DE1526108A1 - Vorrichtung zur fortlaufenden Muellverbrennung - Google Patents
Vorrichtung zur fortlaufenden MuellverbrennungInfo
- Publication number
- DE1526108A1 DE1526108A1 DE19661526108 DE1526108A DE1526108A1 DE 1526108 A1 DE1526108 A1 DE 1526108A1 DE 19661526108 DE19661526108 DE 19661526108 DE 1526108 A DE1526108 A DE 1526108A DE 1526108 A1 DE1526108 A1 DE 1526108A1
- Authority
- DE
- Germany
- Prior art keywords
- outlet
- air
- furnace
- flow plate
- plate
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000004056 waste incineration Methods 0.000 title 1
- 239000000126 substance Substances 0.000 claims description 18
- 239000002699 waste material Substances 0.000 claims description 10
- 239000000463 material Substances 0.000 claims description 9
- 238000002485 combustion reaction Methods 0.000 description 5
- 239000004576 sand Substances 0.000 description 5
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 4
- 239000003245 coal Substances 0.000 description 3
- 230000005484 gravity Effects 0.000 description 3
- 239000011499 joint compound Substances 0.000 description 3
- 238000000034 method Methods 0.000 description 3
- 239000000919 ceramic Substances 0.000 description 2
- 239000010849 combustible waste Substances 0.000 description 2
- 239000000428 dust Substances 0.000 description 2
- 210000003608 fece Anatomy 0.000 description 2
- 239000010794 food waste Substances 0.000 description 2
- 239000000446 fuel Substances 0.000 description 2
- 239000000295 fuel oil Substances 0.000 description 2
- 239000011521 glass Substances 0.000 description 2
- 239000002184 metal Substances 0.000 description 2
- 229910052751 metal Inorganic materials 0.000 description 2
- 150000002739 metals Chemical class 0.000 description 2
- 239000003921 oil Substances 0.000 description 2
- 239000002245 particle Substances 0.000 description 2
- 238000009423 ventilation Methods 0.000 description 2
- 235000017166 Bambusa arundinacea Nutrition 0.000 description 1
- 235000017491 Bambusa tulda Nutrition 0.000 description 1
- 241001330002 Bambuseae Species 0.000 description 1
- 101100286286 Dictyostelium discoideum ipi gene Proteins 0.000 description 1
- 241000196324 Embryophyta Species 0.000 description 1
- 235000015334 Phyllostachys viridis Nutrition 0.000 description 1
- ATJFFYVFTNAWJD-UHFFFAOYSA-N Tin Chemical compound [Sn] ATJFFYVFTNAWJD-UHFFFAOYSA-N 0.000 description 1
- 230000001154 acute effect Effects 0.000 description 1
- 239000011425 bamboo Substances 0.000 description 1
- AIXMJTYHQHQJLU-UHFFFAOYSA-N chembl210858 Chemical compound O1C(CC(=O)OC)CC(C=2C=CC(O)=CC=2)=N1 AIXMJTYHQHQJLU-UHFFFAOYSA-N 0.000 description 1
- 239000002826 coolant Substances 0.000 description 1
- 238000010304 firing Methods 0.000 description 1
- 238000005243 fluidization Methods 0.000 description 1
- 235000013305 food Nutrition 0.000 description 1
- 239000010922 glass waste Substances 0.000 description 1
- 239000010985 leather Substances 0.000 description 1
- 239000010814 metallic waste Substances 0.000 description 1
- 239000000123 paper Substances 0.000 description 1
- 239000004033 plastic Substances 0.000 description 1
- 239000005060 rubber Substances 0.000 description 1
- 238000012216 screening Methods 0.000 description 1
- 239000010802 sludge Substances 0.000 description 1
- 239000007787 solid Substances 0.000 description 1
- 239000004575 stone Substances 0.000 description 1
- 239000010902 straw Substances 0.000 description 1
- 235000013311 vegetables Nutrition 0.000 description 1
- 238000004065 wastewater treatment Methods 0.000 description 1
- 239000002023 wood Substances 0.000 description 1
Classifications
-
- F—MECHANICAL ENGINEERING; LIGHTING; HEATING; WEAPONS; BLASTING
- F23—COMBUSTION APPARATUS; COMBUSTION PROCESSES
- F23G—CREMATION FURNACES; CONSUMING WASTE PRODUCTS BY COMBUSTION
- F23G5/00—Incineration of waste; Incinerator constructions; Details, accessories or control therefor
- F23G5/30—Incineration of waste; Incinerator constructions; Details, accessories or control therefor having a fluidised bed
Landscapes
- Engineering & Computer Science (AREA)
- Mechanical Engineering (AREA)
- General Engineering & Computer Science (AREA)
- Fluidized-Bed Combustion And Resonant Combustion (AREA)
- Gasification And Melting Of Waste (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| JP6709265 | 1965-11-01 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1526108A1 true DE1526108A1 (de) | 1970-02-12 |
Family
ID=13334883
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19661526108 Pending DE1526108A1 (de) | 1965-11-01 | 1966-10-31 | Vorrichtung zur fortlaufenden Muellverbrennung |
Country Status (5)
| Country | Link |
|---|---|
| US (1) | US3397657A (enExample) |
| CH (1) | CH456822A (enExample) |
| DE (1) | DE1526108A1 (enExample) |
| GB (1) | GB1166675A (enExample) |
| NL (1) | NL6615261A (enExample) |
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0019652A1 (de) * | 1979-05-30 | 1980-12-10 | GebràDer Sulzer Aktiengesellschaft | Rost für eine Wirbelschichtfeuerung |
| EP0082622A1 (en) * | 1981-12-15 | 1983-06-29 | William Benedict Johnson | Fluidized bed combustion apparatus and method of carrying out fluidized bed combustion |
| EP0139092A1 (en) * | 1983-07-29 | 1985-05-02 | KRW Energy Systems Inc. | Ash removal apparatus for fluidized bed gasifier |
| EP0235531A1 (en) * | 1986-01-21 | 1987-09-09 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of stable combustion for a fluidized bed incinerator |
| EP0236686A1 (en) * | 1986-01-22 | 1987-09-16 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of catalystless denitrification for fluidized bed incinerators |
| EP0237720A1 (en) * | 1986-01-21 | 1987-09-23 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of secondary combustion promotion for a fluidized bed incinerator |
Families Citing this family (69)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| GB1212887A (en) * | 1968-05-10 | 1970-11-18 | Power Gas Ltd | Improvements in incinerators |
| US3577938A (en) * | 1968-05-10 | 1971-05-11 | Rose Downs & Thompson Ltd | Incinerators |
| US3524633A (en) * | 1968-07-24 | 1970-08-18 | Benjamin P Shiller | Heat transfer apparatus utilizing particles of granular material |
| US3568609A (en) * | 1969-06-16 | 1971-03-09 | Air Preheater | Incineration system |
| US3565022A (en) * | 1969-09-24 | 1971-02-23 | Us Interior | Method for regulating heat output from an oxidizing fluidized bed |
| US3645237A (en) * | 1970-06-10 | 1972-02-29 | American Standard Inc | Water heater having fluidized bed combustion and heat exchange region |
| GB1370096A (en) * | 1970-12-07 | 1974-10-09 | Sprocket Properties Ltd | Fluidised bed apparatus |
| US3702595A (en) * | 1971-02-04 | 1972-11-14 | Power Gas Ltd | Fluidised bed incinerators |
| BE792527A (fr) * | 1971-12-10 | 1973-03-30 | Foster Wheeler Brown Boilers | Perfectionnements aux incinerateurs |
| BE793489A (fr) * | 1972-03-06 | 1973-04-16 | Awt Systems Inc | Appareil ameliore a lit fluidise |
| US3776150A (en) * | 1972-03-06 | 1973-12-04 | Awt Systems Inc | Fluidized bed system for solid wastes |
| US3785304A (en) * | 1972-03-13 | 1974-01-15 | K Stookey | Method and apparatus for the thermal reduction of rubber or plastic material |
| US3818846A (en) * | 1972-04-26 | 1974-06-25 | Combustion Power | Method and apparatus for liquid disposal in a fluid bed reactor |
| GB1397800A (en) * | 1972-09-01 | 1975-06-18 | Coal Industry Patents Ltd | Fluidised bed combusters |
| GB1412033A (en) * | 1973-03-02 | 1975-10-29 | Coal Industry Patents Ltd | Fluidised bed combustion |
| US3805713A (en) * | 1973-05-22 | 1974-04-23 | Heyl & Patterson | Disposal of ash from coal preparation plant tailings |
| GB1419811A (en) * | 1973-06-08 | 1975-12-31 | Coal Industry Patents Ltd | Fluidised bed apparatus |
| US3841240A (en) * | 1973-07-06 | 1974-10-15 | Sola Basic Ind Inc | Continuous fluid bed wire burn-off apparatus and method |
| US3861331A (en) * | 1973-07-20 | 1975-01-21 | Kureha Chemical Ind Co Ltd | Moving bottom incinerator |
| CA1021206A (en) * | 1973-11-09 | 1977-11-22 | Heinz W. Oepke | Fluidized bed furnace having coarse particle discharging device |
| DE2356060C3 (de) * | 1973-11-09 | 1985-08-29 | Thyssen Industrie Ag, 4300 Essen | Wirbelschichtofen für die Verbrennung von teilweise entwässertem Schlamm |
| GB1494996A (en) * | 1973-12-17 | 1977-12-14 | Babcock & Wilcox Ltd | Fluidised bed combustion system |
| GB1536654A (en) * | 1974-10-31 | 1978-12-20 | Exxon Research Engineering Co | Distributing fluids into fluidized beds |
| US3946680A (en) * | 1974-12-23 | 1976-03-30 | The Firestone Tire & Rubber Company | Burning used tires, etc. and apparatus therefor |
| US4060041A (en) * | 1975-06-30 | 1977-11-29 | Energy Products Of Idaho | Low pollution incineration of solid waste |
| US4240377A (en) * | 1978-01-19 | 1980-12-23 | Johnson William B | Fluidized-bed compact boiler and method of operation |
| US4197086A (en) * | 1977-12-01 | 1980-04-08 | Foster Wheeler Energy Corporation | Method and apparatus for agglomerating solid non-combustible waste material |
| US4308806A (en) * | 1978-04-05 | 1982-01-05 | Babcock-Hitachi Kabushiki Kaisha | Incinerator for burning waste and a method of utilizing same |
| US4177742A (en) * | 1978-04-05 | 1979-12-11 | Babcock-Hitachi Kabushiki Kaisha | Incinerator for burning waste and a method of utilizing same |
| US4196676A (en) * | 1978-07-21 | 1980-04-08 | Combustion Power Company, Inc. | Fluid bed combustion method and apparatus |
| US4227469A (en) * | 1978-08-23 | 1980-10-14 | Frank Collura | Multipurpose slag system |
| US4227488A (en) * | 1978-10-03 | 1980-10-14 | Foster Wheeler Energy Corporation | Fluidized bed unit including a cooling device for bed material |
| ZA801294B (en) * | 1979-03-14 | 1981-10-28 | British Petroleum Co | Fluidised bed combustor |
| DE3066469D1 (en) * | 1979-06-08 | 1984-03-15 | Babcock Bsh Ag | Process and arrangement for feeding comminuted solid fuel to a fluidized bed furnace |
| US4330502A (en) * | 1980-06-16 | 1982-05-18 | A. Ahlstrom Osakeyhtio | Fluidized bed reactor |
| US4402665A (en) * | 1980-08-07 | 1983-09-06 | York-Shipley, Inc. | Combustor air grid |
| GB2082469B (en) * | 1980-08-29 | 1985-07-31 | Flameless Furnaces Ltd | Fluidized bed combustor |
| US4400150A (en) * | 1980-10-20 | 1983-08-23 | Stone-Platt Fluidfire Limited | Fluidized bed combustor distributor plate assembly |
| US4345894A (en) * | 1980-10-20 | 1982-08-24 | Stone-Platt Fluidfire Limited | Light fuel start-up fluidized bed combustor |
| US4372228A (en) * | 1980-12-04 | 1983-02-08 | York-Shipley, Inc. | Fluidized bed reactor utilizing a conical-shaped support and method of operating the reactor |
| US4419330A (en) * | 1981-01-27 | 1983-12-06 | Ebara Corporation | Thermal reactor of fluidizing bed type |
| FI64858C (fi) * | 1981-02-24 | 1984-01-10 | Ahlstroem Oy | Slussmatare |
| US4357883A (en) * | 1981-08-10 | 1982-11-09 | Combustion Engineering, Inc. | Bed drain cover assembly for a fluidized bed |
| US4404755A (en) * | 1981-08-25 | 1983-09-20 | Foster Wheeler Energy Corporation | Fluidized bed heat exchanger utilizing induced diffusion and circulation |
| US4349969A (en) * | 1981-09-11 | 1982-09-21 | Foster Wheeler Energy Corporation | Fluidized bed reactor utilizing zonal fluidization and anti-mounding pipes |
| US4539939A (en) * | 1981-12-15 | 1985-09-10 | Johnson William B | Fluidized bed combustion apparatus and method |
| US4475467A (en) * | 1982-02-12 | 1984-10-09 | York-Shipley, Inc. | Fluidized bed reactor utilizing a plate support and method of operating the reactor |
| US4446799A (en) * | 1982-05-07 | 1984-05-08 | Combustion Engineering, Inc. | Fluidized bed fuel feed system |
| US4424766A (en) | 1982-09-09 | 1984-01-10 | Boyle Bede Alfred | Hydro/pressurized fluidized bed combustor |
| US4908124A (en) * | 1982-09-20 | 1990-03-13 | Combustion Power Company | Method and apparatus for removing foreign objects from fluid bed systems |
| US4421038A (en) * | 1982-09-20 | 1983-12-20 | Combustion Power Company, Inc. | Method and apparatus for removing foreign objects from fluid bed systems |
| GB2132500B (en) * | 1982-12-17 | 1986-06-04 | Coal Ind | Classification and recycling of fluidised bed material |
| GB8319139D0 (en) * | 1983-07-15 | 1983-08-17 | Coal Industry Patents Ltd | Fluidised bed systems |
| WO1987001433A1 (fr) * | 1985-09-09 | 1987-03-12 | Foerster Guenther | Procede et dispositif de combustion de matieres solides et/ou liquides |
| FI75504C (fi) * | 1984-08-28 | 1988-07-11 | Ahlstroem Oy | Anordning i virvelbaeddsreaktor. |
| US4595416A (en) * | 1984-10-01 | 1986-06-17 | Fuller Company | Method and apparatus for producing cement clinker including white cement |
| GB2189164A (en) * | 1986-03-14 | 1987-10-21 | Univ Birmingham | Apparatus for fluidised beds |
| CA1285761C (en) * | 1986-04-01 | 1991-07-09 | Kawasaki Jukogyo Kabushiki Kaisha | Plant for manufacturing cement clinker |
| US4700636A (en) * | 1986-10-23 | 1987-10-20 | Dorr-Oliver Incorporated | Ash classifier |
| US5158449A (en) * | 1991-01-08 | 1992-10-27 | Institute Of Gas Technology | Thermal ash agglomeration process |
| EP1058051B1 (en) * | 1998-02-27 | 2005-07-20 | Ebara Corporation | Fluidized bed gasification furnace |
| EP1631374A2 (en) * | 2003-04-30 | 2006-03-08 | Ebara Corporation | A supplying apparatus for supplying combustible material, a gasification apparatus for gasifying combustible material and method for gasifying combustible material |
| FI116315B (fi) * | 2004-04-02 | 2005-10-31 | Foster Wheeler Energia Oy | Leijupetireaktorin arinasuutin |
| US20110083593A1 (en) * | 2009-10-12 | 2011-04-14 | AirClean Technologies, Inc. | Fluidized combustor |
| DE102012001400A1 (de) * | 2012-01-26 | 2013-08-01 | Babcock Borsig Steinmüller Gmbh | Dampferzeugeranlage mit Nachbrennkammer |
| US10226826B2 (en) | 2013-10-22 | 2019-03-12 | Milwaukee Electric Tool Corporation | Hydraulic power tool |
| CN205977914U (zh) | 2015-05-06 | 2017-02-22 | 米沃奇电动工具公司 | 液压动力工具 |
| IT202100007661A1 (it) * | 2021-03-29 | 2022-09-29 | Cicsa S R L | Metodo per il raffreddamento ed il recupero termico da materiali ad altissima temperatura |
| WO2022271632A1 (en) | 2021-06-21 | 2022-12-29 | Milwaukee Electric Tool Corporation | Systems and methods for evaluating crimp applications |
Family Cites Families (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1638771A (en) * | 1927-08-09 | Incinerator | ||
| US1204530A (en) * | 1912-09-06 | 1916-11-14 | Walter B Wright | Incinerating-furnace. |
| US2246224A (en) * | 1937-10-27 | 1941-06-17 | Municipal Sanitary Service Cor | Disposal of garbage or garbage and sewage sludge and the like |
| US2903981A (en) * | 1955-11-14 | 1959-09-15 | John E Brink | Ash producing furnaces and ash removal apparatus for use therewith |
| NL219677A (enExample) * | 1958-03-24 | |||
| US3306236A (en) * | 1964-09-11 | 1967-02-28 | Exxon Research Engineering Co | Burner for waste materials and method of burning waste materials |
-
1966
- 1966-10-25 US US589384A patent/US3397657A/en not_active Expired - Lifetime
- 1966-10-28 NL NL6615261A patent/NL6615261A/xx unknown
- 1966-10-31 DE DE19661526108 patent/DE1526108A1/de active Pending
- 1966-10-31 CH CH1568466A patent/CH456822A/de unknown
- 1966-11-01 GB GB48891/66A patent/GB1166675A/en not_active Expired
Cited By (6)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0019652A1 (de) * | 1979-05-30 | 1980-12-10 | GebràDer Sulzer Aktiengesellschaft | Rost für eine Wirbelschichtfeuerung |
| EP0082622A1 (en) * | 1981-12-15 | 1983-06-29 | William Benedict Johnson | Fluidized bed combustion apparatus and method of carrying out fluidized bed combustion |
| EP0139092A1 (en) * | 1983-07-29 | 1985-05-02 | KRW Energy Systems Inc. | Ash removal apparatus for fluidized bed gasifier |
| EP0235531A1 (en) * | 1986-01-21 | 1987-09-09 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of stable combustion for a fluidized bed incinerator |
| EP0237720A1 (en) * | 1986-01-21 | 1987-09-23 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of secondary combustion promotion for a fluidized bed incinerator |
| EP0236686A1 (en) * | 1986-01-22 | 1987-09-16 | Ishikawajima-Harima Heavy Industries Co., Ltd. | Method of catalystless denitrification for fluidized bed incinerators |
Also Published As
| Publication number | Publication date |
|---|---|
| US3397657A (en) | 1968-08-20 |
| NL6615261A (enExample) | 1967-05-02 |
| GB1166675A (en) | 1969-10-08 |
| CH456822A (de) | 1968-05-31 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1526108A1 (de) | Vorrichtung zur fortlaufenden Muellverbrennung | |
| DE2929056C2 (enExample) | ||
| DE69111527T2 (de) | Kessel zur Erzeugung von Dampf und Verfahren zum Auslass von Asche. | |
| DE2819184A1 (de) | Fliessbett-verbrennungsvorrichtung mit ascheentfernungseinrichtung | |
| DE2509764C2 (de) | Anlage zum Sortieren von Müll, insbesondere Hausmüll | |
| DE2249454A1 (de) | Wirbelschichtvorrichtung | |
| DE2251513A1 (de) | Verfahren und vorrichtung zum unterbinden des zusetzens von luftfoerderanlagen | |
| CH615745A5 (enExample) | ||
| DE2160685A1 (de) | Wirbelbettvorrichtung | |
| DE3226877A1 (de) | Heizkessel | |
| DE3333929C2 (de) | Verfahren und Vorrichtung zum Trennen von Fremdkörpern von Fließbettpartikeln | |
| DE69801812T2 (de) | Anlage und verfahren zur verbrennung von industrie- und hausmüll und schlamm | |
| DE68916245T2 (de) | Trocknungs- und verbrennungsvorrichtung für feste entflammbare materialien mit hoher feuchtigkeit. | |
| DE4312899C2 (de) | Verfahren und Anordnung zum vollständigen Abbrand von in einem kohlenstaubgefeuerten Dampfkessel zu verbrennenden Biostoffen, insbesondere Holzhackschnitzel | |
| DE1451489A1 (de) | Anlage zur Vernichtung von waessrigem Bodenschlamm | |
| DE498070C (de) | Muell- und Kehricht-Verbrennungs- und Verschwelungs-Drehtrommel, deren Mantel als Feuerungsrost dient | |
| WO2016066806A1 (de) | Verfahren zur handhabung von schlacke und rostdurchfall einer müllverbrennungsanlage sowie müllverbrennungsanlage | |
| EP0064688B1 (de) | Verfahren und Vorrichtung zum Lagern von Braunkohlen- und Steinkohlenstaub und Mischungen derselben in einem Vorratsbehälter | |
| DE2523981A1 (de) | Verbrennungsofen | |
| DE2757695A1 (de) | Verbrennungsofen | |
| DE2332661C3 (de) | Einrichtung zum Verbrennen von Müll | |
| DE1952222A1 (de) | Muelleimer | |
| AT296485B (de) | Deckel zum Aufsetzen auf einem metallischen Standard-Müllbehälter od.dgl. | |
| DE1817331A1 (de) | Wanderrostanlage | |
| DD283859B3 (de) | Wirbelschichtfeuerung |