DE2126915A1 - Spielgerät zum Simulieren eines Hockeyspieles o.dgl - Google Patents
Spielgerät zum Simulieren eines Hockeyspieles o.dglInfo
- Publication number
- DE2126915A1 DE2126915A1 DE19712126915 DE2126915A DE2126915A1 DE 2126915 A1 DE2126915 A1 DE 2126915A1 DE 19712126915 DE19712126915 DE 19712126915 DE 2126915 A DE2126915 A DE 2126915A DE 2126915 A1 DE2126915 A1 DE 2126915A1
- Authority
- DE
- Germany
- Prior art keywords
- player
- movement
- main control
- connecting rod
- playing surface
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 230000033001 locomotion Effects 0.000 claims description 44
- 230000005540 biological transmission Effects 0.000 claims description 5
- 230000008878 coupling Effects 0.000 claims description 2
- 238000010168 coupling process Methods 0.000 claims description 2
- 238000005859 coupling reaction Methods 0.000 claims description 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 claims 1
- 230000007246 mechanism Effects 0.000 description 19
- 210000000617 arm Anatomy 0.000 description 7
- 239000002184 metal Substances 0.000 description 7
- 238000004804 winding Methods 0.000 description 6
- 238000010276 construction Methods 0.000 description 4
- 238000006073 displacement reaction Methods 0.000 description 2
- 210000000887 face Anatomy 0.000 description 2
- 239000003292 glue Substances 0.000 description 2
- 239000000463 material Substances 0.000 description 2
- 239000004033 plastic Substances 0.000 description 2
- 230000011664 signaling Effects 0.000 description 2
- 241001136792 Alle Species 0.000 description 1
- OIRDTQYFTABQOQ-UHTZMRCNSA-N Vidarabine Chemical compound C1=NC=2C(N)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@@H]1O OIRDTQYFTABQOQ-UHTZMRCNSA-N 0.000 description 1
- 239000000853 adhesive Substances 0.000 description 1
- 230000001070 adhesive effect Effects 0.000 description 1
- 239000011093 chipboard Substances 0.000 description 1
- 210000000078 claw Anatomy 0.000 description 1
- 210000001520 comb Anatomy 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 230000003247 decreasing effect Effects 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 230000013011 mating Effects 0.000 description 1
- -1 press board Substances 0.000 description 1
- 239000004065 semiconductor Substances 0.000 description 1
Classifications
-
- A—HUMAN NECESSITIES
- A63—SPORTS; GAMES; AMUSEMENTS
- A63F—CARD, BOARD, OR ROULETTE GAMES; INDOOR GAMES USING SMALL MOVING PLAYING BODIES; VIDEO GAMES; GAMES NOT OTHERWISE PROVIDED FOR
- A63F7/00—Indoor games using small moving playing bodies, e.g. balls, discs or blocks
- A63F7/06—Games simulating outdoor ball games, e.g. hockey or football
- A63F7/0684—Games simulating outdoor ball games, e.g. hockey or football with play figures slidable or rotatable about a vertical axis
Landscapes
- Engineering & Computer Science (AREA)
- Multimedia (AREA)
- Toys (AREA)
- Pinball Game Machines (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US4188570A | 1970-06-01 | 1970-06-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2126915A1 true DE2126915A1 (de) | 1971-12-16 |
Family
ID=21918867
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19712126915 Pending DE2126915A1 (de) | 1970-06-01 | 1971-05-29 | Spielgerät zum Simulieren eines Hockeyspieles o.dgl |
Country Status (4)
| Country | Link |
|---|---|
| US (1) | US3647212A (enrdf_load_stackoverflow) |
| CA (1) | CA927862A (enrdf_load_stackoverflow) |
| DE (1) | DE2126915A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1297333A (enrdf_load_stackoverflow) |
Families Citing this family (17)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3765675A (en) * | 1971-07-08 | 1973-10-16 | Marzio R Di | Simulated hockey goalie |
| US3811674A (en) * | 1971-09-27 | 1974-05-21 | E Trunzo | Simulated basketball game |
| US3913913A (en) * | 1971-09-27 | 1975-10-21 | Nicholas D Trbovich | Mounting for a playing piece projector |
| US3827692A (en) * | 1972-06-23 | 1974-08-06 | Marvin Glass & Associates | Magnetic type game |
| US3912269A (en) * | 1974-05-01 | 1975-10-14 | Marvin Glass & Associates | Simulated hockey game |
| IT1040034B (it) * | 1975-07-21 | 1979-12-20 | Cecchetti Claudio | Struttura di gioco in particolare gioco del calcio |
| US4173341A (en) * | 1976-07-22 | 1979-11-06 | George H. Gerstman | Amusement device using perforated board |
| US4168062A (en) * | 1977-12-05 | 1979-09-18 | Mccarthy Gerald F | Automated goalie |
| US4243222A (en) * | 1979-03-23 | 1981-01-06 | Bally Manufacturing Corporation | Seesaw targets apparatus for pinball game |
| US4311309A (en) * | 1980-03-11 | 1982-01-19 | Bradley Philip E | Table top hockey game |
| JPS5738201Y2 (enrdf_load_stackoverflow) * | 1980-04-11 | 1982-08-23 | ||
| US4474375A (en) * | 1980-11-06 | 1984-10-02 | Gordon Stockdale | Tabletop hockey game |
| US5116048A (en) * | 1990-07-11 | 1992-05-26 | Risky Business Enterprises, Inc. | Golf game, apparatus and method therefor |
| US5320350A (en) * | 1992-01-21 | 1994-06-14 | Savage Louis E | Slapball hockey game improvements |
| US5242164A (en) * | 1992-06-12 | 1993-09-07 | Nicoll James D | Tabletop hockey or soccer game |
| US7901290B2 (en) * | 2004-08-16 | 2011-03-08 | Robert Temple | Table game |
| US20070164509A1 (en) * | 2006-01-17 | 2007-07-19 | Hylak Peter J | Game table with pivoting bars and rotating players |
Family Cites Families (10)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| CA632798A (en) * | 1961-12-12 | Eagle Toys Limited | Table hockey games | |
| CA510462A (en) * | 1955-03-01 | A. Yarwood Frederick | Simulated hockey game | |
| FR811323A (fr) * | 1936-02-18 | 1937-04-12 | Jeu de football de salon | |
| GB517203A (en) * | 1938-07-22 | 1940-01-23 | Brent Unger | Improved apparatus for playing a table football, ice-hockey, or the like game |
| GB525790A (en) * | 1938-10-29 | 1940-09-04 | Klas August Widegren | Improved apparatus for a table game |
| US2507258A (en) * | 1946-09-13 | 1950-05-09 | Tousjeux Et Nouveautes S A | Simulated hockey game |
| GB795646A (en) * | 1956-12-08 | 1958-05-28 | Gerald Sidney Biggs | Improvements in or relating to table game apparatus simulating football, hockey and the like |
| US3105687A (en) * | 1960-09-26 | 1963-10-01 | Donald H Munro | Game piece controller and player stabilizer |
| DK103874C (da) * | 1961-06-19 | 1966-02-28 | Jonas Ek Aktiebolag | Miniaturefodboldspil eller lignende spil. |
| DE1678313A1 (de) * | 1968-03-13 | 1972-03-30 | Immendorf Karl Dipl Ing | Modell-Ballspiel |
-
1970
- 1970-06-01 US US41885A patent/US3647212A/en not_active Expired - Lifetime
-
1971
- 1971-05-25 CA CA113805A patent/CA927862A/en not_active Expired
- 1971-05-27 GB GB1297333D patent/GB1297333A/en not_active Expired
- 1971-05-29 DE DE19712126915 patent/DE2126915A1/de active Pending
Also Published As
| Publication number | Publication date |
|---|---|
| US3647212A (en) | 1972-03-07 |
| CA927862A (en) | 1973-06-05 |
| GB1297333A (enrdf_load_stackoverflow) | 1972-11-22 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE2126915A1 (de) | Spielgerät zum Simulieren eines Hockeyspieles o.dgl | |
| DE69310307T2 (de) | Spielzeugroboter | |
| DE212009000110U1 (de) | Action-Spielzeug | |
| DE2440524A1 (de) | Kampfspiel | |
| DE69501876T2 (de) | Bewegbare spielfigur für brettspiel | |
| DE2823319A1 (de) | Magnetische spielzeugfigur mit abnehmbaren teilen | |
| DE2629170A1 (de) | Aus einzelteilen zusammensetzbare puppe | |
| DE3545127A1 (de) | Bewegliche spielzeugfigur | |
| DE3600073A1 (de) | Mechanisch bewegliche spielzeugfigur | |
| DE7533759U (de) | Figurenspielzeug | |
| DE2314009A1 (de) | Geschicklichkeitsspielgeraet | |
| DE2008565A1 (de) | Spielzeugpuppe | |
| DE10339674A1 (de) | Aufbewahrungsmöbel | |
| DE2036410A1 (enrdf_load_stackoverflow) | ||
| DE808556C (de) | Bewegungseinrichtung fuer Spielzeuge, welche die natuerlichen Bewegungen der menschlichen Beine nachbilden | |
| DE2405471A1 (de) | Mini-golfbahn | |
| DE4017349C1 (en) | Bucket and spade play set - incorporates sand-moulds, rake and sieve | |
| DE4244158C2 (de) | Kinderspielgebäude aus Schaumstoff | |
| DE4330994A1 (de) | Automatik-Bindung für ein Snowboard | |
| DE1605184C3 (de) | Selbsttätige Klauenkupplung für Eisenbahnfahrzeuge | |
| DE2054299A1 (de) | Geschicklichkeitsspiel | |
| DE350909C (de) | Fussballbrettspiel | |
| DE202022103512U1 (de) | Schrankenanlage für Spielzeuge | |
| DE1868973U (de) | Verbessertes schaukelpferd. | |
| DE1937261A1 (de) | Vorrichtung an Gesellschaftsspielen |