CA1122587A - Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone - Google Patents
Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidoneInfo
- Publication number
- CA1122587A CA1122587A CA278,637A CA278637A CA1122587A CA 1122587 A CA1122587 A CA 1122587A CA 278637 A CA278637 A CA 278637A CA 1122587 A CA1122587 A CA 1122587A
- Authority
- CA
- Canada
- Prior art keywords
- process according
- pyrrolidone
- quaternary ammonium
- ammonium salt
- alkali metal
- Prior art date
- Legal status (The legal status is an assumption and is not a legal conclusion. Google has not performed a legal analysis and makes no representation as to the accuracy of the status listed.)
- Expired
Links
- HNJBEVLQSNELDL-UHFFFAOYSA-N pyrrolidin-2-one Chemical compound O=C1CCCN1 HNJBEVLQSNELDL-UHFFFAOYSA-N 0.000 title claims abstract description 69
- 239000003054 catalyst Substances 0.000 title claims abstract description 40
- 238000006116 polymerization reaction Methods 0.000 title claims abstract description 33
- 125000001453 quaternary ammonium group Chemical group 0.000 title description 7
- -1 alkali metal pyrrolidonate Chemical class 0.000 claims abstract description 75
- CURLTUGMZLYLDI-UHFFFAOYSA-N Carbon dioxide Chemical compound O=C=O CURLTUGMZLYLDI-UHFFFAOYSA-N 0.000 claims abstract description 64
- 238000000034 method Methods 0.000 claims abstract description 50
- 229910002092 carbon dioxide Inorganic materials 0.000 claims abstract description 45
- 229910052783 alkali metal Inorganic materials 0.000 claims abstract description 36
- 150000003242 quaternary ammonium salts Chemical class 0.000 claims abstract description 32
- 239000001569 carbon dioxide Substances 0.000 claims abstract description 29
- KWYUFKZDYYNOTN-UHFFFAOYSA-M Potassium hydroxide Chemical compound [OH-].[K+] KWYUFKZDYYNOTN-UHFFFAOYSA-M 0.000 claims description 39
- WFDIJRYMOXRFFG-UHFFFAOYSA-N Acetic anhydride Chemical compound CC(=O)OC(C)=O WFDIJRYMOXRFFG-UHFFFAOYSA-N 0.000 claims description 24
- 239000000243 solution Substances 0.000 claims description 22
- 238000006243 chemical reaction Methods 0.000 claims description 18
- MEXQWQLMJYIYPG-UHFFFAOYSA-M potassium;2-oxopyrrolidine-1-carboxylate Chemical group [K+].[O-]C(=O)N1CCCC1=O MEXQWQLMJYIYPG-UHFFFAOYSA-M 0.000 claims description 13
- 150000001340 alkali metals Chemical class 0.000 claims description 10
- 150000004820 halides Chemical class 0.000 claims description 10
- 125000000217 alkyl group Chemical group 0.000 claims description 9
- 150000007942 carboxylates Chemical class 0.000 claims description 9
- MRYQZMHVZZSQRT-UHFFFAOYSA-M tetramethylazanium;acetate Chemical group CC([O-])=O.C[N+](C)(C)C MRYQZMHVZZSQRT-UHFFFAOYSA-M 0.000 claims description 7
- OKIZCWYLBDKLSU-UHFFFAOYSA-M N,N,N-Trimethylmethanaminium chloride Chemical group [Cl-].C[N+](C)(C)C OKIZCWYLBDKLSU-UHFFFAOYSA-M 0.000 claims description 6
- 125000004169 (C1-C6) alkyl group Chemical group 0.000 claims description 4
- CPELXLSAUQHCOX-UHFFFAOYSA-M Bromide Chemical compound [Br-] CPELXLSAUQHCOX-UHFFFAOYSA-M 0.000 claims description 4
- 125000002877 alkyl aryl group Chemical group 0.000 claims description 4
- 125000003698 tetramethyl group Chemical group [H]C([H])([H])* 0.000 claims description 4
- QTBSBXVTEAMEQO-UHFFFAOYSA-M Acetate Chemical compound CC([O-])=O QTBSBXVTEAMEQO-UHFFFAOYSA-M 0.000 claims description 3
- JBKVHLHDHHXQEQ-UHFFFAOYSA-N Caprolactam Natural products O=C1CCCCCN1 JBKVHLHDHHXQEQ-UHFFFAOYSA-N 0.000 claims description 3
- 150000001350 alkyl halides Chemical class 0.000 claims description 3
- 125000005270 trialkylamine group Chemical group 0.000 claims description 3
- YLHUPYSUKYAIBW-UHFFFAOYSA-N 1-acetylpyrrolidin-2-one Chemical group CC(=O)N1CCCC1=O YLHUPYSUKYAIBW-UHFFFAOYSA-N 0.000 claims description 2
- 239000012190 activator Substances 0.000 claims description 2
- NLXLAEXVIDQMFP-UHFFFAOYSA-N Ammonium chloride Substances [NH4+].[Cl-] NLXLAEXVIDQMFP-UHFFFAOYSA-N 0.000 claims 2
- XBDQKXXYIPTUBI-UHFFFAOYSA-M Propionate Chemical compound CCC([O-])=O XBDQKXXYIPTUBI-UHFFFAOYSA-M 0.000 claims 2
- 235000019270 ammonium chloride Nutrition 0.000 claims 2
- 150000001649 bromium compounds Chemical class 0.000 claims 2
- 125000005207 tetraalkylammonium group Chemical group 0.000 claims 2
- CBXCPBUEXACCNR-UHFFFAOYSA-N tetraethylammonium Chemical group CC[N+](CC)(CC)CC CBXCPBUEXACCNR-UHFFFAOYSA-N 0.000 claims 2
- FBEVECUEMUUFKM-UHFFFAOYSA-M tetrapropylazanium;chloride Chemical class [Cl-].CCC[N+](CCC)(CCC)CCC FBEVECUEMUUFKM-UHFFFAOYSA-M 0.000 claims 2
- 230000000379 polymerizing effect Effects 0.000 claims 1
- 150000008044 alkali metal hydroxides Chemical class 0.000 abstract description 4
- 150000003863 ammonium salts Chemical group 0.000 abstract description 4
- 229960004424 carbon dioxide Drugs 0.000 description 20
- UHOVQNZJYSORNB-UHFFFAOYSA-N Benzene Chemical compound C1=CC=CC=C1 UHOVQNZJYSORNB-UHFFFAOYSA-N 0.000 description 12
- 239000000203 mixture Substances 0.000 description 12
- 125000002496 methyl group Chemical group [H]C([H])([H])* 0.000 description 11
- DQAKJEWZWDQURW-UHFFFAOYSA-N pyrrolidonecarboxylic acid Chemical compound OC(=O)N1CCCC1=O DQAKJEWZWDQURW-UHFFFAOYSA-N 0.000 description 10
- 238000004821 distillation Methods 0.000 description 8
- 239000000178 monomer Substances 0.000 description 8
- 238000007792 addition Methods 0.000 description 6
- 230000000694 effects Effects 0.000 description 6
- 150000003839 salts Chemical class 0.000 description 6
- 239000011734 sodium Substances 0.000 description 6
- XLYOFNOQVPJJNP-UHFFFAOYSA-N water Substances O XLYOFNOQVPJJNP-UHFFFAOYSA-N 0.000 description 6
- VEXZGXHMUGYJMC-UHFFFAOYSA-M Chloride anion Chemical compound [Cl-] VEXZGXHMUGYJMC-UHFFFAOYSA-M 0.000 description 5
- 229920000642 polymer Polymers 0.000 description 5
- 239000000047 product Substances 0.000 description 5
- ZLMJMSJWJFRBEC-UHFFFAOYSA-N Potassium Chemical compound [K] ZLMJMSJWJFRBEC-UHFFFAOYSA-N 0.000 description 4
- 229940076134 benzene Drugs 0.000 description 4
- 238000004519 manufacturing process Methods 0.000 description 4
- 229910052700 potassium Inorganic materials 0.000 description 4
- 239000011591 potassium Substances 0.000 description 4
- 229960003975 potassium Drugs 0.000 description 4
- 235000007686 potassium Nutrition 0.000 description 4
- 238000002360 preparation method Methods 0.000 description 4
- 229910052708 sodium Inorganic materials 0.000 description 4
- DGAQECJNVWCQMB-PUAWFVPOSA-M Ilexoside XXIX Chemical compound C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)OS(=O)(=O)[O-])C)C)[C@@H]2[C@]1(C)O)C)C(=O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O.[Na+] DGAQECJNVWCQMB-PUAWFVPOSA-M 0.000 description 3
- OKKJLVBELUTLKV-UHFFFAOYSA-N Methanol Chemical compound OC OKKJLVBELUTLKV-UHFFFAOYSA-N 0.000 description 3
- 229920001007 Nylon 4 Polymers 0.000 description 3
- 239000002253 acid Substances 0.000 description 3
- 125000003710 aryl alkyl group Chemical group 0.000 description 3
- XLYOFNOQVPJJNP-UHFFFAOYSA-M hydroxide Chemical compound [OH-] XLYOFNOQVPJJNP-UHFFFAOYSA-M 0.000 description 3
- 239000008188 pellet Substances 0.000 description 3
- 239000007787 solid Substances 0.000 description 3
- OFBQJSOFQDEBGM-UHFFFAOYSA-N Pentane Chemical compound CCCCC OFBQJSOFQDEBGM-UHFFFAOYSA-N 0.000 description 2
- 239000004698 Polyethylene Substances 0.000 description 2
- WQDUMFSSJAZKTM-UHFFFAOYSA-N Sodium methoxide Chemical compound [Na+].[O-]C WQDUMFSSJAZKTM-UHFFFAOYSA-N 0.000 description 2
- RAHZWNYVWXNFOC-UHFFFAOYSA-N Sulphur dioxide Chemical compound O=S=O RAHZWNYVWXNFOC-UHFFFAOYSA-N 0.000 description 2
- 239000003513 alkali Substances 0.000 description 2
- 239000000908 ammonium hydroxide Substances 0.000 description 2
- 125000000484 butyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 229940000425 combination drug Drugs 0.000 description 2
- 230000000052 comparative effect Effects 0.000 description 2
- 150000001875 compounds Chemical class 0.000 description 2
- 125000001495 ethyl group Chemical group [H]C([H])([H])C([H])([H])* 0.000 description 2
- 238000010438 heat treatment Methods 0.000 description 2
- 125000004051 hexyl group Chemical group [H]C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])C([H])([H])* 0.000 description 2
- 125000000959 isobutyl group Chemical group [H]C([H])([H])C([H])(C([H])([H])[H])C([H])([H])* 0.000 description 2
- 125000001449 isopropyl group Chemical group [H]C([H])([H])C([H])(*)C([H])([H])[H] 0.000 description 2
- RLSSMJSEOOYNOY-UHFFFAOYSA-N m-cresol Chemical compound CC1=CC=CC(O)=C1 RLSSMJSEOOYNOY-UHFFFAOYSA-N 0.000 description 2
- 235000019645 odor Nutrition 0.000 description 2
- 239000002685 polymerization catalyst Substances 0.000 description 2
- 125000001436 propyl group Chemical group [H]C([*])([H])C([H])([H])C([H])([H])[H] 0.000 description 2
- 238000000746 purification Methods 0.000 description 2
- 239000002904 solvent Substances 0.000 description 2
- 125000000999 tert-butyl group Chemical group [H]C([H])([H])C(*)(C([H])([H])[H])C([H])([H])[H] 0.000 description 2
- YMBCJWGVCUEGHA-UHFFFAOYSA-M tetraethylammonium chloride Chemical compound [Cl-].CC[N+](CC)(CC)CC YMBCJWGVCUEGHA-UHFFFAOYSA-M 0.000 description 2
- GTCDARUMAMVCRO-UHFFFAOYSA-M tetraethylazanium;acetate Chemical compound CC([O-])=O.CC[N+](CC)(CC)CC GTCDARUMAMVCRO-UHFFFAOYSA-M 0.000 description 2
- 239000004753 textile Substances 0.000 description 2
- GRYSXUXXBDSYRT-WOUKDFQISA-N (2r,3r,4r,5r)-2-(hydroxymethyl)-4-methoxy-5-[6-(methylamino)purin-9-yl]oxolan-3-ol Chemical compound C1=NC=2C(NC)=NC=NC=2N1[C@@H]1O[C@H](CO)[C@@H](O)[C@H]1OC GRYSXUXXBDSYRT-WOUKDFQISA-N 0.000 description 1
- KAAOWSHHUJOHDI-UHFFFAOYSA-N 2-oxopyrrolidine-1-carboxylic acid 2-oxopyrrolidine-1,3-dicarboxylic acid Chemical compound OC(=O)N1CCCC1=O.OC(=O)C1CCN(C(O)=O)C1=O KAAOWSHHUJOHDI-UHFFFAOYSA-N 0.000 description 1
- 125000000094 2-phenylethyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])C([H])([H])* 0.000 description 1
- YRKRGYRYEQYTOH-UHFFFAOYSA-N 4-methylpyrrolidin-2-one Chemical compound CC1CNC(=O)C1 YRKRGYRYEQYTOH-UHFFFAOYSA-N 0.000 description 1
- IRPVABHDSJVBNZ-RTHVDDQRSA-N 5-[1-(cyclopropylmethyl)-5-[(1R,5S)-3-(oxetan-3-yl)-3-azabicyclo[3.1.0]hexan-6-yl]pyrazol-3-yl]-3-(trifluoromethyl)pyridin-2-amine Chemical compound C1=C(C(F)(F)F)C(N)=NC=C1C1=NN(CC2CC2)C(C2[C@@H]3CN(C[C@@H]32)C2COC2)=C1 IRPVABHDSJVBNZ-RTHVDDQRSA-N 0.000 description 1
- VHUUQVKOLVNVRT-UHFFFAOYSA-N Ammonium hydroxide Chemical compound [NH4+].[OH-] VHUUQVKOLVNVRT-UHFFFAOYSA-N 0.000 description 1
- OKTJSMMVPCPJKN-UHFFFAOYSA-N Carbon Chemical compound [C] OKTJSMMVPCPJKN-UHFFFAOYSA-N 0.000 description 1
- 208000005156 Dehydration Diseases 0.000 description 1
- SRBFZHDQGSBBOR-HWQSCIPKSA-N L-arabinopyranose Chemical compound O[C@H]1COC(O)[C@H](O)[C@H]1O SRBFZHDQGSBBOR-HWQSCIPKSA-N 0.000 description 1
- 229940022663 acetate Drugs 0.000 description 1
- 230000004913 activation Effects 0.000 description 1
- 230000002730 additional effect Effects 0.000 description 1
- 239000000654 additive Substances 0.000 description 1
- 150000001339 alkali metal compounds Chemical class 0.000 description 1
- 229910001508 alkali metal halide Inorganic materials 0.000 description 1
- 150000008045 alkali metal halides Chemical class 0.000 description 1
- 150000001412 amines Chemical class 0.000 description 1
- 238000004458 analytical method Methods 0.000 description 1
- VBKFRQZAZWAUHX-UHFFFAOYSA-N azanium;2-oxopyrrolidine-1-carboxylate Chemical compound [NH4+].[O-]C(=O)N1CCCC1=O VBKFRQZAZWAUHX-UHFFFAOYSA-N 0.000 description 1
- 125000001797 benzyl group Chemical group [H]C1=C([H])C([H])=C(C([H])=C1[H])C([H])([H])* 0.000 description 1
- 238000009835 boiling Methods 0.000 description 1
- 238000012662 bulk polymerization Methods 0.000 description 1
- 229910052799 carbon Inorganic materials 0.000 description 1
- 125000004432 carbon atom Chemical group C* 0.000 description 1
- 125000005521 carbonamide group Chemical group 0.000 description 1
- 150000001732 carboxylic acid derivatives Chemical class 0.000 description 1
- 238000006555 catalytic reaction Methods 0.000 description 1
- 230000000332 continued effect Effects 0.000 description 1
- 238000001816 cooling Methods 0.000 description 1
- 229920001577 copolymer Polymers 0.000 description 1
- 230000018044 dehydration Effects 0.000 description 1
- 238000006297 dehydration reaction Methods 0.000 description 1
- BIWNKSFCNSLQRW-UHFFFAOYSA-M diethyl(dimethyl)azanium;propanoate Chemical compound CCC([O-])=O.CC[N+](C)(C)CC BIWNKSFCNSLQRW-UHFFFAOYSA-M 0.000 description 1
- XWBDWHCCBGMXKG-UHFFFAOYSA-N ethanamine;hydron;chloride Chemical compound Cl.CCN XWBDWHCCBGMXKG-UHFFFAOYSA-N 0.000 description 1
- 238000001125 extrusion Methods 0.000 description 1
- 239000000835 fiber Substances 0.000 description 1
- 238000001914 filtration Methods 0.000 description 1
- 238000010528 free radical solution polymerization reaction Methods 0.000 description 1
- 229920006158 high molecular weight polymer Polymers 0.000 description 1
- XMBWDFGMSWQBCA-UHFFFAOYSA-N hydrogen iodide Chemical compound I XMBWDFGMSWQBCA-UHFFFAOYSA-N 0.000 description 1
- 239000012535 impurity Substances 0.000 description 1
- 238000011065 in-situ storage Methods 0.000 description 1
- 239000012442 inert solvent Substances 0.000 description 1
- 239000003999 initiator Substances 0.000 description 1
- 150000003951 lactams Chemical class 0.000 description 1
- 239000007788 liquid Substances 0.000 description 1
- 238000005259 measurement Methods 0.000 description 1
- 238000000465 moulding Methods 0.000 description 1
- 238000006386 neutralization reaction Methods 0.000 description 1
- 239000012299 nitrogen atmosphere Substances 0.000 description 1
- 230000009965 odorless effect Effects 0.000 description 1
- 125000001997 phenyl group Chemical group [H]C1=C([H])C([H])=C(*)C([H])=C1[H] 0.000 description 1
- 229920000573 polyethylene Polymers 0.000 description 1
- 239000003505 polymerization initiator Substances 0.000 description 1
- 239000002244 precipitate Substances 0.000 description 1
- 150000004040 pyrrolidinones Chemical class 0.000 description 1
- 239000000376 reactant Substances 0.000 description 1
- 239000011541 reaction mixture Substances 0.000 description 1
- 230000035484 reaction time Effects 0.000 description 1
- XIIOFHFUYBLOLW-UHFFFAOYSA-N selpercatinib Chemical compound OC(COC=1C=C(C=2N(C=1)N=CC=2C#N)C=1C=NC(=CC=1)N1CC2N(C(C1)C2)CC=1C=NC(=CC=1)OC)(C)C XIIOFHFUYBLOLW-UHFFFAOYSA-N 0.000 description 1
- 239000002002 slurry Substances 0.000 description 1
- HYRLWUFWDYFEES-UHFFFAOYSA-M sodium;2-oxopyrrolidine-1-carboxylate Chemical compound [Na+].[O-]C(=O)N1CCCC1=O HYRLWUFWDYFEES-UHFFFAOYSA-M 0.000 description 1
- 238000003756 stirring Methods 0.000 description 1
- 150000005622 tetraalkylammonium hydroxides Chemical class 0.000 description 1
- HWCKGOZZJDHMNC-UHFFFAOYSA-M tetraethylammonium bromide Chemical compound [Br-].CC[N+](CC)(CC)CC HWCKGOZZJDHMNC-UHFFFAOYSA-M 0.000 description 1
- 150000003953 γ-lactams Chemical class 0.000 description 1
Classifications
-
- C—CHEMISTRY; METALLURGY
- C08—ORGANIC MACROMOLECULAR COMPOUNDS; THEIR PREPARATION OR CHEMICAL WORKING-UP; COMPOSITIONS BASED THEREON
- C08G—MACROMOLECULAR COMPOUNDS OBTAINED OTHERWISE THAN BY REACTIONS ONLY INVOLVING UNSATURATED CARBON-TO-CARBON BONDS
- C08G69/00—Macromolecular compounds obtained by reactions forming a carboxylic amide link in the main chain of the macromolecule
- C08G69/02—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids
- C08G69/08—Polyamides derived from amino-carboxylic acids or from polyamines and polycarboxylic acids derived from amino-carboxylic acids
- C08G69/14—Lactams
- C08G69/24—Pyrrolidones or piperidones
Landscapes
- Chemical & Material Sciences (AREA)
- Health & Medical Sciences (AREA)
- Chemical Kinetics & Catalysis (AREA)
- Medicinal Chemistry (AREA)
- Polymers & Plastics (AREA)
- Organic Chemistry (AREA)
- Polyamides (AREA)
- Macromolecular Compounds Obtained By Forming Nitrogen-Containing Linkages In General (AREA)
- Organic Low-Molecular-Weight Compounds And Preparation Thereof (AREA)
Applications Claiming Priority (6)
| Application Number | Priority Date | Filing Date | Title |
|---|---|---|---|
| US687,968 | 1976-05-19 | ||
| US05/687,968 US4098774A (en) | 1976-05-19 | 1976-05-19 | Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone |
| US724,801 | 1976-09-20 | ||
| US05/724,801 US4101447A (en) | 1976-09-20 | 1976-09-20 | Pyrrolidone polymerization catalyst system |
| US77049977A | 1977-02-22 | 1977-02-22 | |
| US770,499 | 1977-02-22 |
Publications (1)
| Publication Number | Publication Date |
|---|---|
| CA1122587A true CA1122587A (en) | 1982-04-27 |
Family
ID=27418498
Family Applications (1)
| Application Number | Title | Priority Date | Filing Date |
|---|---|---|---|
| CA278,637A Expired CA1122587A (en) | 1976-05-19 | 1977-05-17 | Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone |
Country Status (7)
| Country | Link |
|---|---|
| JP (1) | JPS52140598A (enrdf_load_stackoverflow) |
| CA (1) | CA1122587A (enrdf_load_stackoverflow) |
| DE (1) | DE2721910A1 (enrdf_load_stackoverflow) |
| FR (1) | FR2352003A1 (enrdf_load_stackoverflow) |
| GB (1) | GB1545183A (enrdf_load_stackoverflow) |
| IT (1) | IT1082059B (enrdf_load_stackoverflow) |
| MX (1) | MX4700E (enrdf_load_stackoverflow) |
Families Citing this family (2)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| EP0005001B1 (en) * | 1978-04-24 | 1982-06-02 | Arthur Conard Barnes | Polymerisation of 2-pyrrolidone with alkali metal pyrrolidonates and quaternary ammonium salts, and polymerisation products thus obtained |
| WO2019156019A1 (ja) * | 2018-02-06 | 2019-08-15 | 株式会社クレハ | ポリアミドの製造方法 |
Family Cites Families (1)
| Publication number | Priority date | Publication date | Assignee | Title |
|---|---|---|---|---|
| FR2105232A2 (en) * | 1969-03-11 | 1972-04-28 | Alrac Corp | 2-pyrrolidone polymers - capable of forming fibres using carbon dioxide additives as catalysts |
-
1977
- 1977-05-14 DE DE19772721910 patent/DE2721910A1/de not_active Ceased
- 1977-05-17 CA CA278,637A patent/CA1122587A/en not_active Expired
- 1977-05-18 FR FR7715369A patent/FR2352003A1/fr active Granted
- 1977-05-18 IT IT2372277A patent/IT1082059B/it active
- 1977-05-19 GB GB2119677A patent/GB1545183A/en not_active Expired
- 1977-05-19 JP JP5713777A patent/JPS52140598A/ja active Granted
- 1977-05-30 MX MX574677U patent/MX4700E/es unknown
Also Published As
| Publication number | Publication date |
|---|---|
| JPS52140598A (en) | 1977-11-24 |
| IT1082059B (it) | 1985-05-21 |
| FR2352003B1 (enrdf_load_stackoverflow) | 1980-01-18 |
| DE2721910A1 (de) | 1977-12-01 |
| MX4700E (es) | 1982-08-04 |
| GB1545183A (en) | 1979-05-02 |
| JPS5337398B2 (enrdf_load_stackoverflow) | 1978-10-07 |
| FR2352003A1 (fr) | 1977-12-16 |
Similar Documents
| Publication | Publication Date | Title |
|---|---|---|
| US4098774A (en) | Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone | |
| US3721652A (en) | Polymers of 2-pyrrolidone | |
| US3042659A (en) | Activators for the polymerization of 2-pyrrolidone | |
| CA1122587A (en) | Quaternary ammonium catalyst system for the polymerization of 2-pyrrolidone | |
| US3174951A (en) | Polymerization of pyrrolidones and piperidones employing oxides of elements of group vi as chain initiators | |
| US3308099A (en) | Production of polylactams | |
| US3879354A (en) | Polylactam powders by anionic polymerization | |
| US3558568A (en) | Production of lactam-lactone copolymers | |
| CA1255039A (en) | Promotion of epsilon-caprolactam polymerization | |
| US2281576A (en) | Polyamides and process of making same | |
| US4192939A (en) | Phosphonium catalyst system for the polymerization of 2-pyrrolidone | |
| US3888832A (en) | Process for obtaining polyamides | |
| US3682869A (en) | Process for the polymerization of 2-pyrrolidone with carbon dioxide as activator | |
| US3671501A (en) | Lactam polymerization with substituted biuret initiators | |
| US4171425A (en) | Nitrobenzene-accelerated lactam polymerization | |
| US4101447A (en) | Pyrrolidone polymerization catalyst system | |
| US4218558A (en) | Pyrrolidone polymerization catalyst system | |
| US4171426A (en) | Triarylmethylhalide-accelerated lactam polymerization | |
| US4100146A (en) | Phosphonium catalyst system for the polymerization of 2-pyrrolidone | |
| US3909498A (en) | Process for preparing granular powdered polyamide | |
| US4180650A (en) | Nitrothiophene-accelerated lactam polymerization | |
| US3016366A (en) | Polymerization of pyrrolidone and piperidone employing n-substituted secondary amides | |
| US3022274A (en) | Polymerization of pyrrolidone and piperidone employing cyanuric chloride | |
| US3681296A (en) | Polymerization of 2-pyrrolidone using azetidinone co-activators and carbon dioxide as activator | |
| US3898199A (en) | Process for obtaining polyamides from lactams |
Legal Events
| Date | Code | Title | Description |
|---|---|---|---|
| MKEX | Expiry |