CA989862A - Arylsubstituted nitroparaphenylenediamine compounds - Google Patents
Arylsubstituted nitroparaphenylenediamine compoundsInfo
- Publication number
- CA989862A CA989862A CA151,586A CA151586A CA989862A CA 989862 A CA989862 A CA 989862A CA 151586 A CA151586 A CA 151586A CA 989862 A CA989862 A CA 989862A
- Authority
- CA
- Canada
- Prior art keywords
- nitroparaphenylenediamine
- arylsubstituted
- compounds
- nitroparaphenylenediamine compounds
- arylsubstituted nitroparaphenylenediamine
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- ZTQDYDIRBKMMQB-UHFFFAOYSA-N n-(4-aminophenyl)nitramide Chemical class NC1=CC=C(N[N+]([O-])=O)C=C1 ZTQDYDIRBKMMQB-UHFFFAOYSA-N 0.000 title 1
Applications Claiming Priority (1)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US23004272A | 1972-02-28 | 1972-02-28 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA989862A true CA989862A (en) | 1976-05-25 |
Family
ID=22863720
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA151,586A Expired CA989862A (en) | 1972-02-28 | 1972-09-13 | Arylsubstituted nitroparaphenylenediamine compounds |
Country Status (1)
| Country | Link |
|---|---|
| CA (1) | CA989862A (en) |
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4423126A (en) | 1982-05-27 | 1983-12-27 | Eastman Kodak Company | Color-forming carboxamidonaphthalene dye precursor and carboximide dye in photographic material and process |
| US4536598A (en) * | 1982-05-27 | 1985-08-20 | Eastman Kodak Company | Color-forming carboxamidonaphthalene dye precursor and carboximide dye in photographic material and process |
-
1972
- 1972-09-13 CA CA151,586A patent/CA989862A/en not_active Expired
Cited By (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| US4423126A (en) | 1982-05-27 | 1983-12-27 | Eastman Kodak Company | Color-forming carboxamidonaphthalene dye precursor and carboximide dye in photographic material and process |
| US4536598A (en) * | 1982-05-27 | 1985-08-20 | Eastman Kodak Company | Color-forming carboxamidonaphthalene dye precursor and carboximide dye in photographic material and process |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| AU462348B2 (en) | Saf-t-jet | |
| AU454372B2 (en) | Childsafe actuator-overcap | |
| CA1034952A (en) | Piperazino-anilido compounds | |
| CA1005447A (en) | Imino-isoindoline compounds | |
| AU466344B2 (en) | Cycloalkyllactamimides | |
| CA989862A (en) | Arylsubstituted nitroparaphenylenediamine compounds | |
| CA993443A (en) | O-mercaptobenzamide compounds | |
| CA1010884A (en) | Trimethylfluoran compounds | |
| CA1005443A (en) | Thienodiazepine compounds | |
| CA1010037A (en) | Benzimidazolinone compounds | |
| AU470572B2 (en) | New deodorant-antiperspirant compounds | |
| AU4575372A (en) | 2-acyl-5-nitrothiazoles | |
| CA895320A (en) | Bisthiachromone compounds | |
| CA895324A (en) | Bis-coumarinyl compounds | |
| CA909232A (en) | 3-amino-7-piperidinofluoran compounds | |
| CA905945A (en) | Pyrazolylazo compounds | |
| CA903759A (en) | Triazolylstyryl compounds | |
| CA915187A (en) | Bischromone compounds | |
| CA901582A (en) | 2-cycloalkyl-thiazole and -oxazole compounds | |
| CA958013A (en) | Tetrasila-adamantane compounds | |
| CA897169A (en) | Aminobenzocycloalkane compounds | |
| CA965410A (en) | Thiadiazolyl-azo-tetrahydroquinoline compounds | |
| CA892607A (en) | Benzheterocyclic compounds | |
| CA892048A (en) | 1-cyclohexylalkyl-isoquinoline compounds | |
| CA889870A (en) | Bis-silylfluoroalkylaromatic compounds |