CH623065A5 - - Google Patents
Download PDFInfo
- Publication number
- CH623065A5 CH623065A5 CH659176A CH659176A CH623065A5 CH 623065 A5 CH623065 A5 CH 623065A5 CH 659176 A CH659176 A CH 659176A CH 659176 A CH659176 A CH 659176A CH 623065 A5 CH623065 A5 CH 623065A5
- Authority
- CH
- Switzerland
- Prior art keywords
- polymerization
- tetrafluoroethylene
- diimine
- oig
- weight
- Prior art date
Links
- 238000006116 polymerization reaction Methods 0.000 claims description 25
- 238000000034 method Methods 0.000 claims description 24
- 229920000642 polymer Polymers 0.000 claims description 20
- BFKJFAAPBSQJPD-UHFFFAOYSA-N tetrafluoroethene Chemical group FC(F)=C(F)F BFKJFAAPBSQJPD-UHFFFAOYSA-N 0.000 claims description 19
- -1 precipitants Substances 0.000 claims description 16
- 230000008569 process Effects 0.000 claims description 16
- 239000006185 dispersion Substances 0.000 claims description 15
- 150000003839 salts Chemical class 0.000 claims description 11
- 150000001875 compounds Chemical class 0.000 claims description 10
- 239000000725 suspension Substances 0.000 claims description 10
- 239000003995 emulsifying agent Substances 0.000 claims description 9
- 239000003054 catalyst Substances 0.000 claims description 8
- 125000001153 fluoro group Chemical group F* 0.000 claims description 8
- 150000001336 alkenes Chemical class 0.000 claims description 7
- 239000003146 anticoagulant agent Substances 0.000 claims description 7
- 229940127219 anticoagulant drug Drugs 0.000 claims description 7
- RAABOESOVLLHRU-UHFFFAOYSA-N diazene Chemical compound N=N RAABOESOVLLHRU-UHFFFAOYSA-N 0.000 claims description 6
- 229910000071 diazene Inorganic materials 0.000 claims description 6
- 229910052731 fluorine Inorganic materials 0.000 claims description 5
- 239000011737 fluorine Substances 0.000 claims description 5
- 229910001385 heavy metal Inorganic materials 0.000 claims description 5
- 230000003647 oxidation Effects 0.000 claims description 5
- 238000007254 oxidation reaction Methods 0.000 claims description 5
- 238000007334 copolymerization reaction Methods 0.000 claims description 4
- 238000004945 emulsification Methods 0.000 claims description 4
- 229910017464 nitrogen compound Inorganic materials 0.000 claims description 4
- 150000002830 nitrogen compounds Chemical class 0.000 claims description 4
- 230000009467 reduction Effects 0.000 claims description 4
- 239000000126 substance Substances 0.000 claims description 4
- 239000004156 Azodicarbonamide Substances 0.000 claims description 3
- XOZUGNYVDXMRKW-AATRIKPKSA-N azodicarbonamide Chemical compound NC(=O)\N=N\C(N)=O XOZUGNYVDXMRKW-AATRIKPKSA-N 0.000 claims description 3
- 235000019399 azodicarbonamide Nutrition 0.000 claims description 3
- UUAGAQFQZIEFAH-UHFFFAOYSA-N chlorotrifluoroethylene Chemical group FC(F)=C(F)Cl UUAGAQFQZIEFAH-UHFFFAOYSA-N 0.000 claims description 3
- 238000004519 manufacturing process Methods 0.000 claims description 3
- 239000000203 mixture Substances 0.000 claims description 3
- 229920001577 copolymer Polymers 0.000 claims description 2
- 229920001519 homopolymer Polymers 0.000 claims description 2
- 238000011065 in-situ storage Methods 0.000 claims description 2
- USVVENVKYJZFMW-ONEGZZNKSA-N (e)-carboxyiminocarbamic acid Chemical compound OC(=O)\N=N\C(O)=O USVVENVKYJZFMW-ONEGZZNKSA-N 0.000 claims 2
- HEMHJVSKTPXQMS-UHFFFAOYSA-M Sodium hydroxide Chemical compound [OH-].[Na+] HEMHJVSKTPXQMS-UHFFFAOYSA-M 0.000 description 21
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 15
- 125000003917 carbamoyl group Chemical group [H]N([H])C(*)=O 0.000 description 13
- 238000007720 emulsion polymerization reaction Methods 0.000 description 11
- QGZKDVFQNNGYKY-UHFFFAOYSA-N ammonia Natural products N QGZKDVFQNNGYKY-UHFFFAOYSA-N 0.000 description 10
- 238000010557 suspension polymerization reaction Methods 0.000 description 10
- RTZKZFJDLAIYFH-UHFFFAOYSA-N ether Substances CCOCC RTZKZFJDLAIYFH-UHFFFAOYSA-N 0.000 description 9
- 239000002245 particle Substances 0.000 description 9
- 239000007787 solid Substances 0.000 description 8
- 239000004908 Emulsion polymer Substances 0.000 description 7
- 239000000843 powder Substances 0.000 description 7
- IJGRMHOSHXDMSA-UHFFFAOYSA-N Atomic nitrogen Chemical compound N#N IJGRMHOSHXDMSA-UHFFFAOYSA-N 0.000 description 6
- 229910000366 copper(II) sulfate Inorganic materials 0.000 description 6
- 238000001125 extrusion Methods 0.000 description 6
- 238000001035 drying Methods 0.000 description 5
- XEEYBQQBJWHFJM-UHFFFAOYSA-N Iron Chemical compound [Fe] XEEYBQQBJWHFJM-UHFFFAOYSA-N 0.000 description 4
- 230000002378 acidificating effect Effects 0.000 description 4
- 239000000654 additive Substances 0.000 description 4
- 229910000069 nitrogen hydride Inorganic materials 0.000 description 4
- 150000001447 alkali salts Chemical class 0.000 description 3
- 150000003863 ammonium salts Chemical class 0.000 description 3
- 230000015572 biosynthetic process Effects 0.000 description 3
- 125000004432 carbon atom Chemical group C* 0.000 description 3
- KXDHJXZQYSOELW-UHFFFAOYSA-N carbonic acid monoamide Natural products NC(O)=O KXDHJXZQYSOELW-UHFFFAOYSA-N 0.000 description 3
- 229910052757 nitrogen Inorganic materials 0.000 description 3
- 229920001343 polytetrafluoroethylene Polymers 0.000 description 3
- 239000004810 polytetrafluoroethylene Substances 0.000 description 3
- 238000005245 sintering Methods 0.000 description 3
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonia chloride Chemical compound [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 description 2
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 2
- VYZAMTAEIAYCRO-UHFFFAOYSA-N Chromium Chemical compound [Cr] VYZAMTAEIAYCRO-UHFFFAOYSA-N 0.000 description 2
- 229910006069 SO3H Inorganic materials 0.000 description 2
- 239000002253 acid Substances 0.000 description 2
- 230000009471 action Effects 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 125000003178 carboxy group Chemical group [H]OC(*)=O 0.000 description 2
- 229910052804 chromium Inorganic materials 0.000 description 2
- 239000011651 chromium Substances 0.000 description 2
- 238000005345 coagulation Methods 0.000 description 2
- 230000015271 coagulation Effects 0.000 description 2
- 239000011248 coating agent Substances 0.000 description 2
- 238000011010 flushing procedure Methods 0.000 description 2
- 239000011888 foil Substances 0.000 description 2
- 150000002334 glycols Chemical class 0.000 description 2
- 238000000227 grinding Methods 0.000 description 2
- 125000004435 hydrogen atom Chemical group [H]* 0.000 description 2
- 238000005470 impregnation Methods 0.000 description 2
- 229910052742 iron Inorganic materials 0.000 description 2
- 239000007788 liquid Substances 0.000 description 2
- 230000001590 oxidative effect Effects 0.000 description 2
- JRKICGRDRMAZLK-UHFFFAOYSA-L persulfate group Chemical group S(=O)(=O)([O-])OOS(=O)(=O)[O-] JRKICGRDRMAZLK-UHFFFAOYSA-L 0.000 description 2
- 229920000151 polyglycol Polymers 0.000 description 2
- 239000010695 polyglycol Substances 0.000 description 2
- 239000011148 porous material Substances 0.000 description 2
- 229910052700 potassium Inorganic materials 0.000 description 2
- 229910052708 sodium Inorganic materials 0.000 description 2
- 238000003756 stirring Methods 0.000 description 2
- GETQZCLCWQTVFV-UHFFFAOYSA-N trimethylamine Chemical compound CN(C)C GETQZCLCWQTVFV-UHFFFAOYSA-N 0.000 description 2
- BQCIDUSAKPWEOX-UHFFFAOYSA-N 1,1-Difluoroethene Chemical compound FC(F)=C BQCIDUSAKPWEOX-UHFFFAOYSA-N 0.000 description 1
- QVHWOZCZUNPZPW-UHFFFAOYSA-N 1,2,3,3,4,4-hexafluorocyclobutene Chemical compound FC1=C(F)C(F)(F)C1(F)F QVHWOZCZUNPZPW-UHFFFAOYSA-N 0.000 description 1
- VZVKWLCVKPJHRK-UHFFFAOYSA-N 1-pent-1-enoxypent-1-ene Chemical compound CCCC=COC=CCCC VZVKWLCVKPJHRK-UHFFFAOYSA-N 0.000 description 1
- LCZVSXRMYJUNFX-UHFFFAOYSA-N 2-[2-(2-hydroxypropoxy)propoxy]propan-1-ol Chemical compound CC(O)COC(C)COC(C)CO LCZVSXRMYJUNFX-UHFFFAOYSA-N 0.000 description 1
- QGZKDVFQNNGYKY-UHFFFAOYSA-O Ammonium Chemical compound [NH4+] QGZKDVFQNNGYKY-UHFFFAOYSA-O 0.000 description 1
- ATRRKUHOCOJYRX-UHFFFAOYSA-N Ammonium bicarbonate Chemical compound [NH4+].OC([O-])=O ATRRKUHOCOJYRX-UHFFFAOYSA-N 0.000 description 1
- LSNNMFCWUKXFEE-UHFFFAOYSA-M Bisulfite Chemical compound OS([O-])=O LSNNMFCWUKXFEE-UHFFFAOYSA-M 0.000 description 1
- QDHHCQZDFGDHMP-UHFFFAOYSA-N Chloramine Chemical compound ClN QDHHCQZDFGDHMP-UHFFFAOYSA-N 0.000 description 1
- RYGMFSIKBFXOCR-UHFFFAOYSA-N Copper Chemical compound [Cu] RYGMFSIKBFXOCR-UHFFFAOYSA-N 0.000 description 1
- VGGSQFUCUMXWEO-UHFFFAOYSA-N Ethene Chemical compound C=C VGGSQFUCUMXWEO-UHFFFAOYSA-N 0.000 description 1
- 239000005977 Ethylene Substances 0.000 description 1
- 241000530268 Lycaena heteronea Species 0.000 description 1
- 229910019142 PO4 Inorganic materials 0.000 description 1
- GOOHAUXETOMSMM-UHFFFAOYSA-N Propylene oxide Chemical compound CC1CO1 GOOHAUXETOMSMM-UHFFFAOYSA-N 0.000 description 1
- 150000007513 acids Chemical class 0.000 description 1
- 229910052783 alkali metal Inorganic materials 0.000 description 1
- 150000001340 alkali metals Chemical class 0.000 description 1
- DQPBABKTKYNPMH-UHFFFAOYSA-N amino hydrogen sulfate Chemical compound NOS(O)(=O)=O DQPBABKTKYNPMH-UHFFFAOYSA-N 0.000 description 1
- 239000001099 ammonium carbonate Substances 0.000 description 1
- 235000012501 ammonium carbonate Nutrition 0.000 description 1
- 235000019270 ammonium chloride Nutrition 0.000 description 1
- 239000007864 aqueous solution Substances 0.000 description 1
- 239000010425 asbestos Substances 0.000 description 1
- 125000004429 atom Chemical group 0.000 description 1
- MMTOJQXQRBHILG-UHFFFAOYSA-N azane;2-(2-hydroxyethoxy)ethanol Chemical compound N.OCCOCCO MMTOJQXQRBHILG-UHFFFAOYSA-N 0.000 description 1
- 125000005603 azodicarboxylic group Chemical group 0.000 description 1
- 230000008901 benefit Effects 0.000 description 1
- 229910021538 borax Inorganic materials 0.000 description 1
- ABDBNWQRPYOPDF-UHFFFAOYSA-N carbonofluoridic acid Chemical class OC(F)=O ABDBNWQRPYOPDF-UHFFFAOYSA-N 0.000 description 1
- 125000004181 carboxyalkyl group Chemical group 0.000 description 1
- 150000001735 carboxylic acids Chemical class 0.000 description 1
- 239000003638 chemical reducing agent Substances 0.000 description 1
- 239000000701 coagulant Substances 0.000 description 1
- 238000000576 coating method Methods 0.000 description 1
- 238000001246 colloidal dispersion Methods 0.000 description 1
- 230000000052 comparative effect Effects 0.000 description 1
- 229910052802 copper Inorganic materials 0.000 description 1
- 239000010949 copper Substances 0.000 description 1
- 238000005336 cracking Methods 0.000 description 1
- 238000000354 decomposition reaction Methods 0.000 description 1
- 239000008367 deionised water Substances 0.000 description 1
- 229910021641 deionized water Inorganic materials 0.000 description 1
- 230000001419 dependent effect Effects 0.000 description 1
- GRWZHXKQBITJKP-UHFFFAOYSA-M dithionite(1-) Chemical compound OS(=O)S([O-])=O GRWZHXKQBITJKP-UHFFFAOYSA-M 0.000 description 1
- 239000000839 emulsion Substances 0.000 description 1
- 238000005516 engineering process Methods 0.000 description 1
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 1
- 238000000605 extraction Methods 0.000 description 1
- XUCNUKMRBVNAPB-UHFFFAOYSA-N fluoroethene Chemical compound FC=C XUCNUKMRBVNAPB-UHFFFAOYSA-N 0.000 description 1
- DWYMPOCYEZONEA-UHFFFAOYSA-N fluorophosphoric acid Chemical class OP(O)(F)=O DWYMPOCYEZONEA-UHFFFAOYSA-N 0.000 description 1
- UQSQSQZYBQSBJZ-UHFFFAOYSA-N fluorosulfonic acid Chemical class OS(F)(=O)=O UQSQSQZYBQSBJZ-UHFFFAOYSA-N 0.000 description 1
- 125000000524 functional group Chemical group 0.000 description 1
- 239000011521 glass Substances 0.000 description 1
- 238000005469 granulation Methods 0.000 description 1
- 230000003179 granulation Effects 0.000 description 1
- HCDGVLDPFQMKDK-UHFFFAOYSA-N hexafluoropropylene Chemical group FC(F)=C(F)C(F)(F)F HCDGVLDPFQMKDK-UHFFFAOYSA-N 0.000 description 1
- 150000002430 hydrocarbons Chemical group 0.000 description 1
- 229910052739 hydrogen Inorganic materials 0.000 description 1
- 229940079826 hydrogen sulfite Drugs 0.000 description 1
- 230000003301 hydrolyzing effect Effects 0.000 description 1
- DOUHZFSGSXMPIE-UHFFFAOYSA-N hydroxidooxidosulfur(.) Chemical compound [O]SO DOUHZFSGSXMPIE-UHFFFAOYSA-N 0.000 description 1
- 150000002500 ions Chemical class 0.000 description 1
- 238000011068 loading method Methods 0.000 description 1
- 239000000314 lubricant Substances 0.000 description 1
- 239000012528 membrane Substances 0.000 description 1
- QSHDDOUJBYECFT-UHFFFAOYSA-N mercury Chemical compound [Hg] QSHDDOUJBYECFT-UHFFFAOYSA-N 0.000 description 1
- 229910052753 mercury Inorganic materials 0.000 description 1
- 229910052751 metal Inorganic materials 0.000 description 1
- 239000002184 metal Substances 0.000 description 1
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 125000004433 nitrogen atom Chemical group N* 0.000 description 1
- 239000003921 oil Substances 0.000 description 1
- 150000001451 organic peroxides Chemical class 0.000 description 1
- 150000004967 organic peroxy acids Chemical class 0.000 description 1
- 150000002926 oxygen Chemical class 0.000 description 1
- 239000001301 oxygen Substances 0.000 description 1
- 229910052760 oxygen Inorganic materials 0.000 description 1
- 239000012188 paraffin wax Substances 0.000 description 1
- 235000019809 paraffin wax Nutrition 0.000 description 1
- SNGREZUHAYWORS-UHFFFAOYSA-N perfluorooctanoic acid Chemical compound OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F SNGREZUHAYWORS-UHFFFAOYSA-N 0.000 description 1
- 230000000737 periodic effect Effects 0.000 description 1
- 150000002978 peroxides Chemical class 0.000 description 1
- 150000004965 peroxy acids Chemical class 0.000 description 1
- 235000019271 petrolatum Nutrition 0.000 description 1
- 235000021317 phosphate Nutrition 0.000 description 1
- 150000003013 phosphoric acid derivatives Chemical class 0.000 description 1
- 238000004321 preservation Methods 0.000 description 1
- 238000003672 processing method Methods 0.000 description 1
- 108090000623 proteins and genes Proteins 0.000 description 1
- 230000001105 regulatory effect Effects 0.000 description 1
- 230000000717 retained effect Effects 0.000 description 1
- 229910052895 riebeckite Inorganic materials 0.000 description 1
- 229910052709 silver Inorganic materials 0.000 description 1
- 239000004332 silver Substances 0.000 description 1
- SQGYOTSLMSWVJD-UHFFFAOYSA-N silver(I) nitrate Inorganic materials [Ag+].[O-]N(=O)=O SQGYOTSLMSWVJD-UHFFFAOYSA-N 0.000 description 1
- 239000004328 sodium tetraborate Substances 0.000 description 1
- 235000010339 sodium tetraborate Nutrition 0.000 description 1
- DHCDFWKWKRSZHF-UHFFFAOYSA-N sulfurothioic S-acid Chemical compound OS(O)(=O)=S DHCDFWKWKRSZHF-UHFFFAOYSA-N 0.000 description 1
- 230000003797 telogen phase Effects 0.000 description 1
- 229910052723 transition metal Inorganic materials 0.000 description 1
- 150000003624 transition metals Chemical class 0.000 description 1
- 229920002554 vinyl polymer Polymers 0.000 description 1
- 238000011179 visual inspection Methods 0.000 description 1
- 238000005406 washing Methods 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08F—MACROMOLECULAR COMPOUNDS OBTAINED BY REACTIONS ONLY INVOLVING CARBON-TO-CARBON UNSATURATED BONDS
- C08F14/00—Homopolymers and copolymers of compounds having one or more unsaturated aliphatic radicals, each having only one carbon-to-carbon double bond, and at least one being terminated by a halogen
- C08F14/18—Monomers containing fluorine
- C08F14/26—Tetrafluoroethene
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Addition Polymer Or Copolymer, Post-Treatments, Or Chemical Modifications (AREA)
- Polymerisation Methods In General (AREA)
- Polymerization Catalysts (AREA)
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| DE2523570A DE2523570C3 (de) | 1975-05-28 | 1975-05-28 | Verfahren zur Polymerisation von Tetrafluoräthylen |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CH623065A5 true CH623065A5 (OSRAM) | 1981-05-15 |
Family
ID=5947593
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CH659176A CH623065A5 (OSRAM) | 1975-05-28 | 1976-05-25 |
Country Status (20)
| Country | Link |
|---|---|
| US (1) | US4112211A (OSRAM) |
| JP (1) | JPS5931523B2 (OSRAM) |
| AT (1) | AT343360B (OSRAM) |
| AU (1) | AU501187B2 (OSRAM) |
| BE (1) | BE842328A (OSRAM) |
| CA (1) | CA1073147A (OSRAM) |
| CH (1) | CH623065A5 (OSRAM) |
| DD (1) | DD125633A5 (OSRAM) |
| DE (1) | DE2523570C3 (OSRAM) |
| DK (1) | DK230876A (OSRAM) |
| ES (1) | ES448135A1 (OSRAM) |
| FR (1) | FR2312513A1 (OSRAM) |
| GB (1) | GB1506832A (OSRAM) |
| IE (1) | IE42822B1 (OSRAM) |
| IN (1) | IN144347B (OSRAM) |
| IT (1) | IT1060685B (OSRAM) |
| LU (1) | LU75028A1 (OSRAM) |
| NL (1) | NL169483C (OSRAM) |
| SE (1) | SE412067B (OSRAM) |
| ZA (1) | ZA763175B (OSRAM) |
Families Citing this family (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| JPS61196821U (OSRAM) * | 1985-05-30 | 1986-12-08 | ||
| JPS637029U (OSRAM) * | 1986-07-01 | 1988-01-18 | ||
| WO1994002547A1 (en) * | 1992-07-21 | 1994-02-03 | E.I. Du Pont De Nemours And Company | Polytetrafluoroethylene with improved creep resistance, and preparation thereof |
| US5229480A (en) * | 1992-09-03 | 1993-07-20 | E. I. Du Pont De Nemours And Company | Vinyl fluoride polymerization |
| US5955556A (en) * | 1995-11-06 | 1999-09-21 | Alliedsignal Inc. | Method of manufacturing fluoropolymers |
| US6280626B1 (en) * | 1998-08-12 | 2001-08-28 | Mitsubishi Rayon Co., Ltd. | Membrane separator assembly and method of cleaning the assembly utilizing gas diffuser underneath the assembly |
| JP4561363B2 (ja) * | 2002-12-19 | 2010-10-13 | 旭硝子株式会社 | テトラフルオロエチレン共重合体 |
| EP1529785B1 (en) * | 2003-10-24 | 2011-03-16 | 3M Innovative Properties Company | Aqueous dispersions of polytetrafluoroethylene particles |
| ATE529451T1 (de) * | 2003-11-17 | 2011-11-15 | 3M Innovative Properties Co | Wässrige ptfe-dispersionen mit einem niedrigen gehalt an fluorierten emulgatoren |
| EP3323853B1 (en) * | 2008-05-30 | 2019-06-26 | Whitford Corporation | Blended fluoropolymer compositions |
| EP3103836A1 (en) | 2015-06-12 | 2016-12-14 | 3M Innovative Properties Company | Fluoropolymer with improved transparency |
Family Cites Families (11)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US2393967A (en) * | 1942-12-24 | 1946-02-05 | Du Pont | Process for polymerizing tetrafluoroethylene |
| GB651315A (en) * | 1947-06-27 | 1951-03-14 | Du Pont | Improvements in and relating to processes for the polymerisation of ethylenically unsaturated compounds |
| US2613203A (en) * | 1950-06-28 | 1952-10-07 | Gen Electric | Method for polymerizing tetrafluoroethylene |
| US2820026A (en) * | 1953-06-11 | 1958-01-14 | Minnesota Mining & Mfg | Manufacture of fluorine containing polymers |
| US3142665A (en) * | 1960-07-26 | 1964-07-28 | Du Pont | Novel tetrafluoroethylene resins and their preparation |
| US3088941A (en) * | 1960-03-11 | 1963-05-07 | Du Pont | Process for the preparation of improved polytetrafluoroethylene extrusion powder |
| US3110704A (en) * | 1960-03-31 | 1963-11-12 | Du Pont | Low pressure tetrafluoroethylene polymerization process |
| US3193543A (en) * | 1963-03-18 | 1965-07-06 | Edison Soc | Process for the polymerization of fluorinated monomers |
| US3404135A (en) * | 1964-01-21 | 1968-10-01 | Rheinpreussen Ag | Process for the manufacture of maleic acid anhydride copolymers |
| US3475391A (en) * | 1967-02-28 | 1969-10-28 | Du Pont | Hydroxylated tetrafluoroethylene/isobutylene polymers and their preparation |
| IT990990B (it) * | 1973-07-06 | 1975-07-10 | Sir Soc Italiana Resine Spa | Procedimento e catalizzatore per la preparazione di polimeri e copolimeri dell acrilonitrile |
-
1975
- 1975-05-28 DE DE2523570A patent/DE2523570C3/de not_active Expired
-
1976
- 1976-05-20 US US05/688,429 patent/US4112211A/en not_active Expired - Lifetime
- 1976-05-21 ES ES448135A patent/ES448135A1/es not_active Expired
- 1976-05-21 NL NLAANVRAGE7605470,A patent/NL169483C/xx not_active IP Right Cessation
- 1976-05-25 CH CH659176A patent/CH623065A5/de not_active IP Right Cessation
- 1976-05-25 SE SE7605940A patent/SE412067B/xx unknown
- 1976-05-25 DD DD193000A patent/DD125633A5/xx unknown
- 1976-05-26 ZA ZA763175A patent/ZA763175B/xx unknown
- 1976-05-26 DK DK230876A patent/DK230876A/da unknown
- 1976-05-26 LU LU75028A patent/LU75028A1/xx unknown
- 1976-05-26 IN IN915/CAL/76A patent/IN144347B/en unknown
- 1976-05-26 AT AT387076A patent/AT343360B/de not_active IP Right Cessation
- 1976-05-26 IT IT23705/76A patent/IT1060685B/it active
- 1976-05-27 JP JP51060729A patent/JPS5931523B2/ja not_active Expired
- 1976-05-27 CA CA253,542A patent/CA1073147A/en not_active Expired
- 1976-05-27 AU AU14346/76A patent/AU501187B2/en not_active Expired
- 1976-05-28 GB GB22451/76A patent/GB1506832A/en not_active Expired
- 1976-05-28 BE BE167422A patent/BE842328A/xx not_active IP Right Cessation
- 1976-05-28 FR FR7616160A patent/FR2312513A1/fr active Granted
- 1976-06-27 IE IE1117/76A patent/IE42822B1/en unknown
Also Published As
| Publication number | Publication date |
|---|---|
| BE842328A (fr) | 1976-11-29 |
| FR2312513A1 (fr) | 1976-12-24 |
| IE42822B1 (en) | 1980-10-22 |
| DE2523570C3 (de) | 1978-12-07 |
| FR2312513B1 (OSRAM) | 1979-06-22 |
| SE7605940L (sv) | 1976-11-29 |
| IN144347B (OSRAM) | 1978-04-29 |
| NL169483B (nl) | 1982-02-16 |
| IE42822L (en) | 1976-11-28 |
| US4112211A (en) | 1978-09-05 |
| DE2523570B2 (de) | 1978-03-30 |
| CA1073147A (en) | 1980-03-04 |
| LU75028A1 (OSRAM) | 1977-02-15 |
| IT1060685B (it) | 1982-08-20 |
| ATA387076A (de) | 1977-09-15 |
| GB1506832A (en) | 1978-04-12 |
| DD125633A5 (OSRAM) | 1977-05-04 |
| NL169483C (nl) | 1982-07-16 |
| DK230876A (da) | 1976-11-29 |
| JPS5931523B2 (ja) | 1984-08-02 |
| DE2523570A1 (de) | 1976-12-02 |
| ZA763175B (en) | 1977-06-29 |
| NL7605470A (nl) | 1976-11-30 |
| SE412067B (sv) | 1980-02-18 |
| ES448135A1 (es) | 1977-07-01 |
| JPS51146588A (en) | 1976-12-16 |
| AU501187B2 (en) | 1979-06-14 |
| AT343360B (de) | 1978-05-26 |
| AU1434676A (en) | 1977-12-01 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| EP0030663B1 (de) | Fluorpolymere mit schalenmodifizierten Teilchen und Verfahren zu deren Herstellung | |
| EP2287209B1 (en) | Method for producing polytetrafluoroethylene fine powder | |
| EP2621967B1 (en) | Process for producing polytetrafluoroethylene fine powder | |
| DE1795078C3 (de) | Wäßrige Polytetrafluoräthylen-Dispersionen, Verfahren zu ihrer Herstellung und ihre Verwendung | |
| DE2617829C2 (de) | Verfahren zur Herstellung von Suspensionspolymerisaten des Tetrafluoräthylens | |
| EP0644209B1 (de) | Polytetrafluorethylen-Mikropulver, ihre Herstellung und Verwendung | |
| DE3024450A1 (de) | Verfahren zur herstellung von waessrigen, kolloidalen dispersionen von copolymerisaten des typs tetrafluorethylen-ethylen | |
| DE2523569C3 (de) | Verfahren zur Polymerisation von Tetrafluoräthylen nach dem Suspensionsverfahren | |
| DE2052495A1 (de) | Verfahren zum Mischpolymensieren von monomerem Tetrafluorethylen und monomerem Fluorvinylather | |
| DE2521738C2 (de) | Verfahren zur Herstellung von zum Extrudieren geeignetem Tetrafluoräthylenpolymer-Pulver | |
| EP0692504A1 (de) | Copolymere vom Typ Tetrafluorethylen-Ethylen mit einer Kern-Hülle-Teilchenstruktur | |
| DE2523570C3 (de) | Verfahren zur Polymerisation von Tetrafluoräthylen | |
| CN107922519A (zh) | 改性聚四氟乙烯的水性乳化液、细粉及拉伸多孔体的制造方法 | |
| DE2037028C2 (de) | Verfahren zur Herstellung fluorhaltiger Copolymerisate | |
| DE1094458B (de) | Verfahren zur Polymerisation von Tetrafluoraethylen | |
| US3088941A (en) | Process for the preparation of improved polytetrafluoroethylene extrusion powder | |
| EP0090142A2 (de) | Verfahren zur Herstellung von verpastbaren Polymeren des Vinylchlorids | |
| DE60036962T2 (de) | Verfahren zur polymerisation von fluorenthaltenden monomeren in wässriger emulsion | |
| DE60109119T2 (de) | Verfahren zum Herstellen von Paraffinwachs | |
| EP0197490B1 (de) | Stabile, wässrige, kolloidale Dispersionen von Copolymerisaten des Typs Tetrafluorethylen-Ethylen und Verfahren zu deren Herstellung | |
| DE2140391C3 (de) | Verfahren zum Polymerisieren von fluorhaltJgen Olefinen und Verwendung der erhaltenen Polymerisate zur Herstellung von Überzügen und Anstrichmitteln | |
| DE2802916A1 (de) | Stabilisierte copolymere auf basis aethylen-tetrafluoraethylen und verfahren zu deren herstellung | |
| DE2235885C3 (de) | Fluorcarbonwachse, wäßrige Fluorcarbonwachsdispersionen und Verfahren zu deren Herstellung | |
| EP0108884B1 (de) | Verfahren zur Herstellung von verpastbaren Polymeren des Vinylchlorids | |
| DE2544040A1 (de) | Verfahren zur herstellung von pastenextrudierbaren polymerisaten des tetrafluoraethylens |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| PL | Patent ceased | ||
| PL | Patent ceased |