQXLKOP-UHFFFAOYSA-N 0.000 description 1
- 206010030113 Oedema Diseases 0.000 description 1
- 235000019502 Orange oil Nutrition 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- 241000282376 Panthera tigris Species 0.000 description 1
- 235000019483 Peanut oil Nutrition 0.000 description 1
- 239000004264 Petrolatum Substances 0.000 description 1
- 239000002202 Polyethylene glycol Substances 0.000 description 1
- 239000004372 Polyvinyl alcohol Substances 0.000 description 1
- 206010050902 Postoperative thrombosis Diseases 0.000 description 1
- 201000004681 Psoriasis Diseases 0.000 description 1
- 235000021355 Stearic acid Nutrition 0.000 description 1
- KDYFGRWQOYBRFD-UHFFFAOYSA-N Succinic acid Natural products OC(=O)CCC(O)=O KDYFGRWQOYBRFD-UHFFFAOYSA-N 0.000 description 1
- 241000282887 Suidae Species 0.000 description 1
- 108090000190 Thrombin Proteins 0.000 description 1
- 229920001615 Tragacanth Polymers 0.000 description 1
- 240000008042 Zea mays Species 0.000 description 1
- 235000005824 Zea mays ssp. parviglumis Nutrition 0.000 description 1
- 235000002017 Zea mays subsp mays Nutrition 0.000 description 1
- IWQOOKNZVROKDM-UHFFFAOYSA-N [2-(4-chlorophenyl)pyridin-3-yl]methanamine Chemical compound NCc1cccnc1-c1ccc(Cl)cc1 IWQOOKNZVROKDM-UHFFFAOYSA-N 0.000 description 1
- 238000005299 abrasion Methods 0.000 description 1
- 235000010489 acacia gum Nutrition 0.000 description 1
- 239000000205 acacia gum Substances 0.000 description 1
- 230000001133 acceleration Effects 0.000 description 1
- 239000012190 activator Substances 0.000 description 1
- 150000001266 acyl halides Chemical class 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 238000004220 aggregation Methods 0.000 description 1
- 230000002776 aggregation Effects 0.000 description 1
- 229910000147 aluminium phosphate Inorganic materials 0.000 description 1
- 235000012211 aluminium silicate Nutrition 0.000 description 1
- 210000004381 amniotic fluid Anatomy 0.000 description 1
- 230000000844 anti-bacterial effect Effects 0.000 description 1
- 239000012736 aqueous medium Substances 0.000 description 1
- 150000004982 aromatic amines Chemical class 0.000 description 1
- 208000011775 arteriosclerosis disease Diseases 0.000 description 1
- 239000003899 bactericide agent Substances 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- 229940092738 beeswax Drugs 0.000 description 1
- 230000009286 beneficial effect Effects 0.000 description 1
- 239000000440 bentonite Substances 0.000 description 1
- 229910000278 bentonite Inorganic materials 0.000 description 1
- SVPXDRXYRYOSEX-UHFFFAOYSA-N bentoquatam Chemical compound O.O=[Si]=O.O=[Al]O[Al]=O SVPXDRXYRYOSEX-UHFFFAOYSA-N 0.000 description 1
- 229960000686 benzalkonium chloride Drugs 0.000 description 1
- 235000010233 benzoic acid Nutrition 0.000 description 1
- PASDCCFISLVPSO-UHFFFAOYSA-N benzoyl chloride Chemical compound ClC(=O)C1=CC=CC=C1 PASDCCFISLVPSO-UHFFFAOYSA-N 0.000 description 1
- 229960002903 benzyl benzoate Drugs 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- CADWTSSKOVRVJC-UHFFFAOYSA-N benzyl(dimethyl)azanium;chloride Chemical compound [Cl-].C[NH+](C)CC1=CC=CC=C1 CADWTSSKOVRVJC-UHFFFAOYSA-N 0.000 description 1
- 230000036765 blood level Effects 0.000 description 1
- OWBTYPJTUOEWEK-UHFFFAOYSA-N butane-2,3-diol Chemical compound CC(O)C(C)O OWBTYPJTUOEWEK-UHFFFAOYSA-N 0.000 description 1
- KDYFGRWQOYBRFD-NUQCWPJISA-N butanedioic acid Chemical compound O[14C](=O)CC[14C](O)=O KDYFGRWQOYBRFD-NUQCWPJISA-N 0.000 description 1
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 239000001506 calcium phosphate Substances 0.000 description 1
- CJZGTCYPCWQAJB-UHFFFAOYSA-L calcium stearate Chemical compound [Ca+2].CCCCCCCCCCCCCCCCCC([O-])=O.CCCCCCCCCCCCCCCCCC([O-])=O CJZGTCYPCWQAJB-UHFFFAOYSA-L 0.000 description 1
- 239000008116 calcium stearate Substances 0.000 description 1
- 235000013539 calcium stearate Nutrition 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000001768 carboxy methyl cellulose Substances 0.000 description 1
- 235000010948 carboxy methyl cellulose Nutrition 0.000 description 1
- 239000008112 carboxymethyl-cellulose Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 210000004027 cell Anatomy 0.000 description 1
- 210000000170 cell membrane Anatomy 0.000 description 1
- 230000001413 cellular effect Effects 0.000 description 1
- 229960004926 chlorobutanol Drugs 0.000 description 1
- 229960002242 chlorocresol Drugs 0.000 description 1
- 125000004218 chloromethyl group Chemical group [H]C([H])(Cl)* 0.000 description 1
- 125000000068 chlorophenyl group Chemical group 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 230000008602 contraction Effects 0.000 description 1
- 238000007796 conventional method Methods 0.000 description 1
- 235000005822 corn Nutrition 0.000 description 1
- 239000008120 corn starch Substances 0.000 description 1
- 235000012343 cottonseed oil Nutrition 0.000 description 1
- 239000002385 cottonseed oil Substances 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 125000001995 cyclobutyl group Chemical group [H]C1([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000000582 cycloheptyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- 125000000113 cyclohexyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C([H])([H])C1([H])[H] 0.000 description 1
- NQOJWOIPQBVKKX-UHFFFAOYSA-N cyclooctane Chemical compound [CH]1CCCCCCC1 NQOJWOIPQBVKKX-UHFFFAOYSA-N 0.000 description 1
- 125000001511 cyclopentyl group Chemical group [H]C1([H])C([H])([H])C([H])([H])C([H])(*)C1([H])[H] 0.000 description 1
- 125000001559 cyclopropyl group Chemical group [H]C1([H])C([H])([H])C1([H])* 0.000 description 1
- 125000003493 decenyl group Chemical group [H]C([*])=C([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000002704 decyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- NEFBYIFKOOEVPA-UHFFFAOYSA-K dicalcium phosphate Chemical compound [Ca+2].[Ca+2].[O-]P([O-])([O-])=O NEFBYIFKOOEVPA-UHFFFAOYSA-K 0.000 description 1
- 229940038472 dicalcium phosphate Drugs 0.000 description 1
- 229910000390 dicalcium phosphate Inorganic materials 0.000 description 1
- XEYBRNLFEZDVAW-ARSRFYASSA-N dinoprostone Chemical compound CCCCC[C@H](O)\C=C\[C@H]1[C@H](O)CC(=O)[C@@H]1C\C=C/CCCC(O)=O XEYBRNLFEZDVAW-ARSRFYASSA-N 0.000 description 1
- 229960002986 dinoprostone Drugs 0.000 description 1
- 239000006185 dispersion Substances 0.000 description 1
- GDNCXORZAMVMIW-UHFFFAOYSA-N dodecane Chemical compound [CH2]CCCCCCCCCCC GDNCXORZAMVMIW-UHFFFAOYSA-N 0.000 description 1
- 239000008157 edible vegetable oil Substances 0.000 description 1
- 239000003995 emulsifying agent Substances 0.000 description 1
- 210000004696 endometrium Anatomy 0.000 description 1
- 230000002708 enhancing effect Effects 0.000 description 1
- BEFDCLMNVWHSGT-UHFFFAOYSA-N ethenylcyclopentane Chemical compound C=CC1CCCC1 BEFDCLMNVWHSGT-UHFFFAOYSA-N 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 210000003754 fetus Anatomy 0.000 description 1
- 239000000796 flavoring agent Substances 0.000 description 1
- 235000019634 flavors Nutrition 0.000 description 1
- 239000012530 fluid Substances 0.000 description 1
- 239000000417 fungicide Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 229920000159 gelatin Polymers 0.000 description 1
- 235000019322 gelatine Nutrition 0.000 description 1
- 210000004907 gland Anatomy 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 229940075507 glyceryl monostearate Drugs 0.000 description 1
- 150000002334 glycols Chemical class 0.000 description 1
- 239000008187 granular material Substances 0.000 description 1
- 125000003187 heptyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 125000006038 hexenyl group Chemical group 0.000 description 1
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 1
- 238000006197 hydroboration reaction Methods 0.000 description 1
- IXCSERBJSXMMFS-UHFFFAOYSA-N hydrogen chloride Substances Cl.Cl IXCSERBJSXMMFS-UHFFFAOYSA-N 0.000 description 1
- 229910000041 hydrogen chloride Inorganic materials 0.000 description 1
- 230000006872 improvement Effects 0.000 description 1
- 230000005764 inhibitory process Effects 0.000 description 1
- 229910052500 inorganic mineral Inorganic materials 0.000 description 1
- 238000007918 intramuscular administration Methods 0.000 description 1
- 238000010255 intramuscular injection Methods 0.000 description 1
- 239000007927 intramuscular injection Substances 0.000 description 1
- 238000001990 intravenous administration Methods 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- VFQXVTODMYMSMJ-UHFFFAOYSA-N isonicotinamide Chemical compound NC(=O)C1=CC=NC=C1 VFQXVTODMYMSMJ-UHFFFAOYSA-N 0.000 description 1
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 1
- 239000004310 lactic acid Substances 0.000 description 1
- 235000014655 lactic acid Nutrition 0.000 description 1
- 229940039717 lanolin Drugs 0.000 description 1
- 235000019388 lanolin Nutrition 0.000 description 1
- 150000002632 lipids Chemical class 0.000 description 1
- 229940057995 liquid paraffin Drugs 0.000 description 1
- 210000004072 lung Anatomy 0.000 description 1
- 229920000609 methyl cellulose Polymers 0.000 description 1
- 239000004292 methyl p-hydroxybenzoate Substances 0.000 description 1
- 235000010270 methyl p-hydroxybenzoate Nutrition 0.000 description 1
- 239000001923 methylcellulose Substances 0.000 description 1
- 235000010981 methylcellulose Nutrition 0.000 description 1
- 229960002216 methylparaben Drugs 0.000 description 1
- 229940016286 microcrystalline cellulose Drugs 0.000 description 1
- 235000019813 microcrystalline cellulose Nutrition 0.000 description 1
- 239000008108 microcrystalline cellulose Substances 0.000 description 1
- 235000010755 mineral Nutrition 0.000 description 1
- 239000011707 mineral Substances 0.000 description 1
- 238000002156 mixing Methods 0.000 description 1
- 239000001788 mono and diglycerides of fatty acids Substances 0.000 description 1
- 208000010125 myocardial infarction Diseases 0.000 description 1
- 210000000754 myometrium Anatomy 0.000 description 1
- QXVSZZRIGDEOOB-UHFFFAOYSA-N n-(4-chlorophenyl)pyridine-4-carboxamide Chemical compound C1=CC(Cl)=CC=C1NC(=O)C1=CC=NC=C1 QXVSZZRIGDEOOB-UHFFFAOYSA-N 0.000 description 1
- WOGCGGHLJSJNEO-UHFFFAOYSA-N n-(pyridin-2-ylmethyl)-3-(trifluoromethyl)benzamide Chemical compound FC(F)(F)C1=CC=CC(C(=O)NCC=2N=CC=CC=2)=C1 WOGCGGHLJSJNEO-UHFFFAOYSA-N 0.000 description 1
- BYRNRQGGSWMMFE-UHFFFAOYSA-N n-(pyridin-2-ylmethyl)-3-(trifluoromethyl)benzamide;hydrochloride Chemical compound Cl.FC(F)(F)C1=CC=CC(C(=O)NCC=2N=CC=CC=2)=C1 BYRNRQGGSWMMFE-UHFFFAOYSA-N 0.000 description 1
- FTCFXBBBKDOQJA-UHFFFAOYSA-N n-(pyridin-2-ylmethyl)aniline Chemical compound C=1C=CC=NC=1CNC1=CC=CC=C1 FTCFXBBBKDOQJA-UHFFFAOYSA-N 0.000 description 1
- KUBDCHSZNMFKFV-UHFFFAOYSA-N n-(pyridin-2-ylmethyl)cyclohexanamine Chemical compound C=1C=CC=NC=1CNC1CCCCC1 KUBDCHSZNMFKFV-UHFFFAOYSA-N 0.000 description 1
- HRKKGFODPBEUJP-UHFFFAOYSA-N n-(pyridin-3-ylmethyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NCC1=CC=CN=C1 HRKKGFODPBEUJP-UHFFFAOYSA-N 0.000 description 1
- HAEOUCJROPAGBU-UHFFFAOYSA-N n-(pyridin-4-ylmethyl)-4-(trifluoromethyl)benzamide;hydrochloride Chemical compound Cl.C1=CC(C(F)(F)F)=CC=C1C(=O)NCC1=CC=NC=C1 HAEOUCJROPAGBU-UHFFFAOYSA-N 0.000 description 1
- VDJSXBBFSHLEHE-UHFFFAOYSA-N n-(pyridin-4-ylmethyl)benzamide Chemical compound C=1C=CC=CC=1C(=O)NCC1=CC=NC=C1 VDJSXBBFSHLEHE-UHFFFAOYSA-N 0.000 description 1
- JBVOKYZHUYHBNI-UHFFFAOYSA-N n-[(2-amino-6-methylpyridin-3-yl)methyl]-3,4,5-triethoxybenzamide Chemical compound CCOC1=C(OCC)C(OCC)=CC(C(=O)NCC=2C(=NC(C)=CC=2)N)=C1 JBVOKYZHUYHBNI-UHFFFAOYSA-N 0.000 description 1
- ZMUBVSNWFIFSFH-UHFFFAOYSA-N n-[(2-aminopyridin-3-yl)methyl]-3,4,5-trimethoxybenzamide Chemical compound COC1=C(OC)C(OC)=CC(C(=O)NCC=2C(=NC=CC=2)N)=C1 ZMUBVSNWFIFSFH-UHFFFAOYSA-N 0.000 description 1
- NXFRSZGBCLVQSB-UHFFFAOYSA-N n-[(6-methylpyridin-3-yl)methyl]benzamide Chemical compound C1=NC(C)=CC=C1CNC(=O)C1=CC=CC=C1 NXFRSZGBCLVQSB-UHFFFAOYSA-N 0.000 description 1
- LOSPGUXDEKCHEV-UHFFFAOYSA-N n-[4-(trichloromethoxy)phenyl]pyridine-4-carboxamide Chemical compound C1=CC(OC(Cl)(Cl)Cl)=CC=C1NC(=O)C1=CC=NC=C1 LOSPGUXDEKCHEV-UHFFFAOYSA-N 0.000 description 1
- JFCDNQVJUVAQQQ-UHFFFAOYSA-N n-[4-(trifluoromethyl)phenyl]pyridine-4-carboxamide Chemical compound C1=CC(C(F)(F)F)=CC=C1NC(=O)C1=CC=NC=C1 JFCDNQVJUVAQQQ-UHFFFAOYSA-N 0.000 description 1
- GBZKRGRJAGTFOU-UHFFFAOYSA-N n-benzhydrylpyridine-4-carboxamide Chemical compound C=1C=NC=CC=1C(=O)NC(C=1C=CC=CC=1)C1=CC=CC=C1 GBZKRGRJAGTFOU-UHFFFAOYSA-N 0.000 description 1
- PKFMWPJKURNXFK-UHFFFAOYSA-N n-benzyl-2-pyridin-4-ylacetamide Chemical compound C=1C=CC=CC=1CNC(=O)CC1=CC=NC=C1 PKFMWPJKURNXFK-UHFFFAOYSA-N 0.000 description 1
- YIGMDKYIWMVZDV-UHFFFAOYSA-N n-benzylpyridine-4-carboxamide Chemical compound C=1C=NC=CC=1C(=O)NCC1=CC=CC=C1 YIGMDKYIWMVZDV-UHFFFAOYSA-N 0.000 description 1
- YGEKXEPYAHXBFY-UHFFFAOYSA-N n-butyl-2-chloropyridine-4-carboxamide Chemical compound CCCCNC(=O)C1=CC=NC(Cl)=C1 YGEKXEPYAHXBFY-UHFFFAOYSA-N 0.000 description 1
- PKMDOBRIYRUQRO-UHFFFAOYSA-N n-butyl-6-methylpyridine-2-carbothioamide Chemical compound CCCCNC(=S)C1=CC=CC(C)=N1 PKMDOBRIYRUQRO-UHFFFAOYSA-N 0.000 description 1
- WIRGFWGEJNBWAN-UHFFFAOYSA-N n-cyclohexylpyridine-2-carboxamide Chemical compound C=1C=CC=NC=1C(=O)NC1CCCCC1 WIRGFWGEJNBWAN-UHFFFAOYSA-N 0.000 description 1
- JQTHXEGKBQNTHL-UHFFFAOYSA-N n-ethyl-2,6-dimethylpyridine-4-carboxamide Chemical compound CCNC(=O)C1=CC(C)=NC(C)=C1 JQTHXEGKBQNTHL-UHFFFAOYSA-N 0.000 description 1
- SSWBSSQOUMVOMZ-UHFFFAOYSA-N n-methyl-n-(2-pyridin-2-ylethyl)-4-(trifluoromethyl)benzamide Chemical compound C=1C=C(C(F)(F)F)C=CC=1C(=O)N(C)CCC1=CC=CC=N1 SSWBSSQOUMVOMZ-UHFFFAOYSA-N 0.000 description 1
- VHPLSRUYMRRUFN-UHFFFAOYSA-N n-naphthalen-1-ylpyridine-4-carboxamide Chemical compound C=1C=CC2=CC=CC=C2C=1NC(=O)C1=CC=NC=C1 VHPLSRUYMRRUFN-UHFFFAOYSA-N 0.000 description 1
- FCTZHFATVFONMW-UHFFFAOYSA-N n-phenylpyridine-4-carboxamide Chemical compound C=1C=NC=CC=1C(=O)NC1=CC=CC=C1 FCTZHFATVFONMW-UHFFFAOYSA-N 0.000 description 1
- 125000001624 naphthyl group Chemical group 0.000 description 1
- 125000005187 nonenyl group Chemical group C(=CCCCCCCC)* 0.000 description 1
- 125000001400 nonyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- QIQXTHQIDYTFRH-UHFFFAOYSA-N octadecanoic acid Chemical compound CCCCCCCCCCCCCCCCCC(O)=O QIQXTHQIDYTFRH-UHFFFAOYSA-N 0.000 description 1
- OQCDKBAXFALNLD-UHFFFAOYSA-N octadecanoic acid Natural products CCCCCCCC(C)CCCCCCCCC(O)=O OQCDKBAXFALNLD-UHFFFAOYSA-N 0.000 description 1
- 125000004365 octenyl group Chemical group C(=CCCCCCC)* 0.000 description 1
- 125000002347 octyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- 239000003883 ointment base Substances 0.000 description 1
- 239000010502 orange oil Substances 0.000 description 1
- 210000000056 organ Anatomy 0.000 description 1
- 239000012074 organic phase Substances 0.000 description 1
- 239000003960 organic solvent Substances 0.000 description 1
- WLJNZVDCPSBLRP-UHFFFAOYSA-N pamoic acid Chemical compound C1=CC=C2C(CC=3C4=CC=CC=C4C=C(C=3O)C(=O)O)=C(O)C(C(O)=O)=CC2=C1 WLJNZVDCPSBLRP-UHFFFAOYSA-N 0.000 description 1
- FJKROLUGYXJWQN-UHFFFAOYSA-N papa-hydroxy-benzoic acid Natural products OC(=O)C1=CC=C(O)C=C1 FJKROLUGYXJWQN-UHFFFAOYSA-N 0.000 description 1
- 238000007911 parenteral administration Methods 0.000 description 1
- 239000000312 peanut oil Substances 0.000 description 1
- 239000008188 pellet Substances 0.000 description 1
- 230000035515 penetration Effects 0.000 description 1
- 125000002255 pentenyl group Chemical group C(=CCCC)* 0.000 description 1
- 125000001147 pentyl group Chemical group C(CCCC)* 0.000 description 1
- 229940066842 petrolatum Drugs 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 239000000825 pharmaceutical preparation Substances 0.000 description 1
- 229960003742 phenol Drugs 0.000 description 1
- 125000000951 phenoxy group Chemical group [H]C1=C([H])C([H])=C(O*)C([H])=C1[H] 0.000 description 1
- WVDDGKGOMKODPV-ZQBYOMGUSA-N phenyl(114C)methanol Chemical compound O[14CH2]C1=CC=CC=C1 WVDDGKGOMKODPV-ZQBYOMGUSA-N 0.000 description 1
- 239000010452 phosphate Substances 0.000 description 1
- NBIIXXVUZAFLBC-UHFFFAOYSA-K phosphate Chemical compound [O-]P([O-])([O-])=O NBIIXXVUZAFLBC-UHFFFAOYSA-K 0.000 description 1
- 230000035479 physiological effects, processes and functions Effects 0.000 description 1
- IBBMAWULFFBRKK-UHFFFAOYSA-N picolinamide Chemical compound NC(=O)C1=CC=CC=N1 IBBMAWULFFBRKK-UHFFFAOYSA-N 0.000 description 1
- 230000003169 placental effect Effects 0.000 description 1
- 210000004623 platelet-rich plasma Anatomy 0.000 description 1
- 229940068918 polyethylene glycol 400 Drugs 0.000 description 1
- 229920005862 polyol Polymers 0.000 description 1
- 150000003077 polyols Chemical class 0.000 description 1
- 239000000244 polyoxyethylene sorbitan monooleate Substances 0.000 description 1
- 235000010482 polyoxyethylene sorbitan monooleate Nutrition 0.000 description 1
- 239000001818 polyoxyethylene sorbitan monostearate Substances 0.000 description 1
- 235000010989 polyoxyethylene sorbitan monostearate Nutrition 0.000 description 1
- 229940068968 polysorbate 80 Drugs 0.000 description 1
- 229920000053 polysorbate 80 Polymers 0.000 description 1
- 229920000166 polytrimethylene carbonate Polymers 0.000 description 1
- 229920002451 polyvinyl alcohol Polymers 0.000 description 1
- 229910000027 potassium carbonate Inorganic materials 0.000 description 1
- 230000035935 pregnancy Effects 0.000 description 1
- 238000003825 pressing Methods 0.000 description 1
- 230000002265 prevention Effects 0.000 description 1
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 1
- XEYBRNLFEZDVAW-UHFFFAOYSA-N prostaglandin E2 Natural products CCCCCC(O)C=CC1C(O)CC(=O)C1CC=CCCCC(O)=O XEYBRNLFEZDVAW-UHFFFAOYSA-N 0.000 description 1
- WGJJROVFWIXTPA-OALUTQOASA-N prostanoic acid Chemical compound CCCCCCCC[C@H]1CCC[C@@H]1CCCCCCC(O)=O WGJJROVFWIXTPA-OALUTQOASA-N 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 102000004169 proteins and genes Human genes 0.000 description 1
- 238000011084 recovery Methods 0.000 description 1
- 239000006215 rectal suppository Substances 0.000 description 1
- 238000011946 reduction process Methods 0.000 description 1
- 230000027272 reproductive process Effects 0.000 description 1
- 229960004889 salicylic acid Drugs 0.000 description 1
- 210000004927 skin cell Anatomy 0.000 description 1
- 206010040882 skin lesion Diseases 0.000 description 1
- 231100000444 skin lesion Toxicity 0.000 description 1
- 210000002460 smooth muscle Anatomy 0.000 description 1
- 235000017557 sodium bicarbonate Nutrition 0.000 description 1
- 229910000030 sodium bicarbonate Inorganic materials 0.000 description 1
- 239000011780 sodium chloride Substances 0.000 description 1
- 239000001509 sodium citrate Substances 0.000 description 1
- NLJMYIDDQXHKNR-UHFFFAOYSA-K sodium citrate Chemical compound O.O.[Na+].[Na+].[Na+].[O-]C(=O)CC(O)(CC([O-])=O)C([O-])=O NLJMYIDDQXHKNR-UHFFFAOYSA-K 0.000 description 1
- 239000011775 sodium fluoride Substances 0.000 description 1
- 235000013024 sodium fluoride Nutrition 0.000 description 1
- 239000012064 sodium phosphate buffer Substances 0.000 description 1
- 239000004334 sorbic acid Substances 0.000 description 1
- 235000010199 sorbic acid Nutrition 0.000 description 1
- 229940075582 sorbic acid Drugs 0.000 description 1
- 239000000600 sorbitol Substances 0.000 description 1
- 235000010356 sorbitol Nutrition 0.000 description 1
- 239000012177 spermaceti Substances 0.000 description 1
- 229940084106 spermaceti Drugs 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 239000007858 starting material Substances 0.000 description 1
- 239000008117 stearic acid Substances 0.000 description 1
- 230000001954 sterilising effect Effects 0.000 description 1
- 239000010414 supernatant solution Substances 0.000 description 1
- 239000004094 surface-active agent Substances 0.000 description 1
- 238000011477 surgical intervention Methods 0.000 description 1
- 239000000375 suspending agent Substances 0.000 description 1
- 230000008961 swelling Effects 0.000 description 1
- 239000006188 syrup Substances 0.000 description 1
- 235000020357 syrup Nutrition 0.000 description 1
- 239000008399 tap water Substances 0.000 description 1
- 235000020679 tap water Nutrition 0.000 description 1
- 229940124597 therapeutic agent Drugs 0.000 description 1
- RTKIYNMVFMVABJ-UHFFFAOYSA-L thimerosal Chemical compound [Na+].CC[Hg]SC1=CC=CC=C1C([O-])=O RTKIYNMVFMVABJ-UHFFFAOYSA-L 0.000 description 1
- 229940033663 thimerosal Drugs 0.000 description 1
- 229960004072 thrombin Drugs 0.000 description 1
- 125000003944 tolyl group Chemical group 0.000 description 1
- 230000001256 tonic effect Effects 0.000 description 1
- 235000010487 tragacanth Nutrition 0.000 description 1
- 239000000196 tragacanth Substances 0.000 description 1
- 229940116362 tragacanth Drugs 0.000 description 1
- 125000005270 trialkylamine group Chemical group 0.000 description 1
- IMFACGCPASFAPR-UHFFFAOYSA-N tributylamine Chemical compound CCCCN(CCCC)CCCC IMFACGCPASFAPR-UHFFFAOYSA-N 0.000 description 1
- 125000003866 trichloromethyl group Chemical group ClC(Cl)(Cl)* 0.000 description 1
- 125000002023 trifluoromethyl group Chemical group FC(F)(F)* 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
- YFTHZRPMJXBUME-UHFFFAOYSA-N tripropylamine Chemical compound CCCN(CCC)CCC YFTHZRPMJXBUME-UHFFFAOYSA-N 0.000 description 1
- 125000005065 undecenyl group Chemical group C(=CCCCCCCCCC)* 0.000 description 1
- 210000004291 uterus Anatomy 0.000 description 1
- 125000000391 vinyl group Chemical group [H]C([*])=C([H])[H] 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07D—HETEROCYCLIC COMPOUNDS
- C07D213/00—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members
- C07D213/02—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members
- C07D213/04—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom
- C07D213/24—Heterocyclic compounds containing six-membered rings, not condensed with other rings, with one nitrogen atom as the only ring hetero atom and three or more double bonds between ring members or between ring members and non-ring members having three double bonds between ring members or between ring members and non-ring members having no bond between the ring nitrogen atom and a non-ring member or having only hydrogen or carbon atoms directly attached to the ring nitrogen atom with substituted hydrocarbon radicals attached to ring carbon atoms
- C07D213/36—Radicals substituted by singly-bound nitrogen atoms
- C07D213/40—Acylated substituent nitrogen atom
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C405/00—Compounds containing a five-membered ring having two side-chains in ortho position to each other, and having oxygen atoms directly attached to the ring in ortho position to one of the side-chains, one side-chain containing, not directly attached to the ring, a carbon atom having three bonds to hetero atoms with at the most one bond to halogen, and the other side-chain having oxygen atoms attached in gamma-position to the ring, e.g. prostaglandins ; Analogues or derivatives thereof
Landscapes
- Chemical & Material Sciences (AREA)
- Organic Chemistry (AREA)
- Pyridine Compounds (AREA)
- Pharmaceuticals Containing Other Organic And Inorganic Compounds (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US42836473A | 1973-12-26 | 1973-12-26 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2460756A1 true DE2460756A1 (de) | 1975-07-10 |
Family
ID=23698579
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19742460756 Pending DE2460756A1 (de) | 1973-12-26 | 1974-12-21 | Arzneimittel zur verbesserung der endogenen prostaglandinbildung sowie neue n-(pyridylalkyl)-benzamide, die als wirkstoffe fuer die arzneimittel geeignet sind, und verfahren zu deren herstellung |
Country Status (6)
Families Citing this family (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| ES492686A0 (es) * | 1980-06-23 | 1981-06-01 | Made Labor Sa | Un metodo para la produccion industrial de n-(4-piridilme- til)-benzamidas |
| US4500714A (en) * | 1981-10-15 | 1985-02-19 | Chugai Seiyaku Kabushiki Kaisha | 3-Substituted-ureido-N-pyridyl benzamides |
| US4501746A (en) * | 1981-12-18 | 1985-02-26 | Eli Lilly And Company | N,N-disubstituted carboxamide derivatives, and fungicidal use thereof |
| EP0539588A1 (en) * | 1990-07-05 | 1993-05-05 | Nippon Soda Co., Ltd. | Amine derivative |
| DE102006046161A1 (de) * | 2006-09-29 | 2008-04-03 | Bayer Cropscience Ag | Neue kristalline Modifikation |
| CN105503879B (zh) * | 2014-10-20 | 2018-06-12 | 北京大学深圳研究生院 | 一种固定化蛋白的方法 |
| WO2016095205A1 (en) * | 2014-12-19 | 2016-06-23 | Merck Sharp & Dohme Corp. | Heteroaryl orexin receptor antagonists |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3037988A (en) * | 1962-06-05 | Benzoylamiivomethylpykidines | ||
| US2776294A (en) * | 1957-01-01 | Tropic acid n- | ||
| US2870156A (en) * | 1958-03-03 | 1959-01-20 | Bristol Lab Inc | N-pyridylethyl-3, 4, 5 trimethoxybenzamide |
| US3367940A (en) * | 1963-01-02 | 1968-02-06 | Chevron Res | Beta-picolinamide derivatives |
| US3455940A (en) * | 1965-12-07 | 1969-07-15 | Herbert C Stecker | Certain halo and dihalo n-substituted salicylamides |
| US3439019A (en) * | 1966-01-19 | 1969-04-15 | Merck & Co Inc | N-benzoyloxymethyl benzamides and their preparation |
| CH488691A (de) * | 1967-10-20 | 1970-04-15 | Eprova Ag | Verfahren zur Herstellung von neuen Butoxy-dimethylbenzamiden |
| US3509166A (en) * | 1968-01-15 | 1970-04-28 | American Cyanamid Co | Tetrahydro-pyridine derivatives of benzamide |
| US3923820A (en) * | 1974-04-08 | 1975-12-02 | Made Labor Sa | Method of obtaining 3,5 di-methylbenzamid substitutes |
-
1974
- 1974-12-12 NL NL7416176A patent/NL7416176A/xx not_active Application Discontinuation
- 1974-12-20 JP JP49145818A patent/JPS5095277A/ja active Pending
- 1974-12-21 DE DE19742460756 patent/DE2460756A1/de active Pending
- 1974-12-23 GB GB55418/74A patent/GB1490200A/en not_active Expired
- 1974-12-24 FR FR7442757A patent/FR2255901B1/fr not_active Expired
-
1975
- 1975-06-25 US US05/590,032 patent/US4069224A/en not_active Expired - Lifetime
Also Published As
| Publication number | Publication date |
|---|---|
| US4069224A (en) | 1978-01-17 |
| NL7416176A (nl) | 1975-06-30 |
| FR2255901A1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-07-25 |
| FR2255901B1 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1978-07-28 |
| JPS5095277A (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | 1975-07-29 |
| GB1490200A (en) | 1977-10-26 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP1339675B1 (de) | Ortho, meta-substituierte bisarylverbindungen, verfahren zu ihrer herstellung, ihre verwendung als medikament sowie sie enthaltende pharmazeutische zubereitungen | |
| EP1341764B1 (de) | Ortho-substituierte stickstoffhaltige bisarylverbindungen zur verwendung als kalium-kanal-inhibitoren | |
| EP1349846B1 (de) | Arylierte furan- und thiophencarbonsaureamide mit kalium kanal blockierender wirkung | |
| DE69813839T2 (de) | Verwendung von n,n-bis (phenylcarbamoylmethyl) dimethylammoniumchlorid und derivaten davon zur behandlung von chronischem schmerz | |
| DE1795792A1 (de) | Die serumlipoidkonzentration vermindernde arzneimittel | |
| DE3037770C2 (de) | N-Niedrigalkyl-3-phenoxy-1-azetidincarboxamide und diese Verbindungen enthaltende Zubereitungen | |
| DE10121002A1 (de) | Verwendung von Anthranilsäureamiden als Medikament zur Behandlung von Arrhythmien sowie sie enthaltende pharmazeutische Zubereitungen | |
| DE3887544T2 (de) | Beta-aminoethyl-substituierte Phenyl-Verbindungen, diese enthaltende entzündungshemmende oder analgetische Zusammensetzungen. | |
| LU84892A1 (fr) | Komposition zur reduktion der sebumsekretion | |
| DE3785401T2 (de) | Verwendung von Phenylethanolaminen zur Herstellung von Arzneimitteln, wirksam für gastrointestinale Beschwerden. | |
| DE69736130T2 (de) | Pharmazeutische produkte zur heilung und vorbeugung von krankheiten, die aus der beschädigung der vaskulären endothelzellen hervorgehen | |
| DE2924691C2 (GUID-C5D7CC26-194C-43D0-91A1-9AE8C70A9BFF.html) | ||
| DE2460756A1 (de) | Arzneimittel zur verbesserung der endogenen prostaglandinbildung sowie neue n-(pyridylalkyl)-benzamide, die als wirkstoffe fuer die arzneimittel geeignet sind, und verfahren zu deren herstellung | |
| EP1605976B1 (de) | Kombination von phenylcarbonsäureamiden mit blockern des ikr-kanals und deren verwendung zur behandlung von vorhofarrhythmien | |
| DE3873210T2 (de) | Verwendung von benzylpyridin-derivaten zur herstellung eines arzneimittels zur behandlung der demenz. | |
| DE2460828A1 (de) | Pharmazeutische praeparate zur verbesserung der endogenen bildung von prostaglandinen sowie neue substituierte 1-pyridylalkyl-3-phenylthioharnstoffe, die als wirkstoffe fuer die pharmazeutischen praeparate geeignet sind, und verfahren zu deren herstellung | |
| CH633535A5 (en) | Process for the preparation of pyridine derivatives. | |
| EP0206297B1 (de) | 4-Amino-2-(imidazolidin-2-on-l-yl)-pyrimidin-5-carbonsäure-(N-(3-trifluormethyl-phenyl)-amide) zur antithrombotischen Prophylaxe und Behandlung sowie ihre Verwendung zur Herstellung von antithrombotisch wirksamen Arzneimitteln | |
| DE60025518T2 (de) | Hypoglykämische mittel, die organische zinkkomplexe enthalten | |
| DE69919789T2 (de) | Loratadin zur Verwendung als Antiarrhythmikum | |
| DE10312073A1 (de) | 2-(Butyl-1-sulfonylamino)-N-[1(R)-(6-methoxy-pyridin-3yl)-propyl]-benzamid, dessen Verwendung als Medikament sowie dieses enthaltende pharmazeutische Zubereitungen | |
| DE2059620C3 (de) | 2-(alpha-(p-Chlorphenoxy)-isobutyryl)aminoäthansulfonsäure, ihre physiologisch verträglichen Salze, Verfahren zur Herstellung dieser Verbindungen und pharmakologisch wirksame Zubereitungen derselben | |
| DE60102481T2 (de) | Purinriboside als antiarrhythmika | |
| EP1720549A1 (de) | Kv1.5-blocker zur selektiven steigerung der vorhofkontraktilität und behandlung der herzinsuffizienz | |
| DE2460888A1 (de) | Derivate von 1-pyridylalkyl-3- phenylharnstoffen und pyridyl-n-oxide derselben sowie deren pharmazeutisch brauchbare saeureanlagerungssalze und pharmazeutische zubereitungen |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| OHN | Withdrawal |