CN1456054A - Methoxy methyl acrylate compounds as bactericidal agent - Google Patents
Methoxy methyl acrylate compounds as bactericidal agent Download PDFInfo
- Publication number
- CN1456054A CN1456054A CN 03120882 CN03120882A CN1456054A CN 1456054 A CN1456054 A CN 1456054A CN 03120882 CN03120882 CN 03120882 CN 03120882 A CN03120882 A CN 03120882A CN 1456054 A CN1456054 A CN 1456054A
- Authority
- CN
- China
- Prior art keywords
- compound
- composition
- powdery mildew
- mildew
- cucumber
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Granted
Links
- 150000001875 compounds Chemical class 0.000 title claims description 79
- 239000003899 bactericide agent Substances 0.000 title claims description 7
- BAPJBEWLBFYGME-UHFFFAOYSA-N acrylic acid methyl ester Natural products COC(=O)C=C BAPJBEWLBFYGME-UHFFFAOYSA-N 0.000 title 1
- 125000004184 methoxymethyl group Chemical group [H]C([H])([H])OC([H])([H])* 0.000 title 1
- 239000000203 mixture Substances 0.000 claims abstract description 56
- 239000000843 powder Substances 0.000 claims abstract description 17
- 238000000034 method Methods 0.000 claims abstract description 11
- 240000008067 Cucumis sativus Species 0.000 claims description 29
- 235000010799 Cucumis sativus var sativus Nutrition 0.000 claims description 28
- 241000221785 Erysiphales Species 0.000 claims description 27
- 241000209140 Triticum Species 0.000 claims description 19
- 241000233679 Peronosporaceae Species 0.000 claims description 18
- 235000021307 Triticum Nutrition 0.000 claims description 15
- 238000002360 preparation method Methods 0.000 claims description 13
- 201000010099 disease Diseases 0.000 claims description 11
- 208000037265 diseases, disorders, signs and symptoms Diseases 0.000 claims description 11
- 239000002904 solvent Substances 0.000 claims description 11
- 238000009736 wetting Methods 0.000 claims description 10
- 238000006243 chemical reaction Methods 0.000 claims description 9
- 239000003513 alkali Substances 0.000 claims description 8
- 230000000844 anti-bacterial effect Effects 0.000 claims description 8
- SINFYWWJOCXYFD-UHFFFAOYSA-N methoxymethyl prop-2-enoate Chemical class COCOC(=O)C=C SINFYWWJOCXYFD-UHFFFAOYSA-N 0.000 claims description 8
- 239000000417 fungicide Substances 0.000 claims description 7
- JEIPFZHSYJVQDO-UHFFFAOYSA-N iron(III) oxide Inorganic materials O=[Fe]O[Fe]=O JEIPFZHSYJVQDO-UHFFFAOYSA-N 0.000 claims description 6
- 239000000839 emulsion Substances 0.000 claims description 5
- 230000000855 fungicidal effect Effects 0.000 claims description 5
- 230000003641 microbiacidal effect Effects 0.000 claims description 5
- 229940124561 microbicide Drugs 0.000 claims description 5
- 239000002855 microbicide agent Substances 0.000 claims description 5
- 240000005979 Hordeum vulgare Species 0.000 claims description 3
- 235000007340 Hordeum vulgare Nutrition 0.000 claims description 3
- 239000004480 active ingredient Substances 0.000 claims description 3
- 239000008187 granular material Substances 0.000 claims description 3
- 239000002917 insecticide Substances 0.000 claims description 3
- 241000235349 Ascomycota Species 0.000 claims description 2
- 241000233654 Oomycetes Species 0.000 claims description 2
- 235000013399 edible fruits Nutrition 0.000 claims description 2
- 239000000126 substance Substances 0.000 claims description 2
- 239000000375 suspending agent Substances 0.000 claims description 2
- 235000013311 vegetables Nutrition 0.000 claims description 2
- 239000004009 herbicide Substances 0.000 claims 1
- 239000005648 plant growth regulator Substances 0.000 claims 1
- 239000000645 desinfectant Substances 0.000 abstract description 5
- 239000003814 drug Substances 0.000 description 46
- 238000012360 testing method Methods 0.000 description 31
- 230000003449 preventive effect Effects 0.000 description 22
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 description 16
- 239000007921 spray Substances 0.000 description 16
- 230000001225 therapeutic effect Effects 0.000 description 13
- CDBYLPFSWZWCQE-UHFFFAOYSA-L Sodium Carbonate Chemical compound [Na+].[Na+].[O-]C([O-])=O CDBYLPFSWZWCQE-UHFFFAOYSA-L 0.000 description 12
- CSCPPACGZOOCGX-UHFFFAOYSA-N Acetone Chemical group CC(C)=O CSCPPACGZOOCGX-UHFFFAOYSA-N 0.000 description 11
- 230000000857 drug effect Effects 0.000 description 11
- FFSJPOPLSWBGQY-UHFFFAOYSA-N triazol-4-one Chemical compound O=C1C=NN=N1 FFSJPOPLSWBGQY-UHFFFAOYSA-N 0.000 description 10
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 9
- ZMANZCXQSJIPKH-UHFFFAOYSA-N Triethylamine Chemical compound CCN(CC)CC ZMANZCXQSJIPKH-UHFFFAOYSA-N 0.000 description 9
- -1 methoxy-methyl acrylate compound Chemical class 0.000 description 9
- 239000003921 oil Substances 0.000 description 9
- 238000009472 formulation Methods 0.000 description 8
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 8
- 239000003795 chemical substances by application Substances 0.000 description 7
- 230000000694 effects Effects 0.000 description 7
- 229940072033 potash Drugs 0.000 description 7
- BWHMMNNQKKPAPP-UHFFFAOYSA-L potassium carbonate Substances [K+].[K+].[O-]C([O-])=O BWHMMNNQKKPAPP-UHFFFAOYSA-L 0.000 description 7
- 235000015320 potassium carbonate Nutrition 0.000 description 7
- 239000004094 surface-active agent Substances 0.000 description 7
- WURBVZBTWMNKQT-UHFFFAOYSA-N 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1,2,4-triazol-1-yl)butan-2-one Chemical compound C1=NC=NN1C(C(=O)C(C)(C)C)OC1=CC=C(Cl)C=C1 WURBVZBTWMNKQT-UHFFFAOYSA-N 0.000 description 6
- LFQSCWFLJHTTHZ-UHFFFAOYSA-N Ethanol Chemical compound CCO LFQSCWFLJHTTHZ-UHFFFAOYSA-N 0.000 description 6
- JUJWROOIHBZHMG-UHFFFAOYSA-N Pyridine Chemical compound C1=CC=NC=C1 JUJWROOIHBZHMG-UHFFFAOYSA-N 0.000 description 6
- 150000007529 inorganic bases Chemical class 0.000 description 6
- 150000007530 organic bases Chemical class 0.000 description 6
- 230000004224 protection Effects 0.000 description 6
- 229910000029 sodium carbonate Inorganic materials 0.000 description 6
- 239000007787 solid Substances 0.000 description 6
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Polymers C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 5
- 235000009854 Cucurbita moschata Nutrition 0.000 description 5
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 5
- 235000009754 Vitis X bourquina Nutrition 0.000 description 5
- 235000012333 Vitis X labruscana Nutrition 0.000 description 5
- 240000006365 Vitis vinifera Species 0.000 description 5
- 235000014787 Vitis vinifera Nutrition 0.000 description 5
- 150000002148 esters Chemical class 0.000 description 5
- 238000011081 inoculation Methods 0.000 description 5
- 229910052708 sodium Inorganic materials 0.000 description 5
- 239000011734 sodium Substances 0.000 description 5
- VTYYLEPIZMXCLO-UHFFFAOYSA-L Calcium carbonate Chemical compound [Ca+2].[O-]C([O-])=O VTYYLEPIZMXCLO-UHFFFAOYSA-L 0.000 description 4
- 241000196324 Embryophyta Species 0.000 description 4
- IAYPIBMASNFSPL-UHFFFAOYSA-N Ethylene oxide Chemical compound C1CO1 IAYPIBMASNFSPL-UHFFFAOYSA-N 0.000 description 4
- 239000005807 Metalaxyl Substances 0.000 description 4
- CTQNGGLPUBDAKN-UHFFFAOYSA-N O-Xylene Chemical compound CC1=CC=CC=C1C CTQNGGLPUBDAKN-UHFFFAOYSA-N 0.000 description 4
- ATUOYWHBWRKTHZ-UHFFFAOYSA-N Propane Chemical compound CCC ATUOYWHBWRKTHZ-UHFFFAOYSA-N 0.000 description 4
- KEAYESYHFKHZAL-UHFFFAOYSA-N Sodium Chemical compound [Na] KEAYESYHFKHZAL-UHFFFAOYSA-N 0.000 description 4
- QAOWNCQODCNURD-UHFFFAOYSA-N Sulfuric acid Chemical compound OS(O)(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-N 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 150000003851 azoles Chemical class 0.000 description 4
- 239000002585 base Substances 0.000 description 4
- 239000012141 concentrate Substances 0.000 description 4
- 239000007859 condensation product Substances 0.000 description 4
- 239000002270 dispersing agent Substances 0.000 description 4
- 238000005516 engineering process Methods 0.000 description 4
- 230000002045 lasting effect Effects 0.000 description 4
- ZQEIXNIJLIKNTD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)alaninate Chemical compound COCC(=O)N(C(C)C(=O)OC)C1=C(C)C=CC=C1C ZQEIXNIJLIKNTD-UHFFFAOYSA-N 0.000 description 4
- 230000002265 prevention Effects 0.000 description 4
- 238000012545 processing Methods 0.000 description 4
- 239000012312 sodium hydride Substances 0.000 description 4
- 229910000104 sodium hydride Inorganic materials 0.000 description 4
- 239000003381 stabilizer Substances 0.000 description 4
- QPVRKFOKCKORDP-UHFFFAOYSA-N 1,3-dimethylcyclohexa-2,4-dien-1-ol Chemical compound CC1=CC(C)(O)CC=C1 QPVRKFOKCKORDP-UHFFFAOYSA-N 0.000 description 3
- ZWEHNKRNPOVVGH-UHFFFAOYSA-N 2-Butanone Chemical compound CCC(C)=O ZWEHNKRNPOVVGH-UHFFFAOYSA-N 0.000 description 3
- 239000005995 Aluminium silicate Substances 0.000 description 3
- 241000894006 Bacteria Species 0.000 description 3
- 240000001980 Cucurbita pepo Species 0.000 description 3
- 235000009852 Cucurbita pepo Nutrition 0.000 description 3
- XEKOWRVHYACXOJ-UHFFFAOYSA-N Ethyl acetate Chemical compound CCOC(C)=O XEKOWRVHYACXOJ-UHFFFAOYSA-N 0.000 description 3
- KFZMGEQAYNKOFK-UHFFFAOYSA-N Isopropanol Chemical compound CC(C)O KFZMGEQAYNKOFK-UHFFFAOYSA-N 0.000 description 3
- 229920001732 Lignosulfonate Polymers 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- BPQQTUXANYXVAA-UHFFFAOYSA-N Orthosilicate Chemical compound [O-][Si]([O-])([O-])[O-] BPQQTUXANYXVAA-UHFFFAOYSA-N 0.000 description 3
- 239000005818 Picoxystrobin Substances 0.000 description 3
- WYURNTSHIVDZCO-UHFFFAOYSA-N Tetrahydrofuran Chemical compound C1CCOC1 WYURNTSHIVDZCO-UHFFFAOYSA-N 0.000 description 3
- YXFVVABEGXRONW-UHFFFAOYSA-N Toluene Chemical compound CC1=CC=CC=C1 YXFVVABEGXRONW-UHFFFAOYSA-N 0.000 description 3
- XSQUKJJJFZCRTK-UHFFFAOYSA-N Urea Chemical compound NC(N)=O XSQUKJJJFZCRTK-UHFFFAOYSA-N 0.000 description 3
- 230000000996 additive effect Effects 0.000 description 3
- 235000012211 aluminium silicate Nutrition 0.000 description 3
- 150000001412 amines Chemical class 0.000 description 3
- 230000000740 bleeding effect Effects 0.000 description 3
- 239000004202 carbamide Substances 0.000 description 3
- 235000008504 concentrate Nutrition 0.000 description 3
- 229940079593 drug Drugs 0.000 description 3
- 239000003995 emulsifying agent Substances 0.000 description 3
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 3
- 238000002474 experimental method Methods 0.000 description 3
- 229910052740 iodine Inorganic materials 0.000 description 3
- NLYAJNPCOHFWQQ-UHFFFAOYSA-N kaolin Chemical compound O.O.O=[Al]O[Si](=O)O[Si](=O)O[Al]=O NLYAJNPCOHFWQQ-UHFFFAOYSA-N 0.000 description 3
- IBSNKSODLGJUMQ-SDNWHVSQSA-N picoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1COC1=CC=CC(C(F)(F)F)=N1 IBSNKSODLGJUMQ-SDNWHVSQSA-N 0.000 description 3
- 230000000069 prophylactic effect Effects 0.000 description 3
- 238000010298 pulverizing process Methods 0.000 description 3
- UMJSCPRVCHMLSP-UHFFFAOYSA-N pyridine Natural products COC1=CC=CN=C1 UMJSCPRVCHMLSP-UHFFFAOYSA-N 0.000 description 3
- 238000004088 simulation Methods 0.000 description 3
- 235000020354 squash Nutrition 0.000 description 3
- 230000001954 sterilising effect Effects 0.000 description 3
- NTDQQZYCCIDJRK-UHFFFAOYSA-N 4-octylphenol Chemical compound CCCCCCCCC1=CC=C(O)C=C1 NTDQQZYCCIDJRK-UHFFFAOYSA-N 0.000 description 2
- ZCYVEMRRCGMTRW-UHFFFAOYSA-N 7553-56-2 Chemical compound [I] ZCYVEMRRCGMTRW-UHFFFAOYSA-N 0.000 description 2
- 235000000832 Ayote Nutrition 0.000 description 2
- WKBOTKDWSSQWDR-UHFFFAOYSA-N Bromine atom Chemical compound [Br] WKBOTKDWSSQWDR-UHFFFAOYSA-N 0.000 description 2
- KAKZBPTYRLMSJV-UHFFFAOYSA-N Butadiene Chemical compound C=CC=C KAKZBPTYRLMSJV-UHFFFAOYSA-N 0.000 description 2
- ZAMOUSCENKQFHK-UHFFFAOYSA-N Chlorine atom Chemical compound [Cl] ZAMOUSCENKQFHK-UHFFFAOYSA-N 0.000 description 2
- 240000004244 Cucurbita moschata Species 0.000 description 2
- 235000009804 Cucurbita pepo subsp pepo Nutrition 0.000 description 2
- 241000510928 Erysiphe necator Species 0.000 description 2
- LYCAIKOWRPUZTN-UHFFFAOYSA-N Ethylene glycol Chemical compound OCCO LYCAIKOWRPUZTN-UHFFFAOYSA-N 0.000 description 2
- 235000016623 Fragaria vesca Nutrition 0.000 description 2
- 240000009088 Fragaria x ananassa Species 0.000 description 2
- 235000011363 Fragaria x ananassa Nutrition 0.000 description 2
- NTIZESTWPVYFNL-UHFFFAOYSA-N Methyl isobutyl ketone Chemical compound CC(C)CC(C)=O NTIZESTWPVYFNL-UHFFFAOYSA-N 0.000 description 2
- UIHCLUNTQKBZGK-UHFFFAOYSA-N Methyl isobutyl ketone Natural products CCC(C)C(C)=O UIHCLUNTQKBZGK-UHFFFAOYSA-N 0.000 description 2
- YNAVUWVOSKDBBP-UHFFFAOYSA-N Morpholine Chemical compound C1COCCN1 YNAVUWVOSKDBBP-UHFFFAOYSA-N 0.000 description 2
- SMWDFEZZVXVKRB-UHFFFAOYSA-N Quinoline Chemical compound N1=CC=CC2=CC=CC=C21 SMWDFEZZVXVKRB-UHFFFAOYSA-N 0.000 description 2
- VYPSYNLAJGMNEJ-UHFFFAOYSA-N Silicium dioxide Chemical compound O=[Si]=O VYPSYNLAJGMNEJ-UHFFFAOYSA-N 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- PPBRXRYQALVLMV-UHFFFAOYSA-N Styrene Chemical compound C=CC1=CC=CC=C1 PPBRXRYQALVLMV-UHFFFAOYSA-N 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 239000000443 aerosol Substances 0.000 description 2
- FPIPGXGPPPQFEQ-OVSJKPMPSA-N all-trans-retinol Chemical compound OC\C=C(/C)\C=C\C=C(/C)\C=C\C1=C(C)CCCC1(C)C FPIPGXGPPPQFEQ-OVSJKPMPSA-N 0.000 description 2
- PNEYBMLMFCGWSK-UHFFFAOYSA-N aluminium oxide Inorganic materials [O-2].[O-2].[O-2].[Al+3].[Al+3] PNEYBMLMFCGWSK-UHFFFAOYSA-N 0.000 description 2
- 150000001408 amides Chemical class 0.000 description 2
- 239000007900 aqueous suspension Substances 0.000 description 2
- GDTBXPJZTBHREO-UHFFFAOYSA-N bromine Substances BrBr GDTBXPJZTBHREO-UHFFFAOYSA-N 0.000 description 2
- 229910052794 bromium Inorganic materials 0.000 description 2
- OSGAYBCDTDRGGQ-UHFFFAOYSA-L calcium sulfate Chemical compound [Ca+2].[O-]S([O-])(=O)=O OSGAYBCDTDRGGQ-UHFFFAOYSA-L 0.000 description 2
- 125000004432 carbon atom Chemical group C* 0.000 description 2
- 239000000460 chlorine Substances 0.000 description 2
- 229910052801 chlorine Inorganic materials 0.000 description 2
- 230000007797 corrosion Effects 0.000 description 2
- 238000005260 corrosion Methods 0.000 description 2
- JHIVVAPYMSGYDF-UHFFFAOYSA-N cyclohexanone Chemical compound O=C1CCCCC1 JHIVVAPYMSGYDF-UHFFFAOYSA-N 0.000 description 2
- 238000010790 dilution Methods 0.000 description 2
- 239000012895 dilution Substances 0.000 description 2
- WXUZAHCNPWONDH-DYTRJAOYSA-N dimoxystrobin Chemical compound CNC(=O)C(=N\OC)\C1=CC=CC=C1COC1=CC(C)=CC=C1C WXUZAHCNPWONDH-DYTRJAOYSA-N 0.000 description 2
- POLCUAVZOMRGSN-UHFFFAOYSA-N dipropyl ether Polymers CCCOCCC POLCUAVZOMRGSN-UHFFFAOYSA-N 0.000 description 2
- 229910052736 halogen Inorganic materials 0.000 description 2
- 150000002367 halogens Chemical class 0.000 description 2
- 239000003112 inhibitor Substances 0.000 description 2
- 239000011630 iodine Substances 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- TZIHFWKZFHZASV-UHFFFAOYSA-N methyl formate Chemical compound COC=O TZIHFWKZFHZASV-UHFFFAOYSA-N 0.000 description 2
- 229940043265 methyl isobutyl ketone Drugs 0.000 description 2
- 239000001294 propane Substances 0.000 description 2
- 235000015136 pumpkin Nutrition 0.000 description 2
- 159000000000 sodium salts Chemical class 0.000 description 2
- 238000004659 sterilization and disinfection Methods 0.000 description 2
- 239000004575 stone Substances 0.000 description 2
- 239000000725 suspension Substances 0.000 description 2
- VZGDMQKNWNREIO-UHFFFAOYSA-N tetrachloromethane Chemical compound ClC(Cl)(Cl)Cl VZGDMQKNWNREIO-UHFFFAOYSA-N 0.000 description 2
- CXBMCYHAMVGWJQ-CABCVRRESA-N (1,3-dioxo-4,5,6,7-tetrahydroisoindol-2-yl)methyl (1r,3r)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropane-1-carboxylate Chemical compound CC1(C)[C@H](C=C(C)C)[C@H]1C(=O)OCN1C(=O)C(CCCC2)=C2C1=O CXBMCYHAMVGWJQ-CABCVRRESA-N 0.000 description 1
- NHOWDZOIZKMVAI-UHFFFAOYSA-N (2-chlorophenyl)(4-chlorophenyl)pyrimidin-5-ylmethanol Chemical compound C=1N=CN=CC=1C(C=1C(=CC=CC=1)Cl)(O)C1=CC=C(Cl)C=C1 NHOWDZOIZKMVAI-UHFFFAOYSA-N 0.000 description 1
- LDVVMCZRFWMZSG-OLQVQODUSA-N (3ar,7as)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione Chemical compound C1C=CC[C@H]2C(=O)N(SC(Cl)(Cl)Cl)C(=O)[C@H]21 LDVVMCZRFWMZSG-OLQVQODUSA-N 0.000 description 1
- BKBSMMUEEAWFRX-NBVRZTHBSA-N (E)-flumorph Chemical compound C1=C(OC)C(OC)=CC=C1C(\C=1C=CC(F)=CC=1)=C\C(=O)N1CCOCC1 BKBSMMUEEAWFRX-NBVRZTHBSA-N 0.000 description 1
- ZFHGXWPMULPQSE-SZGBIDFHSA-N (Z)-(1S)-cis-tefluthrin Chemical compound FC1=C(F)C(C)=C(F)C(F)=C1COC(=O)[C@@H]1C(C)(C)[C@@H]1\C=C(/Cl)C(F)(F)F ZFHGXWPMULPQSE-SZGBIDFHSA-N 0.000 description 1
- QNBTYORWCCMPQP-JXAWBTAJSA-N (Z)-dimethomorph Chemical compound C1=C(OC)C(OC)=CC=C1C(\C=1C=CC(Cl)=CC=1)=C/C(=O)N1CCOCC1 QNBTYORWCCMPQP-JXAWBTAJSA-N 0.000 description 1
- CKPCAYZTYMHQEX-NBVRZTHBSA-N (e)-1-(2,4-dichlorophenyl)-n-methoxy-2-pyridin-3-ylethanimine Chemical compound C=1C=C(Cl)C=C(Cl)C=1C(=N/OC)/CC1=CC=CN=C1 CKPCAYZTYMHQEX-NBVRZTHBSA-N 0.000 description 1
- UOCLXMDMGBRAIB-UHFFFAOYSA-N 1,1,1-trichloroethane Chemical class CC(Cl)(Cl)Cl UOCLXMDMGBRAIB-UHFFFAOYSA-N 0.000 description 1
- PXMNMQRDXWABCY-UHFFFAOYSA-N 1-(4-chlorophenyl)-4,4-dimethyl-3-(1H-1,2,4-triazol-1-ylmethyl)pentan-3-ol Chemical compound C1=NC=NN1CC(O)(C(C)(C)C)CCC1=CC=C(Cl)C=C1 PXMNMQRDXWABCY-UHFFFAOYSA-N 0.000 description 1
- MGNFYQILYYYUBS-UHFFFAOYSA-N 1-[3-(4-tert-butylphenyl)-2-methylpropyl]piperidine Chemical compound C=1C=C(C(C)(C)C)C=CC=1CC(C)CN1CCCCC1 MGNFYQILYYYUBS-UHFFFAOYSA-N 0.000 description 1
- IANQTJSKSUMEQM-UHFFFAOYSA-N 1-benzofuran Chemical compound C1=CC=C2OC=CC2=C1 IANQTJSKSUMEQM-UHFFFAOYSA-N 0.000 description 1
- 238000005160 1H NMR spectroscopy Methods 0.000 description 1
- YTOPFCCWCSOHFV-UHFFFAOYSA-N 2,6-dimethyl-4-tridecylmorpholine Chemical compound CCCCCCCCCCCCCN1CC(C)OC(C)C1 YTOPFCCWCSOHFV-UHFFFAOYSA-N 0.000 description 1
- UFNOUKDBUJZYDE-UHFFFAOYSA-N 2-(4-chlorophenyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol Chemical compound C1=NC=NN1CC(O)(C=1C=CC(Cl)=CC=1)C(C)C1CC1 UFNOUKDBUJZYDE-UHFFFAOYSA-N 0.000 description 1
- 239000005660 Abamectin Substances 0.000 description 1
- XNCOSPRUTUOJCJ-UHFFFAOYSA-N Biguanide Chemical compound NC(N)=NC(N)=N XNCOSPRUTUOJCJ-UHFFFAOYSA-N 0.000 description 1
- 229940123208 Biguanide Drugs 0.000 description 1
- 239000005745 Captan Substances 0.000 description 1
- TWFZGCMQGLPBSX-UHFFFAOYSA-N Carbendazim Natural products C1=CC=C2NC(NC(=O)OC)=NC2=C1 TWFZGCMQGLPBSX-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- QPLDLSVMHZLSFG-UHFFFAOYSA-N Copper oxide Chemical compound [Cu]=O QPLDLSVMHZLSFG-UHFFFAOYSA-N 0.000 description 1
- 241000219112 Cucumis Species 0.000 description 1
- 235000015510 Cucumis melo subsp melo Nutrition 0.000 description 1
- 239000005946 Cypermethrin Substances 0.000 description 1
- 239000005757 Cyproconazole Substances 0.000 description 1
- 239000005760 Difenoconazole Substances 0.000 description 1
- 239000005761 Dimethomorph Substances 0.000 description 1
- 239000005762 Dimoxystrobin Substances 0.000 description 1
- 239000005777 Fenpropidin Substances 0.000 description 1
- 239000005781 Fludioxonil Substances 0.000 description 1
- YCKRFDGAMUMZLT-UHFFFAOYSA-N Fluorine atom Chemical compound [F] YCKRFDGAMUMZLT-UHFFFAOYSA-N 0.000 description 1
- 239000005789 Folpet Substances 0.000 description 1
- 239000005906 Imidacloprid Substances 0.000 description 1
- 239000005867 Iprodione Substances 0.000 description 1
- 239000005802 Mancozeb Substances 0.000 description 1
- 239000005805 Mepanipyrim Substances 0.000 description 1
- 239000005916 Methomyl Substances 0.000 description 1
- 239000005810 Metrafenone Substances 0.000 description 1
- 208000031888 Mycoses Diseases 0.000 description 1
- ZMXDDKWLCZADIW-UHFFFAOYSA-N N,N-Dimethylformamide Chemical class CN(C)C=O ZMXDDKWLCZADIW-UHFFFAOYSA-N 0.000 description 1
- JHXVRRJXCDAINK-UHFFFAOYSA-N NC(=O)N.N#CC#N Chemical compound NC(=O)N.N#CC#N JHXVRRJXCDAINK-UHFFFAOYSA-N 0.000 description 1
- 238000005481 NMR spectroscopy Methods 0.000 description 1
- 206010028980 Neoplasm Diseases 0.000 description 1
- 239000005814 Pencycuron Substances 0.000 description 1
- CYTYCFOTNPOANT-UHFFFAOYSA-N Perchloroethylene Chemical group ClC(Cl)=C(Cl)Cl CYTYCFOTNPOANT-UHFFFAOYSA-N 0.000 description 1
- ISWSIDIOOBJBQZ-UHFFFAOYSA-N Phenol Chemical compound OC1=CC=CC=C1 ISWSIDIOOBJBQZ-UHFFFAOYSA-N 0.000 description 1
- 239000005821 Propamocarb Substances 0.000 description 1
- 239000005822 Propiconazole Substances 0.000 description 1
- 241000415582 Puccinia striiformis f. sp. tritici Species 0.000 description 1
- 239000005869 Pyraclostrobin Substances 0.000 description 1
- 239000005663 Pyridaben Substances 0.000 description 1
- DBMJMQXJHONAFJ-UHFFFAOYSA-M Sodium laurylsulphate Chemical compound [Na+].CCCCCCCCCCCCOS([O-])(=O)=O DBMJMQXJHONAFJ-UHFFFAOYSA-M 0.000 description 1
- 229920002125 Sokalan® Polymers 0.000 description 1
- 229930006000 Sucrose Natural products 0.000 description 1
- CZMRCDWAGMRECN-UGDNZRGBSA-N Sucrose Chemical compound O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@@H]1[C@H](O)[C@@H](O)[C@H](O)[C@@H](CO)O1 CZMRCDWAGMRECN-UGDNZRGBSA-N 0.000 description 1
- QAOWNCQODCNURD-UHFFFAOYSA-L Sulfate Chemical compound [O-]S([O-])(=O)=O QAOWNCQODCNURD-UHFFFAOYSA-L 0.000 description 1
- NINIDFKCEFEMDL-UHFFFAOYSA-N Sulfur Chemical compound [S] NINIDFKCEFEMDL-UHFFFAOYSA-N 0.000 description 1
- 239000005864 Sulphur Substances 0.000 description 1
- 239000005839 Tebuconazole Substances 0.000 description 1
- 239000005939 Tefluthrin Substances 0.000 description 1
- 239000005842 Thiophanate-methyl Substances 0.000 description 1
- OKJPEAGHQZHRQV-UHFFFAOYSA-N Triiodomethane Natural products IC(I)I OKJPEAGHQZHRQV-UHFFFAOYSA-N 0.000 description 1
- FJJCIZWZNKZHII-UHFFFAOYSA-N [4,6-bis(cyanoamino)-1,3,5-triazin-2-yl]cyanamide Chemical compound N#CNC1=NC(NC#N)=NC(NC#N)=N1 FJJCIZWZNKZHII-UHFFFAOYSA-N 0.000 description 1
- WHDHEVMINMZADQ-UHFFFAOYSA-N [F].N1C=CC=C1 Chemical class [F].N1C=CC=C1 WHDHEVMINMZADQ-UHFFFAOYSA-N 0.000 description 1
- 239000003905 agrochemical Substances 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- 150000001447 alkali salts Chemical class 0.000 description 1
- 150000001336 alkenes Chemical class 0.000 description 1
- 125000002877 alkyl aryl group Chemical group 0.000 description 1
- 239000011717 all-trans-retinol Substances 0.000 description 1
- 235000019169 all-trans-retinol Nutrition 0.000 description 1
- BFNBIHQBYMNNAN-UHFFFAOYSA-N ammonium sulfate Chemical compound N.N.OS(O)(=O)=O BFNBIHQBYMNNAN-UHFFFAOYSA-N 0.000 description 1
- 229910052921 ammonium sulfate Inorganic materials 0.000 description 1
- 235000011130 ammonium sulphate Nutrition 0.000 description 1
- 150000004945 aromatic hydrocarbons Chemical class 0.000 description 1
- RRZXIRBKKLTSOM-XPNPUAGNSA-N avermectin B1a Chemical compound C1=C[C@H](C)[C@@H]([C@@H](C)CC)O[C@]11O[C@H](C\C=C(C)\[C@@H](O[C@@H]2O[C@@H](C)[C@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)C3)[C@@H](OC)C2)[C@@H](C)\C=C\C=C/2[C@]3([C@H](C(=O)O4)C=C(C)[C@@H](O)[C@H]3OC\2)O)C[C@H]4C1 RRZXIRBKKLTSOM-XPNPUAGNSA-N 0.000 description 1
- WFDXOXNFNRHQEC-GHRIWEEISA-N azoxystrobin Chemical compound CO\C=C(\C(=O)OC)C1=CC=CC=C1OC1=CC(OC=2C(=CC=CC=2)C#N)=NC=N1 WFDXOXNFNRHQEC-GHRIWEEISA-N 0.000 description 1
- 235000013871 bee wax Nutrition 0.000 description 1
- 239000012166 beeswax Substances 0.000 description 1
- RIOXQFHNBCKOKP-UHFFFAOYSA-N benomyl Chemical compound C1=CC=C2N(C(=O)NCCCC)C(NC(=O)OC)=NC2=C1 RIOXQFHNBCKOKP-UHFFFAOYSA-N 0.000 description 1
- 235000012216 bentonite Nutrition 0.000 description 1
- MITFXPHMIHQXPI-UHFFFAOYSA-N benzoxaprofen Natural products N=1C2=CC(C(C(O)=O)C)=CC=C2OC=1C1=CC=C(Cl)C=C1 MITFXPHMIHQXPI-UHFFFAOYSA-N 0.000 description 1
- 230000002902 bimodal effect Effects 0.000 description 1
- 230000015572 biosynthetic process Effects 0.000 description 1
- OIPMQULDKWSNGX-UHFFFAOYSA-N bis[[ethoxy(oxo)phosphaniumyl]oxy]alumanyloxy-ethoxy-oxophosphanium Chemical compound [Al+3].CCO[P+]([O-])=O.CCO[P+]([O-])=O.CCO[P+]([O-])=O OIPMQULDKWSNGX-UHFFFAOYSA-N 0.000 description 1
- 229910000019 calcium carbonate Inorganic materials 0.000 description 1
- 235000010216 calcium carbonate Nutrition 0.000 description 1
- 159000000007 calcium salts Chemical class 0.000 description 1
- 235000012241 calcium silicate Nutrition 0.000 description 1
- 239000001175 calcium sulphate Substances 0.000 description 1
- 235000011132 calcium sulphate Nutrition 0.000 description 1
- 229940117949 captan Drugs 0.000 description 1
- 239000006013 carbendazim Substances 0.000 description 1
- JNPZQRQPIHJYNM-UHFFFAOYSA-N carbendazim Chemical compound C1=C[CH]C2=NC(NC(=O)OC)=NC2=C1 JNPZQRQPIHJYNM-UHFFFAOYSA-N 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- JLQUFIHWVLZVTJ-UHFFFAOYSA-N carbosulfan Chemical compound CCCCN(CCCC)SN(C)C(=O)OC1=CC=CC2=C1OC(C)(C)C2 JLQUFIHWVLZVTJ-UHFFFAOYSA-N 0.000 description 1
- 239000000969 carrier Substances 0.000 description 1
- 239000004359 castor oil Substances 0.000 description 1
- 235000019438 castor oil Nutrition 0.000 description 1
- 239000003153 chemical reaction reagent Substances 0.000 description 1
- 238000004440 column chromatography Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- ARUVKPQLZAKDPS-UHFFFAOYSA-L copper(II) sulfate Chemical compound [Cu+2].[O-][S+2]([O-])([O-])[O-] ARUVKPQLZAKDPS-UHFFFAOYSA-L 0.000 description 1
- 239000006184 cosolvent Substances 0.000 description 1
- 239000012043 crude product Substances 0.000 description 1
- 229960005424 cypermethrin Drugs 0.000 description 1
- KAATUXNTWXVJKI-UHFFFAOYSA-N cypermethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OC(C#N)C1=CC=CC(OC=2C=CC=CC=2)=C1 KAATUXNTWXVJKI-UHFFFAOYSA-N 0.000 description 1
- 239000013530 defoamer Substances 0.000 description 1
- GUJOJGAPFQRJSV-UHFFFAOYSA-N dialuminum;dioxosilane;oxygen(2-);hydrate Chemical compound O.[O-2].[O-2].[O-2].[Al+3].[Al+3].O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O GUJOJGAPFQRJSV-UHFFFAOYSA-N 0.000 description 1
- FHIVAFMUCKRCQO-UHFFFAOYSA-N diazinon Chemical compound CCOP(=S)(OCC)OC1=CC(C)=NC(C(C)C)=N1 FHIVAFMUCKRCQO-UHFFFAOYSA-N 0.000 description 1
- WURGXGVFSMYFCG-UHFFFAOYSA-N dichlofluanid Chemical compound CN(C)S(=O)(=O)N(SC(F)(Cl)Cl)C1=CC=CC=C1 WURGXGVFSMYFCG-UHFFFAOYSA-N 0.000 description 1
- UOAMTSKGCBMZTC-UHFFFAOYSA-N dicofol Chemical compound C=1C=C(Cl)C=CC=1C(C(Cl)(Cl)Cl)(O)C1=CC=C(Cl)C=C1 UOAMTSKGCBMZTC-UHFFFAOYSA-N 0.000 description 1
- 235000014113 dietary fatty acids Nutrition 0.000 description 1
- BQYJATMQXGBDHF-UHFFFAOYSA-N difenoconazole Chemical compound O1C(C)COC1(C=1C(=CC(OC=2C=CC(Cl)=CC=2)=CC=1)Cl)CN1N=CN=C1 BQYJATMQXGBDHF-UHFFFAOYSA-N 0.000 description 1
- 125000000118 dimethyl group Chemical group [H]C([H])([H])* 0.000 description 1
- FPAFDBFIGPHWGO-UHFFFAOYSA-N dioxosilane;oxomagnesium;hydrate Chemical compound O.[Mg]=O.[Mg]=O.[Mg]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O.O=[Si]=O FPAFDBFIGPHWGO-UHFFFAOYSA-N 0.000 description 1
- 238000001035 drying Methods 0.000 description 1
- 239000003480 eluent Substances 0.000 description 1
- 230000007613 environmental effect Effects 0.000 description 1
- 125000001033 ether group Chemical group 0.000 description 1
- 239000000194 fatty acid Substances 0.000 description 1
- 229930195729 fatty acid Natural products 0.000 description 1
- 150000004665 fatty acids Chemical class 0.000 description 1
- 150000002191 fatty alcohols Chemical class 0.000 description 1
- ZNOLGFHPUIJIMJ-UHFFFAOYSA-N fenitrothion Chemical compound COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C(C)=C1 ZNOLGFHPUIJIMJ-UHFFFAOYSA-N 0.000 description 1
- HJUFTIJOISQSKQ-UHFFFAOYSA-N fenoxycarb Chemical compound C1=CC(OCCNC(=O)OCC)=CC=C1OC1=CC=CC=C1 HJUFTIJOISQSKQ-UHFFFAOYSA-N 0.000 description 1
- FKLFBQCQQYDUAM-UHFFFAOYSA-N fenpiclonil Chemical compound ClC1=CC=CC(C=2C(=CNC=2)C#N)=C1Cl FKLFBQCQQYDUAM-UHFFFAOYSA-N 0.000 description 1
- NYPJDWWKZLNGGM-UHFFFAOYSA-N fenvalerate Chemical compound C=1C=C(Cl)C=CC=1C(C(C)C)C(=O)OC(C#N)C(C=1)=CC=CC=1OC1=CC=CC=C1 NYPJDWWKZLNGGM-UHFFFAOYSA-N 0.000 description 1
- MUJOIMFVNIBMKC-UHFFFAOYSA-N fludioxonil Chemical compound C=12OC(F)(F)OC2=CC=CC=1C1=CNC=C1C#N MUJOIMFVNIBMKC-UHFFFAOYSA-N 0.000 description 1
- RYLHNOVXKPXDIP-UHFFFAOYSA-N flufenoxuron Chemical compound C=1C=C(NC(=O)NC(=O)C=2C(=CC=CC=2F)F)C(F)=CC=1OC1=CC=C(C(F)(F)F)C=C1Cl RYLHNOVXKPXDIP-UHFFFAOYSA-N 0.000 description 1
- 229910052731 fluorine Inorganic materials 0.000 description 1
- 239000011737 fluorine Substances 0.000 description 1
- HKIOYBQGHSTUDB-UHFFFAOYSA-N folpet Chemical compound C1=CC=C2C(=O)N(SC(Cl)(Cl)Cl)C(=O)C2=C1 HKIOYBQGHSTUDB-UHFFFAOYSA-N 0.000 description 1
- ZEMPKEQAKRGZGQ-XOQCFJPHSA-N glycerol triricinoleate Natural products CCCCCC[C@@H](O)CC=CCCCCCCCC(=O)OC[C@@H](COC(=O)CCCCCCCC=CC[C@@H](O)CCCCCC)OC(=O)CCCCCCCC=CC[C@H](O)CCCCCC ZEMPKEQAKRGZGQ-XOQCFJPHSA-N 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- WGCNASOHLSPBMP-UHFFFAOYSA-N hydroxyacetaldehyde Natural products OCC=O WGCNASOHLSPBMP-UHFFFAOYSA-N 0.000 description 1
- KGVPNLBXJKTABS-UHFFFAOYSA-N hymexazol Chemical compound CC1=CC(O)=NO1 KGVPNLBXJKTABS-UHFFFAOYSA-N 0.000 description 1
- YWTYJOPNNQFBPC-UHFFFAOYSA-N imidacloprid Chemical compound [O-][N+](=O)\N=C1/NCCN1CC1=CC=C(Cl)N=C1 YWTYJOPNNQFBPC-UHFFFAOYSA-N 0.000 description 1
- 229940056881 imidacloprid Drugs 0.000 description 1
- 208000015181 infectious disease Diseases 0.000 description 1
- 230000002401 inhibitory effect Effects 0.000 description 1
- 238000002347 injection Methods 0.000 description 1
- 239000007924 injection Substances 0.000 description 1
- 238000011835 investigation Methods 0.000 description 1
- INQOMBQAUSQDDS-UHFFFAOYSA-N iodomethane Chemical compound IC INQOMBQAUSQDDS-UHFFFAOYSA-N 0.000 description 1
- ONUFESLQCSAYKA-UHFFFAOYSA-N iprodione Chemical compound O=C1N(C(=O)NC(C)C)CC(=O)N1C1=CC(Cl)=CC(Cl)=C1 ONUFESLQCSAYKA-UHFFFAOYSA-N 0.000 description 1
- 239000003350 kerosene Substances 0.000 description 1
- 150000002576 ketones Chemical class 0.000 description 1
- 229920005610 lignin Polymers 0.000 description 1
- 238000012423 maintenance Methods 0.000 description 1
- 238000004519 manufacturing process Methods 0.000 description 1
- 239000004579 marble Substances 0.000 description 1
- 239000000463 material Substances 0.000 description 1
- CIFWZNRJIBNXRE-UHFFFAOYSA-N mepanipyrim Chemical compound CC#CC1=CC(C)=NC(NC=2C=CC=CC=2)=N1 CIFWZNRJIBNXRE-UHFFFAOYSA-N 0.000 description 1
- NNKVPIKMPCQWCG-UHFFFAOYSA-N methamidophos Chemical compound COP(N)(=O)SC NNKVPIKMPCQWCG-UHFFFAOYSA-N 0.000 description 1
- IXJOSTZEBSTPAG-UHFFFAOYSA-N methasulfocarb Chemical compound CNC(=O)SC1=CC=C(OS(C)(=O)=O)C=C1 IXJOSTZEBSTPAG-UHFFFAOYSA-N 0.000 description 1
- UHXUZOCRWCRNSJ-QPJJXVBHSA-N methomyl Chemical compound CNC(=O)O\N=C(/C)SC UHXUZOCRWCRNSJ-QPJJXVBHSA-N 0.000 description 1
- CIEXPHRYOLIQQD-UHFFFAOYSA-N methyl N-(2,6-dimethylphenyl)-N-2-furoylalaninate Chemical compound CC=1C=CC=C(C)C=1N(C(C)C(=O)OC)C(=O)C1=CC=CO1 CIEXPHRYOLIQQD-UHFFFAOYSA-N 0.000 description 1
- 230000001035 methylating effect Effects 0.000 description 1
- AMSPWOYQQAWRRM-UHFFFAOYSA-N metrafenone Chemical compound COC1=CC=C(Br)C(C)=C1C(=O)C1=C(C)C=C(OC)C(OC)=C1OC AMSPWOYQQAWRRM-UHFFFAOYSA-N 0.000 description 1
- 239000010445 mica Substances 0.000 description 1
- 229910052618 mica group Inorganic materials 0.000 description 1
- 239000002480 mineral oil Substances 0.000 description 1
- 235000010446 mineral oil Nutrition 0.000 description 1
- 238000012986 modification Methods 0.000 description 1
- 230000004048 modification Effects 0.000 description 1
- 229910052901 montmorillonite Inorganic materials 0.000 description 1
- 239000000025 natural resin Substances 0.000 description 1
- 150000002825 nitriles Chemical class 0.000 description 1
- 230000003647 oxidation Effects 0.000 description 1
- 238000007254 oxidation reaction Methods 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- RLBIQVVOMOPOHC-UHFFFAOYSA-N parathion-methyl Chemical group COP(=S)(OC)OC1=CC=C([N+]([O-])=O)C=C1 RLBIQVVOMOPOHC-UHFFFAOYSA-N 0.000 description 1
- 239000002245 particle Substances 0.000 description 1
- OGYFATSSENRIKG-UHFFFAOYSA-N pencycuron Chemical compound C1=CC(Cl)=CC=C1CN(C(=O)NC=1C=CC=CC=1)C1CCCC1 OGYFATSSENRIKG-UHFFFAOYSA-N 0.000 description 1
- WXZMFSXDPGVJKK-UHFFFAOYSA-N pentaerythritol Chemical compound OCC(CO)(CO)CO WXZMFSXDPGVJKK-UHFFFAOYSA-N 0.000 description 1
- RLLPVAHGXHCWKJ-UHFFFAOYSA-N permethrin Chemical compound CC1(C)C(C=C(Cl)Cl)C1C(=O)OCC1=CC=CC(OC=2C=CC=CC=2)=C1 RLLPVAHGXHCWKJ-UHFFFAOYSA-N 0.000 description 1
- 229960000490 permethrin Drugs 0.000 description 1
- 230000000361 pesticidal effect Effects 0.000 description 1
- 239000003209 petroleum derivative Substances 0.000 description 1
- 150000004885 piperazines Chemical class 0.000 description 1
- 239000004584 polyacrylic acid Substances 0.000 description 1
- 229920000642 polymer Polymers 0.000 description 1
- 239000004800 polyvinyl chloride Substances 0.000 description 1
- 229920000915 polyvinyl chloride Polymers 0.000 description 1
- 239000000047 product Substances 0.000 description 1
- WZZLDXDUQPOXNW-UHFFFAOYSA-N propamocarb Chemical compound CCCOC(=O)NCCCN(C)C WZZLDXDUQPOXNW-UHFFFAOYSA-N 0.000 description 1
- STJLVHWMYQXCPB-UHFFFAOYSA-N propiconazole Chemical compound O1C(CCC)COC1(C=1C(=CC(Cl)=CC=1)Cl)CN1N=CN=C1 STJLVHWMYQXCPB-UHFFFAOYSA-N 0.000 description 1
- YRRBXJLFCBCKNW-UHFFFAOYSA-N prothiocarb Chemical compound CCSC(=O)NCCCN(C)C YRRBXJLFCBCKNW-UHFFFAOYSA-N 0.000 description 1
- HZRSNVGNWUDEFX-UHFFFAOYSA-N pyraclostrobin Chemical compound COC(=O)N(OC)C1=CC=CC=C1COC1=NN(C=2C=CC(Cl)=CC=2)C=C1 HZRSNVGNWUDEFX-UHFFFAOYSA-N 0.000 description 1
- DWFZBUWUXWZWKD-UHFFFAOYSA-N pyridaben Chemical compound C1=CC(C(C)(C)C)=CC=C1CSC1=C(Cl)C(=O)N(C(C)(C)C)N=C1 DWFZBUWUXWZWKD-UHFFFAOYSA-N 0.000 description 1
- 238000011160 research Methods 0.000 description 1
- 239000011347 resin Substances 0.000 description 1
- 229920005989 resin Polymers 0.000 description 1
- MSHXTAQSSIEBQS-UHFFFAOYSA-N s-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydron;chloride Chemical compound [Cl-].NC(=O)SCC([NH+](C)C)CSC(N)=O MSHXTAQSSIEBQS-UHFFFAOYSA-N 0.000 description 1
- 150000003839 salts Chemical class 0.000 description 1
- 235000019333 sodium laurylsulphate Nutrition 0.000 description 1
- 239000001488 sodium phosphate Substances 0.000 description 1
- 229910000162 sodium phosphate Inorganic materials 0.000 description 1
- 239000002689 soil Substances 0.000 description 1
- 238000001228 spectrum Methods 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 239000005720 sucrose Substances 0.000 description 1
- SEEPANYCNGTZFQ-UHFFFAOYSA-N sulfadiazine Chemical compound C1=CC(N)=CC=C1S(=O)(=O)NC1=NC=CC=N1 SEEPANYCNGTZFQ-UHFFFAOYSA-N 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-M sulfonate Chemical compound [O-]S(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-M 0.000 description 1
- BDHFUVZGWQCTTF-UHFFFAOYSA-N sulfonic acid Chemical compound OS(=O)=O BDHFUVZGWQCTTF-UHFFFAOYSA-N 0.000 description 1
- 150000003459 sulfonic acid esters Chemical class 0.000 description 1
- 229910021653 sulphate ion Inorganic materials 0.000 description 1
- 238000013268 sustained release Methods 0.000 description 1
- 239000012730 sustained-release form Substances 0.000 description 1
- 230000002195 synergetic effect Effects 0.000 description 1
- 229920003002 synthetic resin Polymers 0.000 description 1
- 239000000057 synthetic resin Substances 0.000 description 1
- 239000000454 talc Substances 0.000 description 1
- 235000012222 talc Nutrition 0.000 description 1
- 229910052623 talc Inorganic materials 0.000 description 1
- 229960005199 tetramethrin Drugs 0.000 description 1
- QGHREAKMXXNCOA-UHFFFAOYSA-N thiophanate-methyl Chemical group COC(=O)NC(=S)NC1=CC=CC=C1NC(=S)NC(=O)OC QGHREAKMXXNCOA-UHFFFAOYSA-N 0.000 description 1
- QSOHVSNIQHGFJU-UHFFFAOYSA-L thiosultap disodium Chemical compound [Na+].[Na+].[O-]S(=O)(=O)SCC(N(C)C)CSS([O-])(=O)=O QSOHVSNIQHGFJU-UHFFFAOYSA-L 0.000 description 1
- 150000003852 triazoles Chemical class 0.000 description 1
- AMFGTOFWMRQMEM-UHFFFAOYSA-N triazophos Chemical compound N1=C(OP(=S)(OCC)OCC)N=CN1C1=CC=CC=C1 AMFGTOFWMRQMEM-UHFFFAOYSA-N 0.000 description 1
- RYFMWSXOAZQYPI-UHFFFAOYSA-K trisodium phosphate Chemical compound [Na+].[Na+].[Na+].[O-]P([O-])([O-])=O RYFMWSXOAZQYPI-UHFFFAOYSA-K 0.000 description 1
- 239000001993 wax Substances 0.000 description 1
- 239000000080 wetting agent Substances 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C69/00—Esters of carboxylic acids; Esters of carbonic or haloformic acids
- C07C69/66—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety
- C07C69/73—Esters of carboxylic acids having esterified carboxylic groups bound to acyclic carbon atoms and having any of the groups OH, O—metal, —CHO, keto, ether, acyloxy, groups, groups, or in the acid moiety of unsaturated acids
- C07C69/734—Ethers
- C07C69/736—Ethers the hydroxy group of the ester being etherified with a hydroxy compound having the hydroxy group bound to a carbon atom of a six-membered aromatic ring
-
- A—HUMAN NECESSITIES
- A01—AGRICULTURE; FORESTRY; ANIMAL HUSBANDRY; HUNTING; TRAPPING; FISHING
- A01N—PRESERVATION OF BODIES OF HUMANS OR ANIMALS OR PLANTS OR PARTS THEREOF; BIOCIDES, e.g. AS DISINFECTANTS, AS PESTICIDES OR AS HERBICIDES; PEST REPELLANTS OR ATTRACTANTS; PLANT GROWTH REGULATORS
- A01N37/00—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids
- A01N37/36—Biocides, pest repellants or attractants, or plant growth regulators containing organic compounds containing a carbon atom having three bonds to hetero atoms with at the most two bonds to halogen, e.g. carboxylic acids containing at least one carboxylic group or a thio analogue, or a derivative thereof, and a singly bound oxygen or sulfur atom attached to the same carbon skeleton, this oxygen or sulfur atom not being a member of a carboxylic group or of a thio analogue, or of a derivative thereof, e.g. hydroxy-carboxylic acids
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/31—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by introduction of functional groups containing oxygen only in singly bound form
-
- C—CHEMISTRY; METALLURGY
- C07—ORGANIC CHEMISTRY
- C07C—ACYCLIC OR CARBOCYCLIC COMPOUNDS
- C07C67/00—Preparation of carboxylic acid esters
- C07C67/30—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group
- C07C67/333—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton
- C07C67/343—Preparation of carboxylic acid esters by modifying the acid moiety of the ester, such modification not being an introduction of an ester group by isomerisation; by change of size of the carbon skeleton by increase in the number of carbon atoms
Abstract
Description
Medicament | Concentration (ppm) | Powdery mildew of cucumber | |
Preventive effect (%) | Result of treatment (%) | ||
Compound (I) | ????10 | ????100 | ????98.89 |
????5 | ????100 | ????97.53 | |
????2.5 | ????97.22 | ????88.89 | |
????1.25 | ????90.28 | ????85.71 | |
????0.625 | ????85.31 | ????64.81 | |
????0.315 | ????63.11 | ????29.63 | |
????ZA-1963 | ????10 | ????98.15 | ????86.11 |
????5 | ????88.89 | ????68.52 | |
????2.5 | ????81.75 | ????36.11 | |
????1.25 | ????75.60 | ????23.42 | |
????0.625 | ????47.63 | ????8.33 | |
????0.315 | ????41.67 | ????0.0 | |
Triazolone | ????100 | ????100 | |
????50 | ????81.25 | ||
????25 | ????45.40 |
Medicament | Concentration (ppm) | Wheat powdery mildew | |
Preventive effect (%) | Result of treatment (%) | ||
Compound (I) | ????25 | ????100 | ????100 |
????12.5 | ????100 | ????100 | |
????6.25 | ????100 | ????100 | |
????3.125 | ????100 | ????100 | |
????1.563 | ????98.33 | ????97.33 | |
????0.781 | ????87.43 | ????84.13 | |
????ZA-1963 | ????25 | ????100 | ????99.77 |
????12.5 | ????99.60 | ????98.31 | |
????6.25 | ????91.30 | ????82.95 | |
????3.125 | ????93.61 | ????73.15 | |
????1.563 | ????78.18 | ????71.97 | |
????0.781 | ????53.05 | ????38.97 | |
Triazolone | ????100 | ||
????50 | |||
????25 |
Medicament | Concentration (mg/l) | Preventive effect (%) |
Compound (I) | ????50 | ????100 |
????25 | ????100 | |
????12.5 | ????100 | |
????6.25 | ????95.60 | |
????3.125 | ????70.37 | |
????ZA-1963 | ????50 | ????93.61 |
????25 | ????83.26 | |
????12.5 | ????64.25 | |
????6.25 | ????49.57 | |
????3.125 | ????41.83 | |
Triazolone | ????100 | ????64.93 |
????50 | ????13.85 |
Medicament | Concentration mg/l | Preventive effect (%) | |||
7 days | 10 days | 15 days | 20 days |
Compound (I) | ????50 | ????100 | ????100 | ??99.6 | ??88.16 |
????25 | ????100 | ????100 | ??98.51 | ??87.23 | |
??ZA-1963 | ????50 | ????100 | ????100 | ??96.43 | ??85.21 |
????25 | ????100 | ????100 | ??96.31 | ??84.68 |
Medicament | Concentration (ppm) | Disease index | Disease refers to increase number | Preventive effect (%) |
Compound (I) | ????50 | ??17 | ????1.5 | ????91.8 |
????25 | ??22.75 | ????1 | ????96.4 | |
????12.5 | ??22.5 | ????2.5 | ????90.9 | |
????6.25 | ??23.75 | ????2 | ????92.7 | |
Triadimefon | ????200 | ??20 | ????7.25 | ????72.7 |
????CK | ??44.25 | ????27.5 | ????27.5 |
Medicament | Concentration (ppm) | Disease index | Disease refers to increase number | Preventive effect (%) |
Compound (I) | ????50 | ??21.25 | ????0.5 | ????98.6 |
????25 | ??26.75 | ????1.25 | ????96.5 | |
????12.5 | ??21.25 | ????2.75 | ????92.2 | |
????6.25 | ??24.5 | ????2.75 | ????92.2 | |
Triadimefon | ????200 | ??37.25 | ????11 | ????68.8 |
????CK | ??59.5 | ????35.25 | ????35.25 |
Medicament | Concentration (ppm) | Preventive effect (%) |
Compound (I) | 100 | 100 |
?50 | 100 | |
?25 | 100 | |
?12.5 | 97.18 | |
?6.25 | 91.55 | |
?3.125 | 77.46 | |
ZA-1963 | ?100 | 91.55 |
?50 | 60.56 | |
?25 | 46.48 | |
?12.5 | 40.84 | |
?6.25 | 26.76 | |
?3.125 | 9.86 | |
Metalaxyl | ?500 | 70.11 |
Medicament | Concentration (ppm) | Radix before the medicine | Sick index | Preventive effect (%) |
Compound (I) | ???12.5 | ????1.61 | ????4.89 | ????50.94 |
???25 | ????1.89 | ????4.33 | ????62.97 | |
???50 | ????2.00 | ????3.89 | ????68.58 | |
???100 | ????2.28 | ????3.20 | ????77.34 | |
???200 | ????2.22 | ????2.47 | ????82.05 | |
Ke Lu | ???1000 | ????1.55 | ????1.68 | ????82.49 |
??CK | ????1.89 | ????11.70 |
Medicament | Concentration (ppm) | Radix before the medicine | Sick index | Preventive effect (%) |
Compound (I) | ????12.5 | ????0.96 | ????3.89 | ????51.38 |
????25 | ????1.07 | ????3.04 | ????65.91 | |
????50 | ????1.04 | ????2.59 | ????70.01 | |
????100 | ????0.93 | ????1.84 | ????76.12 | |
????200 | ????0.89 | ????1.28 | ????82.67 | |
Ke Lu | ????1000 | ????0.93 | ????1.13 | ????85.33 |
????CK | ????0.78 | ????6.48 |
Medicament | Concentration (ppm) | Preventive effect (%) |
Compound (I) | ?500 | ?98.51 |
?250 | ?89.94 | |
?125 | ?88.02 | |
?62.5 | ?69.83 | |
?31.25 | ?68.41 | |
ZA-1963 | ?500 | ?93.20 |
?250 | ?86.38 | |
?125 | ?80.94 | |
?62.5 | ?73.86 | |
?31.25 | ?63.24 |
Claims (9)
Priority Applications (6)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CN 03120882 CN1201657C (en) | 2003-03-25 | 2003-03-25 | Methoxy methyl acrylate compounds as bactericidal agent |
PCT/CN2004/000226 WO2004084632A1 (en) | 2003-03-25 | 2004-03-19 | Fungicides containing methoxy acrylic acid methyl ester compound |
BRPI0409037-3A BRPI0409037A (en) | 2003-03-25 | 2004-03-19 | fungicides containing methoxy acrylic acid methyl ester compound |
TR2005/03847T TR200503847T1 (en) | 2003-03-25 | 2004-03-19 | Fungicides containing methoxy acrylic acid methyl ester compound. |
AU2004224838A AU2004224838A1 (en) | 2003-03-25 | 2004-03-19 | Fungicides containing methoxy acrylic acid methyl ester compound |
ZA200508026A ZA200508026B (en) | 2003-03-25 | 2005-10-04 | Fungicides containing methoxy acrylic acid methyl ester compound |
Applications Claiming Priority (1)
Application Number | Priority Date | Filing Date | Title |
---|---|---|---|
CN 03120882 CN1201657C (en) | 2003-03-25 | 2003-03-25 | Methoxy methyl acrylate compounds as bactericidal agent |
Publications (2)
Publication Number | Publication Date |
---|---|
CN1456054A true CN1456054A (en) | 2003-11-19 |
CN1201657C CN1201657C (en) | 2005-05-18 |
Family
ID=29411572
Family Applications (1)
Application Number | Title | Priority Date | Filing Date |
---|---|---|---|
CN 03120882 Expired - Lifetime CN1201657C (en) | 2003-03-25 | 2003-03-25 | Methoxy methyl acrylate compounds as bactericidal agent |
Country Status (6)
Country | Link |
---|---|
CN (1) | CN1201657C (en) |
AU (1) | AU2004224838A1 (en) |
BR (1) | BRPI0409037A (en) |
TR (1) | TR200503847T1 (en) |
WO (1) | WO2004084632A1 (en) |
ZA (1) | ZA200508026B (en) |
Cited By (155)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN100401889C (en) * | 2005-08-17 | 2008-07-16 | 浙江化工科技集团有限公司 | Composition of bactericide |
CN102115458A (en) * | 2010-11-25 | 2011-07-06 | 大连凯飞精细化工有限公司 | Synthesis method of 3-methoxy-2-aryl(methyl)acrylate compounds |
CN101524076B (en) * | 2005-08-17 | 2012-11-07 | 浙江省化工研究院有限公司 | Fungicide composition |
CN102835399A (en) * | 2012-09-27 | 2012-12-26 | 陕西上格之路生物科学有限公司 | Metrafenone-containing bactericidal composition |
CN102919240A (en) * | 2010-12-08 | 2013-02-13 | 陕西美邦农药有限公司 | Tridemorph-containing sterilizing composition |
CN101642119B (en) * | 2009-08-24 | 2013-06-05 | 陕西上格之路生物科学有限公司 | Agricultural sterilizing composition containing kresoxim-methyl benzene |
CN103598193A (en) * | 2013-10-23 | 2014-02-26 | 江苏丰登农药有限公司 | Picoxystrobin and thiram containing sterilization composition and application thereof |
CN103975927A (en) * | 2013-04-07 | 2014-08-13 | 海南正业中农高科股份有限公司 | Fungicidal composition containing cyflufenamid and pyraoxystrobin or 2-[2-(2,5-dimethyl-phenoxymethyl)-phenyl]-3-methoxy-acrylic acid methyl ester, and applications |
CN105766919A (en) * | 2016-04-22 | 2016-07-20 | 广东中迅农科股份有限公司 | Bactericidal composition containing triflumizole and (E)2-[2-(2, 5-dimethylphenoxytoluene)-phenyl]-3-methoxyacrylate |
WO2016174042A1 (en) | 2015-04-27 | 2016-11-03 | BASF Agro B.V. | Pesticidal compositions |
WO2017076757A1 (en) | 2015-11-02 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017076740A1 (en) | 2015-11-04 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017081312A1 (en) | 2015-11-13 | 2017-05-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017081310A1 (en) | 2015-11-13 | 2017-05-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017085098A1 (en) | 2015-11-19 | 2017-05-26 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017085100A1 (en) | 2015-11-19 | 2017-05-26 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
EP3202267A1 (en) | 2016-02-05 | 2017-08-09 | Basf Se | Pesticidal mixtures |
EP3205208A1 (en) | 2016-02-09 | 2017-08-16 | Basf Se | Mixtures and compositions comprising paenibacillus strains or fusaricidins and chemical pesticides |
WO2017153200A1 (en) | 2016-03-10 | 2017-09-14 | Basf Se | Fungicidal mixtures iii comprising strobilurin-type fungicides |
WO2017178245A1 (en) | 2016-04-11 | 2017-10-19 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018050421A1 (en) | 2016-09-13 | 2018-03-22 | Basf Se | Fungicidal mixtures i comprising quinoline fungicides |
WO2018054723A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018054721A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018054711A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018065182A1 (en) | 2016-10-04 | 2018-04-12 | Basf Se | Reduced quinoline compounds as antifuni agents |
WO2018073110A1 (en) | 2016-10-20 | 2018-04-26 | Basf Se | Quinoline compounds as fungicides |
EP3339297A1 (en) | 2016-12-20 | 2018-06-27 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
EP3338552A1 (en) | 2016-12-21 | 2018-06-27 | Basf Se | Use of a tetrazolinone fungicide on transgenic plants |
WO2018114393A1 (en) | 2016-12-19 | 2018-06-28 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018134127A1 (en) | 2017-01-23 | 2018-07-26 | Basf Se | Fungicidal pyridine compounds |
WO2018149754A1 (en) | 2017-02-16 | 2018-08-23 | Basf Se | Pyridine compounds |
WO2018153730A1 (en) | 2017-02-21 | 2018-08-30 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018177970A1 (en) | 2017-03-31 | 2018-10-04 | Basf Se | Process for preparing chiral 2,3-dihydrothiazolo[3,2-a]pyrimidin-4-ium compounds |
WO2018184970A1 (en) | 2017-04-07 | 2018-10-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018184882A1 (en) | 2017-04-06 | 2018-10-11 | Basf Se | Pyridine compounds |
WO2018188962A1 (en) | 2017-04-11 | 2018-10-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018193385A1 (en) | 2017-04-20 | 2018-10-25 | Pi Industries Ltd. | Novel phenylamine compounds |
WO2018202487A1 (en) | 2017-05-04 | 2018-11-08 | Basf Se | Substituted 5-(haloalkyl)-5-hydroxy-isoxazoles for combating phytopathogenic fungi |
WO2018202491A1 (en) | 2017-05-04 | 2018-11-08 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2018202428A1 (en) | 2017-05-02 | 2018-11-08 | Basf Se | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2018202737A1 (en) | 2017-05-05 | 2018-11-08 | Basf Se | Fungicidal mixtures comprising triazole compounds |
WO2018210658A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210660A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210659A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210661A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018219725A1 (en) | 2017-05-30 | 2018-12-06 | Basf Se | Pyridine and pyrazine compounds |
WO2018219797A1 (en) | 2017-06-02 | 2018-12-06 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018234139A1 (en) | 2017-06-19 | 2018-12-27 | Basf Se | 2-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aryloxy](thio)acetamides for combating phytopathogenic fungi |
WO2019002158A1 (en) | 2017-06-30 | 2019-01-03 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019025250A1 (en) | 2017-08-04 | 2019-02-07 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019038042A1 (en) | 2017-08-21 | 2019-02-28 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019042800A1 (en) | 2017-08-29 | 2019-03-07 | Basf Se | Pesticidal mixtures |
WO2019042932A1 (en) | 2017-08-31 | 2019-03-07 | Basf Se | Method of controlling rice pests in rice |
EP3453706A1 (en) | 2017-09-08 | 2019-03-13 | Basf Se | Pesticidal imidazole compounds |
WO2019052932A1 (en) | 2017-09-18 | 2019-03-21 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019057660A1 (en) | 2017-09-25 | 2019-03-28 | Basf Se | Indole and azaindole compounds with substituted 6-membered aryl and heteroaryl rings as agrochemical fungicides |
WO2019072906A1 (en) | 2017-10-13 | 2019-04-18 | Basf Se | Imidazolidine pyrimidinium compounds for combating animal pests |
WO2019101511A1 (en) | 2017-11-23 | 2019-05-31 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019115343A1 (en) | 2017-12-15 | 2019-06-20 | Basf Se | Fungicidal mixture comprising substituted pyridines |
WO2019115511A1 (en) | 2017-12-14 | 2019-06-20 | Basf Se | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2019123196A1 (en) | 2017-12-20 | 2019-06-27 | Pi Industries Ltd. | Fluoralkenyl compounds, process for preparation and use thereof |
WO2019121143A1 (en) | 2017-12-20 | 2019-06-27 | Basf Se | Substituted cyclopropyl derivatives |
WO2019137995A1 (en) | 2018-01-11 | 2019-07-18 | Basf Se | Novel pyridazine compounds for controlling invertebrate pests |
WO2019145140A1 (en) | 2018-01-09 | 2019-08-01 | Basf Se | Silylethynyl hetaryl compounds as nitrification inhibitors |
WO2019150311A1 (en) | 2018-02-02 | 2019-08-08 | Pi Industries Ltd. | 1-3 dithiol compounds and their use for the protection of crops from phytopathogenic microorganisms |
WO2019154665A1 (en) | 2018-02-07 | 2019-08-15 | Basf Se | New pyridine carboxamides |
WO2019154663A1 (en) | 2018-02-07 | 2019-08-15 | Basf Se | New pyridine carboxamides |
EP3530116A1 (en) | 2018-02-27 | 2019-08-28 | Basf Se | Fungicidal mixtures comprising xemium |
EP3530118A1 (en) | 2018-02-26 | 2019-08-28 | Basf Se | Fungicidal mixtures |
EP3533333A1 (en) | 2018-03-02 | 2019-09-04 | Basf Se | Fungicidal mixtures comprising pydiflumetofen |
EP3533331A1 (en) | 2018-03-02 | 2019-09-04 | Basf Se | Fungicidal mixtures comprising pydiflumetofen |
WO2019166252A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Fungicidal mixtures comprising fenpropidin |
WO2019166561A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of alkoxypyrazoles as nitrification inhibitors |
WO2019166558A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of pyrazole propargyl ethers as nitrification inhibitors |
WO2019166257A1 (en) | 2018-03-01 | 2019-09-06 | BASF Agro B.V. | Fungicidal compositions of mefentrifluconazole |
WO2019166560A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of n-functionalized alkoxy pyrazole compounds as nitrification inhibitors |
EP3536150A1 (en) | 2018-03-06 | 2019-09-11 | Basf Se | Fungicidal mixtures comprising fluxapyroxad |
WO2019175713A1 (en) | 2018-03-14 | 2019-09-19 | Basf Corporation | New catechol molecules and their use as inhibitors to p450 related metabolic pathways |
WO2019175712A1 (en) | 2018-03-14 | 2019-09-19 | Basf Corporation | New uses for catechol molecules as inhibitors to glutathione s-transferase metabolic pathways |
WO2019219464A1 (en) | 2018-05-15 | 2019-11-21 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019219529A1 (en) | 2018-05-15 | 2019-11-21 | Basf Se | Mixtures comprising benzpyrimoxan and oxazosulfyl and uses and methods of applying them |
WO2019224092A1 (en) | 2018-05-22 | 2019-11-28 | Basf Se | Pesticidally active c15-derivatives of ginkgolides |
WO2020002472A1 (en) | 2018-06-28 | 2020-01-02 | Basf Se | Use of alkynylthiophenes as nitrification inhibitors |
WO2020020777A1 (en) | 2018-07-23 | 2020-01-30 | Basf Se | Use of substituted 2-thiazolines as nitrification inhibitors |
WO2020020765A1 (en) | 2018-07-23 | 2020-01-30 | Basf Se | Use of a substituted thiazolidine compound as nitrification inhibitor |
WO2020035826A1 (en) | 2018-08-17 | 2020-02-20 | Pi Industries Ltd. | 1,2-dithiolone compounds and use thereof |
EP3613736A1 (en) | 2018-08-22 | 2020-02-26 | Basf Se | Substituted glutarimide derivatives |
EP3628157A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Method of controlling insecticide resistant insects and virus transmission to plants |
EP3628158A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Pesticidal mixture comprising a mesoionic compound and a biopesticide |
EP3628156A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Method for controlling pests of sugarcane, citrus, rapeseed, and potato plants |
WO2020064492A1 (en) | 2018-09-28 | 2020-04-02 | Basf Se | Method of controlling pests by seed treatment application of a mesoionic compound or mixture thereof |
EP3643705A1 (en) | 2018-10-24 | 2020-04-29 | Basf Se | Pesticidal compounds |
WO2020095161A1 (en) | 2018-11-05 | 2020-05-14 | Pi Industries Ltd. | Nitrone compounds and use thereof |
EP3670501A1 (en) | 2018-12-17 | 2020-06-24 | Basf Se | Substituted [1,2,4]triazole compounds as fungicides |
EP3696177A1 (en) | 2019-02-12 | 2020-08-19 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2020169414A1 (en) | 2019-02-20 | 2020-08-27 | Basf Se | Pesticidal mixtures comprising a pyrazole compound |
US10779536B2 (en) | 2014-11-07 | 2020-09-22 | Basf Se | Pesticidal mixtures |
EP3730489A1 (en) | 2019-04-25 | 2020-10-28 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2020239517A1 (en) | 2019-05-29 | 2020-12-03 | Basf Se | Mesoionic imidazolium compounds and derivatives for combating animal pests |
WO2020244970A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | New carbocyclic pyridine carboxamides |
WO2020244969A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | Pyridine derivatives and their use as fungicides |
WO2020244968A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | Fungicidal n-(pyrid-3-yl)carboxamides |
EP3766879A1 (en) | 2019-07-19 | 2021-01-20 | Basf Se | Pesticidal pyrazole derivatives |
EP3769623A1 (en) | 2019-07-22 | 2021-01-27 | Basf Se | Mesoionic imidazolium compounds and derivatives for combating animal pests |
US10905122B2 (en) | 2016-03-16 | 2021-02-02 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on cereals |
WO2021063736A1 (en) | 2019-10-02 | 2021-04-08 | Basf Se | Bicyclic pyridine derivatives |
WO2021063735A1 (en) | 2019-10-02 | 2021-04-08 | Basf Se | New bicyclic pyridine derivatives |
WO2021130143A1 (en) | 2019-12-23 | 2021-07-01 | Basf Se | Enzyme enhanced root uptake of agrochemical active compound |
WO2021170463A1 (en) | 2020-02-28 | 2021-09-02 | BASF Agro B.V. | Methods and uses of a mixture comprising alpha-cypermethrin and dinotefuran for controlling invertebrate pests in turf |
WO2021175669A1 (en) | 2020-03-04 | 2021-09-10 | Basf Se | Use of substituted 1,2,4-oxadiazoles for combating phytopathogenic fungi |
WO2021209360A1 (en) | 2020-04-14 | 2021-10-21 | Basf Se | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
EP3903584A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iv |
EP3903583A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iii |
EP3903581A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors i |
EP3903582A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ii |
WO2021219513A1 (en) | 2020-04-28 | 2021-11-04 | Basf Se | Pesticidal compounds |
EP3909950A1 (en) | 2020-05-13 | 2021-11-17 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2021249800A1 (en) | 2020-06-10 | 2021-12-16 | Basf Se | Substituted [1,2,4]triazole compounds as fungicides |
EP3939961A1 (en) | 2020-07-16 | 2022-01-19 | Basf Se | Strobilurin type compounds and their use for combating phytopathogenic fungi |
WO2022017836A1 (en) | 2020-07-20 | 2022-01-27 | BASF Agro B.V. | Fungicidal compositions comprising (r)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1- (1,2,4-triazol-1-yl)propan-2-ol |
EP3945089A1 (en) | 2020-07-31 | 2022-02-02 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors v |
US11241012B2 (en) | 2016-03-16 | 2022-02-08 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on soybean |
EP3970494A1 (en) | 2020-09-21 | 2022-03-23 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors viii |
WO2022064453A1 (en) | 2020-09-26 | 2022-03-31 | Pi Industries Ltd. | Nematocidal compounds and use thereof |
WO2022090069A1 (en) | 2020-11-02 | 2022-05-05 | Basf Se | Compositions comprising mefenpyr-diethyl |
WO2022090071A1 (en) | 2020-11-02 | 2022-05-05 | Basf Se | Use of mefenpyr-diethyl for controlling phytopathogenic fungi |
WO2022089969A1 (en) | 2020-10-27 | 2022-05-05 | BASF Agro B.V. | Compositions comprising mefentrifluconazole |
WO2022106304A1 (en) | 2020-11-23 | 2022-05-27 | BASF Agro B.V. | Compositions comprising mefentrifluconazole |
EP4018830A1 (en) | 2020-12-23 | 2022-06-29 | Basf Se | Pesticidal mixtures |
WO2022167488A1 (en) | 2021-02-02 | 2022-08-11 | Basf Se | Synergistic action of dcd and alkoxypyrazoles as nitrification inhibitors |
EP4043444A1 (en) | 2021-02-11 | 2022-08-17 | Basf Se | Substituted isoxazoline derivatives |
US11425909B2 (en) | 2016-03-16 | 2022-08-30 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on fruits |
WO2022238157A1 (en) | 2021-05-11 | 2022-11-17 | Basf Se | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2022243111A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted pyridines as fungicides |
WO2022243107A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted pyridines as fungicides |
WO2022243521A1 (en) | 2021-05-21 | 2022-11-24 | Basf Se | Use of ethynylpyridine compounds as nitrification inhibitors |
WO2022243523A1 (en) | 2021-05-21 | 2022-11-24 | Basf Se | Use of an n-functionalized alkoxy pyrazole compound as nitrification inhibitor |
WO2022243109A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted quinolines as fungicides |
EP4094579A1 (en) | 2021-05-28 | 2022-11-30 | Basf Se | Pesticidal mixtures comprising metyltetraprole |
WO2022268810A1 (en) | 2021-06-21 | 2022-12-29 | Basf Se | Metal-organic frameworks with pyrazole-based building blocks |
EP4119547A1 (en) | 2021-07-12 | 2023-01-18 | Basf Se | Triazole compounds for the control of invertebrate pests |
WO2023011958A1 (en) | 2021-08-02 | 2023-02-09 | Basf Se | (3-pirydyl)-quinazoline |
WO2023011957A1 (en) | 2021-08-02 | 2023-02-09 | Basf Se | (3-quinolyl)-quinazoline |
EP4140995A1 (en) | 2021-08-27 | 2023-03-01 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4140986A1 (en) | 2021-08-23 | 2023-03-01 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4151631A1 (en) | 2021-09-20 | 2023-03-22 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2023072670A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors x |
WO2023072671A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ix |
EP4194453A1 (en) | 2021-12-08 | 2023-06-14 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4198033A1 (en) | 2021-12-14 | 2023-06-21 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
EP4198023A1 (en) | 2021-12-16 | 2023-06-21 | Basf Se | Pesticidally active thiosemicarbazone compounds |
EP4238971A1 (en) | 2022-03-02 | 2023-09-06 | Basf Se | Substituted isoxazoline derivatives |
WO2023203066A1 (en) | 2022-04-21 | 2023-10-26 | Basf Se | Synergistic action as nitrification inhibitors of dcd oligomers with alkoxypyrazole and its oligomers |
WO2024028243A1 (en) | 2022-08-02 | 2024-02-08 | Basf Se | Pyrazolo pesticidal compounds |
EP4342885A1 (en) | 2022-09-20 | 2024-03-27 | Basf Se | N-(3-(aminomethyl)-phenyl)-5-(4-phenyl)-5-(trifluoromethyl)-4,5-dihydroisoxazol-3-amine derivatives and similar compounds as pesticides |
Families Citing this family (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
US8772290B2 (en) | 2010-04-21 | 2014-07-08 | Oscotech Inc. | Alpha-arylmethoxyacrylate derivative, preparation method thereof, and pharmaceutical composition containing same |
Family Cites Families (1)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
DE3545319A1 (en) * | 1985-12-20 | 1987-06-25 | Basf Ag | ACRYLIC ACID ESTERS AND FUNGICIDES THAT CONTAIN THESE COMPOUNDS |
-
2003
- 2003-03-25 CN CN 03120882 patent/CN1201657C/en not_active Expired - Lifetime
-
2004
- 2004-03-19 WO PCT/CN2004/000226 patent/WO2004084632A1/en active Application Filing
- 2004-03-19 TR TR2005/03847T patent/TR200503847T1/en unknown
- 2004-03-19 AU AU2004224838A patent/AU2004224838A1/en not_active Abandoned
- 2004-03-19 BR BRPI0409037-3A patent/BRPI0409037A/en not_active Application Discontinuation
-
2005
- 2005-10-04 ZA ZA200508026A patent/ZA200508026B/en unknown
Cited By (170)
Publication number | Priority date | Publication date | Assignee | Title |
---|---|---|---|---|
CN100401889C (en) * | 2005-08-17 | 2008-07-16 | 浙江化工科技集团有限公司 | Composition of bactericide |
CN101524076B (en) * | 2005-08-17 | 2012-11-07 | 浙江省化工研究院有限公司 | Fungicide composition |
CN101642119B (en) * | 2009-08-24 | 2013-06-05 | 陕西上格之路生物科学有限公司 | Agricultural sterilizing composition containing kresoxim-methyl benzene |
CN102115458A (en) * | 2010-11-25 | 2011-07-06 | 大连凯飞精细化工有限公司 | Synthesis method of 3-methoxy-2-aryl(methyl)acrylate compounds |
CN102115458B (en) * | 2010-11-25 | 2019-12-13 | 大连九信精细化工有限公司 | Synthetic method of 3-methoxy-2-aryl methyl acrylate compound |
CN102919240A (en) * | 2010-12-08 | 2013-02-13 | 陕西美邦农药有限公司 | Tridemorph-containing sterilizing composition |
CN102919240B (en) * | 2010-12-08 | 2014-08-13 | 陕西美邦农药有限公司 | Tridemorph-containing sterilizing composition |
CN102835399A (en) * | 2012-09-27 | 2012-12-26 | 陕西上格之路生物科学有限公司 | Metrafenone-containing bactericidal composition |
CN102835399B (en) * | 2012-09-27 | 2014-04-30 | 陕西上格之路生物科学有限公司 | Metrafenone-containing bactericidal composition |
CN103975927A (en) * | 2013-04-07 | 2014-08-13 | 海南正业中农高科股份有限公司 | Fungicidal composition containing cyflufenamid and pyraoxystrobin or 2-[2-(2,5-dimethyl-phenoxymethyl)-phenyl]-3-methoxy-acrylic acid methyl ester, and applications |
CN103975927B (en) * | 2013-04-07 | 2016-06-08 | 海南正业中农高科股份有限公司 | A kind of bactericidal composition containing cyflufenamid and pyraoxystrobin or ZJ0712 and application |
CN103598193A (en) * | 2013-10-23 | 2014-02-26 | 江苏丰登农药有限公司 | Picoxystrobin and thiram containing sterilization composition and application thereof |
US10779536B2 (en) | 2014-11-07 | 2020-09-22 | Basf Se | Pesticidal mixtures |
WO2016174042A1 (en) | 2015-04-27 | 2016-11-03 | BASF Agro B.V. | Pesticidal compositions |
WO2017076757A1 (en) | 2015-11-02 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017076740A1 (en) | 2015-11-04 | 2017-05-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017081312A1 (en) | 2015-11-13 | 2017-05-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017081310A1 (en) | 2015-11-13 | 2017-05-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017085098A1 (en) | 2015-11-19 | 2017-05-26 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2017085100A1 (en) | 2015-11-19 | 2017-05-26 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
EP3202267A1 (en) | 2016-02-05 | 2017-08-09 | Basf Se | Pesticidal mixtures |
EP3205208A1 (en) | 2016-02-09 | 2017-08-16 | Basf Se | Mixtures and compositions comprising paenibacillus strains or fusaricidins and chemical pesticides |
WO2017153200A1 (en) | 2016-03-10 | 2017-09-14 | Basf Se | Fungicidal mixtures iii comprising strobilurin-type fungicides |
US10905122B2 (en) | 2016-03-16 | 2021-02-02 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on cereals |
US11425909B2 (en) | 2016-03-16 | 2022-08-30 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on fruits |
US11241012B2 (en) | 2016-03-16 | 2022-02-08 | Basf Se | Use of tetrazolinones for combating resistant phytopathogenic fungi on soybean |
WO2017178245A1 (en) | 2016-04-11 | 2017-10-19 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
CN105766919A (en) * | 2016-04-22 | 2016-07-20 | 广东中迅农科股份有限公司 | Bactericidal composition containing triflumizole and (E)2-[2-(2, 5-dimethylphenoxytoluene)-phenyl]-3-methoxyacrylate |
WO2018050421A1 (en) | 2016-09-13 | 2018-03-22 | Basf Se | Fungicidal mixtures i comprising quinoline fungicides |
WO2018054723A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018054721A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018054711A1 (en) | 2016-09-26 | 2018-03-29 | Basf Se | Pyridine compounds for controlling phytopathogenic harmful fungi |
WO2018065182A1 (en) | 2016-10-04 | 2018-04-12 | Basf Se | Reduced quinoline compounds as antifuni agents |
WO2018073110A1 (en) | 2016-10-20 | 2018-04-26 | Basf Se | Quinoline compounds as fungicides |
WO2018114393A1 (en) | 2016-12-19 | 2018-06-28 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
EP3339297A1 (en) | 2016-12-20 | 2018-06-27 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
EP3338552A1 (en) | 2016-12-21 | 2018-06-27 | Basf Se | Use of a tetrazolinone fungicide on transgenic plants |
WO2018134127A1 (en) | 2017-01-23 | 2018-07-26 | Basf Se | Fungicidal pyridine compounds |
WO2018149754A1 (en) | 2017-02-16 | 2018-08-23 | Basf Se | Pyridine compounds |
WO2018153730A1 (en) | 2017-02-21 | 2018-08-30 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018177970A1 (en) | 2017-03-31 | 2018-10-04 | Basf Se | Process for preparing chiral 2,3-dihydrothiazolo[3,2-a]pyrimidin-4-ium compounds |
EP3978504A1 (en) | 2017-03-31 | 2022-04-06 | Basf Se | Chiral 2,3-dihydrothiazolo[3,2-a]pyrimidine derivatives for combating animal pests |
WO2018184882A1 (en) | 2017-04-06 | 2018-10-11 | Basf Se | Pyridine compounds |
WO2018184970A1 (en) | 2017-04-07 | 2018-10-11 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018188962A1 (en) | 2017-04-11 | 2018-10-18 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018193385A1 (en) | 2017-04-20 | 2018-10-25 | Pi Industries Ltd. | Novel phenylamine compounds |
US11524934B2 (en) | 2017-04-20 | 2022-12-13 | Pi Industries Ltd | Phenylamine compounds |
WO2018202428A1 (en) | 2017-05-02 | 2018-11-08 | Basf Se | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2018202491A1 (en) | 2017-05-04 | 2018-11-08 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2018202487A1 (en) | 2017-05-04 | 2018-11-08 | Basf Se | Substituted 5-(haloalkyl)-5-hydroxy-isoxazoles for combating phytopathogenic fungi |
WO2018202737A1 (en) | 2017-05-05 | 2018-11-08 | Basf Se | Fungicidal mixtures comprising triazole compounds |
WO2018210659A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210661A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210660A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018210658A1 (en) | 2017-05-15 | 2018-11-22 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2018219725A1 (en) | 2017-05-30 | 2018-12-06 | Basf Se | Pyridine and pyrazine compounds |
WO2018219797A1 (en) | 2017-06-02 | 2018-12-06 | Basf Se | Substituted oxadiazoles for combating phytopathogenic fungi |
WO2018234139A1 (en) | 2017-06-19 | 2018-12-27 | Basf Se | 2-[[5-(trifluoromethyl)-1,2,4-oxadiazol-3-yl]aryloxy](thio)acetamides for combating phytopathogenic fungi |
WO2019002158A1 (en) | 2017-06-30 | 2019-01-03 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019025250A1 (en) | 2017-08-04 | 2019-02-07 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019038042A1 (en) | 2017-08-21 | 2019-02-28 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019042800A1 (en) | 2017-08-29 | 2019-03-07 | Basf Se | Pesticidal mixtures |
EP3915379A1 (en) | 2017-08-29 | 2021-12-01 | Basf Se | Pesticidal mixtures |
WO2019042932A1 (en) | 2017-08-31 | 2019-03-07 | Basf Se | Method of controlling rice pests in rice |
WO2019043183A1 (en) | 2017-08-31 | 2019-03-07 | Basf Se | Method of controlling rice pests in rice |
EP3453706A1 (en) | 2017-09-08 | 2019-03-13 | Basf Se | Pesticidal imidazole compounds |
WO2019052932A1 (en) | 2017-09-18 | 2019-03-21 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019057660A1 (en) | 2017-09-25 | 2019-03-28 | Basf Se | Indole and azaindole compounds with substituted 6-membered aryl and heteroaryl rings as agrochemical fungicides |
WO2019072906A1 (en) | 2017-10-13 | 2019-04-18 | Basf Se | Imidazolidine pyrimidinium compounds for combating animal pests |
WO2019101511A1 (en) | 2017-11-23 | 2019-05-31 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019115511A1 (en) | 2017-12-14 | 2019-06-20 | Basf Se | Fungicidal mixture comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2019115343A1 (en) | 2017-12-15 | 2019-06-20 | Basf Se | Fungicidal mixture comprising substituted pyridines |
WO2019123196A1 (en) | 2017-12-20 | 2019-06-27 | Pi Industries Ltd. | Fluoralkenyl compounds, process for preparation and use thereof |
WO2019121143A1 (en) | 2017-12-20 | 2019-06-27 | Basf Se | Substituted cyclopropyl derivatives |
WO2019145140A1 (en) | 2018-01-09 | 2019-08-01 | Basf Se | Silylethynyl hetaryl compounds as nitrification inhibitors |
WO2019137995A1 (en) | 2018-01-11 | 2019-07-18 | Basf Se | Novel pyridazine compounds for controlling invertebrate pests |
WO2019150311A1 (en) | 2018-02-02 | 2019-08-08 | Pi Industries Ltd. | 1-3 dithiol compounds and their use for the protection of crops from phytopathogenic microorganisms |
WO2019154663A1 (en) | 2018-02-07 | 2019-08-15 | Basf Se | New pyridine carboxamides |
WO2019154665A1 (en) | 2018-02-07 | 2019-08-15 | Basf Se | New pyridine carboxamides |
EP3530118A1 (en) | 2018-02-26 | 2019-08-28 | Basf Se | Fungicidal mixtures |
EP3530116A1 (en) | 2018-02-27 | 2019-08-28 | Basf Se | Fungicidal mixtures comprising xemium |
WO2019166560A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of n-functionalized alkoxy pyrazole compounds as nitrification inhibitors |
WO2019166558A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of pyrazole propargyl ethers as nitrification inhibitors |
WO2019166561A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Use of alkoxypyrazoles as nitrification inhibitors |
WO2019166252A1 (en) | 2018-02-28 | 2019-09-06 | Basf Se | Fungicidal mixtures comprising fenpropidin |
US11917995B2 (en) | 2018-03-01 | 2024-03-05 | BASF Agro B.V. | Fungicidal compositions of mefentrifluconazole |
WO2019166257A1 (en) | 2018-03-01 | 2019-09-06 | BASF Agro B.V. | Fungicidal compositions of mefentrifluconazole |
EP3533331A1 (en) | 2018-03-02 | 2019-09-04 | Basf Se | Fungicidal mixtures comprising pydiflumetofen |
EP3533333A1 (en) | 2018-03-02 | 2019-09-04 | Basf Se | Fungicidal mixtures comprising pydiflumetofen |
EP3536150A1 (en) | 2018-03-06 | 2019-09-11 | Basf Se | Fungicidal mixtures comprising fluxapyroxad |
WO2019175713A1 (en) | 2018-03-14 | 2019-09-19 | Basf Corporation | New catechol molecules and their use as inhibitors to p450 related metabolic pathways |
WO2019175712A1 (en) | 2018-03-14 | 2019-09-19 | Basf Corporation | New uses for catechol molecules as inhibitors to glutathione s-transferase metabolic pathways |
WO2019219529A1 (en) | 2018-05-15 | 2019-11-21 | Basf Se | Mixtures comprising benzpyrimoxan and oxazosulfyl and uses and methods of applying them |
CN112423590B (en) * | 2018-05-15 | 2022-07-08 | 巴斯夫欧洲公司 | Mixtures and use comprising benzpyrimoxan and oxazosulfyl and methods for their application |
CN112423590A (en) * | 2018-05-15 | 2021-02-26 | 巴斯夫欧洲公司 | Mixtures and use comprising benzpyrimoxan and oxazosulfyl and methods for their application |
WO2019219464A1 (en) | 2018-05-15 | 2019-11-21 | Basf Se | Substituted trifluoromethyloxadiazoles for combating phytopathogenic fungi |
WO2019224092A1 (en) | 2018-05-22 | 2019-11-28 | Basf Se | Pesticidally active c15-derivatives of ginkgolides |
WO2020002472A1 (en) | 2018-06-28 | 2020-01-02 | Basf Se | Use of alkynylthiophenes as nitrification inhibitors |
WO2020020765A1 (en) | 2018-07-23 | 2020-01-30 | Basf Se | Use of a substituted thiazolidine compound as nitrification inhibitor |
WO2020020777A1 (en) | 2018-07-23 | 2020-01-30 | Basf Se | Use of substituted 2-thiazolines as nitrification inhibitors |
WO2020035826A1 (en) | 2018-08-17 | 2020-02-20 | Pi Industries Ltd. | 1,2-dithiolone compounds and use thereof |
EP3613736A1 (en) | 2018-08-22 | 2020-02-26 | Basf Se | Substituted glutarimide derivatives |
EP3628157A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Method of controlling insecticide resistant insects and virus transmission to plants |
WO2020064408A1 (en) | 2018-09-28 | 2020-04-02 | Basf Se | Method of controlling insecticide resistant insects and virus transmission to plants |
WO2020064492A1 (en) | 2018-09-28 | 2020-04-02 | Basf Se | Method of controlling pests by seed treatment application of a mesoionic compound or mixture thereof |
WO2020064480A1 (en) | 2018-09-28 | 2020-04-02 | Basf Se | Pesticidal mixture comprising a mesoionic compound and a biopesticide |
EP3628158A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Pesticidal mixture comprising a mesoionic compound and a biopesticide |
EP3628156A1 (en) | 2018-09-28 | 2020-04-01 | Basf Se | Method for controlling pests of sugarcane, citrus, rapeseed, and potato plants |
EP3643705A1 (en) | 2018-10-24 | 2020-04-29 | Basf Se | Pesticidal compounds |
WO2020083733A1 (en) | 2018-10-24 | 2020-04-30 | Basf Se | Pesticidal compounds |
WO2020095161A1 (en) | 2018-11-05 | 2020-05-14 | Pi Industries Ltd. | Nitrone compounds and use thereof |
EP3670501A1 (en) | 2018-12-17 | 2020-06-24 | Basf Se | Substituted [1,2,4]triazole compounds as fungicides |
EP3696177A1 (en) | 2019-02-12 | 2020-08-19 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2020169414A1 (en) | 2019-02-20 | 2020-08-27 | Basf Se | Pesticidal mixtures comprising a pyrazole compound |
EP3730489A1 (en) | 2019-04-25 | 2020-10-28 | Basf Se | Heteroaryl compounds as agrochemical fungicides |
WO2020239517A1 (en) | 2019-05-29 | 2020-12-03 | Basf Se | Mesoionic imidazolium compounds and derivatives for combating animal pests |
WO2020244968A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | Fungicidal n-(pyrid-3-yl)carboxamides |
WO2020244969A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | Pyridine derivatives and their use as fungicides |
WO2020244970A1 (en) | 2019-06-06 | 2020-12-10 | Basf Se | New carbocyclic pyridine carboxamides |
WO2021013561A1 (en) | 2019-07-19 | 2021-01-28 | Basf Se | Pesticidal pyrazole and triazole derivatives |
EP3766879A1 (en) | 2019-07-19 | 2021-01-20 | Basf Se | Pesticidal pyrazole derivatives |
EP3769623A1 (en) | 2019-07-22 | 2021-01-27 | Basf Se | Mesoionic imidazolium compounds and derivatives for combating animal pests |
WO2021063736A1 (en) | 2019-10-02 | 2021-04-08 | Basf Se | Bicyclic pyridine derivatives |
WO2021063735A1 (en) | 2019-10-02 | 2021-04-08 | Basf Se | New bicyclic pyridine derivatives |
WO2021130143A1 (en) | 2019-12-23 | 2021-07-01 | Basf Se | Enzyme enhanced root uptake of agrochemical active compound |
WO2021170463A1 (en) | 2020-02-28 | 2021-09-02 | BASF Agro B.V. | Methods and uses of a mixture comprising alpha-cypermethrin and dinotefuran for controlling invertebrate pests in turf |
WO2021175669A1 (en) | 2020-03-04 | 2021-09-10 | Basf Se | Use of substituted 1,2,4-oxadiazoles for combating phytopathogenic fungi |
WO2021209360A1 (en) | 2020-04-14 | 2021-10-21 | Basf Se | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
EP3903582A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ii |
WO2021219513A1 (en) | 2020-04-28 | 2021-11-04 | Basf Se | Pesticidal compounds |
EP3903581A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors i |
EP3903583A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iii |
EP3903584A1 (en) | 2020-04-28 | 2021-11-03 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors iv |
EP3909950A1 (en) | 2020-05-13 | 2021-11-17 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2021249800A1 (en) | 2020-06-10 | 2021-12-16 | Basf Se | Substituted [1,2,4]triazole compounds as fungicides |
EP3939961A1 (en) | 2020-07-16 | 2022-01-19 | Basf Se | Strobilurin type compounds and their use for combating phytopathogenic fungi |
WO2022017836A1 (en) | 2020-07-20 | 2022-01-27 | BASF Agro B.V. | Fungicidal compositions comprising (r)-2-[4-(4-chlorophenoxy)-2-(trifluoromethyl)phenyl]-1- (1,2,4-triazol-1-yl)propan-2-ol |
EP3945089A1 (en) | 2020-07-31 | 2022-02-02 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors v |
EP3970494A1 (en) | 2020-09-21 | 2022-03-23 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors viii |
WO2022064453A1 (en) | 2020-09-26 | 2022-03-31 | Pi Industries Ltd. | Nematocidal compounds and use thereof |
WO2022089969A1 (en) | 2020-10-27 | 2022-05-05 | BASF Agro B.V. | Compositions comprising mefentrifluconazole |
WO2022090069A1 (en) | 2020-11-02 | 2022-05-05 | Basf Se | Compositions comprising mefenpyr-diethyl |
WO2022090071A1 (en) | 2020-11-02 | 2022-05-05 | Basf Se | Use of mefenpyr-diethyl for controlling phytopathogenic fungi |
WO2022106304A1 (en) | 2020-11-23 | 2022-05-27 | BASF Agro B.V. | Compositions comprising mefentrifluconazole |
EP4018830A1 (en) | 2020-12-23 | 2022-06-29 | Basf Se | Pesticidal mixtures |
WO2022167488A1 (en) | 2021-02-02 | 2022-08-11 | Basf Se | Synergistic action of dcd and alkoxypyrazoles as nitrification inhibitors |
EP4043444A1 (en) | 2021-02-11 | 2022-08-17 | Basf Se | Substituted isoxazoline derivatives |
WO2022238157A1 (en) | 2021-05-11 | 2022-11-17 | Basf Se | Fungicidal mixtures comprising substituted 3-phenyl-5-(trifluoromethyl)-1,2,4-oxadiazoles |
WO2022243109A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted quinolines as fungicides |
WO2022243107A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted pyridines as fungicides |
WO2022243111A1 (en) | 2021-05-18 | 2022-11-24 | Basf Se | New substituted pyridines as fungicides |
WO2022243521A1 (en) | 2021-05-21 | 2022-11-24 | Basf Se | Use of ethynylpyridine compounds as nitrification inhibitors |
WO2022243523A1 (en) | 2021-05-21 | 2022-11-24 | Basf Se | Use of an n-functionalized alkoxy pyrazole compound as nitrification inhibitor |
EP4094579A1 (en) | 2021-05-28 | 2022-11-30 | Basf Se | Pesticidal mixtures comprising metyltetraprole |
WO2022268810A1 (en) | 2021-06-21 | 2022-12-29 | Basf Se | Metal-organic frameworks with pyrazole-based building blocks |
EP4119547A1 (en) | 2021-07-12 | 2023-01-18 | Basf Se | Triazole compounds for the control of invertebrate pests |
WO2023011958A1 (en) | 2021-08-02 | 2023-02-09 | Basf Se | (3-pirydyl)-quinazoline |
WO2023011957A1 (en) | 2021-08-02 | 2023-02-09 | Basf Se | (3-quinolyl)-quinazoline |
EP4140986A1 (en) | 2021-08-23 | 2023-03-01 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4140995A1 (en) | 2021-08-27 | 2023-03-01 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4151631A1 (en) | 2021-09-20 | 2023-03-22 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
WO2023072671A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors ix |
WO2023072670A1 (en) | 2021-10-28 | 2023-05-04 | Basf Se | Use of strobilurin type compounds for combating phytopathogenic fungi containing an amino acid substitution f129l in the mitochondrial cytochrome b protein conferring resistance to qo inhibitors x |
EP4194453A1 (en) | 2021-12-08 | 2023-06-14 | Basf Se | Pyrazine compounds for the control of invertebrate pests |
EP4198033A1 (en) | 2021-12-14 | 2023-06-21 | Basf Se | Heterocyclic compounds for the control of invertebrate pests |
EP4198023A1 (en) | 2021-12-16 | 2023-06-21 | Basf Se | Pesticidally active thiosemicarbazone compounds |
EP4238971A1 (en) | 2022-03-02 | 2023-09-06 | Basf Se | Substituted isoxazoline derivatives |
WO2023203066A1 (en) | 2022-04-21 | 2023-10-26 | Basf Se | Synergistic action as nitrification inhibitors of dcd oligomers with alkoxypyrazole and its oligomers |
WO2024028243A1 (en) | 2022-08-02 | 2024-02-08 | Basf Se | Pyrazolo pesticidal compounds |
EP4342885A1 (en) | 2022-09-20 | 2024-03-27 | Basf Se | N-(3-(aminomethyl)-phenyl)-5-(4-phenyl)-5-(trifluoromethyl)-4,5-dihydroisoxazol-3-amine derivatives and similar compounds as pesticides |
Also Published As
Publication number | Publication date |
---|---|
TR200503847T1 (en) | 2006-04-21 |
AU2004224838A1 (en) | 2004-10-07 |
BRPI0409037A (en) | 2006-03-28 |
CN1201657C (en) | 2005-05-18 |
ZA200508026B (en) | 2006-10-25 |
WO2004084632A1 (en) | 2004-10-07 |
Similar Documents
Publication | Publication Date | Title |
---|---|---|
CN1201657C (en) | Methoxy methyl acrylate compounds as bactericidal agent | |
CN1114590C (en) | Unsaturated oximino ether bactericide | |
TWI508962B (en) | Solid forms of an azocyclic amide | |
CN1214718C (en) | Microbicide | |
CN1062711C (en) | Pesticide and fungicide of unsaturated oximido ethers | |
CN1078043C (en) | Combinations of a fungicide having an azole group with an insecticide having a pyrazole, pyrrole or phenylimidazole group | |
CN1152252A (en) | Fungicidal composition and method of controlling fungus infestation | |
CN1079638C (en) | Fungicidal mixture | |
CN1066610C (en) | A plant-microbicidal composition having synergistic action, comprising at least two active ingredient components, eherein...... | |
JPS63145277A (en) | Carbamoylimidazole derivative, production thereof and use thereof as sterilizer | |
CN1623390A (en) | Application of 2-cydno-3-amino-3-phenylethyl acrylate for preventing and treating patty rice bakanae disease | |
CN1293807C (en) | Fungicidal formulation | |
DE60203534T2 (en) | NEW PHENYL-PROPARGYL ETHER DERIVATIVES | |
CN1393134A (en) | Insecticide-disinfectant composition containing zarilamid | |
CN1163143C (en) | Fungicide mixture | |
CN1810115A (en) | Flusilazole-and kresoxim methyl bactericide composition and its prepn process | |
DD206929A5 (en) | FUNGICIDAL COMPOSITION | |
CN1824648A (en) | Indene substituted oximinoether kind bactericide and insecticide | |
CN1565182A (en) | Bactericidal compositions of flumorph and enostroburin and synergist | |
CN1536962A (en) | Composition for controlling plant pathogenic bacterium and method for controlling plant pathogenic bacterium | |
CN104814035B (en) | Combination | |
TWI563917B (en) | Herbicidal composition | |
CN1331560A (en) | Fungicide mixtures which are based on derivatives of morpholine or piperidine and derivatives of oxime ether | |
CN1029930C (en) | Protectant of plant controlling fungi | |
CN1216439A (en) | Fungicide mixture |
Legal Events
Date | Code | Title | Description |
---|---|---|---|
C06 | Publication | ||
PB01 | Publication | ||
C10 | Entry into substantive examination | ||
SE01 | Entry into force of request for substantive examination | ||
C14 | Grant of patent or utility model | ||
GR01 | Patent grant | ||
C56 | Change in the name or address of the patentee |
Owner name: ZHEJIANG CHEM-TECH GROUP CO., LTD. Free format text: FORMER NAME: CHEMICAL INDUSTRY INST. OF ZHEJIANG PROV. Owner name: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY C Free format text: FORMER NAME: ZHEJIANG CHEM-TECH GROUP CO., LTD. |
|
CP01 | Change in the name or title of a patent holder |
Address after: 310023, Zhejiang, Hangzhou Province, leaving the camp door Patentee after: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY Ltd. Address before: 310023, Zhejiang, Hangzhou Province, leaving the camp door Patentee before: ZHEJIANG CHEM TECH GROUP Co.,Ltd. Address after: 310023, Zhejiang, Hangzhou Province, leaving the camp door Patentee after: ZHEJIANG CHEM TECH GROUP Co.,Ltd. Address before: 310023, Zhejiang, Hangzhou Province, leaving the camp door Patentee before: ZHEJIANG CHEMICAL INDUSTRY Research Institute |
|
ASS | Succession or assignment of patent right |
Owner name: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY, Effective date: 20121012 Owner name: SINOCHEM LANTIAN CO., LTD. Free format text: FORMER OWNER: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY, LTD. Effective date: 20121012 |
|
C41 | Transfer of patent application or patent right or utility model | ||
COR | Change of bibliographic data |
Free format text: CORRECT: ADDRESS; FROM: 310023 HANGZHOU, ZHEJIANG PROVINCE TO: 310051 HANGZHOU, ZHEJIANG PROVINCE |
|
TR01 | Transfer of patent right |
Effective date of registration: 20121012 Address after: 310051 Binjiang District Jiangnan Road, Zhejiang, No. 96, No. Patentee after: SINOCHEM LANTIAN Co.,Ltd. Patentee after: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY Ltd. Address before: 310023, Zhejiang, Hangzhou Province, leaving the camp door Patentee before: ZHEJIANG RESEARCH INSTITUTE OF CHEMICAL INDUSTRY Ltd. |
|
PE01 | Entry into force of the registration of the contract for pledge of patent right |
Denomination of invention: Methyl Methoxyacrylate compound fungicide Effective date of registration: 20211011 Granted publication date: 20050518 Pledgee: Industrial and Commercial Bank of China Limited Hangzhou Zhaohui sub branch Pledgor: SINOCHEM LANTIAN Co.,Ltd. Registration number: Y2021330001830 |
|
PE01 | Entry into force of the registration of the contract for pledge of patent right | ||
PC01 | Cancellation of the registration of the contract for pledge of patent right |
Date of cancellation: 20220507 Granted publication date: 20050518 Pledgee: Industrial and Commercial Bank of China Limited Hangzhou Zhaohui sub branch Pledgor: SINOCHEM LANTIAN Co.,Ltd. Registration number: Y2021330001830 |
|
PC01 | Cancellation of the registration of the contract for pledge of patent right | ||
CX01 | Expiry of patent term |
Granted publication date: 20050518 |
|
CX01 | Expiry of patent term |