DE1214786B - Elektrischer Kondenstator und Verfahren zu seiner Herstellung - Google Patents
Elektrischer Kondenstator und Verfahren zu seiner HerstellungInfo
- Publication number
- DE1214786B DE1214786B DEST13099A DEST013099A DE1214786B DE 1214786 B DE1214786 B DE 1214786B DE ST13099 A DEST13099 A DE ST13099A DE ST013099 A DEST013099 A DE ST013099A DE 1214786 B DE1214786 B DE 1214786B
- Authority
- DE
- Germany
- Prior art keywords
- layer
- electrical
- capacitor according
- layers
- partial
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Pending
Links
- 239000003990 capacitor Substances 0.000 title claims description 58
- 238000000034 method Methods 0.000 title claims description 21
- 238000004519 manufacturing process Methods 0.000 title claims description 20
- 230000008569 process Effects 0.000 title claims description 5
- 239000010410 layer Substances 0.000 claims description 194
- 150000001875 compounds Chemical class 0.000 claims description 23
- 239000004065 semiconductor Substances 0.000 claims description 21
- QVGXLLKOCUKJST-UHFFFAOYSA-N atomic oxygen Chemical compound [O] QVGXLLKOCUKJST-UHFFFAOYSA-N 0.000 claims description 20
- 239000001301 oxygen Substances 0.000 claims description 20
- 229910052760 oxygen Inorganic materials 0.000 claims description 20
- 229910052751 metal Inorganic materials 0.000 claims description 18
- 239000002184 metal Substances 0.000 claims description 18
- 239000011248 coating agent Substances 0.000 claims description 16
- 238000000576 coating method Methods 0.000 claims description 16
- 239000000463 material Substances 0.000 claims description 14
- 229910044991 metal oxide Inorganic materials 0.000 claims description 14
- 150000004706 metal oxides Chemical class 0.000 claims description 14
- 230000003647 oxidation Effects 0.000 claims description 14
- 238000007254 oxidation reaction Methods 0.000 claims description 14
- 239000000126 substance Substances 0.000 claims description 14
- 230000004888 barrier function Effects 0.000 claims description 10
- GUVRBAGPIYLISA-UHFFFAOYSA-N tantalum atom Chemical compound [Ta] GUVRBAGPIYLISA-UHFFFAOYSA-N 0.000 claims description 10
- 230000015556 catabolic process Effects 0.000 claims description 9
- 229910052715 tantalum Inorganic materials 0.000 claims description 9
- UQSXHKLRYXJYBZ-UHFFFAOYSA-N Iron oxide Chemical compound [Fe]=O UQSXHKLRYXJYBZ-UHFFFAOYSA-N 0.000 claims description 8
- 230000009467 reduction Effects 0.000 claims description 8
- 238000010438 heat treatment Methods 0.000 claims description 7
- 239000008240 homogeneous mixture Substances 0.000 claims description 6
- 229910052752 metalloid Inorganic materials 0.000 claims description 5
- 150000002738 metalloids Chemical class 0.000 claims description 5
- 239000000203 mixture Substances 0.000 claims description 5
- XOLBLPGZBRYERU-UHFFFAOYSA-N tin dioxide Chemical compound O=[Sn]=O XOLBLPGZBRYERU-UHFFFAOYSA-N 0.000 claims description 5
- 229910001887 tin oxide Inorganic materials 0.000 claims description 5
- XLOMVQKBTHCTTD-UHFFFAOYSA-N Zinc monoxide Chemical compound [Zn]=O XLOMVQKBTHCTTD-UHFFFAOYSA-N 0.000 claims description 4
- 239000000654 additive Substances 0.000 claims description 4
- NUJOXMJBOLGQSY-UHFFFAOYSA-N manganese dioxide Chemical compound O=[Mn]=O NUJOXMJBOLGQSY-UHFFFAOYSA-N 0.000 claims description 4
- 229910052709 silver Inorganic materials 0.000 claims description 4
- 239000004332 silver Substances 0.000 claims description 4
- 238000007740 vapor deposition Methods 0.000 claims description 4
- 229910052782 aluminium Inorganic materials 0.000 claims description 3
- XAGFODPZIPBFFR-UHFFFAOYSA-N aluminium Chemical compound [Al] XAGFODPZIPBFFR-UHFFFAOYSA-N 0.000 claims description 3
- ZJRXSAYFZMGQFP-UHFFFAOYSA-N barium peroxide Chemical compound [Ba+2].[O-][O-] ZJRXSAYFZMGQFP-UHFFFAOYSA-N 0.000 claims description 3
- 239000011230 binding agent Substances 0.000 claims description 3
- 239000004020 conductor Substances 0.000 claims description 3
- 239000012084 conversion product Substances 0.000 claims description 3
- YADSGOSSYOOKMP-UHFFFAOYSA-N dioxolead Chemical compound O=[Pb]=O YADSGOSSYOOKMP-UHFFFAOYSA-N 0.000 claims description 3
- 239000007789 gas Substances 0.000 claims description 3
- 229910000464 lead oxide Inorganic materials 0.000 claims description 3
- 229910000510 noble metal Inorganic materials 0.000 claims description 3
- YEXPOXQUZXUXJW-UHFFFAOYSA-N oxolead Chemical compound [Pb]=O YEXPOXQUZXUXJW-UHFFFAOYSA-N 0.000 claims description 3
- BPUBBGLMJRNUCC-UHFFFAOYSA-N oxygen(2-);tantalum(5+) Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[Ta+5].[Ta+5] BPUBBGLMJRNUCC-UHFFFAOYSA-N 0.000 claims description 3
- 239000012286 potassium permanganate Substances 0.000 claims description 3
- 229910001936 tantalum oxide Inorganic materials 0.000 claims description 3
- 229910001128 Sn alloy Inorganic materials 0.000 claims description 2
- GWEVSGVZZGPLCZ-UHFFFAOYSA-N Titan oxide Chemical compound O=[Ti]=O GWEVSGVZZGPLCZ-UHFFFAOYSA-N 0.000 claims description 2
- XHCLAFWTIXFWPH-UHFFFAOYSA-N [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] Chemical compound [O-2].[O-2].[O-2].[O-2].[O-2].[V+5].[V+5] XHCLAFWTIXFWPH-UHFFFAOYSA-N 0.000 claims description 2
- LQBJWKCYZGMFEV-UHFFFAOYSA-N lead tin Chemical compound [Sn].[Pb] LQBJWKCYZGMFEV-UHFFFAOYSA-N 0.000 claims description 2
- 239000000758 substrate Substances 0.000 claims description 2
- OGIDPMRJRNCKJF-UHFFFAOYSA-N titanium oxide Inorganic materials [Ti]=O OGIDPMRJRNCKJF-UHFFFAOYSA-N 0.000 claims description 2
- 229910001935 vanadium oxide Inorganic materials 0.000 claims description 2
- 239000011787 zinc oxide Substances 0.000 claims description 2
- 239000011241 protective layer Substances 0.000 claims 2
- 229910045601 alloy Inorganic materials 0.000 claims 1
- 239000000956 alloy Substances 0.000 claims 1
- 239000011247 coating layer Substances 0.000 claims 1
- AXZAYXJCENRGIM-UHFFFAOYSA-J dipotassium;tetrabromoplatinum(2-) Chemical compound [K+].[K+].[Br-].[Br-].[Br-].[Br-].[Pt+2] AXZAYXJCENRGIM-UHFFFAOYSA-J 0.000 claims 1
- 229910052976 metal sulfide Inorganic materials 0.000 claims 1
- 229910001487 potassium perchlorate Inorganic materials 0.000 claims 1
- 239000000843 powder Substances 0.000 claims 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 9
- 229910002804 graphite Inorganic materials 0.000 description 9
- 239000010439 graphite Substances 0.000 description 9
- PXHVJJICTQNCMI-UHFFFAOYSA-N Nickel Chemical compound [Ni] PXHVJJICTQNCMI-UHFFFAOYSA-N 0.000 description 8
- 239000011133 lead Substances 0.000 description 5
- 229910052759 nickel Inorganic materials 0.000 description 4
- 230000035515 penetration Effects 0.000 description 4
- 230000009471 action Effects 0.000 description 3
- 230000008901 benefit Effects 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- -1 B. of lead or nickel Chemical class 0.000 description 2
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 2
- BQCADISMDOOEFD-UHFFFAOYSA-N Silver Chemical compound [Ag] BQCADISMDOOEFD-UHFFFAOYSA-N 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- 239000000919 ceramic Substances 0.000 description 2
- 230000008859 change Effects 0.000 description 2
- 238000010276 construction Methods 0.000 description 2
- 230000001419 dependent effect Effects 0.000 description 2
- 230000008020 evaporation Effects 0.000 description 2
- 238000001704 evaporation Methods 0.000 description 2
- AMWRITDGCCNYAT-UHFFFAOYSA-L hydroxy(oxo)manganese;manganese Chemical compound [Mn].O[Mn]=O.O[Mn]=O AMWRITDGCCNYAT-UHFFFAOYSA-L 0.000 description 2
- 239000011229 interlayer Substances 0.000 description 2
- VKJKEPKFPUWCAS-UHFFFAOYSA-M potassium chlorate Chemical compound [K+].[O-]Cl(=O)=O VKJKEPKFPUWCAS-UHFFFAOYSA-M 0.000 description 2
- 238000002791 soaking Methods 0.000 description 2
- 238000005507 spraying Methods 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VMQMZMRVKUZKQL-UHFFFAOYSA-N Cu+ Chemical compound [Cu+] VMQMZMRVKUZKQL-UHFFFAOYSA-N 0.000 description 1
- PWHULOQIROXLJO-UHFFFAOYSA-N Manganese Chemical compound [Mn] PWHULOQIROXLJO-UHFFFAOYSA-N 0.000 description 1
- UCKMPCXJQFINFW-UHFFFAOYSA-N Sulphide Chemical compound [S-2] UCKMPCXJQFINFW-UHFFFAOYSA-N 0.000 description 1
- OUUQCZGPVNCOIJ-UHFFFAOYSA-M Superoxide Chemical class [O-][O] OUUQCZGPVNCOIJ-UHFFFAOYSA-M 0.000 description 1
- 230000002238 attenuated effect Effects 0.000 description 1
- 239000010953 base metal Substances 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- 150000004649 carbonic acid derivatives Chemical class 0.000 description 1
- 229910010293 ceramic material Inorganic materials 0.000 description 1
- 239000002800 charge carrier Substances 0.000 description 1
- 238000006243 chemical reaction Methods 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000470 constituent Substances 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- OMZSGWSJDCOLKM-UHFFFAOYSA-N copper(II) sulfide Chemical compound [S-2].[Cu+2] OMZSGWSJDCOLKM-UHFFFAOYSA-N 0.000 description 1
- GBRBMTNGQBKBQE-UHFFFAOYSA-L copper;diiodide Chemical compound I[Cu]I GBRBMTNGQBKBQE-UHFFFAOYSA-L 0.000 description 1
- 230000007547 defect Effects 0.000 description 1
- 238000007872 degassing Methods 0.000 description 1
- 230000000694 effects Effects 0.000 description 1
- 239000012799 electrically-conductive coating Substances 0.000 description 1
- 230000005611 electricity Effects 0.000 description 1
- 238000009713 electroplating Methods 0.000 description 1
- 239000011888 foil Substances 0.000 description 1
- 239000012212 insulator Substances 0.000 description 1
- 239000011630 iodine Substances 0.000 description 1
- 229910052740 iodine Inorganic materials 0.000 description 1
- 229910052742 iron Inorganic materials 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 229910052748 manganese Inorganic materials 0.000 description 1
- 239000011572 manganese Substances 0.000 description 1
- MIVBAHRSNUNMPP-UHFFFAOYSA-N manganese(2+);dinitrate Chemical compound [Mn+2].[O-][N+]([O-])=O.[O-][N+]([O-])=O MIVBAHRSNUNMPP-UHFFFAOYSA-N 0.000 description 1
- WPBNNNQJVZRUHP-UHFFFAOYSA-L manganese(2+);methyl n-[[2-(methoxycarbonylcarbamothioylamino)phenyl]carbamothioyl]carbamate;n-[2-(sulfidocarbothioylamino)ethyl]carbamodithioate Chemical compound [Mn+2].[S-]C(=S)NCCNC([S-])=S.COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC WPBNNNQJVZRUHP-UHFFFAOYSA-L 0.000 description 1
- 238000007620 mathematical function Methods 0.000 description 1
- 230000008018 melting Effects 0.000 description 1
- 238000002844 melting Methods 0.000 description 1
- 238000001465 metallisation Methods 0.000 description 1
- 150000002823 nitrates Chemical class 0.000 description 1
- 239000011148 porous material Substances 0.000 description 1
- 239000010970 precious metal Substances 0.000 description 1
- 230000000750 progressive effect Effects 0.000 description 1
- 239000007921 spray Substances 0.000 description 1
- 238000005496 tempering Methods 0.000 description 1
- 238000005979 thermal decomposition reaction Methods 0.000 description 1
- 230000007704 transition Effects 0.000 description 1
- WFKWXMTUELFFGS-UHFFFAOYSA-N tungsten Chemical compound [W] WFKWXMTUELFFGS-UHFFFAOYSA-N 0.000 description 1
- 229910052721 tungsten Inorganic materials 0.000 description 1
- 239000010937 tungsten Substances 0.000 description 1
- 238000010792 warming Methods 0.000 description 1
Classifications
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G9/00—Electrolytic capacitors, rectifiers, detectors, switching devices, light-sensitive or temperature-sensitive devices; Processes of their manufacture
- H01G9/004—Details
- H01G9/008—Terminals
- H01G9/012—Terminals specially adapted for solid capacitors
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G9/00—Electrolytic capacitors, rectifiers, detectors, switching devices, light-sensitive or temperature-sensitive devices; Processes of their manufacture
- H01G9/004—Details
- H01G9/02—Diaphragms; Separators
-
- H—ELECTRICITY
- H01—ELECTRIC ELEMENTS
- H01G—CAPACITORS; CAPACITORS, RECTIFIERS, DETECTORS, SWITCHING DEVICES, LIGHT-SENSITIVE OR TEMPERATURE-SENSITIVE DEVICES OF THE ELECTROLYTIC TYPE
- H01G9/00—Electrolytic capacitors, rectifiers, detectors, switching devices, light-sensitive or temperature-sensitive devices; Processes of their manufacture
- H01G9/15—Solid electrolytic capacitors
-
- Y—GENERAL TAGGING OF NEW TECHNOLOGICAL DEVELOPMENTS; GENERAL TAGGING OF CROSS-SECTIONAL TECHNOLOGIES SPANNING OVER SEVERAL SECTIONS OF THE IPC; TECHNICAL SUBJECTS COVERED BY FORMER USPC CROSS-REFERENCE ART COLLECTIONS [XRACs] AND DIGESTS
- Y10—TECHNICAL SUBJECTS COVERED BY FORMER USPC
- Y10T—TECHNICAL SUBJECTS COVERED BY FORMER US CLASSIFICATION
- Y10T29/00—Metal working
- Y10T29/43—Electric condenser making
Landscapes
- Engineering & Computer Science (AREA)
- Power Engineering (AREA)
- Microelectronics & Electronic Packaging (AREA)
- Fixed Capacitors And Capacitor Manufacturing Machines (AREA)
Priority Applications (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| NL112320D NL112320C (forum.php) | 1957-10-26 | ||
| DEST13099A DE1214786B (de) | 1957-10-26 | 1957-10-26 | Elektrischer Kondenstator und Verfahren zu seiner Herstellung |
| CH6464858A CH407326A (de) | 1957-10-26 | 1958-10-03 | Elektrischer Kondensator |
| US769396A US3054029A (en) | 1957-10-26 | 1958-10-24 | Electrical condenser |
| GB34086/58A GB899637A (en) | 1957-10-26 | 1958-10-24 | Electrical condenser |
| FR777481A FR1214984A (fr) | 1957-10-26 | 1958-10-24 | Condensateur électrique |
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DEST13099A DE1214786B (de) | 1957-10-26 | 1957-10-26 | Elektrischer Kondenstator und Verfahren zu seiner Herstellung |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| DE1214786B true DE1214786B (de) | 1966-04-21 |
Family
ID=7455941
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| DEST13099A Pending DE1214786B (de) | 1957-10-26 | 1957-10-26 | Elektrischer Kondenstator und Verfahren zu seiner Herstellung |
Country Status (6)
| Country | Link |
|---|---|
| US (1) | US3054029A (forum.php) |
| CH (1) | CH407326A (forum.php) |
| DE (1) | DE1214786B (forum.php) |
| FR (1) | FR1214984A (forum.php) |
| GB (1) | GB899637A (forum.php) |
| NL (1) | NL112320C (forum.php) |
Families Citing this family (25)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US3241008A (en) * | 1966-03-15 | Formation of electrode | ||
| GB967746A (en) * | 1960-11-08 | 1964-08-26 | Nippon Electric Co | Electrolytic capacitors |
| US3214651A (en) * | 1961-10-27 | 1965-10-26 | Westinghouse Electric Corp | Semiconductor device base electrode assembly and process for producing the same |
| DE1144848B (de) * | 1961-11-22 | 1963-03-07 | Samuel Ruben | Verfahren zur Herstellung eines Elektrolytkondensators |
| US3273027A (en) * | 1962-09-19 | 1966-09-13 | Johnson Matthey & Mallory Ltd | Three-terminal electrolytic device |
| US3239436A (en) * | 1962-09-28 | 1966-03-08 | Matsushita Electric Industrial Co Ltd | Method of making titanium electrolytic capacitors |
| US3307089A (en) * | 1963-03-16 | 1967-02-28 | Matsushita Electric Industrial Co Ltd | Semiconductor device showing the effect of storing charges of single polarity |
| US3353124A (en) * | 1963-04-18 | 1967-11-14 | Globe Union Inc | Nickel oxide capacitors |
| US3320484A (en) * | 1963-11-12 | 1967-05-16 | Texas Instruments Inc | Dielectric devices |
| US3320494A (en) * | 1963-11-12 | 1967-05-16 | Texas Instruments Inc | Method and capacitor comprising oxide electrolyte derived from permanganic acid |
| GB1044444A (en) * | 1964-01-31 | 1966-09-28 | Standard Telephones Cables Ltd | Improvements relating to capacitors |
| DE1215260B (de) * | 1964-06-12 | 1966-04-28 | Bosch Gmbh Robert | Verfahren zur Herstellung von Trockenelektrolytkondensatoren |
| US3343047A (en) * | 1964-10-05 | 1967-09-19 | Mallory & Co Inc P R | Hermetically sealed solid tantalum capacitor |
| US3538394A (en) * | 1964-11-27 | 1970-11-03 | Johnson Matthey & Mallory Ltd | Multiterminal encapsulated resistance-capacitance device |
| US3345543A (en) * | 1965-03-11 | 1967-10-03 | Sato Toshio | Solid electrolytic capacitor with anodized aluminum electrode and method of making |
| US3458775A (en) * | 1966-04-20 | 1969-07-29 | Lignes Telegraph Telephon | Solid electrolytic capacitor having mixed dioxide semiconductor layer |
| US3531383A (en) * | 1966-08-05 | 1970-09-29 | Siemens Ag | Method of producing electric capacitors |
| US3502949A (en) * | 1967-04-15 | 1970-03-24 | Nippon Electric Co | Thin film solid electrolyte capacitor |
| US3473092A (en) * | 1967-07-10 | 1969-10-14 | Mallory & Co Inc P R | Electrolyte capacitor having a seeded manganese oxide dielectric layer |
| US3538395A (en) * | 1968-03-12 | 1970-11-03 | Union Carbide Corp | Solid electrolyte capacitor and method for making same |
| CA928405A (en) * | 1969-06-20 | 1973-06-12 | Yamamoto Yoshio | Solid electrolytic capacitor |
| GB1310285A (en) * | 1970-01-26 | 1973-03-14 | Kapsch Telephon Telegraph | Semi-conductive electrical elements and methods of manufacturing them |
| SU320209A1 (ru) * | 1970-04-20 | 1976-08-05 | Способ изготовлени оксидно-полупроводниковых конденсаторов | |
| US3935516A (en) * | 1973-04-14 | 1976-01-27 | International Standard Electric Corporation | Capacitor with glass metal conductive layer |
| US3956676A (en) * | 1973-11-02 | 1976-05-11 | P. R. Mallory & Co., Inc. | Electrical device having anode riser assembly with polymeric film means |
Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR760588A (fr) * | 1933-06-17 | 1934-02-26 | Ver Gluehlampen & Elec Ag | Condensateur |
| CH186945A (fr) * | 1935-04-15 | 1936-10-15 | Katzman Jacob | Condensateur électrique. |
| DE865485C (de) * | 1943-03-27 | 1953-02-02 | Bosch Gmbh Robert | Elektrischer Kondensator mit ausbrennfaehigen Belegungen |
| DE869662C (de) * | 1944-08-24 | 1953-03-05 | Lutz & Co | Keramischer Mehrschichtkondensator |
| DE898479C (de) * | 1940-07-11 | 1953-11-30 | Siemens Ag | Elektrischer Kondensator mit einem Dielektrikum aus auf einem Belegungsmetall aufgewachsenen Umsetzungsprodukten |
| DE1011081B (de) * | 1953-08-18 | 1957-06-27 | Siemens Ag | Zu einem Bauelement zusammengefasste Widerstandskondensator-Kombination |
| DE966275C (de) * | 1939-02-21 | 1957-07-18 | Siemens Ag | Elektrischer Kondensator mit einem keramischen Mehrschichtendielektrikum beliebiger Temperaturabhaengigkeit der Kapazitaet |
| DE972845C (de) * | 1949-10-29 | 1959-10-08 | Technograph Printed Circuits L | Mehrschichtfolie zur Herstellung gedruckter Schaltungen oder gedruckter Schaltelemente |
Family Cites Families (9)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US1261711A (en) * | 1917-09-05 | 1918-04-02 | Gen Electric | Protective device. |
| US1510173A (en) * | 1923-09-14 | 1924-09-30 | Siemens Ag | Manganese-peroxide anode |
| US1847653A (en) * | 1928-03-12 | 1932-03-01 | Technidyne Corp | Manufacture of resistance units |
| US1906691A (en) * | 1928-03-28 | 1933-05-02 | Lilienfeld Julius Edgar | Electrical condenser device |
| US2005279A (en) * | 1930-07-24 | 1935-06-18 | Philips Nv | Electrical condenser |
| NL46405C (forum.php) * | 1936-02-04 | 1900-01-01 | ||
| US2299228A (en) * | 1938-01-12 | 1942-10-20 | Radio Patents Corp | Electric condenser |
| US2862156A (en) * | 1954-09-14 | 1958-11-25 | Ruben Samuel | Dry capacitor |
| US2936514A (en) * | 1955-10-24 | 1960-05-17 | Sprague Electric Co | Electrolytic device |
-
0
- NL NL112320D patent/NL112320C/xx active
-
1957
- 1957-10-26 DE DEST13099A patent/DE1214786B/de active Pending
-
1958
- 1958-10-03 CH CH6464858A patent/CH407326A/de unknown
- 1958-10-24 GB GB34086/58A patent/GB899637A/en not_active Expired
- 1958-10-24 FR FR777481A patent/FR1214984A/fr not_active Expired
- 1958-10-24 US US769396A patent/US3054029A/en not_active Expired - Lifetime
Patent Citations (8)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR760588A (fr) * | 1933-06-17 | 1934-02-26 | Ver Gluehlampen & Elec Ag | Condensateur |
| CH186945A (fr) * | 1935-04-15 | 1936-10-15 | Katzman Jacob | Condensateur électrique. |
| DE966275C (de) * | 1939-02-21 | 1957-07-18 | Siemens Ag | Elektrischer Kondensator mit einem keramischen Mehrschichtendielektrikum beliebiger Temperaturabhaengigkeit der Kapazitaet |
| DE898479C (de) * | 1940-07-11 | 1953-11-30 | Siemens Ag | Elektrischer Kondensator mit einem Dielektrikum aus auf einem Belegungsmetall aufgewachsenen Umsetzungsprodukten |
| DE865485C (de) * | 1943-03-27 | 1953-02-02 | Bosch Gmbh Robert | Elektrischer Kondensator mit ausbrennfaehigen Belegungen |
| DE869662C (de) * | 1944-08-24 | 1953-03-05 | Lutz & Co | Keramischer Mehrschichtkondensator |
| DE972845C (de) * | 1949-10-29 | 1959-10-08 | Technograph Printed Circuits L | Mehrschichtfolie zur Herstellung gedruckter Schaltungen oder gedruckter Schaltelemente |
| DE1011081B (de) * | 1953-08-18 | 1957-06-27 | Siemens Ag | Zu einem Bauelement zusammengefasste Widerstandskondensator-Kombination |
Also Published As
| Publication number | Publication date |
|---|---|
| NL112320C (forum.php) | |
| CH407326A (de) | 1966-02-15 |
| GB899637A (en) | 1962-06-27 |
| US3054029A (en) | 1962-09-11 |
| FR1214984A (fr) | 1960-04-13 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| DE1214786B (de) | Elektrischer Kondenstator und Verfahren zu seiner Herstellung | |
| EP0302274B1 (de) | Elektrisches Vielschichtbauelement und Verfahren zu dessen Herstellung | |
| DE3035058C2 (de) | Drahtelektrode für das funkenerosive Schneiden sowie Verfahren zur Herstellung der Drahtelektrode | |
| EP0753868B1 (de) | Elektrolytkondensator, insbesondere Tantal-Elektrolytkondensator | |
| DE2623592C2 (de) | Festelektrolyt-Kondensator und Verfahren zu seiner Herstellung | |
| EP1430489B1 (de) | Elektrokeramisches bauelement mit mehreren kontaktflächen | |
| DE1080696B (de) | Transistor, insbesondere Unipolartransistor, mit einem ebenen Halbleiterkoerper und halbleitenden, zylindrischen Zaehnen auf dessen Oberflaeche und Verfahren zu seiner Herstellung | |
| DE2703636C3 (de) | Regenerierfähiger elektrischer Kondensator und Verfahren zu seiner Herstellung | |
| EP0302294A1 (de) | Füllschichtbauteil mit einem gesinterten, monolithischen Keramikkörper und Verfahren zu dessen Herstellung | |
| DE2227751A1 (de) | Elektrischer kondensator | |
| DE2700013A1 (de) | Regenerierfaehiger elektrischer kondensator | |
| DE1293519B (de) | Verfahren zur Herstellung von dielektrischen oder halbleitenden Oxidschichten | |
| DE10044450C1 (de) | Verfahren zur Herstellung einer Elektrode für Kondensatoren und zur Herstellung eines Kondensators | |
| DE68912365T2 (de) | Mehrschichtkondensator. | |
| DE1192720B (de) | Verfahren zur elektrischen Isolierung der Oberflaeche eines elektrischen Leiters ausAluminium | |
| DE1275221B (de) | Verfahren zur Herstellung eines einen Tunneleffekt aufweisenden elektronischen Festkoerperbauelementes | |
| DE2234618C3 (de) | Elektrolytkondensator und Verfahren zur Herstellung seiner Elektroden | |
| DE1260047B (de) | Starkstrom-Kryotron | |
| DE1097568B (de) | Verfahren zur Herstellung einer Halbleiteranordnung mit einem gleichmaessig gesinterten Koerper aus Erdalkalititanaten | |
| DE2655567C2 (de) | Einstückiger Schichtkondensator und Verfahren zu seiner Herstellung | |
| DE2631776A1 (de) | Elektrischer kondensator | |
| DE914041C (de) | Verfahren zur Herstellung von elektrisch hochwertigen, als Kondensatordielektrikum oder Isolierstoff dienenden Metalloxyden | |
| DE3881359T2 (de) | Kondensatortantaloberfläche zur Verwendung als Gegenelektrodenanordnung und Verfahren. | |
| DE1261602B (de) | Verfahren zum Herstellen von elektrischen Kondensatoren oder Gleichrichtern oder aehnlichen elektrischen Bauelementen mit einem Koerper aus keramischem Material hoher DK | |
| DE2164684C3 (de) | Ausfallsicherer Josephson-Kontakt und Verfahren zu seiner Herstellung |