DE1274578B - Verfahren zur Herstellung von Cycloalkylaminverbindungen - Google Patents
Verfahren zur Herstellung von CycloalkylaminverbindungenInfo
- Publication number
- DE1274578B DE1274578B DEF45013A DEF0045013A DE1274578B DE 1274578 B DE1274578 B DE 1274578B DE F45013 A DEF45013 A DE F45013A DE F0045013 A DEF0045013 A DE F0045013A DE 1274578 B DE1274578 B DE 1274578B
- Authority
- DE
- Germany
- Prior art keywords
- acid
- compounds
- formic acid
- cycloalkylamine
- mol
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 238000000034 method Methods 0.000 title claims description 12
- 150000001875 compounds Chemical class 0.000 title claims description 5
- 238000002360 preparation method Methods 0.000 title description 3
- BDAGIHXWWSANSR-UHFFFAOYSA-N methanoic acid Natural products OC=O BDAGIHXWWSANSR-UHFFFAOYSA-N 0.000 claims description 30
- OSWFIVFLDKOXQC-UHFFFAOYSA-N 4-(3-methoxyphenyl)aniline Chemical compound COC1=CC=CC(C=2C=CC(N)=CC=2)=C1 OSWFIVFLDKOXQC-UHFFFAOYSA-N 0.000 claims description 15
- 235000019253 formic acid Nutrition 0.000 claims description 15
- 150000002576 ketones Chemical class 0.000 claims description 14
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 6
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 6
- 239000002253 acid Substances 0.000 claims description 4
- 150000007513 acids Chemical class 0.000 claims description 2
- 238000004519 manufacturing process Methods 0.000 claims description 2
- 238000006053 organic reaction Methods 0.000 claims description 2
- 239000004014 plasticizer Substances 0.000 claims description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 15
- -1 formaldehyde Amino acid Chemical class 0.000 description 15
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 description 12
- LRHPLDYGYMQRHN-UHFFFAOYSA-N N-Butanol Chemical compound CCCCO LRHPLDYGYMQRHN-UHFFFAOYSA-N 0.000 description 8
- 239000000203 mixture Substances 0.000 description 8
- 229910052757 nitrogen Inorganic materials 0.000 description 8
- 125000004432 carbon atom Chemical group C* 0.000 description 7
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical compound CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 6
- 229910002092 carbon dioxide Inorganic materials 0.000 description 6
- 238000006243 chemical reaction Methods 0.000 description 6
- 229910052739 hydrogen Inorganic materials 0.000 description 6
- KXDHJXZQYSOELW-UHFFFAOYSA-N Carbamic acid Chemical class NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 5
- WSFSSNUMVMOOMR-UHFFFAOYSA-N Formaldehyde Chemical compound O=C WSFSSNUMVMOOMR-UHFFFAOYSA-N 0.000 description 5
- 150000001413 amino acids Chemical class 0.000 description 5
- 238000002844 melting Methods 0.000 description 5
- 230000008018 melting Effects 0.000 description 5
- 238000010992 reflux Methods 0.000 description 5
- GUOSQNAUYHMCRU-UHFFFAOYSA-N 11-Aminoundecanoic acid Chemical compound NCCCCCCCCCCC(O)=O GUOSQNAUYHMCRU-UHFFFAOYSA-N 0.000 description 4
- 239000013078 crystal Substances 0.000 description 4
- BTCSSZJGUNDROE-UHFFFAOYSA-N gamma-aminobutyric acid Chemical compound NCCCC(O)=O BTCSSZJGUNDROE-UHFFFAOYSA-N 0.000 description 4
- 238000003756 stirring Methods 0.000 description 4
- SLXKOJJOQWFEFD-UHFFFAOYSA-N 6-aminohexanoic acid Chemical compound NCCCCCC(O)=O SLXKOJJOQWFEFD-UHFFFAOYSA-N 0.000 description 3
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical compound CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 3
- 229960002684 aminocaproic acid Drugs 0.000 description 3
- 239000001569 carbon dioxide Substances 0.000 description 3
- 150000001728 carbonyl compounds Chemical class 0.000 description 3
- 239000002904 solvent Substances 0.000 description 3
- UJBOOUHRTQVGRU-UHFFFAOYSA-N 3-methylcyclohexan-1-one Chemical compound CC1CCCC(=O)C1 UJBOOUHRTQVGRU-UHFFFAOYSA-N 0.000 description 2
- WOSJQBFTZURPKY-UHFFFAOYSA-N 4-(cyclohexylamino)butanoic acid Chemical compound OC(=O)CCCNC1CCCCC1 WOSJQBFTZURPKY-UHFFFAOYSA-N 0.000 description 2
- HAWVCXABNZBPED-UHFFFAOYSA-N 4-[2-(4-oxocyclohexyl)propan-2-yl]cyclohexan-1-one Chemical compound C1CC(=O)CCC1C(C)(C)C1CCC(=O)CC1 HAWVCXABNZBPED-UHFFFAOYSA-N 0.000 description 2
- VGVHNLRUAMRIEW-UHFFFAOYSA-N 4-methylcyclohexan-1-one Chemical compound CC1CCC(=O)CC1 VGVHNLRUAMRIEW-UHFFFAOYSA-N 0.000 description 2
- IKHGUXGNUITLKF-UHFFFAOYSA-N Acetaldehyde Chemical compound CC=O IKHGUXGNUITLKF-UHFFFAOYSA-N 0.000 description 2
- QGZKDVFQNNGYKY-UHFFFAOYSA-N Ammonia Chemical compound N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 2
- DHMQDGOQFOQNFH-UHFFFAOYSA-N Glycine Chemical compound NCC(O)=O DHMQDGOQFOQNFH-UHFFFAOYSA-N 0.000 description 2
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 2
- 238000006547 Leuckart Thiophenol synthesis reaction Methods 0.000 description 2
- UCMIRNVEIXFBKS-UHFFFAOYSA-N beta-alanine Chemical compound NCCC(O)=O UCMIRNVEIXFBKS-UHFFFAOYSA-N 0.000 description 2
- 230000001588 bifunctional effect Effects 0.000 description 2
- 238000009835 boiling Methods 0.000 description 2
- 238000001816 cooling Methods 0.000 description 2
- PAFZNILMFXTMIY-UHFFFAOYSA-N cyclohexylamine Chemical compound NC1CCCCC1 PAFZNILMFXTMIY-UHFFFAOYSA-N 0.000 description 2
- BGTOWKSIORTVQH-UHFFFAOYSA-N cyclopentanone Chemical compound O=C1CCCC1 BGTOWKSIORTVQH-UHFFFAOYSA-N 0.000 description 2
- 125000002147 dimethylamino group Chemical group [H]C([H])([H])N(*)C([H])([H])[H] 0.000 description 2
- 238000004821 distillation Methods 0.000 description 2
- 238000000921 elemental analysis Methods 0.000 description 2
- 229960003692 gamma aminobutyric acid Drugs 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- ZXEKIIBDNHEJCQ-UHFFFAOYSA-N isobutanol Chemical compound CC(C)CO ZXEKIIBDNHEJCQ-UHFFFAOYSA-N 0.000 description 2
- 125000004433 nitrogen atom Chemical group N* 0.000 description 2
- FDPIMTJIUBPUKL-UHFFFAOYSA-N pentan-3-one Chemical compound CCC(=O)CC FDPIMTJIUBPUKL-UHFFFAOYSA-N 0.000 description 2
- 238000001953 recrystallisation Methods 0.000 description 2
- MXEOFTCIEDUHCX-UHFFFAOYSA-N 1-cyclohexylazepan-2-one Chemical compound O=C1CCCCCN1C1CCCCC1 MXEOFTCIEDUHCX-UHFFFAOYSA-N 0.000 description 1
- SWILKIQCGDTBQV-UHFFFAOYSA-N 2,4-dimethylcyclohexan-1-one Chemical compound CC1CCC(=O)C(C)C1 SWILKIQCGDTBQV-UHFFFAOYSA-N 0.000 description 1
- KBXJMKRDYAGLKP-UHFFFAOYSA-N 2-(10-methylundecyl)cyclohexan-1-one Chemical compound C(CCCCCCCCC(C)C)C1C(CCCC1)=O KBXJMKRDYAGLKP-UHFFFAOYSA-N 0.000 description 1
- LFSAPCRASZRSKS-UHFFFAOYSA-N 2-methylcyclohexan-1-one Chemical compound CC1CCCCC1=O LFSAPCRASZRSKS-UHFFFAOYSA-N 0.000 description 1
- MRBFWTDIRYEDBQ-UHFFFAOYSA-N 4-(2-aminoethyl)benzoic acid Chemical compound NCCC1=CC=C(C(O)=O)C=C1 MRBFWTDIRYEDBQ-UHFFFAOYSA-N 0.000 description 1
- ASSYWVLYXRBXPL-UHFFFAOYSA-N 4-(2-methylpropyl)cyclohexan-1-one Chemical compound CC(C)CC1CCC(=O)CC1 ASSYWVLYXRBXPL-UHFFFAOYSA-N 0.000 description 1
- FCENMZBOJIWSJD-UHFFFAOYSA-N 4-(4-oxocyclohexyl)oxycyclohexan-1-one Chemical compound C1CC(=O)CCC1OC1CCC(=O)CC1 FCENMZBOJIWSJD-UHFFFAOYSA-N 0.000 description 1
- ZOLFBGNMCGRRKG-UHFFFAOYSA-N 4-[(4-oxocyclohexyl)methyl]cyclohexan-1-one Chemical compound C1CC(=O)CCC1CC1CCC(=O)CC1 ZOLFBGNMCGRRKG-UHFFFAOYSA-N 0.000 description 1
- BLKMNPMSVHEHSS-UHFFFAOYSA-N 4-[1-(4-oxocyclohexyl)cyclohexyl]cyclohexan-1-one Chemical compound C1CCC(CC1)(C2CCC(=O)CC2)C3CCC(=O)CC3 BLKMNPMSVHEHSS-UHFFFAOYSA-N 0.000 description 1
- JLYNSPSTPQAEAX-UHFFFAOYSA-N 4-cyclohexylcyclohexan-1-one Chemical compound C1CC(=O)CCC1C1CCCCC1 JLYNSPSTPQAEAX-UHFFFAOYSA-N 0.000 description 1
- FPKISACHVIIMRA-UHFFFAOYSA-N 4-propan-2-ylcyclohexan-1-one Chemical compound CC(C)C1CCC(=O)CC1 FPKISACHVIIMRA-UHFFFAOYSA-N 0.000 description 1
- MIOQYAVMRIUVDK-UHFFFAOYSA-N 6-(cyclohexylamino)hexanoic acid Chemical compound OC(=O)CCCCCNC1CCCCC1 MIOQYAVMRIUVDK-UHFFFAOYSA-N 0.000 description 1
- KWOLFJPFCHCOCG-UHFFFAOYSA-N Acetophenone Chemical compound CC(=O)C1=CC=CC=C1 KWOLFJPFCHCOCG-UHFFFAOYSA-N 0.000 description 1
- XBPCUCUWBYBCDP-UHFFFAOYSA-N Dicyclohexylamine Chemical compound C1CCCCC1NC1CCCCC1 XBPCUCUWBYBCDP-UHFFFAOYSA-N 0.000 description 1
- 239000004471 Glycine Substances 0.000 description 1
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 1
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 1
- FXHOOIRPVKKKFG-UHFFFAOYSA-N N,N-Dimethylacetamide Chemical compound CN(C)C(C)=O FXHOOIRPVKKKFG-UHFFFAOYSA-N 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 150000001298 alcohols Chemical class 0.000 description 1
- 150000001299 aldehydes Chemical class 0.000 description 1
- 125000000217 alkyl group Chemical group 0.000 description 1
- 230000029936 alkylation Effects 0.000 description 1
- 238000005804 alkylation reaction Methods 0.000 description 1
- 125000002947 alkylene group Chemical group 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 125000003277 amino group Chemical group 0.000 description 1
- 229910021529 ammonia Inorganic materials 0.000 description 1
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 description 1
- RWCCWEUUXYIKHB-UHFFFAOYSA-N benzophenone Chemical compound C=1C=CC=CC=1C(=O)C1=CC=CC=C1 RWCCWEUUXYIKHB-UHFFFAOYSA-N 0.000 description 1
- 239000012965 benzophenone Substances 0.000 description 1
- 239000006227 byproduct Substances 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical group 0.000 description 1
- 239000007795 chemical reaction product Substances 0.000 description 1
- 238000004140 cleaning Methods 0.000 description 1
- 238000002425 crystallisation Methods 0.000 description 1
- 230000008025 crystallization Effects 0.000 description 1
- 125000004122 cyclic group Chemical group 0.000 description 1
- 150000003997 cyclic ketones Chemical class 0.000 description 1
- SHQSVMDWKBRBGB-UHFFFAOYSA-N cyclobutanone Chemical compound O=C1CCC1 SHQSVMDWKBRBGB-UHFFFAOYSA-N 0.000 description 1
- IIRFCWANHMSDCG-UHFFFAOYSA-N cyclooctanone Chemical compound O=C1CCCCCCC1 IIRFCWANHMSDCG-UHFFFAOYSA-N 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- 238000002474 experimental method Methods 0.000 description 1
- IBRZMAIAORVEIM-UHFFFAOYSA-N formylcarbamic acid Chemical class OC(=O)NC=O IBRZMAIAORVEIM-UHFFFAOYSA-N 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- MQWCXKGKQLNYQG-UHFFFAOYSA-N methyl cyclohexan-4-ol Natural products CC1CCC(O)CC1 MQWCXKGKQLNYQG-UHFFFAOYSA-N 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- PZYDAVFRVJXFHS-UHFFFAOYSA-N n-cyclohexyl-2-pyrrolidone Chemical compound O=C1CCCN1C1CCCCC1 PZYDAVFRVJXFHS-UHFFFAOYSA-N 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- KRIOVPPHQSLHCZ-UHFFFAOYSA-N phenyl propionaldehyde Natural products CCC(=O)C1=CC=CC=C1 KRIOVPPHQSLHCZ-UHFFFAOYSA-N 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- BDERNNFJNOPAEC-UHFFFAOYSA-N propan-1-ol Chemical compound CCCO BDERNNFJNOPAEC-UHFFFAOYSA-N 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- 238000006467 substitution reaction Methods 0.000 description 1
- 229910052717 sulfur Inorganic materials 0.000 description 1
- 239000011593 sulfur Substances 0.000 description 1
- 239000004753 textile Substances 0.000 description 1
- HTSABYAWKQAHBT-UHFFFAOYSA-N trans 3-methylcyclohexanol Natural products CC1CCCC(O)C1 HTSABYAWKQAHBT-UHFFFAOYSA-N 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G64/00—Macromolecular compounds obtained by reactions forming a carbonic ester link in the main chain of the macromolecule
- C08G64/20—General preparatory processes
- C08G64/30—General preparatory processes using carbonates
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyesters Or Polycarbonates (AREA)
- Compositions Of Macromolecular Compounds (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Priority Applications (7)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE19651570534 DE1570534A1 (de) | 1965-01-21 | 1965-01-21 | Verfahren zum Herstellen hochmolekularer,thermoplastischer Polycarbonate nach dem Umesterungsverfahren |
| DEF45013A DE1274578B (de) | 1965-01-21 | 1965-01-21 | Verfahren zur Herstellung von Cycloalkylaminverbindungen |
| GB1882/66A GB1079822A (en) | 1965-01-21 | 1966-01-14 | Process for the production of high molecular weight,thermoplastic polycarbonates |
| BE675190D BE675190A (OSRAM) | 1965-01-21 | 1966-01-17 | |
| FR46175A FR1463702A (fr) | 1965-01-21 | 1966-01-17 | Procédé de préparation de polycarbonates thermoplastiques à poids moléculaire élevé par le procédé de transestérification |
| US521808A US3442854A (en) | 1965-01-21 | 1966-01-20 | Quaternary ammonium phosphonium and arsonium catalysts for the production of polycarbonates by the transesterification method |
| NL6600826A NL6600826A (OSRAM) | 1965-01-21 | 1966-01-21 |
Applications Claiming Priority (2)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEF45013A DE1274578B (de) | 1965-01-21 | 1965-01-21 | Verfahren zur Herstellung von Cycloalkylaminverbindungen |
| DEF0045012 | 1965-01-21 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1274578B true DE1274578B (de) | 1968-08-08 |
Family
ID=25976593
Family Applications (2)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEF45013A Pending DE1274578B (de) | 1965-01-21 | 1965-01-21 | Verfahren zur Herstellung von Cycloalkylaminverbindungen |
| DE19651570534 Pending DE1570534A1 (de) | 1965-01-21 | 1965-01-21 | Verfahren zum Herstellen hochmolekularer,thermoplastischer Polycarbonate nach dem Umesterungsverfahren |
Family Applications After (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DE19651570534 Pending DE1570534A1 (de) | 1965-01-21 | 1965-01-21 | Verfahren zum Herstellen hochmolekularer,thermoplastischer Polycarbonate nach dem Umesterungsverfahren |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3442854A (OSRAM) |
| BE (1) | BE675190A (OSRAM) |
| DE (2) | DE1274578B (OSRAM) |
| FR (1) | FR1463702A (OSRAM) |
| GB (1) | GB1079822A (OSRAM) |
| NL (1) | NL6600826A (OSRAM) |
Families Citing this family (67)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4217438A (en) * | 1978-12-15 | 1980-08-12 | General Electric Company | Polycarbonate transesterification process |
| US4330664A (en) | 1979-12-26 | 1982-05-18 | General Electric Company | Polycarbonate transesterification with catalyst containing aluminum hydride or borohydride group |
| US4345062A (en) * | 1979-12-26 | 1982-08-17 | General Electric Company | Polycarbonate transesterification with tetraborate or tetraaluminate anion containing catalyst |
| US4321356A (en) | 1980-03-27 | 1982-03-23 | General Electric Company | Transesterification process utilizing as a reactant bis(ortho-haloaryl)carbonates |
| US4395574A (en) * | 1980-05-12 | 1983-07-26 | The Dow Chemical Co. | Phosphonium phenoxide catalysts for promoting reaction of epoxides with phenols and/or carboxylic acids |
| US4605731A (en) * | 1985-04-16 | 1986-08-12 | General Electric Company | Method for preparing linear polycarbonate from cyclic oligomer with aryl carbanion generating catalyst |
| DE3523399A1 (de) * | 1985-06-29 | 1987-01-08 | Bayer Ag | Verfahren zur herstellung von duromeren aliphatischen polycarbonaten |
| US5171830A (en) * | 1991-08-16 | 1992-12-15 | Arco Chemical Technology, L.P. | Catalytic process for the preparation of polyalkylene carbonates |
| EP0564727B1 (en) * | 1992-04-07 | 1997-08-13 | Council of Scientific and Industrial Research | Process for the preparation of aryl polycarbonates in the presence of bioxyanion catalysts |
| EP0592900A3 (en) * | 1992-10-14 | 1995-02-22 | Daicel Chem | Process for the preparation of polycarbonates by polycondensation in the melt. |
| DE69333628T2 (de) * | 1992-10-14 | 2005-02-03 | Daicel Chemical Industries, Ltd., Sakai | Verfahren zur Darstellung von Polycarbonaten durch Polykondensation in der Schmelze |
| DE4238123C2 (de) * | 1992-11-12 | 2000-03-09 | Bayer Ag | Verfahren zur Herstellung von thermoplastischen Polycarbonaten |
| JPH06228300A (ja) * | 1992-12-11 | 1994-08-16 | Daicel Chem Ind Ltd | ポリカーボネートの製造法 |
| DE4312390A1 (de) * | 1993-04-16 | 1994-10-20 | Bayer Ag | Zweistufen-Verfahren zur Herstellung von thermoplastischem Polycarbonat |
| DE4320156A1 (de) * | 1993-06-18 | 1994-12-22 | Bayer Ag | Verfahren zur Herstellung von thermoplastischen Polycarbonaten |
| EP0640646B1 (en) * | 1993-08-26 | 2002-11-06 | Teijin Limited | Process for production of stabilized polycarnonate |
| JP3396942B2 (ja) * | 1994-02-21 | 2003-04-14 | 三菱化学株式会社 | 芳香族ポリカーボネートの製造方法 |
| US5412061A (en) * | 1994-03-07 | 1995-05-02 | General Electric Company | Polycarbonate melt condensation synthesis using a tetraorganophosphonium carboxylate salt catalyst |
| US5578694A (en) * | 1994-09-21 | 1996-11-26 | Mitsubishi Chemical Corporation | Process for producing aromatic polycarbonate |
| DE69632527D1 (de) * | 1995-01-31 | 2004-06-24 | Idemitsu Kosan Co | Verfahren zur herstellung von polycarbonat |
| DE19504622A1 (de) * | 1995-02-13 | 1996-08-14 | Bayer Ag | Zweistufen-Verfahren zur Herstellung von thermoplastischem Polycarbonat |
| US5886132A (en) * | 1996-12-20 | 1999-03-23 | General Electric Company | Method for controlling the effective level of catalyst during the preparation of a polycarbonate polymer by transesterification |
| DE19727351C1 (de) | 1997-06-27 | 1999-02-11 | Bayer Ag | Verfahren zur Herstellung von Phosphoniumphenolaten |
| USRE38530E1 (en) * | 1997-07-23 | 2004-06-08 | General Electric Company | Anti-static resin composition containing fluorinated phosphonium sulfonates |
| US6194497B1 (en) * | 1997-07-23 | 2001-02-27 | General Electric Company | Anti-static resin composition containing fluorinated phosphonium sulfonates |
| DE19810745C2 (de) * | 1998-03-12 | 2000-05-04 | Bayer Ag | Flüssige Katalysatorformulierung aus Tetraphenylphosphoniumphenolat und Phenol und deren Verwendung |
| US6653434B2 (en) | 2000-12-29 | 2003-11-25 | General Electric Company | Process for the production of polycarbonate |
| WO2002060855A2 (en) * | 2000-12-28 | 2002-08-08 | General Electric Company | Process for the production of polycarbonate |
| DE10114804A1 (de) * | 2001-03-26 | 2002-10-10 | Bayer Ag | Verfahren zur Herstellung von Polycarbonaten |
| US20030120025A1 (en) * | 2001-09-07 | 2003-06-26 | Brack Hans Peter | Process for the production of polycarbonate |
| US6706846B2 (en) | 2001-10-10 | 2004-03-16 | General Electric Company | Method for end-capping polycarbonate resins and composition for use in same |
| US6500914B1 (en) | 2001-10-10 | 2002-12-31 | General Electric Company | Method for end-capping polycarbonate resins and composition for use in same |
| US6504002B1 (en) | 2001-12-21 | 2003-01-07 | General Electric Company | Process for the production of branched melt polycarbonate by late addition of fries-inducing catalyst |
| DE10215498A1 (de) * | 2002-04-09 | 2003-10-23 | Bayer Ag | Lagerung von Phosphoniumphenolat-Katalysatoren und deren Verwendung als Umesterungskatalysatoren |
| KR100576223B1 (ko) * | 2002-10-01 | 2006-05-03 | 주식회사 엘지화학 | 폴리카보네이트 수지의 제조방법 |
| US20040167283A1 (en) * | 2003-02-24 | 2004-08-26 | Michael Vinciguerra | Linear polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US6861499B2 (en) * | 2003-02-24 | 2005-03-01 | Triton Systems, Inc. | Branched polyphosphonates that exhibit an advantageous combination of properties, and methods related thereto |
| US20050085580A1 (en) * | 2003-10-16 | 2005-04-21 | General Electric Company | Light-Colored Polycarbonate Compositions and Methods |
| US7112645B2 (en) * | 2004-03-19 | 2006-09-26 | General Electric Company | Polycarbonate composition and method of making thereof |
| US7560525B2 (en) * | 2004-04-02 | 2009-07-14 | Frx Polymers, Llc | Crystalline polyphosphonates and methods related thereto |
| US7211690B2 (en) * | 2004-04-13 | 2007-05-01 | General Electric Company | Methods of making an antistatic agent |
| US7105626B2 (en) * | 2004-09-10 | 2006-09-12 | General Electric Company | Method for incorporating alkyl ester endgroups to improve the release properties of melt polycarbonate |
| US20060100327A1 (en) * | 2004-11-08 | 2006-05-11 | Hoeks Theodorus L | Methods of making an antistatic agent |
| US7569717B2 (en) * | 2005-07-19 | 2009-08-04 | Frx Polymers, Llc | Diaryl alkylphosphonates and method for preparing same |
| US7645850B2 (en) * | 2005-08-11 | 2010-01-12 | Frx Polymers, Inc. | Poly(block-phosphonato-ester) and poly(block-phosphonato-carbonate) and methods of making same |
| US7666932B2 (en) * | 2005-10-17 | 2010-02-23 | Frx Polymers, Inc. | Compositions comprising polyphosphonates and additives that exhibit an advantageous combination of properties, and methods related thereto |
| CN101291942B (zh) * | 2005-10-18 | 2012-05-30 | Frx聚合物有限责任公司 | 烷基膦酸二芳基酯及其制备方法 |
| US7838604B2 (en) * | 2005-12-01 | 2010-11-23 | Frx Polymers, Inc. | Method for the production of block copolycarbonate/phosphonates and compositions therefrom |
| TWI387584B (zh) * | 2006-03-13 | 2013-03-01 | Shell Int Research | 碳酸伸烷酯之生產方法及由此生產之碳酸伸烷酯於烷二醇及碳酸二烷酯之製造中之用途 |
| US7928259B2 (en) * | 2008-02-12 | 2011-04-19 | Frx Polymers, Inc. | Diaryl alkylphosphonates and methods for preparing same |
| US20110237695A1 (en) * | 2010-03-23 | 2011-09-29 | Clariant International Ltd. | Flame Retardant Combinations For Polyester Elastomers And Flame Retarded Extrusion Or Molding Compositions Therefrom |
| CN104379651B (zh) | 2012-05-24 | 2016-10-26 | 沙特基础全球技术有限公司 | 改善的阻燃剂聚合物组合物 |
| DE102012022482A1 (de) | 2012-11-19 | 2014-05-22 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Polymerzusammensetzung mit verbesserter Langzeitstabilität, hieraus hergestellte Formteile sowie Verwendungszwecke |
| EP2743299A1 (de) | 2012-12-12 | 2014-06-18 | Zylum Beteiligungsgesellschaft mbH & Co. Patente II KG | Synergistische Zusammensetzung und deren Verwendung als Flammschutzmittel |
| TW201439222A (zh) | 2013-01-22 | 2014-10-16 | Frx Polymers Inc | 含磷環氧化合物及源自其之組成物 |
| DE102013005307A1 (de) | 2013-03-25 | 2014-09-25 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von organischen Oxyimiden als Flammschutzmittel für Kunststoffe sowie flammgeschützte Kunststoffzusammensetzung und hieraus hergestelltem Formteil |
| EP3036279B1 (en) | 2013-10-08 | 2019-05-08 | Momentive Performance Materials GmbH | Reactive functional siloxane compositions |
| DE102014210214A1 (de) | 2014-05-28 | 2015-12-03 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von Oxyimid-enthaltenden Copolymeren oder Polymeren als Flammschutzmittel, Stabilisatoren, Rheologiemodifikatoren für Kunststoffe, Initiatoren für Polymerisations- und Pfropfprozesse, Vernetzungs- oder Kopplungsmittel sowie solche Copolymere oder Polymere enthaltende Kunststoffformmassen |
| DE102014211276A1 (de) | 2014-06-12 | 2015-12-17 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von Hydroxybenzotriazol-Derivaten und/oder Hydroxy-Indazol-Derivaten als Flammschutzmittel für Kunststoffe sowie flammgeschützte Kunststoffformmasse |
| DE102014218810B3 (de) | 2014-09-18 | 2016-01-28 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von organischen Oxyimidsalzen als Flammschutzmittel, flammengeschützte Kunststoffzusammensetzung, Verfahren zur ihrer Herstellung sowie Formteil, Lack oder Beschichtung |
| DE102014218811A1 (de) | 2014-09-18 | 2016-03-24 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von phosphorhaltigen organischen Oxyimiden als Flammschutzmittel, Radikalgeneratoren und/oder als Stabilisatoren für Kunststoffe, flammgeschützte Kunststoffzusammensetzung, Verfahren zu deren Herstellung sowie Formteile, Lacke und Beschichtungen |
| DE102016119477A1 (de) | 2016-10-12 | 2018-04-12 | Epc Engineering Consulting Gmbh | Katalysator-System |
| DE102017212772B3 (de) | 2017-07-25 | 2018-01-25 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Halogenfreie Sulfonsäureester und/oder Sulfinsäureester als Flammschutzmittel in Kunststoffen, diese enthaltende Kunststoffzusammensetzungen und deren Verwendung |
| DE102019210040A1 (de) | 2019-07-08 | 2021-01-14 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung e.V. | Verwendung von phenolisch substituierten Zuckerderivaten als Stabilisatoren, Kunststoffzusammensetzung, Verfahren zur Stabilisierung von Kunststoffen sowie phenolisch substituierte Zuckerderivate |
| DE102021205168A1 (de) | 2021-05-20 | 2022-11-24 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung eingetragener Verein | Verwendung mindestens einer Schwefel enthaltenden Aminosäure zur Stabilisierung von thermoplastischen Kunststoff-Recyclaten, stabilisiertes thermo-plastisches Kunststoffrecyclat, Stabilisatorzusammensetzung, Masterbatch sowie Formmasse bzw. Formteil |
| DE102021212696A1 (de) | 2021-11-11 | 2023-05-11 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung eingetragener Verein | Stabilisatoren auf Basis von Syringasäure, Vanillinsäure, lsovanillinsäure oder 5-Hydroxyveratrumsäure, Kunststoffzusammensetzung, Verfahren zur Stabiliserung einer Kunststoffzusammensetzung sowie Stabilisatorzusammensetzung |
| DE102022201632A1 (de) | 2022-02-16 | 2023-08-17 | Fraunhofer-Gesellschaft zur Förderung der angewandten Forschung eingetragener Verein | Polymere Stabilisatoren auf Basis von Syringasäure, Vanillinsäure, lsovanillinsäure oder 5-Hydroxyveratrumsäure, Kunststoffzusammensetzung, Verfahren zur Stabiliserung einer Kunststoffzusammensetzung sowie Stabilisatorzusammensetzung |
Family Cites Families (5)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3227681A (en) * | 1966-01-04 | Ar-loh | ||
| US3153008A (en) * | 1955-07-05 | 1964-10-13 | Gen Electric | Aromatic carbonate resins and preparation thereof |
| US3275601A (en) * | 1956-01-04 | 1966-09-27 | Bayer Ag | Manufacture of polycarbonates using tertiary amines, quaternary amines and salts thereof as catalysts |
| US3193530A (en) * | 1960-09-22 | 1965-07-06 | Allied Chem | Process for preparation of polycarbonates employing arsonium catalysts |
| US3193529A (en) * | 1960-09-22 | 1965-07-06 | Allied Chem | Process for preparation of polycarbonates employing phosphonium catalysts |
-
1965
- 1965-01-21 DE DEF45013A patent/DE1274578B/de active Pending
- 1965-01-21 DE DE19651570534 patent/DE1570534A1/de active Pending
-
1966
- 1966-01-14 GB GB1882/66A patent/GB1079822A/en not_active Expired
- 1966-01-17 FR FR46175A patent/FR1463702A/fr not_active Expired
- 1966-01-17 BE BE675190D patent/BE675190A/xx unknown
- 1966-01-20 US US521808A patent/US3442854A/en not_active Expired - Lifetime
- 1966-01-21 NL NL6600826A patent/NL6600826A/xx unknown
Non-Patent Citations (1)
| Title |
|---|
| None * |
Also Published As
| Publication number | Publication date |
|---|---|
| NL6600826A (OSRAM) | 1966-07-22 |
| FR1463702A (fr) | 1966-12-23 |
| BE675190A (OSRAM) | 1966-07-18 |
| US3442854A (en) | 1969-05-06 |
| DE1570534A1 (de) | 1970-01-29 |
| GB1079822A (en) | 1967-08-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1274578B (de) | Verfahren zur Herstellung von Cycloalkylaminverbindungen | |
| DE1795808C2 (de) | Verfahren zur Herstellung von 2,2,6,6-Tetramethyl-4-oxopiperidin | |
| DE1129153B (de) | Verfahren zur Herstellung von ª-Cyan-ª-Alkyl-ª-phenylacrylsaeureestern | |
| DE1543832A1 (de) | Verfahren zur Herstellung von alpha-Aminocarbonsaeuren | |
| DE1695594A1 (de) | In 2-Stellung substituierte delta1-Pyrrolinverbindungen und Verfahren zu ihrer Herstellung | |
| DE1212984B (de) | Verfahren zur Herstellung von basisch substituierten Cumaronen | |
| DE1947193A1 (de) | Verfahren zur Herstellung von 5-Methylen-2,4-oxazolidindionen | |
| DE2502951C3 (de) | Verfahren zur Herstellung von Orotsäure oder Thioorotsäure | |
| DE2005515C3 (de) | Verfahren zur Herstellung von γ -Cyanbutyraldinünen | |
| DE2609864C2 (de) | Verfahren zur Herstellung von 3-Amino-1,2-benzisothiazolen | |
| DE964590C (de) | Verfahren zur Herstellung von Glykocyamin | |
| DE2429746A1 (de) | Verfahren zur herstellung von triacetonamin | |
| DE3441929A1 (de) | Verfahren zur herstellung von substituierten piperidinen | |
| DE942149C (de) | Verfahren zur Herstellung substituierter Glycinamide | |
| DE1670693B2 (de) | Verfahren zur Herstellung von Chinoxalin-dl-N-oxlden | |
| DE1768276C3 (de) | Verfahren zur Herstellung von Ureidomethylphosphoniumsalzen | |
| DE1445655C3 (de) | Verfahren zur Herstellung von in 3-Stellung gamma-Aminopropylgruppen enthaltenden 3,4,5,6-Tetrahydropyridinderivaten | |
| DE2439550C3 (de) | Verfahren zur Herstellung von 1substituierten 2-Methyl-tetrahydropvrimidinen | |
| DE2658220A1 (de) | Neues verfahren zur herstellung von 1-carbamoyl-3-(3,5-dichlorphenyl)-hydantoinen | |
| DE2060846A1 (de) | Pyrimidinderivate | |
| DE1800328C (de) | Verfahren zur Herstellung von 3,5-Dihydroxy-1,2-dioxolanen | |
| DE837096C (de) | Verfahren zur Herstellung von Acetoacetylharnstoff | |
| DE1247304B (de) | Verfahren zur Herstellung von Guanidinderivaten | |
| DE1202282B (de) | Verfahren zur Herstellung von aliphatischen Diaminen | |
| DE1226589B (de) | Verfahren zur Herstellung von Imidazolidonen |