DE2016656B - - Google Patents
Info
- Publication number
- DE2016656B DE2016656B DE19702016656 DE2016656 DE2016656B DE 2016656 B DE2016656 B DE 2016656B DE 19702016656 DE19702016656 DE 19702016656 DE 2016656 DE2016656 DE 2016656 DE 2016656 B DE2016656 B DE 2016656B
- Authority
- DE
- Germany
- Prior art keywords
- alcohols
- secondary alcohols
- products
- adducts
- sulfation
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 150000003333 secondary alcohols Chemical class 0.000 claims description 27
- 238000000034 method Methods 0.000 claims description 11
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 claims description 8
- 239000003795 chemical substances by application Substances 0.000 claims description 8
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 claims description 7
- 230000001180 sulfating effect Effects 0.000 claims description 7
- RTZKZFJDLAIYFH-UHFFFAOYSA-N Diethyl ether Chemical compound CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 claims description 6
- 125000002947 alkylene group Chemical group 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 239000007858 starting material Substances 0.000 claims description 5
- 150000003467 sulfuric acid derivatives Chemical class 0.000 claims description 5
- 239000004721 Polyphenylene oxide Substances 0.000 claims description 3
- 239000012188 paraffin wax Substances 0.000 claims description 3
- 229920000570 polyether Polymers 0.000 claims description 3
- 125000004432 carbon atom Chemical group C* 0.000 claims description 2
- 238000002360 preparation method Methods 0.000 claims description 2
- 239000000047 product Substances 0.000 description 15
- 239000000203 mixture Substances 0.000 description 13
- 230000019635 sulfation Effects 0.000 description 12
- 238000005670 sulfation reaction Methods 0.000 description 12
- 238000006243 chemical reaction Methods 0.000 description 10
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 9
- 239000003054 catalyst Substances 0.000 description 8
- 150000001298 alcohols Chemical class 0.000 description 6
- 238000007046 ethoxylation reaction Methods 0.000 description 6
- 125000002887 hydroxy group Chemical group [H]O* 0.000 description 5
- -1 pro-alcohols Chemical class 0.000 description 5
- 239000002994 raw material Substances 0.000 description 5
- 239000000126 substance Substances 0.000 description 5
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 4
- 125000003545 alkoxy group Chemical group 0.000 description 4
- XTHPWXDJESJLNJ-UHFFFAOYSA-N sulfurochloridic acid Chemical compound OS(Cl)(=O)=O XTHPWXDJESJLNJ-UHFFFAOYSA-N 0.000 description 4
- KEQGZUUPPQEDPF-UHFFFAOYSA-N 1,3-dichloro-5,5-dimethylimidazolidine-2,4-dione Chemical group CC1(C)N(Cl)C(=O)N(Cl)C1=O KEQGZUUPPQEDPF-UHFFFAOYSA-N 0.000 description 3
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 3
- 150000003138 primary alcohols Chemical class 0.000 description 3
- 238000009736 wetting Methods 0.000 description 3
- VEXZGXHMUGYJMC-UHFFFAOYSA-N Hydrochloric acid Chemical compound Cl VEXZGXHMUGYJMC-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 2
- 230000002378 acidificating effect Effects 0.000 description 2
- 239000013543 active substance Substances 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 229940000488 arsenic acid Drugs 0.000 description 2
- KGBXLFKZBHKPEV-UHFFFAOYSA-N boric acid Chemical compound OB(O)O KGBXLFKZBHKPEV-UHFFFAOYSA-N 0.000 description 2
- 239000003153 chemical reaction reagent Substances 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 238000007598 dipping method Methods 0.000 description 2
- 238000004519 manufacturing process Methods 0.000 description 2
- 229910052757 nitrogen Inorganic materials 0.000 description 2
- 230000035484 reaction time Effects 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Chemical group O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 2
- JDSQBDGCMUXRBM-UHFFFAOYSA-N 2-[2-(2-butoxypropoxy)propoxy]propan-1-ol Chemical compound CCCCOC(C)COC(C)COC(C)CO JDSQBDGCMUXRBM-UHFFFAOYSA-N 0.000 description 1
- QGVQOXWNOSEKGM-UHFFFAOYSA-N 2-hydroxyacetic acid;prop-1-ene Chemical group CC=C.OCC(O)=O QGVQOXWNOSEKGM-UHFFFAOYSA-N 0.000 description 1
- DJHGAFSJWGLOIV-UHFFFAOYSA-N Arsenic acid Chemical compound O[As](O)(O)=O DJHGAFSJWGLOIV-UHFFFAOYSA-N 0.000 description 1
- ZOXJGFHDIHLPTG-UHFFFAOYSA-N Boron Chemical compound [B] ZOXJGFHDIHLPTG-UHFFFAOYSA-N 0.000 description 1
- 229920000742 Cotton Polymers 0.000 description 1
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 1
- WHXSMMKQMYFTQS-UHFFFAOYSA-N Lithium Chemical compound [Li] WHXSMMKQMYFTQS-UHFFFAOYSA-N 0.000 description 1
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 1
- IKWTVSLWAPBBKU-UHFFFAOYSA-N a1010_sial Chemical compound O=[As]O[As]=O IKWTVSLWAPBBKU-UHFFFAOYSA-N 0.000 description 1
- 150000004703 alkoxides Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 229910000413 arsenic oxide Inorganic materials 0.000 description 1
- 229960002594 arsenic trioxide Drugs 0.000 description 1
- 239000002585 base Substances 0.000 description 1
- 239000004327 boric acid Substances 0.000 description 1
- 229910052796 boron Inorganic materials 0.000 description 1
- JKWMSGQKBLHBQQ-UHFFFAOYSA-N boron trioxide Inorganic materials O=BOB=O JKWMSGQKBLHBQQ-UHFFFAOYSA-N 0.000 description 1
- 150000001642 boronic acid derivatives Chemical class 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 239000012153 distilled water Substances 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- 239000004744 fabric Substances 0.000 description 1
- 239000011552 falling film Substances 0.000 description 1
- 239000007789 gas Substances 0.000 description 1
- 150000004679 hydroxides Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052744 lithium Inorganic materials 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- APVPOHHVBBYQAV-UHFFFAOYSA-N n-(4-aminophenyl)sulfonyloctadecanamide Chemical compound CCCCCCCCCCCCCCCCCC(=O)NS(=O)(=O)C1=CC=C(N)C=C1 APVPOHHVBBYQAV-UHFFFAOYSA-N 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 229920001515 polyalkylene glycol Polymers 0.000 description 1
- 229910052700 potassium Inorganic materials 0.000 description 1
- 239000011591 potassium Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000002000 scavenging effect Effects 0.000 description 1
- 238000010517 secondary reaction Methods 0.000 description 1
- 238000004062 sedimentation Methods 0.000 description 1
- 238000000926 separation method Methods 0.000 description 1
- 229910052708 sodium Inorganic materials 0.000 description 1
- 239000011734 sodium Substances 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- IIACRCGMVDHOTQ-UHFFFAOYSA-N sulfamic acid Chemical compound NS(O)(=O)=O IIACRCGMVDHOTQ-UHFFFAOYSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-N sulfuric acid Substances OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 1
- 238000010998 test method Methods 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
- 238000010626 work up procedure Methods 0.000 description 1
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE2016656B true DE2016656B (enrdf_load_stackoverflow) |
Family
ID=
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0052801A1 (de) * | 1980-11-26 | 1982-06-02 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung von Ethersulfaten mit erniedrigtem Dioxangehalt |
Cited By (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0052801A1 (de) * | 1980-11-26 | 1982-06-02 | Henkel Kommanditgesellschaft auf Aktien | Verfahren zur Herstellung von Ethersulfaten mit erniedrigtem Dioxangehalt |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0301414A2 (de) | Oberflächenaktive Hydroxysulfonate | |
| DE2309679C3 (enrdf_load_stackoverflow) | ||
| DE2016656A1 (de) | Verfahren zur Herstellung oberflächenaktiver Äther- und Polyäthersulfate | |
| DE3918252A1 (de) | Fettalkylsulfate und fettalkyl-polyalkylenglycolethersulfate, verfahren zu ihrer herstellung und ihre verwendung | |
| EP0137983B1 (de) | Ethersulfonate und ihre Herstellung | |
| DE1568754A1 (de) | Verfahren zur Herstellung kapillaraktiver Sulfate | |
| DE3933860A1 (de) | Verfahren zur herstellung von alkyl-polyethoxyethersulfaten | |
| EP0300444A1 (de) | Alkylsulfat-Ethersulfat-Gemische und deren Verwendung | |
| EP0617732B1 (de) | Verfahren zur herstellung hydrophilisierter triglyceride | |
| DE1568769C3 (de) | Verfahren zur Herstellung oberflächenaktiver Sulfonate | |
| DE2016656B (enrdf_load_stackoverflow) | ||
| DE4105851A1 (de) | Verfahren zur herstellung von alkyl- und/oder alkenylsulfat-pasten mit verbesserter fliessfaehigkeit | |
| DE1295536B (de) | Verfahren zur Herstellung eines oberflaechenaktiven Mittels | |
| WO1991011504A1 (de) | Sulfitierte hydroxycarbonsäureester | |
| EP0224523B1 (de) | Teilester von 2-benzylalkanolen-(1) und 2-benzylalkanol-1-polyglykolethern sowie verfahren zu ihrer herstellung | |
| WO1991013896A1 (de) | Verfahren zur sulfierung alkylglykosidhaltiger gemische | |
| WO1993003007A1 (de) | Sulfosuccinate | |
| DE2746904A1 (de) | Nichtionogene tenside | |
| DE917602C (de) | Verfahren zur Herstellung von Sulfonierungserzeugnissen aus AEthern | |
| DE694944C (de) | Verfahren zur Herstellung von kapillaraktiven Stoffen | |
| WO1992000945A1 (de) | Ungesättigte polyalkylenglycolether | |
| AT263744B (de) | Verfahren zur Herstellung kapillaraktiver Sulfate | |
| DE701403C (de) | Verfahren zur Sulfonierung von organischen, Oxygruppen enthaltenden Verbindungen | |
| DE4136783A1 (de) | Alkyl- und/oder alkenyloligoglykosid-isethionate | |
| DE4438583A1 (de) | Wäßrige Handgeschirrspülmittel |