DE1629890B2 - Zuendvorrichtung zur entflammung brennbarer gase - Google Patents
Zuendvorrichtung zur entflammung brennbarer gaseInfo
- Publication number
- DE1629890B2 DE1629890B2 DE19671629890 DE1629890A DE1629890B2 DE 1629890 B2 DE1629890 B2 DE 1629890B2 DE 19671629890 DE19671629890 DE 19671629890 DE 1629890 A DE1629890 A DE 1629890A DE 1629890 B2 DE1629890 B2 DE 1629890B2
- Authority
- DE
- Germany
- Prior art keywords
- ignition device
- mass
- ignition
- housing
- piezo element
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000007789 gas Substances 0.000 title claims description 17
- 238000010304 firing Methods 0.000 claims description 14
- 210000002105 tongue Anatomy 0.000 claims description 10
- 230000001939 inductive effect Effects 0.000 claims description 3
- 230000001629 suppression Effects 0.000 claims 1
- 239000011810 insulating material Substances 0.000 description 4
- RNFJDJUURJAICM-UHFFFAOYSA-N 2,2,4,4,6,6-hexaphenoxy-1,3,5-triaza-2$l^{5},4$l^{5},6$l^{5}-triphosphacyclohexa-1,3,5-triene Chemical compound N=1P(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP(OC=2C=CC=CC=2)(OC=2C=CC=CC=2)=NP=1(OC=1C=CC=CC=1)OC1=CC=CC=C1 RNFJDJUURJAICM-UHFFFAOYSA-N 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 230000000694 effects Effects 0.000 description 2
- 239000003063 flame retardant Substances 0.000 description 2
- VNWKTOKETHGBQD-UHFFFAOYSA-N methane Chemical compound C VNWKTOKETHGBQD-UHFFFAOYSA-N 0.000 description 2
- 208000034656 Contusions Diseases 0.000 description 1
- 239000001273 butane Substances 0.000 description 1
- 238000002485 combustion reaction Methods 0.000 description 1
- 230000000994 depressogenic effect Effects 0.000 description 1
- 238000010891 electric arc Methods 0.000 description 1
- 238000009413 insulation Methods 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 238000000034 method Methods 0.000 description 1
- IJDNQMDRQITEOD-UHFFFAOYSA-N n-butane Chemical compound CCCC IJDNQMDRQITEOD-UHFFFAOYSA-N 0.000 description 1
- OFBQJSOFQDEBGM-UHFFFAOYSA-N n-pentane Natural products CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 1
- 239000003345 natural gas Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 230000003068 static effect Effects 0.000 description 1
- 230000002459 sustained effect Effects 0.000 description 1
- 229920001169 thermoplastic Polymers 0.000 description 1
- 239000004416 thermosoftening plastic Substances 0.000 description 1
- 230000001960 triggered effect Effects 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23Q—IGNITION; EXTINGUISHING-DEVICES
- F23Q3/00—Igniters using electrically-produced sparks
- F23Q3/002—Igniters using electrically-produced sparks using piezoelectric elements
Landscapes
- Engineering & Computer Science (AREA)
- Chemical & Material Sciences (AREA)
- Combustion & Propulsion (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Ignition Installations For Internal Combustion Engines (AREA)
- Air Bags (AREA)
- Portable Nailing Machines And Staplers (AREA)
Priority Applications (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DK52068A DK124630B (da) | 1967-02-11 | 1968-02-09 | Piezoelektrisk tændingsapparat til antændelse af brændbare gasser. |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEB0091158 | 1967-02-11 |
Publications (2)
| Publication Number | Publication Date |
|---|---|
| DE1629890A1 DE1629890A1 (de) | 1971-03-11 |
| DE1629890B2 true DE1629890B2 (de) | 1973-05-03 |
Family
ID=6985684
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19671629890 Pending DE1629890B2 (de) | 1967-02-11 | 1967-02-11 | Zuendvorrichtung zur entflammung brennbarer gase |
Country Status (10)
| Country | Link |
|---|---|
| US (1) | US3486075A (en:Method) |
| AT (1) | AT287900B (en:Method) |
| BE (1) | BE710606A (en:Method) |
| CH (1) | CH464832A (en:Method) |
| DE (1) | DE1629890B2 (en:Method) |
| ES (1) | ES350355A1 (en:Method) |
| FR (1) | FR1552537A (en:Method) |
| GB (1) | GB1221701A (en:Method) |
| NL (1) | NL146594B (en:Method) |
| SE (1) | SE337791B (en:Method) |
Families Citing this family (23)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1282095A (en) * | 1968-08-02 | 1972-07-19 | Ronson Products Ltd | Improvements relating to piezo-electric ignition devices |
| US3585417A (en) * | 1969-03-06 | 1971-06-15 | Mallory & Co Inc P R | Piezoelectric device having a resistor and a plastic insulating casing |
| DE2058968A1 (de) * | 1970-12-01 | 1972-06-15 | Dynamit Nobel Ag | Piezoelektrische Energiequelle |
| SE351286C (sv) * | 1971-12-23 | 1979-07-30 | Swelex Teknik Ab | Piezoelektrisk gastendare |
| JPS5321336Y2 (en:Method) * | 1973-03-31 | 1978-06-03 | ||
| IT1023732B (it) * | 1973-05-14 | 1978-05-30 | Braun Ag | Dispositivo di accensione piezoelettrico per accendisigari ed altro |
| DE2335058A1 (de) * | 1973-07-10 | 1975-01-30 | Braun Ag | Piezozuender |
| US4025817A (en) * | 1974-09-03 | 1977-05-24 | Eastman Kodak Company | Trigger device for an electronic flash unit |
| US3992640A (en) * | 1974-11-29 | 1976-11-16 | Eastman Kodak Company | Piezo crystal housing and mount |
| JPS51155173U (en:Method) * | 1975-06-03 | 1976-12-10 | ||
| JPS52105568U (en:Method) * | 1976-02-06 | 1977-08-11 | ||
| JPS52109980U (en:Method) * | 1976-02-17 | 1977-08-20 | ||
| JPS52102479U (en:Method) * | 1976-01-28 | 1977-08-03 | ||
| JPS52140975U (en:Method) * | 1976-04-20 | 1977-10-25 | ||
| GB1554332A (en) * | 1976-06-10 | 1979-10-17 | Matsushita Electric Industrial Co Ltd | High voltage generating device |
| JPS52168081U (en:Method) * | 1976-06-10 | 1977-12-20 | ||
| US4623814A (en) | 1985-11-25 | 1986-11-18 | Matsushita Electric Industrial Co., Ltd. | Piezoelectric high-voltage generating device |
| FR2674004B1 (fr) * | 1991-03-13 | 1995-12-08 | Laforest Bic Sa | Mecanisme piezo-electrique pour briquets a gaz. |
| US5798601A (en) * | 1995-06-08 | 1998-08-25 | Hansen; James M. | Adjustable retrofit ignition kit for portable gas appliances |
| AU1067397A (en) * | 1995-12-04 | 1997-06-27 | Laforest Bic, S.A. | Piezoelectric mechanism for gas lighters with externally closed telescopic body |
| US5854530A (en) * | 1996-12-18 | 1998-12-29 | Bic Corporation | Piezoelectric lighter which has a higher level of difficulty for operation |
| US6046528A (en) * | 1997-11-03 | 2000-04-04 | Bic Corporation | Selectively actuatable piezoelectric ignition mechanism |
| US12111053B2 (en) * | 2021-10-05 | 2024-10-08 | Vpr Brands, Lp | Table-top lighters |
Family Cites Families (7)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3200295A (en) * | 1962-12-26 | 1965-08-10 | Honeywell Inc | Manually operable piezoelectric lighters |
| GB1076275A (en) * | 1963-02-27 | 1967-07-19 | Sapphire Molectric Ltd | Improvements in and relating to ignition devices |
| US3344314A (en) * | 1963-11-20 | 1967-09-26 | Honeywell Inc | Igniter employing a piezoelectric voltage source |
| US3324317A (en) * | 1965-01-21 | 1967-06-06 | Magnavox Co | Solid state inertial energy generatorstorage system |
| US3387912A (en) * | 1965-11-26 | 1968-06-11 | Mansei Kogyo Kk | Ignition mechanism of liquefied gas fueled lighter |
| US3384786A (en) * | 1965-12-28 | 1968-05-21 | Mansei Kogyo Kk | Manually operable piezoelectric gas lighters |
| US3408153A (en) * | 1966-04-25 | 1968-10-29 | Ishiguro Mitsuei | Gas lighter with a manually operable piezoelectric ignition device |
-
1967
- 1967-02-11 DE DE19671629890 patent/DE1629890B2/de active Pending
-
1968
- 1968-01-16 CH CH64068A patent/CH464832A/de unknown
- 1968-01-18 AT AT54368A patent/AT287900B/de not_active IP Right Cessation
- 1968-01-29 FR FR1552537D patent/FR1552537A/fr not_active Expired
- 1968-02-07 US US703760A patent/US3486075A/en not_active Expired - Lifetime
- 1968-02-09 BE BE710606D patent/BE710606A/xx unknown
- 1968-02-09 SE SE01740/68A patent/SE337791B/xx unknown
- 1968-02-09 NL NL686801855A patent/NL146594B/xx unknown
- 1968-02-09 GB GB6558/68A patent/GB1221701A/en not_active Expired
- 1968-02-10 ES ES350355A patent/ES350355A1/es not_active Expired
Also Published As
| Publication number | Publication date |
|---|---|
| DE1629890A1 (de) | 1971-03-11 |
| NL6801855A (en:Method) | 1968-08-12 |
| FR1552537A (en:Method) | 1969-01-03 |
| US3486075A (en) | 1969-12-23 |
| NL146594B (nl) | 1975-07-15 |
| CH464832A (de) | 1968-11-15 |
| GB1221701A (en) | 1971-02-10 |
| SE337791B (en:Method) | 1971-08-23 |
| BE710606A (en:Method) | 1968-06-17 |
| ES350355A1 (es) | 1969-04-16 |
| AT287900B (de) | 1971-02-10 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1629890B2 (de) | Zuendvorrichtung zur entflammung brennbarer gase | |
| DE1629892A1 (de) | Piezoelektrische Zuendvorrichtung zur Entflammung von brennbaren Gasen | |
| DE68904988T2 (de) | Gasfeuerzeug mit verschlussvorrichtung zur vermeidung unerwuenschter zuendung. | |
| DE1782767A1 (de) | Gasfeuerzeug | |
| DE1295902B (de) | Gasfeuerzeug mit elektrischer Funkenzuendung | |
| DE1632657A1 (de) | Zuender fuer ein Gasfeuerzeug | |
| DE2058968A1 (de) | Piezoelektrische Energiequelle | |
| DE1228883B (de) | Spann- und Ausloesevorrichtung | |
| DE1278777B (de) | Gasfeuerzeug mit elektrischer Funkenzuendung | |
| DE1931005B1 (de) | Zuendbares mechanisches Schaltelement | |
| DE1629891A1 (de) | Piezoelektrische Zuendvorrichtung fuer brennbare Gase,insbesondere fuer Gasfeuerzeuge | |
| DE1457626A1 (de) | Gasfeuerzeug mit elektrischer Funkenzuendung | |
| DE2010154B2 (de) | Waffe mit einem Metallrohr, das an einem Ende offen ist und am anderen Ende einen Boden aufweist sowie zur Aufnahme von Geschossen dient | |
| DE8532369U1 (de) | Piezoelektrisches Gasfeuerzeug | |
| DE6603062U (de) | Piezoelektrische zuendvorrichtung zur entflammung brennbarer gase. | |
| CH446558A (de) | Verfahren und Anordnung zum Verschweissen zweier Werkstücke miteinander unter Verwendung eines kurzzeitigen Lichtbogens und Anwendung des Verfahrens | |
| DE1200171B (de) | Elektrische Zuendschraube | |
| AT293593B (de) | Zündvorrichtung zur Entflammung brennbarer Gase | |
| DE3005919C2 (en:Method) | ||
| DE102011076158B4 (de) | Bolzengerät und Verfahren zum Betreiben eines Bolzensetzgeräts | |
| DE2919966C2 (de) | Halterung eines Feststofftreibsatzes | |
| DE20209374U1 (de) | Elektrisches Sicherheitsfeuerzeug | |
| AT391026B (de) | Handgranatenzuender | |
| DE1429117C2 (de) | Handbetätigtes Feuerzeug mit elektrischer Funkenzündung | |
| DE2121621C3 (de) | Gekapselter piezoelektrischer Zündgenerator |